New Upstream Release - ruby-rails-assets-jquery-nicescroll
Ready changes
Summary
Merged new upstream version: 3.7.6+dfsg (was: 3.6.6+dfsg).
Resulting package
Built on 2023-01-04T17:00 (took 8m25s)
The resulting binary packages can be installed (if you have the apt repository enabled) by running one of:
apt install -t fresh-releases libjs-jquery-nicescrollapt install -t fresh-releases ruby-rails-assets-jquery-nicescroll
Lintian Result
- libjs-jquery-nicescroll_3.7.6+dfsg-1~jan+nur1_all.deb
- ruby-rails-assets-jquery-nicescroll_3.7.6+dfsg-1~jan+nur1.dsc
- ruby-rails-assets-jquery-nicescroll_3.7.6+dfsg-1~jan+nur1_all.deb
- ruby-rails-assets-jquery-nicescroll_3.7.6+dfsg-1~jan+nur1_amd64.buildinfo
- ruby-rails-assets-jquery-nicescroll_3.7.6+dfsg-1~jan+nur1_amd64.changes
Diff
diff --git a/Rakefile b/Rakefile
index 2995527..c702cfc 100644
--- a/Rakefile
+++ b/Rakefile
@@ -1 +1 @@
-require "bundler/gem_tasks"
+require 'bundler/gem_tasks'
diff --git a/app/assets/images/jquery.nicescroll/dist/zoomico.png b/app/assets/images/jquery.nicescroll/dist/zoomico.png
index 57e32da..667ea33 100644
Binary files a/app/assets/images/jquery.nicescroll/dist/zoomico.png and b/app/assets/images/jquery.nicescroll/dist/zoomico.png differ
diff --git a/app/assets/images/jquery.nicescroll/zoomico.png b/app/assets/images/jquery.nicescroll/zoomico.png
index 57e32da..667ea33 100644
Binary files a/app/assets/images/jquery.nicescroll/zoomico.png and b/app/assets/images/jquery.nicescroll/zoomico.png differ
diff --git a/app/assets/javascripts/jquery.nicescroll.js b/app/assets/javascripts/jquery.nicescroll.js
index 54e6c2f..25cf560 100644
--- a/app/assets/javascripts/jquery.nicescroll.js
+++ b/app/assets/javascripts/jquery.nicescroll.js
@@ -1 +1 @@
-//= require jquery.nicescroll/jquery.nicescroll.js
+//= require jquery.nicescroll/jquery.nicescroll.min.js
diff --git a/app/assets/javascripts/jquery.nicescroll/jquery.nicescroll.iframehelper.js b/app/assets/javascripts/jquery.nicescroll/jquery.nicescroll.iframehelper.js
new file mode 100644
index 0000000..bc2a453
--- /dev/null
+++ b/app/assets/javascripts/jquery.nicescroll/jquery.nicescroll.iframehelper.js
@@ -0,0 +1,105 @@
+/* iframe script helper for jquery.nicescroll
+-- version 0.9.0
+-- copyright 2017-06-18 InuYaksa*2017
+-- licensed under the MIT
+--
+-- https://nicescroll.areaaperta.com/
+-- https://github.com/inuyaksa/jquery.nicescroll
+--
+*/
+
+(function (document,window) {
+
+ var body = document.body;
+ var parent = window.parent;
+
+ if (parent && ("createEvent" in document)) {
+
+ var isoldie = ("documentMode" in document); // 11-
+ var ismsedge = ("msCredentials" in window); // MS Edge 14+
+
+ function onwheel(e) {
+
+ var evt = document.createEvent("MouseEvents");
+ evt.initEvent('wheel', true, true);
+ evt.deltaMode = e.deltaMode;
+ evt.deltaX = e.deltaX;
+ evt.deltaY = e.deltaY;
+ evt.deltaZ = e.deltaZ;
+ evt.wheelDelta = e.wheelDelta;
+ evt.wheelDeltaX = e.wheelDeltaX;
+ evt.wheelDeltaY = e.wheelDeltaY;
+
+ parent.dispatchEvent(evt);
+ }
+
+ body.addEventListener("wheel", onwheel);
+
+ }
+
+ if (window.addEventListener) {
+
+ // https://davidwalsh.name/add-rules-stylesheets
+ var sheet = (function () {
+ var style = document.createElement("style");
+ style.appendChild(document.createTextNode(""));
+ document.head.appendChild(style);
+ return style.sheet;
+ })();
+
+ var tmrscroll = false;
+ var lastiframe = null;
+ var lastiframeviewport = null;
+ var lastscroll = [];
+
+ window.addEventListener("scroll", function (e) {
+ if (lastiframeviewport) {
+ // var df = [ window.scrollX - lastscroll[0], window.scrollY - lastscroll[1] ];
+ window.scrollTo(lastscroll[0], lastscroll[1]);
+ // lastiframeviewport.scrollBy(df[0],df[1]);
+ // console.log(df);
+ }
+ });
+
+ function findNiceParent(t) {
+ do {
+ if ($.data(t, '__nicescroll') !== undefined) return t;
+ t = t.parentNode || false;
+ } while (t);
+ return false;
+ }
+
+ window.addEventListener("load", function () {
+
+ var hasstyle = false;
+
+ $.nicescroll.each(function () {
+ var nice = this;
+ nice.scrollstart(function () {
+ if (!hasstyle) sheet.insertRule("iframe { pointer-events: none !important; }", 0);
+ hasstyle = true;
+ });
+ nice.scrollend(function () {
+ if (hasstyle) sheet.deleteRule(0);
+ hasstyle = false;
+ });
+ });
+
+ $("iframe").each(function () {
+ this.addEventListener("mouseenter", function (e) {
+ lastiframe = e.target;
+ var chk = findNiceParent(lastiframe);
+ lastiframeviewport = chk;
+ //if (chk) lastiframeviewport = $(chk).getNiceScroll();
+ lastscroll = [window.scrollX, window.scrollY];
+ });
+ this.addEventListener("mouseleave", function (e) {
+ lastiframe = lastiframeviewport = null;
+ });
+ });
+
+ });
+
+ }
+
+})(document,window);
\ No newline at end of file
diff --git a/app/assets/javascripts/jquery.nicescroll/jquery.nicescroll.js b/app/assets/javascripts/jquery.nicescroll/jquery.nicescroll.js
index dab30b1..c7205e7 100644
--- a/app/assets/javascripts/jquery.nicescroll/jquery.nicescroll.js
+++ b/app/assets/javascripts/jquery.nicescroll/jquery.nicescroll.js
@@ -1,14 +1,16 @@
/* jquery.nicescroll
--- version 3.6.6
--- copyright 2015-11-17 InuYaksa*2015
+-- version 3.7.6
+-- copyright 2017-07-19 InuYaksa*2017
-- licensed under the MIT
--
--- http://nicescroll.areaaperta.com/
+-- https://nicescroll.areaaperta.com/
-- https://github.com/inuyaksa/jquery.nicescroll
--
*/
-(function(factory) {
+/* jshint expr: true */
+
+(function (factory) {
if (typeof define === 'function' && define.amd) {
// AMD. Register as anonymous module.
define(['jquery'], factory);
@@ -19,51 +21,68 @@
// Browser globals.
factory(jQuery);
}
-}(function(jQuery) {
+}(function (jQuery) {
+
"use strict";
// globals
- var domfocus = false;
- var mousefocus = false;
- var tabindexcounter = 0;
- var ascrailcounter = 2000;
- var globalmaxzindex = 0;
+ var domfocus = false,
+ mousefocus = false,
+ tabindexcounter = 0,
+ ascrailcounter = 2000,
+ globalmaxzindex = 0;
- var $ = jQuery; // sandbox
+ var $ = jQuery, // sandbox
+ _doc = document,
+ _win = window,
+ $window = $(_win);
+
+ var delegatevents = [];
// http://stackoverflow.com/questions/2161159/get-script-path
function getScriptPath() {
- var scripts = document.getElementsByTagName('script');
- var path = scripts.length ? scripts[scripts.length - 1].src.split('?')[0] : '';
+ var scripts = _doc.currentScript || (function () { var s = _doc.getElementsByTagName('script'); return (s.length) ? s[s.length - 1] : false; })();
+ var path = scripts ? scripts.src.split('?')[0] : '';
return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
}
- var vendors = ['webkit','ms','moz','o'];
-
- var setAnimationFrame = window.requestAnimationFrame || false;
- var clearAnimationFrame = window.cancelAnimationFrame || false;
+ // based on code by Paul Irish https://www.paulirish.com/2011/requestanimationframe-for-smart-animating/
+ var setAnimationFrame = _win.requestAnimationFrame || _win.webkitRequestAnimationFrame || _win.mozRequestAnimationFrame || false;
+ var clearAnimationFrame = _win.cancelAnimationFrame || _win.webkitCancelAnimationFrame || _win.mozCancelAnimationFrame || false;
- if (!setAnimationFrame) { // legacy detection
- for (var vx in vendors) {
- var v = vendors[vx];
- if (!setAnimationFrame) setAnimationFrame = window[v + 'RequestAnimationFrame'];
- if (!clearAnimationFrame) clearAnimationFrame = window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame'];
- }
+ if (!setAnimationFrame) {
+ var anilasttime = 0;
+ setAnimationFrame = function (callback, element) {
+ var currTime = new Date().getTime();
+ var timeToCall = Math.max(0, 16 - (currTime - anilasttime));
+ var id = _win.setTimeout(function () { callback(currTime + timeToCall); },
+ timeToCall);
+ anilasttime = currTime + timeToCall;
+ return id;
+ };
+ clearAnimationFrame = function (id) {
+ _win.clearTimeout(id);
+ };
+ } else {
+ if (!_win.cancelAnimationFrame) clearAnimationFrame = function (id) { };
}
- var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
+ var ClsMutationObserver = _win.MutationObserver || _win.WebKitMutationObserver || false;
+
+ var now = Date.now || function () { return new Date().getTime(); };
var _globaloptions = {
zindex: "auto",
cursoropacitymin: 0,
cursoropacitymax: 1,
cursorcolor: "#424242",
- cursorwidth: "5px",
+ cursorwidth: "6px",
cursorborder: "1px solid #fff",
cursorborderradius: "5px",
- scrollspeed: 60,
- mousescrollstep: 8 * 3,
- touchbehavior: false,
+ scrollspeed: 40,
+ mousescrollstep: 9 * 3,
+ touchbehavior: false, // deprecated
+ emulatetouch: false, // replacing touchbehavior
hwacceleration: true,
usetransition: true,
boxzoom: false,
@@ -108,62 +127,65 @@
cursordragontouch: false,
oneaxismousemode: "auto",
scriptpath: getScriptPath(),
- preventmultitouchscrolling: true
+ preventmultitouchscrolling: true,
+ disablemutationobserver: false,
+ enableobserver: true,
+ scrollbarid: false
};
var browserdetected = false;
- var getBrowserDetection = function() {
+ var getBrowserDetection = function () {
if (browserdetected) return browserdetected;
- var _el = document.createElement('DIV'),
- _style = _el.style,
- _agent = navigator.userAgent,
- _platform = navigator.platform,
- d = {};
+ var _el = _doc.createElement('DIV'),
+ _style = _el.style,
+ _agent = navigator.userAgent,
+ _platform = navigator.platform,
+ d = {};
- d.haspointerlock = "pointerLockElement" in document || "webkitPointerLockElement" in document || "mozPointerLockElement" in document;
+ d.haspointerlock = "pointerLockElement" in _doc || "webkitPointerLockElement" in _doc || "mozPointerLockElement" in _doc;
- d.isopera = ("opera" in window); // 12-
+ d.isopera = ("opera" in _win); // 12-
d.isopera12 = (d.isopera && ("getUserMedia" in navigator));
- d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]");
+ d.isoperamini = (Object.prototype.toString.call(_win.operamini) === "[object OperaMini]");
- d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10-
+ d.isie = (("all" in _doc) && ("attachEvent" in _el) && !d.isopera); //IE10-
d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
- d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode == 7));
- d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode == 8);
- d.isie9 = d.isie && ("performance" in window) && (document.documentMode >= 9);
- d.isie10 = d.isie && ("performance" in window) && (document.documentMode == 10);
- d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+
- d.isieedge = (navigator.userAgent.match(/Edge\/12\./));
+ d.isie7 = d.isie && !d.isieold && (!("documentMode" in _doc) || (_doc.documentMode === 7));
+ d.isie8 = d.isie && ("documentMode" in _doc) && (_doc.documentMode === 8);
+ d.isie9 = d.isie && ("performance" in _win) && (_doc.documentMode === 9);
+ d.isie10 = d.isie && ("performance" in _win) && (_doc.documentMode === 10);
+ d.isie11 = ("msRequestFullscreen" in _el) && (_doc.documentMode >= 11); // IE11+
- d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango
- if (d.isie9mobile) d.isie9 = false;
- d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0
+ d.ismsedge = ("msCredentials" in _win); // MS Edge 14+
d.ismozilla = ("MozAppearance" in _style);
- d.iswebkit = ("WebkitAppearance" in _style);
+ d.iswebkit = !d.ismsedge && ("WebkitAppearance" in _style);
- d.ischrome = ("chrome" in window);
- d.ischrome22 = (d.ischrome && d.haspointerlock);
- d.ischrome26 = (d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
+ d.ischrome = d.iswebkit && ("chrome" in _win);
+ d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation
+ d.ischrome22 = (!d.ischrome38) && (d.ischrome && d.haspointerlock);
+ d.ischrome26 = (!d.ischrome38) && (d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
- d.cantouch = ("ontouchstart" in document.documentElement) || ("ontouchstart" in window); // detection for Chrome Touch Emulation
- d.hasmstouch = (window.MSPointerEvent || false); // IE10 pointer events
- d.hasw3ctouch = (window.PointerEvent || false) && ((navigator.MaxTouchPoints > 0)||(navigator.msMaxTouchPoints > 0)); //IE11 pointer events, following W3C Pointer Events spec
+ d.cantouch = ("ontouchstart" in _doc.documentElement) || ("ontouchstart" in _win); // with detection for Chrome Touch Emulation
+ d.hasw3ctouch = (_win.PointerEvent || false) && ((navigator.maxTouchPoints > 0) || (navigator.msMaxTouchPoints > 0)); //IE11 pointer events, following W3C Pointer Events spec
+ d.hasmstouch = (!d.hasw3ctouch) && (_win.MSPointerEvent || false); // IE10 pointer events
d.ismac = /^mac$/i.test(_platform);
- d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(_platform));
- d.isios4 = ((d.isios) && !("seal" in Object));
- d.isios7 = ((d.isios)&&("webkitHidden" in document)); //iOS 7+
+ d.isios = d.cantouch && /iphone|ipad|ipod/i.test(_platform);
+ d.isios4 = d.isios && !("seal" in Object);
+ d.isios7 = d.isios && ("webkitHidden" in _doc); //iOS 7+
+ d.isios8 = d.isios && ("hidden" in _doc); //iOS 8+
+ d.isios10 = d.isios && _win.Proxy; //iOS 10+
d.isandroid = (/android/i.test(_agent));
d.haseventlistener = ("addEventListener" in _el);
-
+
d.trstyle = false;
d.hastransform = false;
d.hastranslate3d = false;
@@ -171,49 +193,56 @@
d.hastransition = false;
d.transitionend = false;
- var a;
- var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];
- for (a = 0; a < check.length; a++) {
- if (typeof _style[check[a]] != "undefined") {
- d.trstyle = check[a];
- break;
+ d.trstyle = "transform";
+ d.hastransform = ("transform" in _style) || (function () {
+ var check = ['msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];
+ for (var a = 0, c = check.length; a < c; a++) {
+ if (_style[check[a]] !== undefined) {
+ d.trstyle = check[a];
+ break;
+ }
}
- }
- d.hastransform = (!!d.trstyle);
+ d.hastransform = (!!d.trstyle);
+ })();
+
if (d.hastransform) {
_style[d.trstyle] = "translate3d(1px,2px,3px)";
d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
}
- d.transitionstyle = false;
+ d.transitionstyle = "transition";
d.prefixstyle = '';
- d.transitionend = false;
- check = ['transition', 'webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
- var prefix = ['', '-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
- var evs = ['transitionend', 'webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
- for (a = 0; a < check.length; a++) {
- if (check[a] in _style) {
- d.transitionstyle = check[a];
- d.prefixstyle = prefix[a];
- d.transitionend = evs[a];
- break;
+ d.transitionend = "transitionend";
+
+ d.hastransition = ("transition" in _style) || (function () {
+
+ d.transitionend = false;
+ var check = ['webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
+ var prefix = ['-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
+ var evs = ['webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
+ for (var a = 0, c = check.length; a < c; a++) {
+ if (check[a] in _style) {
+ d.transitionstyle = check[a];
+ d.prefixstyle = prefix[a];
+ d.transitionend = evs[a];
+ break;
+ }
}
- }
- if (d.ischrome26) { // always use prefix
- d.prefixstyle = prefix[1];
- }
+ if (d.ischrome26) d.prefixstyle = prefix[1]; // always use prefix
- d.hastransition = (d.transitionstyle);
+ d.hastransition = (d.transitionstyle);
+
+ })();
function detectCursorGrab() {
- var lst = ['-webkit-grab', '-moz-grab', 'grab'];
- if ((d.ischrome && !d.ischrome22) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
- for (var a = 0; a < lst.length; a++) {
+ var lst = ['grab', '-webkit-grab', '-moz-grab'];
+ if ((d.ischrome && !d.ischrome38) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
+ for (var a = 0, l = lst.length; a < l; a++) {
var p = lst[a];
_style.cursor = p;
if (_style.cursor == p) return p;
}
- return 'url(//mail.google.com/mail/images/2/openhand.cur),n-resize'; // thank you google for custom cursor!
+ return 'url(https://cdnjs.cloudflare.com/ajax/libs/slider-pro/1.3.0/css/images/openhand.cur),n-resize'; // thanks to https://cdnjs.com/ for the openhand cursor!
}
d.cursorgrabvalue = detectCursorGrab();
@@ -228,38 +257,42 @@
return d;
};
- var NiceScrollClass = function(myopt, me) {
+ var NiceScrollClass = function (myopt, me) {
var self = this;
- this.version = '3.6.6';
+ this.version = '3.7.6';
this.name = 'nicescroll';
this.me = me;
- this.opt = {
- doc: $("body"),
+ var $body = $("body");
+
+ var opt = this.opt = {
+ doc: $body,
win: false
};
- $.extend(this.opt, _globaloptions); // clone opts
+ $.extend(opt, _globaloptions); // clone opts
// Options for internal use
- this.opt.snapbackspeed = 80;
+ opt.snapbackspeed = 80;
if (myopt || false) {
- for (var a in self.opt) {
- if (typeof myopt[a] != "undefined") self.opt[a] = myopt[a];
+ for (var a in opt) {
+ if (myopt[a] !== undefined) opt[a] = myopt[a];
}
}
- this.doc = self.opt.doc;
+ if (opt.disablemutationobserver) ClsMutationObserver = false;
+
+ this.doc = opt.doc;
this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : '';
- this.ispage = /^BODY|HTML/.test((self.opt.win) ? self.opt.win[0].nodeName : this.doc[0].nodeName);
- this.haswrapper = (self.opt.win !== false);
- this.win = self.opt.win || (this.ispage ? $(window) : this.doc);
- this.docscroll = (this.ispage && !this.haswrapper) ? $(window) : this.win;
- this.body = $("body");
+ this.ispage = /^BODY|HTML/.test((opt.win) ? opt.win[0].nodeName : this.doc[0].nodeName);
+ this.haswrapper = (opt.win !== false);
+ this.win = opt.win || (this.ispage ? $window : this.doc);
+ this.docscroll = (this.ispage && !this.haswrapper) ? $window : this.win;
+ this.body = $body;
this.viewport = false;
this.isfixed = false;
@@ -271,7 +304,7 @@
this.forcescreen = false; //force to use screen position on events
- this.canshowonmouseevent = (self.opt.autohidemode != "scroll");
+ this.canshowonmouseevent = (opt.autohidemode != "scroll");
// Events jump table
this.onmousedown = false;
@@ -305,20 +338,40 @@
this.cursorheight = 20;
this.scrollvaluemax = 0;
- this.isrtlmode = (this.opt.rtlmode == "auto") ? ((this.win[0] == window ? this.body : this.win).css("direction") == "rtl") : (this.opt.rtlmode === true);
+ // http://dev.w3.org/csswg/css-writing-modes-3/#logical-to-physical
+ // http://dev.w3.org/csswg/css-writing-modes-3/#svg-writing-mode
+ if (opt.rtlmode == "auto") {
+ var target = this.win[0] == _win ? this.body : this.win;
+ var writingMode = target.css("writing-mode") || target.css("-webkit-writing-mode") || target.css("-ms-writing-mode") || target.css("-moz-writing-mode");
+
+ if (writingMode == "horizontal-tb" || writingMode == "lr-tb" || writingMode === "") {
+ this.isrtlmode = (target.css("direction") == "rtl");
+ this.isvertical = false;
+ } else {
+ this.isrtlmode = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl" || writingMode == "rl-tb");
+ this.isvertical = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl");
+ }
+ } else {
+ this.isrtlmode = (opt.rtlmode === true);
+ this.isvertical = false;
+ }
// this.checkrtlmode = false;
-
+
this.scrollrunning = false;
this.scrollmom = false;
- this.observer = false; // observer div changes
+ this.observer = false; // observer div changes
this.observerremover = false; // observer on parent for remove detection
- this.observerbody = false; // observer on body for position change
+ this.observerbody = false; // observer on body for position change
- do {
- this.id = "ascrail" + (ascrailcounter++);
- } while (document.getElementById(this.id));
+ if (opt.scrollbarid !== false) {
+ this.id = opt.scrollbarid;
+ } else {
+ do {
+ this.id = "ascrail" + (ascrailcounter++);
+ } while (_doc.getElementById(this.id));
+ }
this.rail = false;
this.cursor = false;
@@ -331,7 +384,7 @@
this.hasfocus = false;
this.hasmousefocus = false;
- this.visibility = true;
+ //this.visibility = true;
this.railslocked = false; // locked by resize
this.locked = false; // prevent lost of locked status sets by user
this.hidden = false; // rails always hidden
@@ -339,8 +392,8 @@
this.wheelprevented = false; //prevent mousewheel event
- this.overflowx = self.opt.overflowx;
- this.overflowy = self.opt.overflowy;
+ this.overflowx = opt.overflowx;
+ this.overflowy = opt.overflowy;
this.nativescrollingarea = false;
this.checkarea = 0;
@@ -359,88 +412,84 @@
var cap = $.extend({}, this.detected);
- this.canhwscroll = (cap.hastransform && self.opt.hwacceleration);
+ this.canhwscroll = (cap.hastransform && opt.hwacceleration);
this.ishwscroll = (this.canhwscroll && self.haswrapper);
- this.hasreversehr = (this.isrtlmode&&!cap.iswebkit); //RTL mode with reverse horizontal axis
-
+ if (!this.isrtlmode) {
+ this.hasreversehr = false;
+ } else if (this.isvertical) { // RTL mode with reverse horizontal axis
+ this.hasreversehr = !(cap.iswebkit || cap.isie || cap.isie11);
+ } else {
+ this.hasreversehr = !(cap.iswebkit || (cap.isie && !cap.isie10 && !cap.isie11));
+ }
+
this.istouchcapable = false; // desktop devices with touch screen support
//## Check WebKit-based desktop with touch support
//## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
- if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) {
+
+ if (!cap.cantouch && (cap.hasw3ctouch || cap.hasmstouch)) { // desktop device with multiple input
+ this.istouchcapable = true;
+ } else if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) {
this.istouchcapable = true;
- cap.cantouch = false; // parse normal desktop events
}
//## disable MouseLock API on user request
- if (!self.opt.enablemouselockapi) {
+ if (!opt.enablemouselockapi) {
cap.hasmousecapture = false;
cap.haspointerlock = false;
}
-/* deprecated
- this.delayed = function(name, fn, tm, lazy) {
- };
-*/
-
- this.debounced = function(name, fn, tm) {
- var dd = self.delaylist[name];
- self.delaylist[name] = fn;
+ this.debounced = function (name, fn, tm) {
+ if (!self) return;
+ var dd = self.delaylist[name] || false;
if (!dd) {
- self.debouncedelayed = setTimeout(function() {
- if (!self) return;
- var fn = self.delaylist[name];
- self.delaylist[name] = false;
- fn.call(self);
- }, tm);
+ self.delaylist[name] = {
+ h: setAnimationFrame(function () {
+ self.delaylist[name].fn.call(self);
+ self.delaylist[name] = false;
+ }, tm)
+ };
+ fn.call(self);
}
+ self.delaylist[name].fn = fn;
};
- var _onsync = false;
-
- this.synched = function(name, fn) {
- function requestSync() {
- if (_onsync) return;
- setAnimationFrame(function() {
- _onsync = false;
- for (var nn in self.synclist) {
- var fn = self.synclist[nn];
- if (fn) fn.call(self);
- self.synclist[nn] = false;
- }
+ this.synched = function (name, fn) {
+ if (self.synclist[name]) self.synclist[name] = fn;
+ else {
+ self.synclist[name] = fn;
+ setAnimationFrame(function () {
+ if (!self) return;
+ self.synclist[name] && self.synclist[name].call(self);
+ self.synclist[name] = null;
});
- _onsync = true;
}
-
- self.synclist[name] = fn;
- requestSync();
- return name;
};
- this.unsynched = function(name) {
+ this.unsynched = function (name) {
if (self.synclist[name]) self.synclist[name] = false;
};
- this.css = function(el, pars) { // save & set
+ this.css = function (el, pars) { // save & set
for (var n in pars) {
self.saved.css.push([el, n, el.css(n)]);
el.css(n, pars[n]);
}
};
- this.scrollTop = function(val) {
- return (typeof val == "undefined") ? self.getScrollTop() : self.setScrollTop(val);
+ this.scrollTop = function (val) {
+ return (val === undefined) ? self.getScrollTop() : self.setScrollTop(val);
};
- this.scrollLeft = function(val) {
- return (typeof val == "undefined") ? self.getScrollLeft() : self.setScrollLeft(val);
+ this.scrollLeft = function (val) {
+ return (val === undefined) ? self.getScrollLeft() : self.setScrollLeft(val);
};
// derived by by Dan Pupius www.pupius.net
- var BezierClass = function(st, ed, spd, p1, p2, p3, p4) {
-
+ var BezierClass = function (st, ed, spd, p1, p2, p3, p4) {
+
this.st = st;
this.ed = ed;
this.spd = spd;
@@ -450,30 +499,32 @@
this.p3 = p3 || 0;
this.p4 = p4 || 1;
- this.ts = (new Date()).getTime();
- this.df = this.ed - this.st;
+ this.ts = now();
+ this.df = ed - st;
};
BezierClass.prototype = {
- B2: function(t) {
- return 3 * t * t * (1 - t);
+ B2: function (t) {
+ return 3 * (1 - t) * (1 - t) * t;
+ },
+ B3: function (t) {
+ return 3 * (1 - t) * t * t;
},
- B3: function(t) {
- return 3 * t * (1 - t) * (1 - t);
+ B4: function (t) {
+ return t * t * t;
},
- B4: function(t) {
- return (1 - t) * (1 - t) * (1 - t);
+ getPos: function () {
+ return (now() - this.ts) / this.spd;
},
- getNow: function() {
- var nw = (new Date()).getTime();
- var pc = 1 - ((nw - this.ts) / this.spd);
+ getNow: function () {
+ var pc = (now() - this.ts) / this.spd;
var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
- return (pc < 0) ? this.ed : this.st + Math.round(this.df * bz);
+ return (pc >= 1) ? this.ed : this.st + (this.df * bz) | 0;
},
- update: function(ed, spd) {
+ update: function (ed, spd) {
this.st = this.getNow();
this.ed = ed;
this.spd = spd;
- this.ts = (new Date()).getTime();
+ this.ts = now();
this.df = this.ed - this.st;
return this;
}
@@ -488,8 +539,8 @@
return false;
}
- if (this.ishwscroll) {
- // hw accelerated scroll
+ if (this.ishwscroll) { // hw accelerated scroll
+
this.doc.translate = {
x: 0,
y: 0,
@@ -500,7 +551,7 @@
//this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/
- this.getScrollTop = function(last) {
+ this.getScrollTop = function (last) {
if (!last) {
var mtx = getMatrixValues();
if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
@@ -509,7 +560,7 @@
return self.doc.translate.y;
};
- this.getScrollLeft = function(last) {
+ this.getScrollLeft = function (last) {
if (!last) {
var mtx = getMatrixValues();
if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
@@ -518,68 +569,85 @@
return self.doc.translate.x;
};
- this.notifyScrollEvent = function(el) {
- var e = document.createEvent("UIEvents");
- e.initUIEvent("scroll", false, true, window, 1);
+ this.notifyScrollEvent = function (el) {
+ var e = _doc.createEvent("UIEvents");
+ e.initUIEvent("scroll", false, false, _win, 1);
e.niceevent = true;
el.dispatchEvent(e);
};
var cxscrollleft = (this.isrtlmode) ? 1 : -1;
- if (cap.hastranslate3d && self.opt.enabletranslate3d) {
- this.setScrollTop = function(val, silent) {
+ if (cap.hastranslate3d && opt.enabletranslate3d) {
+ this.setScrollTop = function (val, silent) {
self.doc.translate.y = val;
self.doc.translate.ty = (val * -1) + "px";
- self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
+ self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0)");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
- this.setScrollLeft = function(val, silent) {
+ this.setScrollLeft = function (val, silent) {
self.doc.translate.x = val;
self.doc.translate.tx = (val * cxscrollleft) + "px";
- self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
+ self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0)");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
} else {
- this.setScrollTop = function(val, silent) {
+ this.setScrollTop = function (val, silent) {
self.doc.translate.y = val;
self.doc.translate.ty = (val * -1) + "px";
self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
- this.setScrollLeft = function(val, silent) {
+ this.setScrollLeft = function (val, silent) {
self.doc.translate.x = val;
self.doc.translate.tx = (val * cxscrollleft) + "px";
self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
}
- } else {
- // native scroll
- this.getScrollTop = function() {
+ } else { // native scroll
+
+ this.getScrollTop = function () {
return self.docscroll.scrollTop();
};
- this.setScrollTop = function(val) {
- return setTimeout(function() {self.docscroll.scrollTop(val)}, 1);
+ this.setScrollTop = function (val) {
+ self.docscroll.scrollTop(val);
};
- this.getScrollLeft = function() {
- if (self.detected.ismozilla && self.isrtlmode)
- return Math.abs(self.docscroll.scrollLeft());
- return self.docscroll.scrollLeft();
+
+ this.getScrollLeft = function () {
+ var val;
+ if (!self.hasreversehr) {
+ val = self.docscroll.scrollLeft();
+ } else if (self.detected.ismozilla) {
+ val = self.page.maxw - Math.abs(self.docscroll.scrollLeft());
+ } else {
+ val = self.page.maxw - self.docscroll.scrollLeft();
+ }
+ return val;
};
- this.setScrollLeft = function(val) {
- return setTimeout(function() {self.docscroll.scrollLeft((self.detected.ismozilla && self.isrtlmode) ? -val : val)}, 1);
+ this.setScrollLeft = function (val) {
+ return setTimeout(function () {
+ if (!self) return;
+ if (self.hasreversehr) {
+ if (self.detected.ismozilla) {
+ val = -(self.page.maxw - val);
+ } else {
+ val = self.page.maxw - val;
+ }
+ }
+ return self.docscroll.scrollLeft(val);
+ }, 1);
};
}
- this.getTarget = function(e) {
+ this.getTarget = function (e) {
if (!e) return false;
if (e.target) return e.target;
if (e.srcElement) return e.srcElement;
return false;
};
- this.hasParent = function(e, id) {
+ this.hasParent = function (e, id) {
if (!e) return false;
var el = e.target || e.srcElement || e || false;
while (el && el.id != id) {
@@ -594,7 +662,7 @@
while (dom.length > 0) {
if (dom[0].nodeType == 9) return false;
var zi = dom.css('zIndex');
- if (!isNaN(zi) && zi != 0) return parseInt(zi);
+ if (!isNaN(zi) && zi !== 0) return parseInt(zi);
dom = dom.parent();
}
return false;
@@ -619,56 +687,58 @@
return px;
}
- this.getDocumentScrollOffset = function() {
- return {top:window.pageYOffset||document.documentElement.scrollTop,
- left:window.pageXOffset||document.documentElement.scrollLeft};
- }
-
- this.getOffset = function() {
+ this.getDocumentScrollOffset = function () {
+ return {
+ top: _win.pageYOffset || _doc.documentElement.scrollTop,
+ left: _win.pageXOffset || _doc.documentElement.scrollLeft
+ };
+ };
+
+ this.getOffset = function () {
if (self.isfixed) {
var ofs = self.win.offset(); // fix Chrome auto issue (when right/bottom props only)
var scrl = self.getDocumentScrollOffset();
- ofs.top-=scrl.top;
- ofs.left-=scrl.left;
- return ofs;
+ ofs.top -= scrl.top;
+ ofs.left -= scrl.left;
+ return ofs;
}
var ww = self.win.offset();
- if (!self.viewport) return ww;
+ if (!self.viewport) return ww;
var vp = self.viewport.offset();
return {
- top: ww.top - vp.top,// + self.viewport.scrollTop(),
- left: ww.left - vp.left // + self.viewport.scrollLeft()
+ top: ww.top - vp.top,
+ left: ww.left - vp.left
};
};
- this.updateScrollBar = function(len) {
+ this.updateScrollBar = function (len) {
+ var pos, off;
if (self.ishwscroll) {
- self.rail.css({ //**
- height: self.win.innerHeight() - (self.opt.railpadding.top + self.opt.railpadding.bottom)
+ self.rail.css({
+ height: self.win.innerHeight() - (opt.railpadding.top + opt.railpadding.bottom)
});
- if (self.railh) self.railh.css({ //**
- width: self.win.innerWidth() - (self.opt.railpadding.left + self.opt.railpadding.right)
+ if (self.railh) self.railh.css({
+ width: self.win.innerWidth() - (opt.railpadding.left + opt.railpadding.right)
});
-
} else {
var wpos = self.getOffset();
- var pos = {
+ pos = {
top: wpos.top,
- left: wpos.left - (self.opt.railpadding.left + self.opt.railpadding.right)
+ left: wpos.left - (opt.railpadding.left + opt.railpadding.right)
};
pos.top += getWidthToPixel(self.win, 'border-top-width', true);
pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width');
- var off = self.opt.railoffset;
+ off = opt.railoffset;
if (off) {
if (off.top) pos.top += off.top;
if (off.left) pos.left += off.left;
}
-
+
if (!self.railslocked) self.rail.css({
top: pos.top,
left: pos.left,
- height: ((len) ? len.h : self.win.innerHeight()) - (self.opt.railpadding.top + self.opt.railpadding.bottom)
+ height: ((len) ? len.h : self.win.innerHeight()) - (opt.railpadding.top + opt.railpadding.bottom)
});
if (self.zoom) {
@@ -679,183 +749,183 @@
}
if (self.railh && !self.railslocked) {
- var pos = {
+ pos = {
top: wpos.top,
left: wpos.left
};
- var off = self.opt.railhoffset;
- if (!!off) {
- if (!!off.top) pos.top += off.top;
- if (!!off.left) pos.left += off.left;
+ off = opt.railhoffset;
+ if (off) {
+ if (off.top) pos.top += off.top;
+ if (off.left) pos.left += off.left;
}
var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true);
var x = pos.left + getWidthToPixel(self.win, 'border-left-width');
self.railh.css({
- top: y - (self.opt.railpadding.top + self.opt.railpadding.bottom),
+ top: y - (opt.railpadding.top + opt.railpadding.bottom),
left: x,
width: self.railh.width
});
}
-
}
};
- this.doRailClick = function(e, dbl, hr) {
+ this.doRailClick = function (e, dbl, hr) {
var fn, pg, cur, pos;
if (self.railslocked) return;
+
self.cancelEvent(e);
+ if (!("pageY" in e)) {
+ e.pageX = e.clientX + _doc.documentElement.scrollLeft;
+ e.pageY = e.clientY + _doc.documentElement.scrollTop;
+ }
+
if (dbl) {
fn = (hr) ? self.doScrollLeft : self.doScrollTop;
cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y);
- fn(cur);
+ self.unsynched("relativexy");
+ fn(cur|0);
} else {
fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
cur = (hr) ? self.scroll.x : self.scroll.y;
pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
pg = (hr) ? self.view.w : self.view.h;
- fn((cur >= pos) ? pg: -pg);// (cur >= pos) ? fn(pg): fn(-pg);
+ fn((cur >= pos) ? pg : -pg);
}
};
- self.hasanimationframe = (setAnimationFrame);
- self.hascancelanimationframe = (clearAnimationFrame);
+ self.newscrolly = self.newscrollx = 0;
- if (!self.hasanimationframe) {
- setAnimationFrame = function(fn) {
- return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16);
- }; // 1000/60)};
- clearAnimationFrame = clearInterval;
- } else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
- self.cancelAnimationFrame = true;
- };
+ self.hasanimationframe = ("requestAnimationFrame" in _win);
+ self.hascancelanimationframe = ("cancelAnimationFrame" in _win);
- this.init = function() {
+ self.hasborderbox = false;
+
+ this.init = function () {
self.saved.css = [];
- if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
+ if (cap.isandroid && !("hidden" in _doc)) return true; // Android 3- SORRY, DO NOT WORK!
- if (cap.hasmstouch) self.css((self.ispage) ? $("html") : self.win, {
- '-ms-touch-action': 'none'
- });
+ opt.emulatetouch = opt.emulatetouch || opt.touchbehavior; // mantain compatibility with "touchbehavior"
+
+ self.hasborderbox = _win.getComputedStyle && (_win.getComputedStyle(_doc.body)['box-sizing'] === "border-box");
+
+ var _scrollyhidden = { 'overflow-y': 'hidden' };
+ if (cap.isie11 || cap.isie10) _scrollyhidden['-ms-overflow-style'] = 'none'; // IE 10 & 11 is always a world apart!
+
+ if (self.ishwscroll) {
+ this.doc.css(cap.transitionstyle, cap.prefixstyle + 'transform 0ms ease-out');
+ if (cap.transitionend) self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
+ }
self.zindex = "auto";
- if (!self.ispage && self.opt.zindex == "auto") {
+ if (!self.ispage && opt.zindex == "auto") {
self.zindex = getZIndex() || "auto";
} else {
- self.zindex = self.opt.zindex;
+ self.zindex = opt.zindex;
}
- if (!self.ispage && self.zindex != "auto") {
- if (self.zindex > globalmaxzindex) globalmaxzindex = self.zindex;
+ if (!self.ispage && self.zindex != "auto" && self.zindex > globalmaxzindex) {
+ globalmaxzindex = self.zindex;
}
- if (self.isie && self.zindex == 0 && self.opt.zindex == "auto") { // fix IE auto == 0
+ if (self.isie && self.zindex === 0 && opt.zindex == "auto") { // fix IE auto == 0
self.zindex = "auto";
}
- if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {
+ if (!self.ispage || !cap.isieold) {
var cont = self.docscroll;
if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc;
- if (!cap.isie9mobile) self.css(cont, {
- 'overflow-y': 'hidden'
- });
+ self.css(cont, _scrollyhidden);
- if (self.ispage && cap.isie7) {
- if (self.doc[0].nodeName == 'BODY') self.css($("html"), {
- 'overflow-y': 'hidden'
- }); //IE7 double scrollbar issue
- else if (self.doc[0].nodeName == 'HTML') self.css($("body"), {
- 'overflow-y': 'hidden'
- }); //IE7 double scrollbar issue
+ if (self.ispage && (cap.isie11 || cap.isie)) { // IE 7-11
+ self.css($("html"), _scrollyhidden);
}
- if (cap.isios && !self.ispage && !self.haswrapper) self.css($("body"), {
+ if (cap.isios && !self.ispage && !self.haswrapper) self.css($body, {
"-webkit-overflow-scrolling": "touch"
}); //force hw acceleration
- var cursor = $(document.createElement('div'));
+ var cursor = $(_doc.createElement('div'));
cursor.css({
position: "relative",
top: 0,
"float": "right",
- width: self.opt.cursorwidth,
- height: "0px",
- 'background-color': self.opt.cursorcolor,
- border: self.opt.cursorborder,
+ width: opt.cursorwidth,
+ height: 0,
+ 'background-color': opt.cursorcolor,
+ border: opt.cursorborder,
'background-clip': 'padding-box',
- '-webkit-border-radius': self.opt.cursorborderradius,
- '-moz-border-radius': self.opt.cursorborderradius,
- 'border-radius': self.opt.cursorborderradius
+ '-webkit-border-radius': opt.cursorborderradius,
+ '-moz-border-radius': opt.cursorborderradius,
+ 'border-radius': opt.cursorborderradius
});
- cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());
-
cursor.addClass('nicescroll-cursors');
-
+
self.cursor = cursor;
- var rail = $(document.createElement('div'));
+ var rail = $(_doc.createElement('div'));
rail.attr('id', self.id);
rail.addClass('nicescroll-rails nicescroll-rails-vr');
- var v, a, kp = ["left","right","top","bottom"]; //**
+ var v, a, kp = ["left", "right", "top", "bottom"]; //**
for (var n in kp) {
a = kp[n];
- v = self.opt.railpadding[a];
- (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0;
+ v = opt.railpadding[a] || 0;
+ v && rail.css("padding-" + a, v + "px");
}
rail.append(cursor);
- rail.width = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth());
+ rail.width = Math.max(parseFloat(opt.cursorwidth), cursor.outerWidth());
rail.css({
width: rail.width + "px",
- 'zIndex': self.zindex,
- "background": self.opt.background,
+ zIndex: self.zindex,
+ background: opt.background,
cursor: "default"
});
rail.visibility = true;
rail.scrollable = true;
- rail.align = (self.opt.railalign == "left") ? 0 : 1;
+ rail.align = (opt.railalign == "left") ? 0 : 1;
self.rail = rail;
self.rail.drag = false;
var zoom = false;
- if (self.opt.boxzoom && !self.ispage && !cap.isieold) {
- zoom = document.createElement('div');
+ if (opt.boxzoom && !self.ispage && !cap.isieold) {
+ zoom = _doc.createElement('div');
self.bind(zoom, "click", self.doZoom);
- self.bind(zoom, "mouseenter", function() {
- self.zoom.css('opacity', self.opt.cursoropacitymax);
+ self.bind(zoom, "mouseenter", function () {
+ self.zoom.css('opacity', opt.cursoropacitymax);
});
- self.bind(zoom, "mouseleave", function() {
- self.zoom.css('opacity', self.opt.cursoropacitymin);
+ self.bind(zoom, "mouseleave", function () {
+ self.zoom.css('opacity', opt.cursoropacitymin);
});
self.zoom = $(zoom);
self.zoom.css({
- "cursor": "pointer",
- 'z-index': self.zindex,
- 'backgroundImage': 'url(' + self.opt.scriptpath + 'zoomico.png)',
- 'height': 18,
- 'width': 18,
- 'backgroundPosition': '0px 0px'
+ cursor: "pointer",
+ zIndex: self.zindex,
+ backgroundImage: 'url(' + opt.scriptpath + 'zoomico.png)',
+ height: 18,
+ width: 18,
+ backgroundPosition: '0 0'
});
- if (self.opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
- if (cap.cantouch && self.opt.gesturezoom) {
- self.ongesturezoom = function(e) {
+ if (opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
+ if (cap.cantouch && opt.gesturezoom) {
+ self.ongesturezoom = function (e) {
if (e.scale > 1.5) self.doZoomIn(e);
if (e.scale < 0.8) self.doZoomOut(e);
return self.cancelEvent(e);
@@ -869,42 +939,40 @@
self.railh = false;
var railh;
- if (self.opt.horizrailenabled) {
+ if (opt.horizrailenabled) {
self.css(cont, {
- 'overflow-x': 'hidden'
+ overflowX: 'hidden'
});
- var cursor = $(document.createElement('div'));
+ cursor = $(_doc.createElement('div'));
cursor.css({
position: "absolute",
top: 0,
- height: self.opt.cursorwidth,
- width: "0px",
- 'background-color': self.opt.cursorcolor,
- border: self.opt.cursorborder,
- 'background-clip': 'padding-box',
- '-webkit-border-radius': self.opt.cursorborderradius,
- '-moz-border-radius': self.opt.cursorborderradius,
- 'border-radius': self.opt.cursorborderradius
+ height: opt.cursorwidth,
+ width: 0,
+ backgroundColor: opt.cursorcolor,
+ border: opt.cursorborder,
+ backgroundClip: 'padding-box',
+ '-webkit-border-radius': opt.cursorborderradius,
+ '-moz-border-radius': opt.cursorborderradius,
+ 'border-radius': opt.cursorborderradius
});
- if (cap.isieold) cursor.css({'overflow':'hidden'}); //IE6 horiz scrollbar issue
-
- cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());
-
+ if (cap.isieold) cursor.css('overflow', 'hidden'); //IE6 horiz scrollbar issue
+
cursor.addClass('nicescroll-cursors');
-
+
self.cursorh = cursor;
- railh = $(document.createElement('div'));
+ railh = $(_doc.createElement('div'));
railh.attr('id', self.id + '-hr');
railh.addClass('nicescroll-rails nicescroll-rails-hr');
- railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight());
+ railh.height = Math.max(parseFloat(opt.cursorwidth), cursor.outerHeight());
railh.css({
height: railh.height + "px",
'zIndex': self.zindex,
- "background": self.opt.background
+ "background": opt.background
});
railh.append(cursor);
@@ -912,7 +980,7 @@
railh.visibility = true;
railh.scrollable = true;
- railh.align = (self.opt.railvalign == "top") ? 0 : 1;
+ railh.align = (opt.railvalign == "top") ? 0 : 1;
self.railh = railh;
@@ -920,38 +988,31 @@
}
- //
-
if (self.ispage) {
+
rail.css({
position: "fixed",
- top: "0px",
+ top: 0,
height: "100%"
});
- (rail.align) ? rail.css({
- right: "0px"
- }): rail.css({
- left: "0px"
- });
+
+ rail.css((rail.align) ? { right: 0 } : { left: 0 });
+
self.body.append(rail);
if (self.railh) {
railh.css({
position: "fixed",
- left: "0px",
+ left: 0,
width: "100%"
});
- (railh.align) ? railh.css({
- bottom: "0px"
- }): railh.css({
- top: "0px"
- });
+
+ railh.css((railh.align) ? { bottom: 0 } : { top: 0 });
+
self.body.append(railh);
}
} else {
if (self.ishwscroll) {
- if (self.win.css('position') == 'static') self.css(self.win, {
- 'position': 'relative'
- });
+ if (self.win.css('position') == 'static') self.css(self.win, { 'position': 'relative' });
var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
$(bd).scrollTop(0).scrollLeft(0); // fix rail position if content already scrolled
if (self.zoom) {
@@ -967,11 +1028,7 @@
position: "absolute",
top: 0
});
- (rail.align) ? rail.css({
- right: 0
- }): rail.css({
- left: 0
- });
+ rail.css((rail.align) ? { right: 0 } : { left: 0 });
bd.append(rail);
if (railh) {
railh.css({
@@ -979,11 +1036,7 @@
left: 0,
bottom: 0
});
- (railh.align) ? railh.css({
- bottom: 0
- }): railh.css({
- top: 0
- });
+ railh.css((railh.align) ? { bottom: 0 } : { top: 0 });
bd.append(railh);
}
} else {
@@ -993,7 +1046,7 @@
if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
if (self.viewport) {
self.body = self.viewport;
- if ((/fixed|absolute/.test(self.viewport.css("position"))) == false) self.css(self.viewport, {
+ if (!(/fixed|absolute/.test(self.viewport.css("position")))) self.css(self.viewport, {
"position": "relative"
});
}
@@ -1020,766 +1073,785 @@
'-webkit-touch-callout': 'none'
}); // prevent grey layer on click
- if (cap.isie && self.opt.disableoutline) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
- if (cap.iswebkit && self.opt.disableoutline) self.win.css({"outline": "none"}); // Webkit outline
- //if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"}); // Opera 12- to test [TODO]
+ if (opt.disableoutline) {
+ if (cap.isie) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
+ if (cap.iswebkit) self.win.css('outline', 'none'); // Webkit outline
+ }
}
- if (self.opt.autohidemode === false) {
+ if (opt.autohidemode === false) {
self.autohidedom = false;
self.rail.css({
- opacity: self.opt.cursoropacitymax
+ opacity: opt.cursoropacitymax
});
if (self.railh) self.railh.css({
- opacity: self.opt.cursoropacitymax
+ opacity: opt.cursoropacitymax
});
- } else if ((self.opt.autohidemode === true) || (self.opt.autohidemode === "leave")) {
+ } else if ((opt.autohidemode === true) || (opt.autohidemode === "leave")) {
self.autohidedom = $().add(self.rail);
if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor);
if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh);
- } else if (self.opt.autohidemode == "scroll") {
+ } else if (opt.autohidemode == "scroll") {
self.autohidedom = $().add(self.rail);
if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
- } else if (self.opt.autohidemode == "cursor") {
+ } else if (opt.autohidemode == "cursor") {
self.autohidedom = $().add(self.cursor);
if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh);
- } else if (self.opt.autohidemode == "hidden") {
+ } else if (opt.autohidemode == "hidden") {
self.autohidedom = false;
self.hide();
self.railslocked = false;
}
- if (cap.isie9mobile) {
+ if (cap.cantouch || self.istouchcapable || opt.emulatetouch || cap.hasmstouch) {
self.scrollmom = new ScrollMomentumClass2D(self);
- self.onmangotouch = function() {
- var py = self.getScrollTop();
- var px = self.getScrollLeft();
+ var delayedclick = null;
- if ((py == self.scrollmom.lastscrolly) && (px == self.scrollmom.lastscrollx)) return true;
+ self.ontouchstart = function (e) {
- var dfy = py - self.mangotouch.sy;
- var dfx = px - self.mangotouch.sx;
- var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2)));
- if (df == 0) return;
+ if (self.locked) return false;
- var dry = (dfy < 0) ? -1 : 1;
- var drx = (dfx < 0) ? -1 : 1;
+ //if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
+ if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return false; // need test on surface!!
- var tm = +new Date();
- if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);
+ self.hasmoving = false;
- if (((tm - self.mangotouch.tm) > 80) || (self.mangotouch.dry != dry) || (self.mangotouch.drx != drx)) {
+ if (self.scrollmom.timer) {
+ self.triggerScrollEnd();
self.scrollmom.stop();
- self.scrollmom.reset(px, py);
- self.mangotouch.sy = py;
- self.mangotouch.ly = py;
- self.mangotouch.sx = px;
- self.mangotouch.lx = px;
- self.mangotouch.dry = dry;
- self.mangotouch.drx = drx;
- self.mangotouch.tm = tm;
- } else {
+ }
- self.scrollmom.stop();
- self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy);
- self.mangotouch.tm = tm;
-
- var ds = Math.max(Math.abs(self.mangotouch.ly - py), Math.abs(self.mangotouch.lx - px));
- self.mangotouch.ly = py;
- self.mangotouch.lx = px;
-
- if (ds > 2) {
- self.mangotouch.lazy = setTimeout(function() {
- self.mangotouch.lazy = false;
- self.mangotouch.dry = 0;
- self.mangotouch.drx = 0;
- self.mangotouch.tm = 0;
- self.scrollmom.doMomentum(30);
- }, 100);
+ if (!self.railslocked) {
+ var tg = self.getTarget(e);
+
+ if (tg) {
+ var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
+ if (skp) return self.stopPropagation(e);
}
- }
- };
- var top = self.getScrollTop();
- var lef = self.getScrollLeft();
- self.mangotouch = {
- sy: top,
- ly: top,
- dry: 0,
- sx: lef,
- lx: lef,
- drx: 0,
- lazy: false,
- tm: 0
- };
+ var ismouse = (e.type === "mousedown");
- self.bind(self.docscroll, "scroll", self.onmangotouch);
+ if (!("clientX" in e) && ("changedTouches" in e)) {
+ e.clientX = e.changedTouches[0].clientX;
+ e.clientY = e.changedTouches[0].clientY;
+ }
- } else {
+ if (self.forcescreen) {
+ var le = e;
+ e = {
+ "original": (e.original) ? e.original : e
+ };
+ e.clientX = le.screenX;
+ e.clientY = le.screenY;
+ }
- if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) {
+ self.rail.drag = {
+ x: e.clientX,
+ y: e.clientY,
+ sx: self.scroll.x,
+ sy: self.scroll.y,
+ st: self.getScrollTop(),
+ sl: self.getScrollLeft(),
+ pt: 2,
+ dl: false,
+ tg: tg
+ };
- self.scrollmom = new ScrollMomentumClass2D(self);
+ if (self.ispage || !opt.directionlockdeadzone) {
- self.ontouchstart = function(e) {
- if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
-
- self.hasmoving = false;
+ self.rail.drag.dl = "f";
- if (!self.railslocked) {
-
- var tg;
- if (cap.hasmstouch) {
- tg = (e.target) ? e.target : false;
- while (tg) {
- var nc = $(tg).getNiceScroll();
- if ((nc.length > 0) && (nc[0].me == self.me)) break;
- if (nc.length > 0) return false;
- if ((tg.nodeName == 'DIV') && (tg.id == self.id)) break;
- tg = (tg.parentNode) ? tg.parentNode : false;
- }
- }
+ } else {
+
+ var view = {
+ w: $window.width(),
+ h: $window.height()
+ };
- self.cancelScroll();
+ var page = self.getContentSize();
- tg = self.getTarget(e);
+ var maxh = page.h - view.h;
+ var maxw = page.w - view.w;
- if (tg) {
- var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
- if (skp) return self.stopPropagation(e);
- }
+ if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
+ else if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
+ else self.rail.drag.ck = false;
+
+ }
+
+ if (opt.emulatetouch && self.isiframe && cap.isie) {
+ var wp = self.win.position();
+ self.rail.drag.x += wp.left;
+ self.rail.drag.y += wp.top;
+ }
- if (!("clientX" in e) && ("changedTouches" in e)) {
- e.clientX = e.changedTouches[0].clientX;
- e.clientY = e.changedTouches[0].clientY;
+ self.hasmoving = false;
+ self.lastmouseup = false;
+ self.scrollmom.reset(e.clientX, e.clientY);
+
+ if (tg&&ismouse) {
+
+ var ip = /INPUT|SELECT|BUTTON|TEXTAREA/i.test(tg.nodeName);
+ if (!ip) {
+ if (cap.hasmousecapture) tg.setCapture();
+ if (opt.emulatetouch) {
+ if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
+ tg._onclick = tg.onclick;
+ tg.onclick = function (e) {
+ if (self.hasmoving) return false;
+ tg._onclick.call(this, e);
+ };
+ }
+ return self.cancelEvent(e);
+ }
+ return self.stopPropagation(e);
}
- if (self.forcescreen) {
- var le = e;
- e = {
- "original": (e.original) ? e.original : e
+ if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
+ self.preventclick = {
+ "tg": tg,
+ "click": false
};
- e.clientX = le.screenX;
- e.clientY = le.screenY;
}
- self.rail.drag = {
- x: e.clientX,
- y: e.clientY,
- sx: self.scroll.x,
- sy: self.scroll.y,
- st: self.getScrollTop(),
- sl: self.getScrollLeft(),
- pt: 2,
- dl: false
- };
+ }
+ }
- if (self.ispage || !self.opt.directionlockdeadzone) {
- self.rail.drag.dl = "f";
- } else {
+ };
- var view = {
- w: $(window).width(),
- h: $(window).height()
- };
+ self.ontouchend = function (e) {
- var page = {
- w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
- h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
- };
+ if (!self.rail.drag) return true;
- var maxh = Math.max(0, page.h - view.h);
- var maxw = Math.max(0, page.w - view.w);
+ if (self.rail.drag.pt == 2) {
+ //if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
+ if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return false;
- if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
- else if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
- else self.rail.drag.ck = false;
- if (!self.rail.drag.ck) self.rail.drag.dl = "f";
- }
+ self.rail.drag = false;
- if (self.opt.touchbehavior && self.isiframe && cap.isie) {
- var wp = self.win.position();
- self.rail.drag.x += wp.left;
- self.rail.drag.y += wp.top;
- }
+ var ismouse = (e.type === "mouseup");
- self.hasmoving = false;
- self.lastmouseup = false;
- self.scrollmom.reset(e.clientX, e.clientY);
-
- if (!cap.cantouch && !this.istouchcapable && !e.pointerType) {
-
- var ip = (tg) ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false;
- if (!ip) {
- if (!self.ispage && cap.hasmousecapture) tg.setCapture();
- if (self.opt.touchbehavior) {
- if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
- tg._onclick = tg.onclick;
- tg.onclick = function(e) {
- if (self.hasmoving) return false;
- tg._onclick.call(this, e);
- };
- }
- return self.cancelEvent(e);
- }
- return self.stopPropagation(e);
- }
+ if (self.hasmoving) {
+ self.scrollmom.doMomentum();
+ self.lastmouseup = true;
+ self.hideCursor();
+ if (cap.hasmousecapture) _doc.releaseCapture();
+ if (ismouse) return self.cancelEvent(e);
+ }
- if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
- pc = {
- "tg": tg,
- "click": false
- };
- self.preventclick = pc;
- }
+ }
+ else if (self.rail.drag.pt == 1) {
+ return self.onmouseup(e);
+ }
- }
- }
+ };
- };
+ var moveneedoffset = (opt.emulatetouch && self.isiframe && !cap.hasmousecapture);
- self.ontouchend = function(e) {
- if (!self.rail.drag) return true;
- if (self.rail.drag.pt == 2) {
- if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
- self.scrollmom.doMomentum();
- self.rail.drag = false;
- if (self.hasmoving) {
- self.lastmouseup = true;
- self.hideCursor();
- if (cap.hasmousecapture) document.releaseCapture();
- if (!cap.cantouch) return self.cancelEvent(e);
- }
- }
- else if (self.rail.drag.pt == 1) {
- return self.onmouseup(e);
- }
+ var locktollerance = opt.directionlockdeadzone * 0.3 | 0;
- };
+ self.ontouchmove = function (e, byiframe) {
- var moveneedoffset = (self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture);
+ if (!self.rail.drag) return true;
- self.ontouchmove = function(e, byiframe) {
+ if (e.targetTouches && opt.preventmultitouchscrolling) {
+ if (e.targetTouches.length > 1) return true; // multitouch
+ }
- if (!self.rail.drag) return false;
-
- if (e.targetTouches && self.opt.preventmultitouchscrolling) {
- if (e.targetTouches.length > 1) return false; // multitouch
- }
-
- if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
-
- if (self.rail.drag.pt == 2) {
- if (cap.cantouch && (cap.isios) && (typeof e.original == "undefined")) return true; // prevent ios "ghost" events by clickable elements
+ //if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
+ if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return true;
- self.hasmoving = true;
+ if (self.rail.drag.pt == 2) {
- if (self.preventclick && !self.preventclick.click) {
- self.preventclick.click = self.preventclick.tg.onclick || false;
- self.preventclick.tg.onclick = self.onpreventclick;
- }
+ if (("changedTouches" in e)) {
+ e.clientX = e.changedTouches[0].clientX;
+ e.clientY = e.changedTouches[0].clientY;
+ }
- var ev = $.extend({
- "original": e
- }, e);
- e = ev;
+ var ofy, ofx;
+ ofx = ofy = 0;
- if (("changedTouches" in e)) {
- e.clientX = e.changedTouches[0].clientX;
- e.clientY = e.changedTouches[0].clientY;
- }
+ if (moveneedoffset && !byiframe) {
+ var wp = self.win.position();
+ ofx = -wp.left;
+ ofy = -wp.top;
+ }
- if (self.forcescreen) {
- var le = e;
- e = {
- "original": (e.original) ? e.original : e
- };
- e.clientX = le.screenX;
- e.clientY = le.screenY;
- }
+ var fy = e.clientY + ofy;
+ var my = (fy - self.rail.drag.y);
+ var fx = e.clientX + ofx;
+ var mx = (fx - self.rail.drag.x);
- var ofy,ofx;
- ofx = ofy = 0;
+ var ny = self.rail.drag.st - my;
- if (moveneedoffset && !byiframe) {
- var wp = self.win.position();
- ofx = -wp.left;
- ofy = -wp.top;
+ if (self.ishwscroll && opt.bouncescroll) {
+ if (ny < 0) {
+ ny = Math.round(ny / 2);
+ } else if (ny > self.page.maxh) {
+ ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
+ }
+ } else {
+ if (ny < 0) {
+ ny = 0;
+ fy = 0;
}
+ else if (ny > self.page.maxh) {
+ ny = self.page.maxh;
+ fy = 0;
+ }
+ if (fy === 0 && !self.hasmoving) {
+ if (!self.ispage) self.rail.drag = false;
+ return true;
+ }
+ }
- var fy = e.clientY + ofy;
- var my = (fy - self.rail.drag.y);
- var fx = e.clientX + ofx;
- var mx = (fx - self.rail.drag.x);
+ var nx = self.getScrollLeft();
- var ny = self.rail.drag.st - my;
+ if (self.railh && self.railh.scrollable) {
+ nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;
- if (self.ishwscroll && self.opt.bouncescroll) {
- if (ny < 0) {
- ny = Math.round(ny / 2);
- // fy = 0;
- } else if (ny > self.page.maxh) {
- ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
- // fy = 0;
+ if (self.ishwscroll && opt.bouncescroll) {
+ if (nx < 0) {
+ nx = Math.round(nx / 2);
+ } else if (nx > self.page.maxw) {
+ nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
}
} else {
- if (ny < 0) {
- ny = 0;
- fy = 0;
+ if (nx < 0) {
+ nx = 0;
+ fx = 0;
}
- if (ny > self.page.maxh) {
- ny = self.page.maxh;
- fy = 0;
+ if (nx > self.page.maxw) {
+ nx = self.page.maxw;
+ fx = 0;
}
}
- var nx;
- if (self.railh && self.railh.scrollable) {
- nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;
-
- if (self.ishwscroll && self.opt.bouncescroll) {
- if (nx < 0) {
- nx = Math.round(nx / 2);
- // fx = 0;
- } else if (nx > self.page.maxw) {
- nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
- // fx = 0;
- }
- } else {
- if (nx < 0) {
- nx = 0;
- fx = 0;
- }
- if (nx > self.page.maxw) {
- nx = self.page.maxw;
- fx = 0;
- }
+ }
+
+
+ if (!self.hasmoving) {
+
+ if (self.rail.drag.y === e.clientY && self.rail.drag.x === e.clientX) return self.cancelEvent(e); // prevent first useless move event
+
+ var ay = Math.abs(my);
+ var ax = Math.abs(mx);
+ var dz = opt.directionlockdeadzone;
+
+ if (!self.rail.drag.ck) {
+ if (ay > dz && ax > dz) self.rail.drag.dl = "f";
+ else if (ay > dz) self.rail.drag.dl = (ax > locktollerance) ? "f" : "v";
+ else if (ax > dz) self.rail.drag.dl = (ay > locktollerance) ? "f" : "h";
+ }
+ else if (self.rail.drag.ck == "v") {
+ if (ax > dz && ay <= locktollerance) {
+ self.rail.drag = false;
}
+ else if (ay > dz) self.rail.drag.dl = "v";
}
+ else if (self.rail.drag.ck == "h") {
- var grabbed = false;
- if (self.rail.drag.dl) {
- grabbed = true;
- if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
- else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
- } else {
- var ay = Math.abs(my);
- var ax = Math.abs(mx);
- var dz = self.opt.directionlockdeadzone;
- if (self.rail.drag.ck == "v") {
- if (ay > dz && (ax <= (ay * 0.3))) {
- self.rail.drag = false;
- return true;
- } else if (ax > dz) {
- self.rail.drag.dl = "f";
- $("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked)
- }
- } else if (self.rail.drag.ck == "h") {
- if (ax > dz && (ay <= (ax * 0.3))) {
- self.rail.drag = false;
- return true;
- } else if (ay > dz) {
- self.rail.drag.dl = "f";
- $("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked)
- }
+ if (ay > dz && ax <= locktollerance) {
+ self.rail.drag = false;
}
+ else if (ax > dz) self.rail.drag.dl = "h";
+
}
- self.synched("touchmove", function() {
- if (self.rail.drag && (self.rail.drag.pt == 2)) {
- if (self.prepareTransition) self.prepareTransition(0);
- if (self.rail.scrollable) self.setScrollTop(ny);
- self.scrollmom.update(fx, fy);
- if (self.railh && self.railh.scrollable) {
- self.setScrollLeft(nx);
- self.showCursor(ny, nx);
- } else {
- self.showCursor(ny);
- }
- if (cap.isie10) document.selection.clear();
- }
- });
+ if (!self.rail.drag.dl) return self.cancelEvent(e);
- if (cap.ischrome && self.istouchcapable) grabbed = false; //chrome touch emulation doesn't like!
- if (grabbed) return self.cancelEvent(e);
+ self.triggerScrollStart(e.clientX, e.clientY, 0, 0, 0);
+ self.hasmoving = true;
}
- else if (self.rail.drag.pt == 1) { // drag on cursor
- return self.onmousemove(e);
+
+ if (self.preventclick && !self.preventclick.click) {
+ self.preventclick.click = self.preventclick.tg.onclick || false;
+ self.preventclick.tg.onclick = self.onpreventclick;
}
- };
+ if (self.rail.drag.dl) {
+ if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
+ else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
+ }
- }
+ self.synched("touchmove", function () {
+ if (self.rail.drag && (self.rail.drag.pt == 2)) {
+ if (self.prepareTransition) self.resetTransition();
+ if (self.rail.scrollable) self.setScrollTop(ny);
+ self.scrollmom.update(fx, fy);
+ if (self.railh && self.railh.scrollable) {
+ self.setScrollLeft(nx);
+ self.showCursor(ny, nx);
+ } else {
+ self.showCursor(ny);
+ }
+ if (cap.isie10) _doc.selection.clear();
+ }
+ });
+
+ return self.cancelEvent(e);
- self.onmousedown = function(e, hronly) {
- if (self.rail.drag && self.rail.drag.pt != 1) return;
- if (self.railslocked) return self.cancelEvent(e);
+ }
+ else if (self.rail.drag.pt == 1) { // drag on cursor
+ return self.onmousemove(e);
+ }
+
+ };
+
+ self.ontouchstartCursor = function (e, hronly) {
+ if (self.rail.drag && self.rail.drag.pt != 3) return;
+ if (self.locked) return self.cancelEvent(e);
self.cancelScroll();
self.rail.drag = {
- x: e.clientX,
- y: e.clientY,
+ x: e.touches[0].clientX,
+ y: e.touches[0].clientY,
sx: self.scroll.x,
sy: self.scroll.y,
- pt: 1,
+ pt: 3,
hr: (!!hronly)
};
var tg = self.getTarget(e);
if (!self.ispage && cap.hasmousecapture) tg.setCapture();
if (self.isiframe && !cap.hasmousecapture) {
self.saved.csspointerevents = self.doc.css("pointer-events");
- self.css(self.doc, {
- "pointer-events": "none"
- });
+ self.css(self.doc, { "pointer-events": "none" });
}
- self.hasmoving = false;
return self.cancelEvent(e);
};
- self.onmouseup = function(e) {
+ self.ontouchendCursor = function (e) {
if (self.rail.drag) {
- if (self.rail.drag.pt != 1) return true;
- if (cap.hasmousecapture) document.releaseCapture();
- if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
+ if (cap.hasmousecapture) _doc.releaseCapture();
+ if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
+ if (self.rail.drag.pt != 3) return;
self.rail.drag = false;
- //if (!self.rail.active) self.hideCursor();
- if (self.hasmoving) self.triggerScrollEnd(); // TODO - check &&!self.scrollrunning
return self.cancelEvent(e);
}
};
- self.onmousemove = function(e) {
+ self.ontouchmoveCursor = function (e) {
if (self.rail.drag) {
- if (self.rail.drag.pt != 1) return;
-
- if (cap.ischrome && e.which == 0) return self.onmouseup(e);
+ if (self.rail.drag.pt != 3) return;
self.cursorfreezed = true;
- self.hasmoving = true;
if (self.rail.drag.hr) {
- self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
+ self.scroll.x = self.rail.drag.sx + (e.touches[0].clientX - self.rail.drag.x);
if (self.scroll.x < 0) self.scroll.x = 0;
var mw = self.scrollvaluemaxw;
if (self.scroll.x > mw) self.scroll.x = mw;
} else {
- self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
+ self.scroll.y = self.rail.drag.sy + (e.touches[0].clientY - self.rail.drag.y);
if (self.scroll.y < 0) self.scroll.y = 0;
var my = self.scrollvaluemax;
if (self.scroll.y > my) self.scroll.y = my;
}
- self.synched('mousemove', function() {
- if (self.rail.drag && (self.rail.drag.pt == 1)) {
+ self.synched('touchmove', function () {
+ if (self.rail.drag && (self.rail.drag.pt == 3)) {
self.showCursor();
- if (self.rail.drag.hr) {
- if (self.hasreversehr) {
- self.doScrollLeft(self.scrollvaluemaxw-Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
- } else {
- self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
- }
- }
- else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
+ if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), opt.cursordragspeed);
+ else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), opt.cursordragspeed);
}
});
return self.cancelEvent(e);
}
- else {
- self.checkarea = 0;
- }
+
};
- if (cap.cantouch || self.opt.touchbehavior) {
+ }
- self.onpreventclick = function(e) {
- if (self.preventclick) {
- self.preventclick.tg.onclick = self.preventclick.click;
- self.preventclick = false;
- return self.cancelEvent(e);
- }
- }
+ self.onmousedown = function (e, hronly) {
+ if (self.rail.drag && self.rail.drag.pt != 1) return;
+ if (self.railslocked) return self.cancelEvent(e);
+ self.cancelScroll();
+ self.rail.drag = {
+ x: e.clientX,
+ y: e.clientY,
+ sx: self.scroll.x,
+ sy: self.scroll.y,
+ pt: 1,
+ hr: hronly || false
+ };
+ var tg = self.getTarget(e);
- self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging
+ if (cap.hasmousecapture) tg.setCapture();
+ if (self.isiframe && !cap.hasmousecapture) {
+ self.saved.csspointerevents = self.doc.css("pointer-events");
+ self.css(self.doc, {
+ "pointer-events": "none"
+ });
+ }
+ self.hasmoving = false;
+ return self.cancelEvent(e);
+ };
- self.onclick = (cap.isios) ? false : function(e) {
- if (self.lastmouseup) {
- self.lastmouseup = false;
- return self.cancelEvent(e);
- } else {
- return true;
- }
- };
+ self.onmouseup = function (e) {
+ if (self.rail.drag) {
+ if (self.rail.drag.pt != 1) return true;
- if (self.opt.grabcursorenabled && cap.cursorgrabvalue) {
- self.css((self.ispage) ? self.doc : self.win, {
- 'cursor': cap.cursorgrabvalue
- });
- self.css(self.rail, {
- 'cursor': cap.cursorgrabvalue
- });
- }
+ if (cap.hasmousecapture) _doc.releaseCapture();
+ if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
+ self.rail.drag = false;
+ self.cursorfreezed = false;
+ if (self.hasmoving) self.triggerScrollEnd();
+ return self.cancelEvent(e);
+ }
+ };
- } else {
+ self.onmousemove = function (e) {
+ if (self.rail.drag) {
+ if (self.rail.drag.pt !== 1) return;
- var checkSelectionScroll = function(e) {
- if (!self.selectiondrag) return;
+ if (cap.ischrome && e.which === 0) return self.onmouseup(e);
- if (e) {
- var ww = self.win.outerHeight();
- var df = (e.pageY - self.selectiondrag.top);
- if (df > 0 && df < ww) df = 0;
- if (df >= ww) df -= ww;
- self.selectiondrag.df = df;
- }
- if (self.selectiondrag.df == 0) return;
+ self.cursorfreezed = true;
- var rt = -Math.floor(self.selectiondrag.df / 6) * 2;
- self.doScrollBy(rt);
+ if (!self.hasmoving) self.triggerScrollStart(e.clientX, e.clientY, 0, 0, 0);
- self.debounced("doselectionscroll", function() {
- checkSelectionScroll()
- }, 50);
- };
+ self.hasmoving = true;
- if ("getSelection" in document) { // A grade - Major browsers
- self.hasTextSelected = function() {
- return (document.getSelection().rangeCount > 0);
- };
- } else if ("selection" in document) { //IE9-
- self.hasTextSelected = function() {
- return (document.selection.type != "None");
- };
+ if (self.rail.drag.hr) {
+ self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
+ if (self.scroll.x < 0) self.scroll.x = 0;
+ var mw = self.scrollvaluemaxw;
+ if (self.scroll.x > mw) self.scroll.x = mw;
} else {
- self.hasTextSelected = function() { // no support
- return false;
- };
+ self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
+ if (self.scroll.y < 0) self.scroll.y = 0;
+ var my = self.scrollvaluemax;
+ if (self.scroll.y > my) self.scroll.y = my;
}
- self.onselectionstart = function(e) {
-/* More testing - severe chrome issues
- if (!self.haswrapper&&(e.which&&e.which==2)) { // fool browser to manage middle button scrolling
- self.win.css({'overflow':'auto'});
- setTimeout(function(){
- self.win.css({'overflow':''});
- },10);
- return true;
- }
-*/
- if (self.ispage) return;
- self.selectiondrag = self.win.offset();
- };
-
- self.onselectionend = function(e) {
- self.selectiondrag = false;
- };
- self.onselectiondrag = function(e) {
- if (!self.selectiondrag) return;
- if (self.hasTextSelected()) self.debounced("selectionscroll", function() {
- checkSelectionScroll(e)
- }, 250);
- };
+ self.synched('mousemove', function () {
+ if (self.cursorfreezed) {
+ self.showCursor();
- }
+ if (self.rail.drag.hr) {
+ self.scrollLeft(Math.round(self.scroll.x * self.scrollratio.x));
+ } else {
+ self.scrollTop(Math.round(self.scroll.y * self.scrollratio.y));
+ }
- if (cap.hasw3ctouch) { //IE11+
- self.css(self.rail, {
- 'touch-action': 'none'
+ }
});
- self.css(self.cursor, {
- 'touch-action': 'none'
+
+ return self.cancelEvent(e);
+ }
+ else {
+ self.checkarea = 0;
+ }
+ };
+
+ if (cap.cantouch || opt.emulatetouch) {
+
+ self.onpreventclick = function (e) {
+ if (self.preventclick) {
+ self.preventclick.tg.onclick = self.preventclick.click;
+ self.preventclick = false;
+ return self.cancelEvent(e);
+ }
+ };
+
+ self.onclick = (cap.isios) ? false : function (e) { // it needs to check IE11 ???
+ if (self.lastmouseup) {
+ self.lastmouseup = false;
+ return self.cancelEvent(e);
+ } else {
+ return true;
+ }
+ };
+
+ if (opt.grabcursorenabled && cap.cursorgrabvalue) {
+ self.css((self.ispage) ? self.doc : self.win, {
+ 'cursor': cap.cursorgrabvalue
});
- self.bind(self.win, "pointerdown", self.ontouchstart);
- self.bind(document, "pointerup", self.ontouchend);
- self.bind(document, "pointermove", self.ontouchmove);
- } else if (cap.hasmstouch) { //IE10
self.css(self.rail, {
- '-ms-touch-action': 'none'
- });
- self.css(self.cursor, {
- '-ms-touch-action': 'none'
- });
- self.bind(self.win, "MSPointerDown", self.ontouchstart);
- self.bind(document, "MSPointerUp", self.ontouchend);
- self.bind(document, "MSPointerMove", self.ontouchmove);
- self.bind(self.cursor, "MSGestureHold", function(e) {
- e.preventDefault()
- });
- self.bind(self.cursor, "contextmenu", function(e) {
- e.preventDefault()
+ 'cursor': cap.cursorgrabvalue
});
- } else if (this.istouchcapable) { //desktop with screen touch enabled
- self.bind(self.win, "touchstart", self.ontouchstart);
- self.bind(document, "touchend", self.ontouchend);
- self.bind(document, "touchcancel", self.ontouchend);
- self.bind(document, "touchmove", self.ontouchmove);
}
-
- if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.touchbehavior)) {
+ } else {
- self.rail.css({
- "cursor": "default"
- });
- self.railh && self.railh.css({
- "cursor": "default"
- });
+ var checkSelectionScroll = function (e) {
+ if (!self.selectiondrag) return;
- self.jqbind(self.rail, "mouseenter", function() {
- if (!self.ispage && !self.win.is(":visible")) return false;
- if (self.canshowonmouseevent) self.showCursor();
- self.rail.active = true;
- });
- self.jqbind(self.rail, "mouseleave", function() {
- self.rail.active = false;
- if (!self.rail.drag) self.hideCursor();
- });
-
- if (self.opt.sensitiverail) {
- self.bind(self.rail, "click", function(e) {
- self.doRailClick(e, false, false)
- });
- self.bind(self.rail, "dblclick", function(e) {
- self.doRailClick(e, true, false)
- });
- self.bind(self.cursor, "click", function(e) {
- self.cancelEvent(e)
- });
- self.bind(self.cursor, "dblclick", function(e) {
- self.cancelEvent(e)
- });
+ if (e) {
+ var ww = self.win.outerHeight();
+ var df = (e.pageY - self.selectiondrag.top);
+ if (df > 0 && df < ww) df = 0;
+ if (df >= ww) df -= ww;
+ self.selectiondrag.df = df;
}
+ if (self.selectiondrag.df === 0) return;
- if (self.railh) {
- self.jqbind(self.railh, "mouseenter", function() {
- if (!self.ispage && !self.win.is(":visible")) return false;
- if (self.canshowonmouseevent) self.showCursor();
- self.rail.active = true;
- });
- self.jqbind(self.railh, "mouseleave", function() {
- self.rail.active = false;
- if (!self.rail.drag) self.hideCursor();
- });
+ var rt = -(self.selectiondrag.df*2/6)|0;
+ self.doScrollBy(rt);
- if (self.opt.sensitiverail) {
- self.bind(self.railh, "click", function(e) {
- self.doRailClick(e, false, true)
- });
- self.bind(self.railh, "dblclick", function(e) {
- self.doRailClick(e, true, true)
- });
- self.bind(self.cursorh, "click", function(e) {
- self.cancelEvent(e)
- });
- self.bind(self.cursorh, "dblclick", function(e) {
- self.cancelEvent(e)
- });
- }
-
- }
+ self.debounced("doselectionscroll", function () {
+ checkSelectionScroll();
+ }, 50);
+ };
+ if ("getSelection" in _doc) { // A grade - Major browsers
+ self.hasTextSelected = function () {
+ return (_doc.getSelection().rangeCount > 0);
+ };
+ } else if ("selection" in _doc) { //IE9-
+ self.hasTextSelected = function () {
+ return (_doc.selection.type != "None");
+ };
+ } else {
+ self.hasTextSelected = function () { // no support
+ return false;
+ };
}
- if (!cap.cantouch && !self.opt.touchbehavior) {
+ self.onselectionstart = function (e) {
+ // More testing - severe chrome issues
+ /*
+ if (!self.haswrapper&&(e.which&&e.which==2)) { // fool browser to manage middle button scrolling
+ self.win.css({'overflow':'auto'});
+ setTimeout(function(){
+ self.win.css({'overflow':'hidden'});
+ },10);
+ return true;
+ }
+ */
+ if (self.ispage) return;
+ self.selectiondrag = self.win.offset();
+ };
- self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
- self.bind(document, "mousemove", self.onmousemove);
- if (self.onclick) self.bind(document, "click", self.onclick);
+ self.onselectionend = function (e) {
+ self.selectiondrag = false;
+ };
+ self.onselectiondrag = function (e) {
+ if (!self.selectiondrag) return;
+ if (self.hasTextSelected()) self.debounced("selectionscroll", function () {
+ checkSelectionScroll(e);
+ }, 250);
+ };
+ }
- self.bind(self.cursor, "mousedown", self.onmousedown);
- self.bind(self.cursor, "mouseup", self.onmouseup);
+ if (cap.hasw3ctouch) { //IE11+
+ self.css((self.ispage) ? $("html") : self.win, { 'touch-action': 'none' });
+ self.css(self.rail, {
+ 'touch-action': 'none'
+ });
+ self.css(self.cursor, {
+ 'touch-action': 'none'
+ });
+ self.bind(self.win, "pointerdown", self.ontouchstart);
+ self.bind(_doc, "pointerup", self.ontouchend);
+ self.delegate(_doc, "pointermove", self.ontouchmove);
+ } else if (cap.hasmstouch) { //IE10
+ self.css((self.ispage) ? $("html") : self.win, { '-ms-touch-action': 'none' });
+ self.css(self.rail, {
+ '-ms-touch-action': 'none'
+ });
+ self.css(self.cursor, {
+ '-ms-touch-action': 'none'
+ });
+ self.bind(self.win, "MSPointerDown", self.ontouchstart);
+ self.bind(_doc, "MSPointerUp", self.ontouchend);
+ self.delegate(_doc, "MSPointerMove", self.ontouchmove);
+ self.bind(self.cursor, "MSGestureHold", function (e) {
+ e.preventDefault();
+ });
+ self.bind(self.cursor, "contextmenu", function (e) {
+ e.preventDefault();
+ });
+ } else if (cap.cantouch) { // smartphones/touch devices
+ self.bind(self.win, "touchstart", self.ontouchstart, false, true);
+ self.bind(_doc, "touchend", self.ontouchend, false, true);
+ self.bind(_doc, "touchcancel", self.ontouchend, false, true);
+ self.delegate(_doc, "touchmove", self.ontouchmove, false, true);
+ }
- if (self.railh) {
- self.bind(self.cursorh, "mousedown", function(e) {
- self.onmousedown(e, true)
- });
- self.bind(self.cursorh, "mouseup", self.onmouseup);
- }
-
- if (!self.ispage && self.opt.enablescrollonselection) {
- self.bind(self.win[0], "mousedown", self.onselectionstart);
- self.bind(document, "mouseup", self.onselectionend);
- self.bind(self.cursor, "mouseup", self.onselectionend);
- if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
- self.bind(document, "mousemove", self.onselectiondrag);
- }
+ if (opt.emulatetouch) {
+ self.bind(self.win, "mousedown", self.ontouchstart, false, true);
+ self.bind(_doc, "mouseup", self.ontouchend, false, true);
+ self.bind(_doc, "mousemove", self.ontouchmove, false, true);
+ }
- if (self.zoom) {
- self.jqbind(self.zoom, "mouseenter", function() {
- if (self.canshowonmouseevent) self.showCursor();
- self.rail.active = true;
- });
- self.jqbind(self.zoom, "mouseleave", function() {
- self.rail.active = false;
- if (!self.rail.drag) self.hideCursor();
- });
- }
+ if (opt.cursordragontouch || (!cap.cantouch && !opt.emulatetouch)) {
- } else {
+ self.rail.css({
+ cursor: "default"
+ });
+ self.railh && self.railh.css({
+ cursor: "default"
+ });
- self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
- self.bind(document, "mousemove", self.ontouchmove);
- if (self.onclick) self.bind(document, "click", self.onclick);
+ self.jqbind(self.rail, "mouseenter", function () {
+ if (!self.ispage && !self.win.is(":visible")) return false;
+ if (self.canshowonmouseevent) self.showCursor();
+ self.rail.active = true;
+ });
+ self.jqbind(self.rail, "mouseleave", function () {
+ self.rail.active = false;
+ if (!self.rail.drag) self.hideCursor();
+ });
- if (self.opt.cursordragontouch) {
- self.bind(self.cursor, "mousedown", self.onmousedown);
- self.bind(self.cursor, "mouseup", self.onmouseup);
- //self.bind(self.cursor, "mousemove", self.onmousemove);
- self.cursorh && self.bind(self.cursorh, "mousedown", function(e) {
- self.onmousedown(e, true)
+ if (opt.sensitiverail) {
+ self.bind(self.rail, "click", function (e) {
+ self.doRailClick(e, false, false);
+ });
+ self.bind(self.rail, "dblclick", function (e) {
+ self.doRailClick(e, true, false);
+ });
+ self.bind(self.cursor, "click", function (e) {
+ self.cancelEvent(e);
+ });
+ self.bind(self.cursor, "dblclick", function (e) {
+ self.cancelEvent(e);
+ });
+ }
+
+ if (self.railh) {
+ self.jqbind(self.railh, "mouseenter", function () {
+ if (!self.ispage && !self.win.is(":visible")) return false;
+ if (self.canshowonmouseevent) self.showCursor();
+ self.rail.active = true;
+ });
+ self.jqbind(self.railh, "mouseleave", function () {
+ self.rail.active = false;
+ if (!self.rail.drag) self.hideCursor();
+ });
+
+ if (opt.sensitiverail) {
+ self.bind(self.railh, "click", function (e) {
+ self.doRailClick(e, false, true);
+ });
+ self.bind(self.railh, "dblclick", function (e) {
+ self.doRailClick(e, true, true);
+ });
+ self.bind(self.cursorh, "click", function (e) {
+ self.cancelEvent(e);
+ });
+ self.bind(self.cursorh, "dblclick", function (e) {
+ self.cancelEvent(e);
});
- //self.cursorh && self.bind(self.cursorh, "mousemove", self.onmousemove);
- self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup);
}
}
- if (self.opt.enablemousewheel) {
- if (!self.isiframe) self.bind((cap.isie && self.ispage) ? document : self.win /*self.docscroll*/ , "mousewheel", self.onmousewheel);
- self.bind(self.rail, "mousewheel", self.onmousewheel);
- if (self.railh) self.bind(self.railh, "mousewheel", self.onmousewheelhr);
- }
+ }
- if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
- if (!self.win.attr("tabindex")) self.win.attr({
- "tabindex": tabindexcounter++
- });
+ if (opt.cursordragontouch && (this.istouchcapable || cap.cantouch)) {
+ self.bind(self.cursor, "touchstart", self.ontouchstartCursor);
+ self.bind(self.cursor, "touchmove", self.ontouchmoveCursor);
+ self.bind(self.cursor, "touchend", self.ontouchendCursor);
+ self.cursorh && self.bind(self.cursorh, "touchstart", function (e) {
+ self.ontouchstartCursor(e, true);
+ });
+ self.cursorh && self.bind(self.cursorh, "touchmove", self.ontouchmoveCursor);
+ self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor);
+ }
- self.jqbind(self.win, "focus", function(e) {
- domfocus = (self.getTarget(e)).id || true;
- self.hasfocus = true;
- if (self.canshowonmouseevent) self.noticeCursor();
- });
- self.jqbind(self.win, "blur", function(e) {
- domfocus = false;
- self.hasfocus = false;
+// if (!cap.cantouch && !opt.emulatetouch) {
+ if (!opt.emulatetouch && !cap.isandroid && !cap.isios) {
+
+ self.bind((cap.hasmousecapture) ? self.win : _doc, "mouseup", self.onmouseup);
+ self.bind(_doc, "mousemove", self.onmousemove);
+ if (self.onclick) self.bind(_doc, "click", self.onclick);
+
+ self.bind(self.cursor, "mousedown", self.onmousedown);
+ self.bind(self.cursor, "mouseup", self.onmouseup);
+
+ if (self.railh) {
+ self.bind(self.cursorh, "mousedown", function (e) {
+ self.onmousedown(e, true);
});
+ self.bind(self.cursorh, "mouseup", self.onmouseup);
+ }
- self.jqbind(self.win, "mouseenter", function(e) {
- mousefocus = (self.getTarget(e)).id || true;
- self.hasmousefocus = true;
- if (self.canshowonmouseevent) self.noticeCursor();
+ if (!self.ispage && opt.enablescrollonselection) {
+ self.bind(self.win[0], "mousedown", self.onselectionstart);
+ self.bind(_doc, "mouseup", self.onselectionend);
+ self.bind(self.cursor, "mouseup", self.onselectionend);
+ if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
+ self.bind(_doc, "mousemove", self.onselectiondrag);
+ }
+
+ if (self.zoom) {
+ self.jqbind(self.zoom, "mouseenter", function () {
+ if (self.canshowonmouseevent) self.showCursor();
+ self.rail.active = true;
});
- self.jqbind(self.win, "mouseleave", function() {
- mousefocus = false;
- self.hasmousefocus = false;
+ self.jqbind(self.zoom, "mouseleave", function () {
+ self.rail.active = false;
if (!self.rail.drag) self.hideCursor();
});
+ }
+ } else {
+
+ self.bind((cap.hasmousecapture) ? self.win : _doc, "mouseup", self.ontouchend);
+ if (self.onclick) self.bind(_doc, "click", self.onclick);
+
+ if (opt.cursordragontouch) {
+ self.bind(self.cursor, "mousedown", self.onmousedown);
+ self.bind(self.cursor, "mouseup", self.onmouseup);
+ self.cursorh && self.bind(self.cursorh, "mousedown", function (e) {
+ self.onmousedown(e, true);
+ });
+ self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup);
+ } else {
+ self.bind(self.rail, "mousedown", function (e) { e.preventDefault(); }); // prevent text selection
+ self.railh && self.bind(self.railh, "mousedown", function (e) { e.preventDefault(); });
}
- } // !ie9mobile
+ }
+
+
+ if (opt.enablemousewheel) {
+ if (!self.isiframe) self.mousewheel((cap.isie && self.ispage) ? _doc : self.win, self.onmousewheel);
+ self.mousewheel(self.rail, self.onmousewheel);
+ if (self.railh) self.mousewheel(self.railh, self.onmousewheelhr);
+ }
+
+ if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
+ if (!self.win.attr("tabindex")) self.win.attr({
+ "tabindex": ++tabindexcounter
+ });
+
+ self.bind(self.win, "focus", function (e) { // better using native events
+ domfocus = (self.getTarget(e)).id || self.getTarget(e) || false;
+ self.hasfocus = true;
+ if (self.canshowonmouseevent) self.noticeCursor();
+ });
+ self.bind(self.win, "blur", function (e) { // *
+ domfocus = false;
+ self.hasfocus = false;
+ });
+
+ self.bind(self.win, "mouseenter", function (e) { // *
+ mousefocus = (self.getTarget(e)).id || self.getTarget(e) || false;
+ self.hasmousefocus = true;
+ if (self.canshowonmouseevent) self.noticeCursor();
+ });
+ self.bind(self.win, "mouseleave", function (e) { // *
+ mousefocus = false;
+ self.hasmousefocus = false;
+ if (!self.rail.drag) self.hideCursor();
+ });
+
+ }
+
//Thanks to http://www.quirksmode.org !!
- self.onkeypress = function(e) {
- if (self.railslocked && self.page.maxh == 0) return true;
+ self.onkeypress = function (e) {
+ if (self.railslocked && self.page.maxh === 0) return true;
- e = (e) ? e : window.e;
+ e = e || _win.event;
var tg = self.getTarget(e);
if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
var tp = tg.getAttribute('type') || tg.type || false;
@@ -1811,14 +1883,14 @@
case 37:
case 63232: //safari
if (self.railh) {
- (ctrl) ? self.doScrollLeft(0): self.doScrollLeftBy(24 * 3);
+ (ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24 * 3);
ret = true;
}
break;
case 39:
case 63234: //safari
if (self.railh) {
- (ctrl) ? self.doScrollLeft(self.page.maxw): self.doScrollLeftBy(-24 * 3);
+ (ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24 * 3);
ret = true;
}
break;
@@ -1834,17 +1906,17 @@
break;
case 36:
case 63273: // safari
- (self.railh && ctrl) ? self.doScrollPos(0, 0): self.doScrollTo(0);
+ (self.railh && ctrl) ? self.doScrollPos(0, 0) : self.doScrollTo(0);
ret = true;
break;
case 35:
case 63275: // safari
- (self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh): self.doScrollTo(self.page.maxh);
+ (self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh) : self.doScrollTo(self.page.maxh);
ret = true;
break;
case 32:
- if (self.opt.spacebarenabled) {
- (shift) ? self.doScrollBy(self.view.h): self.doScrollBy(-self.view.h);
+ if (opt.spacebarenabled) {
+ (shift) ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h);
ret = true;
}
break;
@@ -1859,122 +1931,128 @@
}
};
- if (self.opt.enablekeyboard) self.bind(document, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);
+ if (opt.enablekeyboard) self.bind(_doc, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);
- self.bind(document, "keydown", function(e) {
+ self.bind(_doc, "keydown", function (e) {
var ctrl = e.ctrlKey || false;
if (ctrl) self.wheelprevented = true;
});
- self.bind(document, "keyup", function(e) {
+ self.bind(_doc, "keyup", function (e) {
var ctrl = e.ctrlKey || false;
if (!ctrl) self.wheelprevented = false;
});
- self.bind(window,"blur",function(e){
+ self.bind(_win, "blur", function (e) {
self.wheelprevented = false;
- });
+ });
- self.bind(window, 'resize', self.lazyResize);
- self.bind(window, 'orientationchange', self.lazyResize);
+ self.bind(_win, 'resize', self.onscreenresize);
+ self.bind(_win, 'orientationchange', self.onscreenresize);
- self.bind(window, "load", self.lazyResize);
+ self.bind(_win, "load", self.lazyResize);
if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
var tmp = self.win.attr("style");
var ww = parseFloat(self.win.css("width")) + 1;
self.win.css('width', ww);
- self.synched("chromefix", function() {
- self.win.attr("style", tmp)
+ self.synched("chromefix", function () {
+ self.win.attr("style", tmp);
});
}
// Trying a cross-browser implementation - good luck!
- self.onAttributeChange = function(e) {
+ self.onAttributeChange = function (e) {
self.lazyResize(self.isieold ? 250 : 30);
};
- if (ClsMutationObserver !== false) {
- self.observerbody = new ClsMutationObserver(function(mutations) {
- mutations.forEach(function(mut){
- if (mut.type=="attributes") {
- return ($("body").hasClass("modal-open") && !$.contains($('.modal-dialog')[0],self.doc[0])) ? self.hide() : self.show(); // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
- }
- });
- if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
- });
- self.observerbody.observe(document.body, {
- childList: true,
- subtree: true,
- characterData: false,
- attributes: true,
- attributeFilter: ['class']
- });
- }
-
- if (!self.ispage && !self.haswrapper) {
- // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
- if (ClsMutationObserver !== false) {
- self.observer = new ClsMutationObserver(function(mutations) {
- mutations.forEach(self.onAttributeChange);
+ if (opt.enableobserver) {
+
+ if ((!self.isie11) && (ClsMutationObserver !== false)) { // IE11 crashes #568
+ self.observerbody = new ClsMutationObserver(function (mutations) {
+ mutations.forEach(function (mut) {
+ if (mut.type == "attributes") {
+ return ($body.hasClass("modal-open") && $body.hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0], self.doc[0])) ? self.hide() : self.show(); // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
+ }
+ });
+ if (self.me.clientWidth != self.page.width || self.me.clientHeight != self.page.height) return self.lazyResize(30);
});
- self.observer.observe(self.win[0], {
+ self.observerbody.observe(_doc.body, {
childList: true,
+ subtree: true,
characterData: false,
attributes: true,
- subtree: false
+ attributeFilter: ['class']
});
- self.observerremover = new ClsMutationObserver(function(mutations) {
- mutations.forEach(function(mo) {
- if (mo.removedNodes.length > 0) {
- for (var dd in mo.removedNodes) {
- if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
+ }
+
+ if (!self.ispage && !self.haswrapper) {
+
+ var _dom = self.win[0];
+
+ // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
+ if (ClsMutationObserver !== false) {
+ self.observer = new ClsMutationObserver(function (mutations) {
+ mutations.forEach(self.onAttributeChange);
+ });
+ self.observer.observe(_dom, {
+ childList: true,
+ characterData: false,
+ attributes: true,
+ subtree: false
+ });
+ self.observerremover = new ClsMutationObserver(function (mutations) {
+ mutations.forEach(function (mo) {
+ if (mo.removedNodes.length > 0) {
+ for (var dd in mo.removedNodes) {
+ if (!!self && (mo.removedNodes[dd] === _dom)) return self.remove();
+ }
}
- }
+ });
});
- });
- self.observerremover.observe(self.win[0].parentNode, {
- childList: true,
- characterData: false,
- attributes: false,
- subtree: false
- });
- } else {
- self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
- if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
- self.bind(self.win, "DOMNodeRemoved", function(e) {
- if (e.target == self.win[0]) self.remove();
- });
+ self.observerremover.observe(_dom.parentNode, {
+ childList: true,
+ characterData: false,
+ attributes: false,
+ subtree: false
+ });
+ } else {
+ self.bind(_dom, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
+ if (cap.isie9) _dom.attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
+ self.bind(_dom, "DOMNodeRemoved", function (e) {
+ if (e.target === _dom) self.remove();
+ });
+ }
}
+
}
//
- if (!self.ispage && self.opt.boxzoom) self.bind(window, "resize", self.resizeZoom);
- if (self.istextarea) {
- self.bind(self.win, "keydown", self.lazyResize);
- self.bind(self.win, "mouseup", self.lazyResize);
- }
+ if (!self.ispage && opt.boxzoom) self.bind(_win, "resize", self.resizeZoom);
+ if (self.istextarea) {
+ self.bind(self.win, "keydown", self.lazyResize);
+ self.bind(self.win, "mouseup", self.lazyResize);
+ }
- // self.checkrtlmode = true;
self.lazyResize(30);
}
-
+
if (this.doc[0].nodeName == 'IFRAME') {
- var oniframeload = function() {
+ var oniframeload = function () {
self.iframexd = false;
var doc;
try {
- doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;
+ doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow._doc;
var a = doc.domain;
} catch (e) {
self.iframexd = true;
- doc = false
+ doc = false;
}
-
+
if (self.iframexd) {
- if ("console" in window) console.log('NiceScroll error: policy restriced iframe');
+ if ("console" in _win) console.log('NiceScroll error: policy restriced iframe');
return true; //cross-domain - I can't manage this
}
@@ -1986,16 +2064,16 @@
"html": self.doc.contents().find('html')[0],
"body": self.doc.contents().find('body')[0]
};
- self.getContentSize = function() {
+ self.getContentSize = function () {
return {
w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
};
};
- self.docscroll = $(self.iframe.body); //$(this.contentWindow);
+ self.docscroll = $(self.iframe.body);
}
- if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) {
+ if (!cap.isios && opt.iframeautoresize && !self.isiframe) {
self.win.scrollTop(0); // reset position
self.doc.height(""); //reset height to fix browser bug
var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight);
@@ -2003,12 +2081,7 @@
}
self.lazyResize(30);
- if (cap.isie7) self.css($(self.iframe.html), {
- 'overflow-y': 'hidden'
- });
- self.css($(self.iframe.body), {
- 'overflow-y': 'hidden'
- });
+ self.css($(self.iframe.body), _scrollyhidden);
if (cap.isios && self.haswrapper) {
self.css($(doc.body), {
@@ -2022,18 +2095,22 @@
self.bind(doc, "scroll", self.onscroll);
}
- if (self.opt.enablemousewheel) {
- self.bind(doc, "mousewheel", self.onmousewheel);
+ if (opt.enablemousewheel) {
+ self.mousewheel(doc, self.onmousewheel);
}
- if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
+ if (opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
- if (cap.cantouch || self.opt.touchbehavior) {
+ if (cap.cantouch) {
+ self.bind(doc, "touchstart", self.ontouchstart);
+ self.bind(doc, "touchmove", self.ontouchmove);
+ }
+ else if (opt.emulatetouch) {
self.bind(doc, "mousedown", self.ontouchstart);
- self.bind(doc, "mousemove", function(e) {
- return self.ontouchmove(e, true)
+ self.bind(doc, "mousemove", function (e) {
+ return self.ontouchmove(e, true);
});
- if (self.opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
+ if (opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
'cursor': cap.cursorgrabvalue
});
}
@@ -2041,14 +2118,14 @@
self.bind(doc, "mouseup", self.ontouchend);
if (self.zoom) {
- if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
+ if (opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom);
}
};
- if (this.doc[0].readyState && this.doc[0].readyState == "complete") {
- setTimeout(function() {
- oniframeload.call(self.doc[0], false)
+ if (this.doc[0].readyState && this.doc[0].readyState === "complete") {
+ setTimeout(function () {
+ oniframeload.call(self.doc[0], false);
}, 500);
}
self.bind(this.doc, "load", oniframeload);
@@ -2057,7 +2134,7 @@
};
- this.showCursor = function(py, px) {
+ this.showCursor = function (py, px) {
if (self.cursortimeout) {
clearTimeout(self.cursortimeout);
self.cursortimeout = 0;
@@ -2065,17 +2142,17 @@
if (!self.rail) return;
if (self.autohidedom) {
self.autohidedom.stop().css({
- opacity: self.opt.cursoropacitymax
+ opacity: opt.cursoropacitymax
});
self.cursoractive = true;
}
if (!self.rail.drag || self.rail.drag.pt != 1) {
- if ((typeof py != "undefined") && (py !== false)) {
- self.scroll.y = Math.round(py * 1 / self.scrollratio.y);
+ if (py !== undefined && py !== false) {
+ self.scroll.y = (py / self.scrollratio.y) | 0;
}
- if (typeof px != "undefined") {
- self.scroll.x = Math.round(px * 1 / self.scrollratio.x);
+ if (px !== undefined) {
+ self.scroll.x = (px / self.scrollratio.x) | 0;
}
}
@@ -2083,99 +2160,85 @@
height: self.cursorheight,
top: self.scroll.y
});
- if (self.cursorh) {
- var lx = (self.hasreversehr) ? self.scrollvaluemaxw-self.scroll.x : self.scroll.x;
- (!self.rail.align && self.rail.visibility) ? self.cursorh.css({
- width: self.cursorwidth,
- left: lx + self.rail.width
- }): self.cursorh.css({
+ if (self.cursorh) {
+ var lx = (self.hasreversehr) ? self.scrollvaluemaxw - self.scroll.x : self.scroll.x;
+ self.cursorh.css({
width: self.cursorwidth,
- left: lx
+ left: (!self.rail.align && self.rail.visibility) ? lx + self.rail.width : lx
});
self.cursoractive = true;
}
if (self.zoom) self.zoom.stop().css({
- opacity: self.opt.cursoropacitymax
+ opacity: opt.cursoropacitymax
});
};
- this.hideCursor = function(tm) {
+ this.hideCursor = function (tm) {
if (self.cursortimeout) return;
if (!self.rail) return;
if (!self.autohidedom) return;
- if (self.hasmousefocus && self.opt.autohidemode == "leave") return;
- self.cursortimeout = setTimeout(function() {
+
+ if (self.hasmousefocus && opt.autohidemode === "leave") return;
+ self.cursortimeout = setTimeout(function () {
if (!self.rail.active || !self.showonmouseevent) {
self.autohidedom.stop().animate({
- opacity: self.opt.cursoropacitymin
+ opacity: opt.cursoropacitymin
});
if (self.zoom) self.zoom.stop().animate({
- opacity: self.opt.cursoropacitymin
+ opacity: opt.cursoropacitymin
});
self.cursoractive = false;
}
self.cursortimeout = 0;
- }, tm || self.opt.hidecursordelay);
+ }, tm || opt.hidecursordelay);
};
- this.noticeCursor = function(tm, py, px) {
+ this.noticeCursor = function (tm, py, px) {
self.showCursor(py, px);
if (!self.rail.active) self.hideCursor(tm);
};
this.getContentSize =
(self.ispage) ?
- function() {
- return {
- w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
- h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
- }
- } : (self.haswrapper) ?
- function() {
- return {
- w: self.doc.outerWidth() + parseInt(self.win.css('paddingLeft')) + parseInt(self.win.css('paddingRight')),
- h: self.doc.outerHeight() + parseInt(self.win.css('paddingTop')) + parseInt(self.win.css('paddingBottom'))
- }
- } : function() {
- return {
- w: self.docscroll[0].scrollWidth,
- h: self.docscroll[0].scrollHeight
- }
- };
-
- this.onResize = function(e, page) {
-
- if (!self || !self.win) return false;
+ function () {
+ return {
+ w: Math.max(_doc.body.scrollWidth, _doc.documentElement.scrollWidth),
+ h: Math.max(_doc.body.scrollHeight, _doc.documentElement.scrollHeight)
+ };
+ } : (self.haswrapper) ?
+ function () {
+ return {
+ w: self.doc[0].offsetWidth,
+ h: self.doc[0].offsetHeight
+ };
+ } : function () {
+ return {
+ w: self.docscroll[0].scrollWidth,
+ h: self.docscroll[0].scrollHeight
+ };
+ };
- if (!self.haswrapper && !self.ispage) {
- if (self.win.css('display') == 'none') {
- if (self.visibility) self.hideRail().hideRailHr();
- return false;
- } else {
- if (!self.hidden && !self.visibility) self.showRail().showRailHr();
- }
- }
+ this.onResize = function (e, page) {
- var premaxh = self.page.maxh;
- var premaxw = self.page.maxw;
+ if (!self || !self.win) return false;
- var preview = {
- h: self.view.h,
- w: self.view.w
- };
+ var premaxh = self.page.maxh,
+ premaxw = self.page.maxw,
+ previewh = self.view.h,
+ previeww = self.view.w;
self.view = {
- w: (self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),
- h: (self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)
+ w: (self.ispage) ? self.win.width() : self.win[0].clientWidth,
+ h: (self.ispage) ? self.win.height() : self.win[0].clientHeight
};
self.page = (page) ? page : self.getContentSize();
self.page.maxh = Math.max(0, self.page.h - self.view.h);
self.page.maxw = Math.max(0, self.page.w - self.view.w);
-
- if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == preview.w) && (self.view.h == preview.h)) {
+
+ if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == previeww) && (self.view.h == previewh)) {
// test position
if (!self.ispage) {
var pos = self.win.offset();
@@ -2189,7 +2252,7 @@
}
}
- if (self.page.maxh == 0) {
+ if (self.page.maxh === 0) {
self.hideRail();
self.scrollvaluemax = 0;
self.scroll.y = 0;
@@ -2198,11 +2261,11 @@
self.setScrollTop(0);
if (self.rail) self.rail.scrollable = false;
} else {
- self.page.maxh -= (self.opt.railpadding.top + self.opt.railpadding.bottom); //**
+ self.page.maxh -= (opt.railpadding.top + opt.railpadding.bottom);
self.rail.scrollable = true;
}
- if (self.page.maxw == 0) {
+ if (self.page.maxw === 0) {
self.hideRailHr();
self.scrollvaluemaxw = 0;
self.scroll.x = 0;
@@ -2213,43 +2276,37 @@
self.railh.scrollable = false;
}
} else {
- self.page.maxw -= (self.opt.railpadding.left + self.opt.railpadding.right); //**
- if (self.railh) self.railh.scrollable = (self.opt.horizrailenabled);
+ self.page.maxw -= (opt.railpadding.left + opt.railpadding.right);
+ if (self.railh) self.railh.scrollable = (opt.horizrailenabled);
}
- self.railslocked = (self.locked) || ((self.page.maxh == 0) && (self.page.maxw == 0));
+ self.railslocked = (self.locked) || ((self.page.maxh === 0) && (self.page.maxw === 0));
if (self.railslocked) {
if (!self.ispage) self.updateScrollBar(self.view);
return false;
}
- if (!self.hidden && !self.visibility) {
- self.showRail().showRailHr();
+ if (!self.hidden) {
+ if (!self.rail.visibility) self.showRail();
+ if (self.railh && !self.railh.visibility) self.showRailHr();
}
- else if (self.railh && (!self.hidden && !self.railh.visibility)) self.showRailHr();
if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20;
self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
- self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorheight);
+ self.cursorheight = (opt.cursorfixedheight) ? opt.cursorfixedheight : Math.max(opt.cursorminheight, self.cursorheight);
self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
- self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorwidth);
+ self.cursorwidth = (opt.cursorfixedheight) ? opt.cursorfixedheight : Math.max(opt.cursorminheight, self.cursorwidth);
- self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder - (self.opt.railpadding.top + self.opt.railpadding.bottom); //**
+ self.scrollvaluemax = self.view.h - self.cursorheight - (opt.railpadding.top + opt.railpadding.bottom);
+ if (!self.hasborderbox) self.scrollvaluemax -= self.cursor[0].offsetHeight - self.cursor[0].clientHeight;
if (self.railh) {
self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w;
- self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder - (self.opt.railpadding.left + self.opt.railpadding.right); //**
+ self.scrollvaluemaxw = self.railh.width - self.cursorwidth - (opt.railpadding.left + opt.railpadding.right);
}
- /*
- if (self.checkrtlmode&&self.railh) {
- self.checkrtlmode = false;
- if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw);
- }
-*/
-
if (!self.ispage) self.updateScrollBar(self.view);
self.scrollratio = {
@@ -2261,28 +2318,54 @@
if (sy > self.page.maxh) {
self.doScrollTop(self.page.maxh);
} else {
- self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
- self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
+ self.scroll.y = (self.getScrollTop() / self.scrollratio.y) | 0;
+ self.scroll.x = (self.getScrollLeft() / self.scrollratio.x) | 0;
if (self.cursoractive) self.noticeCursor();
}
- if (self.scroll.y && (self.getScrollTop() == 0)) self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y));
+ if (self.scroll.y && (self.getScrollTop() === 0)) self.doScrollTo((self.scroll.y * self.scrollratio.y)|0);
return self;
};
this.resize = self.onResize;
- this.lazyResize = function(tm) { // event debounce
- tm = (isNaN(tm)) ? 30 : tm;
- self.debounced('resize', self.resize, tm);
+ var hlazyresize = 0;
+
+ this.onscreenresize = function(e) {
+ clearTimeout(hlazyresize);
+
+ var hiderails = (!self.ispage && !self.haswrapper);
+ if (hiderails) self.hideRails();
+
+ hlazyresize = setTimeout(function () {
+ if (self) {
+ if (hiderails) self.showRails();
+ self.resize();
+ }
+ hlazyresize=0;
+ }, 120);
+ };
+
+ this.lazyResize = function (tm) { // event debounce
+
+ clearTimeout(hlazyresize);
+
+ tm = isNaN(tm) ? 240 : tm;
+
+ hlazyresize = setTimeout(function () {
+ self && self.resize();
+ hlazyresize=0;
+ }, tm);
+
return self;
+
};
- // modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
+ // derived by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
function _modernWheelEvent(dom, name, fn, bubble) {
- self._bind(dom, name, function(e) {
- var e = (e) ? e : window.event;
+ self._bind(dom, name, function (e) {
+ e = e || _win.event;
var event = {
original: e,
target: e.target || e.srcElement,
@@ -2290,209 +2373,253 @@
deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
deltaX: 0,
deltaZ: 0,
- preventDefault: function() {
+ preventDefault: function () {
e.preventDefault ? e.preventDefault() : e.returnValue = false;
return false;
},
- stopImmediatePropagation: function() {
- (e.stopImmediatePropagation) ? e.stopImmediatePropagation(): e.cancelBubble = true;
+ stopImmediatePropagation: function () {
+ (e.stopImmediatePropagation) ? e.stopImmediatePropagation() : e.cancelBubble = true;
}
};
if (name == "mousewheel") {
- event.deltaY = -1 / 40 * e.wheelDelta;
e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
+ e.wheelDeltaY && (event.deltaY = -1 / 40 * e.wheelDeltaY);
+ !event.deltaY && !event.deltaX && (event.deltaY = -1 / 40 * e.wheelDelta);
} else {
event.deltaY = e.detail;
}
return fn.call(dom, event);
}, bubble);
- };
+ }
- this.jqbind = function(dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
+ this.jqbind = function (dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
self.events.push({
e: dom,
n: name,
f: fn,
q: true
});
- $(dom).bind(name, fn);
+ $(dom).on(name, fn);
};
- this.bind = function(dom, name, fn, bubble) { // touch-oriented & fixing jquery bind
+ this.mousewheel = function (dom, fn, bubble) { // bind mousewheel
var el = ("jquery" in dom) ? dom[0] : dom;
-
- if (name == 'mousewheel') {
- if ("onwheel" in self.win) { // modern brosers & IE9 detection fix
- self._bind(el, "wheel", fn, bubble || false);
- } else {
- var wname = (typeof document.onmousewheel != "undefined") ? "mousewheel" : "DOMMouseScroll"; // older IE/Firefox
- _modernWheelEvent(el, wname, fn, bubble || false);
- if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
- }
- } else if (el.addEventListener) {
- if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) { // touch device support
- var tt = (name == 'mousedown') ? 'touchstart' : (name == 'mouseup') ? 'touchend' : 'touchmove';
- self._bind(el, tt, function(e) {
- if (e.touches) {
- if (e.touches.length < 2) {
- var ev = (e.touches.length) ? e.touches[0] : e;
- ev.original = e;
- fn.call(this, ev);
- }
- } else if (e.changedTouches) {
- var ev = e.changedTouches[0];
- ev.original = e;
- fn.call(this, ev);
- } //blackberry
- }, bubble || false);
- }
- self._bind(el, name, fn, bubble || false);
- if (cap.cantouch && name == "mouseup") self._bind(el, "touchcancel", fn, bubble || false);
+ if ("onwheel" in _doc.createElement("div")) { // Modern browsers support "wheel"
+ self._bind(el, "wheel", fn, bubble || false);
} else {
- self._bind(el, name, function(e) {
- e = e || window.event || false;
- if (e) {
- if (e.srcElement) e.target = e.srcElement;
- }
- if (!("pageY" in e)) {
- e.pageX = e.clientX + document.documentElement.scrollLeft;
- e.pageY = e.clientY + document.documentElement.scrollTop;
- }
- return ((fn.call(el, e) === false) || bubble === false) ? self.cancelEvent(e) : true;
- });
+ var wname = (_doc.onmousewheel !== undefined) ? "mousewheel" : "DOMMouseScroll"; // older Webkit+IE support or older Firefox
+ _modernWheelEvent(el, wname, fn, bubble || false);
+ if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
}
};
- if (cap.haseventlistener) { // W3C standard model
- this._bind = function(el, name, fn, bubble) { // primitive bind
- self.events.push({
- e: el,
- n: name,
- f: fn,
- b: bubble,
- q: false
- });
- el.addEventListener(name, fn, bubble || false);
- };
- this.cancelEvent = function(e) {
+ var passiveSupported = false;
+
+ if (cap.haseventlistener) { // W3C standard event model
+
+ // thanks to https://developer.mozilla.org/en-US/docs/Web/API/EventTarget/addEventListener
+ try { var options = Object.defineProperty({}, "passive", { get: function () { passiveSupported = !0; } }); _win.addEventListener("test", null, options); } catch (err) { }
+
+ this.stopPropagation = function (e) {
if (!e) return false;
- var e = (e.original) ? e.original : e;
- e.preventDefault();
+ e = (e.original) ? e.original : e;
e.stopPropagation();
- if (e.preventManipulation) e.preventManipulation(); //IE10
return false;
};
- this.stopPropagation = function(e) {
- if (!e) return false;
- var e = (e.original) ? e.original : e;
- e.stopPropagation();
+
+ this.cancelEvent = function(e) {
+ if (e.cancelable) e.preventDefault();
+ e.stopImmediatePropagation();
+ if (e.preventManipulation) e.preventManipulation(); // IE10+
return false;
+ };
+
+ } else {
+
+ // inspired from https://gist.github.com/jonathantneal/2415137
+
+ Event.prototype.preventDefault = function () {
+ this.returnValue = false;
};
- this._unbind = function(el, name, fn, bub) { // primitive unbind
- el.removeEventListener(name, fn, bub);
+
+ Event.prototype.stopPropagation = function () {
+ this.cancelBubble = true;
};
- } else { // old IE model
- this._bind = function(el, name, fn, bubble) { // primitive bind
- self.events.push({
- e: el,
- n: name,
- f: fn,
- b: bubble,
- q: false
- });
- if (el.attachEvent) {
- el.attachEvent("on" + name, fn);
- } else {
- el["on" + name] = fn;
- }
- };
+
+ _win.constructor.prototype.addEventListener = _doc.constructor.prototype.addEventListener = Element.prototype.addEventListener = function (type, listener, useCapture) {
+ this.attachEvent("on" + type, listener);
+ };
+ _win.constructor.prototype.removeEventListener = _doc.constructor.prototype.removeEventListener = Element.prototype.removeEventListener = function (type, listener, useCapture) {
+ this.detachEvent("on" + type, listener);
+ };
+
// Thanks to http://www.switchonthecode.com !!
- this.cancelEvent = function(e) {
- var e = window.event || false;
- if (!e) return false;
- e.cancelBubble = true;
- e.cancel = true;
- e.returnValue = false;
+ this.cancelEvent = function (e) {
+ e = e || _win.event;
+ if (e) {
+ e.cancelBubble = true;
+ e.cancel = true;
+ e.returnValue = false;
+ }
return false;
};
- this.stopPropagation = function(e) {
- var e = window.event || false;
- if (!e) return false;
- e.cancelBubble = true;
+
+ this.stopPropagation = function (e) {
+ e = e || _win.event;
+ if (e) e.cancelBubble = true;
return false;
};
- this._unbind = function(el, name, fn, bub) { // primitive unbind IE old
- if (el.detachEvent) {
- el.detachEvent('on' + name, fn);
- } else {
- el['on' + name] = false;
- }
- };
+
}
-
- this.unbindAll = function() {
+
+ this.delegate = function (dom, name, fn, bubble, active) {
+
+ var de = delegatevents[name] || false;
+
+ if (!de) {
+
+ de = {
+ a: [],
+ l: [],
+ f: function (e) {
+ var lst = de.l, l = lst.length - 1;
+ var r = false;
+ for (var a = l; a >= 0; a--) {
+ r = lst[a].call(e.target, e);
+ if (r === false) return false;
+ }
+ return r;
+ }
+ };
+
+ self.bind(dom, name, de.f, bubble, active);
+
+ delegatevents[name] = de;
+
+ }
+
+ if (self.ispage) {
+ de.a = [self.id].concat(de.a);
+ de.l = [fn].concat(de.l);
+ } else {
+ de.a.push(self.id);
+ de.l.push(fn);
+ }
+
+ };
+
+ this.undelegate = function (dom, name, fn, bubble, active) {
+ var de = delegatevents[name]||false;
+ if (de&&de.l) { // quick fix #683
+ for (var a=0,l=de.l.length;a<l;a++) {
+ if (de.a[a] === self.id) {
+ de.a.splice(a);
+ de.l.splice(a);
+ if (de.a.length===0) {
+ self._unbind(dom,name,de.l.f);
+ delegatevents[name] = null;
+ }
+ }
+ }
+ }
+ };
+
+ this.bind = function (dom, name, fn, bubble, active) {
+ var el = ("jquery" in dom) ? dom[0] : dom;
+ self._bind(el, name, fn, bubble || false, active || false);
+ };
+
+ this._bind = function (el, name, fn, bubble, active) { // primitive bind
+
+ self.events.push({
+ e: el,
+ n: name,
+ f: fn,
+ b: bubble,
+ q: false
+ });
+
+ (passiveSupported && active) ? el.addEventListener(name, fn, { passive: false, capture: bubble }) : el.addEventListener(name, fn, bubble || false);
+ };
+
+ this._unbind = function (el, name, fn, bub) { // primitive unbind
+ if (delegatevents[name]) self.undelegate(el, name, fn, bub);
+ else el.removeEventListener(name, fn, bub);
+ };
+
+ this.unbindAll = function () {
for (var a = 0; a < self.events.length; a++) {
var r = self.events[a];
- (r.q) ? r.e.unbind(r.n, r.f): self._unbind(r.e, r.n, r.f, r.b);
+ (r.q) ? r.e.unbind(r.n, r.f) : self._unbind(r.e, r.n, r.f, r.b);
}
};
- this.showRail = function() {
- if ((self.page.maxh != 0) && (self.ispage || self.win.css('display') != 'none')) {
- self.visibility = true;
+ this.showRails = function () {
+ return self.showRail().showRailHr();
+ };
+
+ this.showRail = function () {
+ if ((self.page.maxh !== 0) && (self.ispage || self.win.css('display') != 'none')) {
+ //self.visibility = true;
self.rail.visibility = true;
self.rail.css('display', 'block');
}
return self;
};
- this.showRailHr = function() {
- if (!self.railh) return self;
- if ((self.page.maxw != 0) && (self.ispage || self.win.css('display') != 'none')) {
- self.railh.visibility = true;
- self.railh.css('display', 'block');
+ this.showRailHr = function () {
+ if (self.railh) {
+ if ((self.page.maxw !== 0) && (self.ispage || self.win.css('display') != 'none')) {
+ self.railh.visibility = true;
+ self.railh.css('display', 'block');
+ }
}
return self;
};
- this.hideRail = function() {
- self.visibility = false;
+ this.hideRails = function () {
+ return self.hideRail().hideRailHr();
+ };
+
+ this.hideRail = function () {
+ //self.visibility = false;
self.rail.visibility = false;
self.rail.css('display', 'none');
return self;
};
- this.hideRailHr = function() {
- if (!self.railh) return self;
- self.railh.visibility = false;
- self.railh.css('display', 'none');
+ this.hideRailHr = function () {
+ if (self.railh) {
+ self.railh.visibility = false;
+ self.railh.css('display', 'none');
+ }
return self;
};
- this.show = function() {
+ this.show = function () {
self.hidden = false;
self.railslocked = false;
- return self.showRail().showRailHr();
+ return self.showRails();
};
- this.hide = function() {
+ this.hide = function () {
self.hidden = true;
self.railslocked = true;
- return self.hideRail().hideRailHr();
+ return self.hideRails();
};
- this.toggle = function() {
+ this.toggle = function () {
return (self.hidden) ? self.show() : self.hide();
};
- this.remove = function() {
+ this.remove = function () {
self.stop();
if (self.cursortimeout) clearTimeout(self.cursortimeout);
- if (self.debouncedelayed) clearTimeout(self.debouncedelayed);
+ for (var n in self.delaylist) if (self.delaylist[n]) clearAnimationFrame(self.delaylist[n].h);
self.doZoomOut();
self.unbindAll();
@@ -2521,7 +2648,7 @@
}
for (var a = 0; a < self.saved.css.length; a++) {
var d = self.saved.css[a];
- d[0].css(d[1], (typeof d[2] == "undefined") ? '' : d[2]);
+ d[0].css(d[1], (d[2] === undefined) ? '' : d[2]);
}
self.saved = false;
self.me.data('__nicescroll', ''); //erase all traces
@@ -2529,11 +2656,11 @@
// memory leak fixed by GianlucaGuarini - thanks a lot!
// remove the current nicescroll from the $.nicescroll array & normalize array
var lst = $.nicescroll;
- lst.each(function(i) {
+ lst.each(function (i) {
if (!this) return;
if (this.id === self.id) {
delete lst[i];
- for (var b = ++i; b < lst.length; b++, i++) lst[i] = lst[b];
+ for (var b = ++i; b < lst.length; b++ , i++) lst[i] = lst[b];
lst.length--;
if (lst.length) delete lst[lst.length];
}
@@ -2548,32 +2675,32 @@
};
- this.scrollstart = function(fn) {
+ this.scrollstart = function (fn) {
this.onscrollstart = fn;
return self;
};
- this.scrollend = function(fn) {
+ this.scrollend = function (fn) {
this.onscrollend = fn;
return self;
};
- this.scrollcancel = function(fn) {
+ this.scrollcancel = function (fn) {
this.onscrollcancel = fn;
return self;
};
- this.zoomin = function(fn) {
+ this.zoomin = function (fn) {
this.onzoomin = fn;
return self;
};
- this.zoomout = function(fn) {
+ this.zoomout = function (fn) {
this.onzoomout = fn;
return self;
};
- this.isScrollable = function(e) {
+ this.isScrollable = function (e) {
var dom = (e.target) ? e.target : e;
if (dom.nodeName == 'OPTION') return true;
- while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
+ while (dom && (dom.nodeType == 1) && (dom !== this.me[0]) && !(/^BODY|HTML/.test(dom.nodeName))) {
var dd = $(dom);
var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight);
@@ -2582,7 +2709,7 @@
return false;
};
- this.getViewport = function(me) {
+ this.getViewport = function (me) {
var dom = (me && me.parentNode) ? me.parentNode : false;
while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
var dd = $(dom);
@@ -2592,103 +2719,203 @@
if (dd.getNiceScroll().length > 0) return dd;
dom = (dom.parentNode) ? dom.parentNode : false;
}
- return false; //(dom) ? $(dom) : false;
+ return false;
};
- this.triggerScrollEnd = function() {
- if (!self.onscrollend) return;
+ this.triggerScrollStart = function (cx, cy, rx, ry, ms) {
- var px = self.getScrollLeft();
- var py = self.getScrollTop();
+ if (self.onscrollstart) {
+ var info = {
+ type: "scrollstart",
+ current: {
+ x: cx,
+ y: cy
+ },
+ request: {
+ x: rx,
+ y: ry
+ },
+ end: {
+ x: self.newscrollx,
+ y: self.newscrolly
+ },
+ speed: ms
+ };
+ self.onscrollstart.call(self, info);
+ }
- var info = {
- "type": "scrollend",
- "current": {
- "x": px,
- "y": py
- },
- "end": {
- "x": px,
- "y": py
+ };
+
+ this.triggerScrollEnd = function () {
+ if (self.onscrollend) {
+
+ var px = self.getScrollLeft();
+ var py = self.getScrollTop();
+
+ var info = {
+ type: "scrollend",
+ current: {
+ x: px,
+ y: py
+ },
+ end: {
+ x: px,
+ y: py
+ }
+ };
+
+ self.onscrollend.call(self, info);
+
+ }
+
+ };
+
+ var scrolldiry = 0, scrolldirx = 0, scrolltmr = 0, scrollspd = 1;
+
+ function doScrollRelative(px, py, chkscroll, iswheel) {
+
+ if (!self.scrollrunning) {
+ self.newscrolly = self.getScrollTop();
+ self.newscrollx = self.getScrollLeft();
+ scrolltmr = now();
+ }
+
+ var gap = (now() - scrolltmr);
+ scrolltmr = now();
+
+ if (gap > 350) {
+ scrollspd = 1;
+ } else {
+ scrollspd += (2 - scrollspd) / 10;
+ }
+
+ px = px * scrollspd | 0;
+ py = py * scrollspd | 0;
+
+ if (px) {
+
+ if (iswheel) { // mouse-only
+ if (px < 0) { // fix apple magic mouse swipe back/forward
+ if (self.getScrollLeft() >= self.page.maxw) return true;
+ } else {
+ if (self.getScrollLeft() <= 0) return true;
+ }
}
- };
- self.onscrollend.call(self, info);
+
+ var dx = px > 0 ? 1 : -1;
+
+ if (scrolldirx !== dx) {
+ if (self.scrollmom) self.scrollmom.stop();
+ self.newscrollx = self.getScrollLeft();
+ scrolldirx = dx;
+ }
+
+ self.lastdeltax -= px;
+
+ }
+
+ if (py) {
+
+ var chk = (function () {
+ var top = self.getScrollTop();
+ if (py < 0) {
+ if (top >= self.page.maxh) return true;
+ } else {
+ if (top <= 0) return true;
+ }
+ })();
+
+ if (chk) {
+ if (opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) return true;
+ var ny = self.view.h >> 1;
+ if (self.newscrolly < -ny) { self.newscrolly = -ny; py = -1; }
+ else if (self.newscrolly > self.page.maxh + ny) { self.newscrolly = self.page.maxh + ny; py = 1; }
+ else py = 0;
+ }
+
+ var dy = py > 0 ? 1 : -1;
+
+ if (scrolldiry !== dy) {
+ if (self.scrollmom) self.scrollmom.stop();
+ self.newscrolly = self.getScrollTop();
+ scrolldiry = dy;
+ }
+
+ self.lastdeltay -= py;
+
+ }
+
+ if (py || px) {
+ self.synched("relativexy", function () {
+
+ var dty = self.lastdeltay + self.newscrolly;
+ self.lastdeltay = 0;
+
+ var dtx = self.lastdeltax + self.newscrollx;
+ self.lastdeltax = 0;
+
+ if (!self.rail.drag) self.doScrollPos(dtx, dty);
+
+ });
+ }
+
}
+ var hasparentscrollingphase = false;
+
function execScrollWheel(e, hr, chkscroll) {
var px, py;
-
- if (e.deltaMode == 0) { // PIXEL
- px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3)));
- py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3)));
- } else if (e.deltaMode == 1) { // LINE
- px = -Math.floor(e.deltaX * self.opt.mousescrollstep);
- py = -Math.floor(e.deltaY * self.opt.mousescrollstep);
+
+ if (!chkscroll && hasparentscrollingphase) return true;
+
+ if (e.deltaMode === 0) { // PIXEL
+ px = -(e.deltaX * (opt.mousescrollstep / (18 * 3))) | 0;
+ py = -(e.deltaY * (opt.mousescrollstep / (18 * 3))) | 0;
+ } else if (e.deltaMode === 1) { // LINE
+ px = -(e.deltaX * opt.mousescrollstep * 50 / 80) | 0;
+ py = -(e.deltaY * opt.mousescrollstep * 50 / 80) | 0;
}
- if (hr && self.opt.oneaxismousemode && (px == 0) && py) { // classic vertical-only mousewheel + browser with x/y support
+ if (hr && opt.oneaxismousemode && (px === 0) && py) { // classic vertical-only mousewheel + browser with x/y support
px = py;
py = 0;
-
+
if (chkscroll) {
var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0);
if (hrend) { // preserve vertical scrolling
py = px;
- px = 0;
+ px = 0;
}
}
-
- }
- if (px) {
- if (self.scrollmom) {
- self.scrollmom.stop()
- }
- self.lastdeltax += px;
- self.debounced("mousewheelx", function() {
- var dt = self.lastdeltax;
- self.lastdeltax = 0;
- if (!self.rail.drag) {
- self.doScrollLeftBy(dt)
- }
- }, 15);
}
- if (py) {
- if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) {
- if (py < 0) {
- if (self.getScrollTop() >= self.page.maxh) return true;
- } else {
- if (self.getScrollTop() <= 0) return true;
- }
- }
- if (self.scrollmom) {
- self.scrollmom.stop()
- }
- self.lastdeltay += py;
- self.debounced("mousewheely", function() {
- var dt = self.lastdeltay;
- self.lastdeltay = 0;
- if (!self.rail.drag) {
- self.doScrollBy(dt)
- }
- }, 15);
+
+ // invert horizontal direction for rtl mode
+ if (self.isrtlmode) px = -px;
+
+ var chk = doScrollRelative(px, py, chkscroll, true);
+
+ if (chk) {
+ if (chkscroll) hasparentscrollingphase = true;
+ } else {
+ hasparentscrollingphase = false;
+ e.stopImmediatePropagation();
+ return e.preventDefault();
}
- e.stopImmediatePropagation();
- return e.preventDefault();
- };
+ }
- this.onmousewheel = function(e) {
- if (self.wheelprevented) return;
+ this.onmousewheel = function (e) {
+ if (self.wheelprevented||self.locked) return false;
if (self.railslocked) {
self.debounced("checkunlock", self.resize, 250);
- return true;
+ return false;
}
if (self.rail.drag) return self.cancelEvent(e);
- if (self.opt.oneaxismousemode == "auto" && e.deltaX != 0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)
+ if (opt.oneaxismousemode === "auto" && e.deltaX !== 0) opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)
- if (self.opt.oneaxismousemode && e.deltaX == 0) {
+ if (opt.oneaxismousemode && e.deltaX === 0) {
if (!self.rail.scrollable) {
if (self.railh && self.railh.scrollable) {
return self.onmousewheelhr(e);
@@ -2698,9 +2925,9 @@
}
}
- var nw = +(new Date());
+ var nw = now();
var chk = false;
- if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
+ if (opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
self.nativescrollingarea = self.isScrollable(e);
chk = true;
}
@@ -2711,25 +2938,25 @@
return ret;
};
- this.onmousewheelhr = function(e) {
+ this.onmousewheelhr = function (e) {
if (self.wheelprevented) return;
if (self.railslocked || !self.railh.scrollable) return true;
if (self.rail.drag) return self.cancelEvent(e);
- var nw = +(new Date());
+ var nw = now();
var chk = false;
- if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
+ if (opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
self.nativescrollingarea = self.isScrollable(e);
chk = true;
}
self.checkarea = nw;
- if (self.nativescrollingarea) return true; // this isn't my business
+ if (self.nativescrollingarea) return true; // this is not my business
if (self.railslocked) return self.cancelEvent(e);
return execScrollWheel(e, true, chk);
};
- this.stop = function() {
+ this.stop = function () {
self.cancelScroll();
if (self.scrollmon) self.scrollmon.stop();
self.cursorfreezed = false;
@@ -2738,65 +2965,100 @@
return self;
};
- this.getTransitionSpeed = function(dif) {
- var sp = Math.round(self.opt.scrollspeed * 10);
- var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed));
- return (ex > 20) ? ex : 0;
+ this.getTransitionSpeed = function (dif) {
+
+ return 80 + (dif / 72) * opt.scrollspeed |0;
+
};
- if (!self.opt.smoothscroll) {
- this.doScrollLeft = function(x, spd) { //direct
+ if (!opt.smoothscroll) {
+ this.doScrollLeft = function (x, spd) { //direct
var y = self.getScrollTop();
self.doScrollPos(x, y, spd);
};
- this.doScrollTop = function(y, spd) { //direct
+ this.doScrollTop = function (y, spd) { //direct
var x = self.getScrollLeft();
self.doScrollPos(x, y, spd);
};
- this.doScrollPos = function(x, y, spd) { //direct
+ this.doScrollPos = function (x, y, spd) { //direct
var nx = (x > self.page.maxw) ? self.page.maxw : x;
if (nx < 0) nx = 0;
var ny = (y > self.page.maxh) ? self.page.maxh : y;
if (ny < 0) ny = 0;
- self.synched('scroll', function() {
+ self.synched('scroll', function () {
self.setScrollTop(ny);
self.setScrollLeft(nx);
});
};
- this.cancelScroll = function() {}; // direct
- } else if (self.ishwscroll && cap.hastransition && self.opt.usetransition && !!self.opt.smoothscroll) {
- this.prepareTransition = function(dif, istime) {
- var ex = (istime) ? ((dif > 20) ? dif : 0) : self.getTransitionSpeed(dif);
- var trans = (ex) ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : '';
- if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) {
- self.lasttransitionstyle = trans;
- self.doc.css(cap.transitionstyle, trans);
+ this.cancelScroll = function () { }; // direct
+
+ } else if (self.ishwscroll && cap.hastransition && opt.usetransition && !!opt.smoothscroll) {
+
+ var lasttransitionstyle = '';
+
+ this.resetTransition = function () {
+ lasttransitionstyle = '';
+ self.doc.css(cap.prefixstyle + 'transition-duration', '0ms');
+ };
+
+ this.prepareTransition = function (dif, istime) {
+ var ex = (istime) ? dif : self.getTransitionSpeed(dif);
+ var trans = ex + 'ms';
+ if (lasttransitionstyle !== trans) {
+ lasttransitionstyle = trans;
+ self.doc.css(cap.prefixstyle + 'transition-duration', trans);
}
return ex;
};
- this.doScrollLeft = function(x, spd) { //trans
+ this.doScrollLeft = function (x, spd) { //trans
var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
self.doScrollPos(x, y, spd);
};
- this.doScrollTop = function(y, spd) { //trans
+ this.doScrollTop = function (y, spd) { //trans
var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
self.doScrollPos(x, y, spd);
};
- this.doScrollPos = function(x, y, spd) { //trans
+ this.cursorupdate = {
+ running: false,
+ start: function () {
+ var m = this;
+
+ if (m.running) return;
+ m.running = true;
+
+ var loop = function () {
+ if (m.running) setAnimationFrame(loop);
+ self.showCursor(self.getScrollTop(), self.getScrollLeft());
+ self.notifyScrollEvent(self.win[0]);
+ };
+
+ setAnimationFrame(loop);
+ },
+ stop: function () {
+ this.running = false;
+ }
+ };
+
+ this.doScrollPos = function (x, y, spd) { //trans
var py = self.getScrollTop();
var px = self.getScrollLeft();
if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
- if (self.opt.bouncescroll == false) {
+ if (!opt.bouncescroll) {
if (y < 0) y = 0;
else if (y > self.page.maxh) y = self.page.maxh;
if (x < 0) x = 0;
else if (x > self.page.maxw) x = self.page.maxw;
+ } else {
+ if (y < 0) y = y / 2 | 0;
+ else if (y > self.page.maxh) y = self.page.maxh + (y - self.page.maxh) / 2 | 0;
+ if (x < 0) x = x / 2 | 0;
+ else if (x > self.page.maxw) x = self.page.maxw + (x - self.page.maxw) / 2 | 0;
}
if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;
@@ -2804,95 +3066,43 @@
self.newscrolly = y;
self.newscrollx = x;
- self.newscrollspeed = spd || false;
-
- if (self.timer) return false;
-
- self.timer = setTimeout(function() {
+ var top = self.getScrollTop();
+ var lft = self.getScrollLeft();
- var top = self.getScrollTop();
- var lft = self.getScrollLeft();
-
- var dst = {};
- dst.x = x - lft;
- dst.y = y - top;
- dst.px = lft;
- dst.py = top;
-
- var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2)));
- var ms = (self.newscrollspeed && self.newscrollspeed > 1) ? self.newscrollspeed : self.getTransitionSpeed(dd);
- if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed;
-
- self.prepareTransition(ms, true);
-
- if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
-
- if (ms > 0) {
-
- if (!self.scrollrunning && self.onscrollstart) {
- var info = {
- "type": "scrollstart",
- "current": {
- "x": lft,
- "y": top
- },
- "request": {
- "x": x,
- "y": y
- },
- "end": {
- "x": self.newscrollx,
- "y": self.newscrolly
- },
- "speed": ms
- };
- self.onscrollstart.call(self, info);
- }
+ var dst = {};
+ dst.x = x - lft;
+ dst.y = y - top;
- if (cap.transitionend) {
- if (!self.scrollendtrapped) {
- self.scrollendtrapped = true;
- self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
- }
- } else {
- if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
- self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
- }
+ var dd = Math.sqrt((dst.x * dst.x) + (dst.y * dst.y)) | 0;
- var py = top;
- var px = lft;
- self.timerscroll = {
- bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1),
- bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1)
- };
- if (!self.cursorfreezed) self.timerscroll.tm = setInterval(function() {
- self.showCursor(self.getScrollTop(), self.getScrollLeft())
- }, 60);
+ var ms = self.prepareTransition(dd);
- }
+ if (!self.scrollrunning) {
+ self.scrollrunning = true;
+ self.triggerScrollStart(lft, top, x, y, ms);
+ self.cursorupdate.start();
+ }
- self.synched("doScroll-set", function() {
- self.timer = 0;
- if (self.scrollendtrapped) self.scrollrunning = true;
- self.setScrollTop(self.newscrolly);
- self.setScrollLeft(self.newscrollx);
- if (!self.scrollendtrapped) self.onScrollTransitionEnd();
- });
+ self.scrollendtrapped = true;
+ if (!cap.transitionend) {
+ if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
+ self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
+ }
- }, 50);
+ self.setScrollTop(self.newscrolly);
+ self.setScrollLeft(self.newscrollx);
};
- this.cancelScroll = function() {
+ this.cancelScroll = function () {
if (!self.scrollendtrapped) return true;
var py = self.getScrollTop();
var px = self.getScrollLeft();
self.scrollrunning = false;
if (!cap.transitionend) clearTimeout(cap.transitionend);
self.scrollendtrapped = false;
- self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
- self.prepareTransition(0);
+ self.resetTransition();
self.setScrollTop(py); // fire event onscroll
if (self.railh) self.setScrollLeft(px);
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
@@ -2900,203 +3110,129 @@
self.cursorfreezed = false;
+ self.cursorupdate.stop();
self.showCursor(py, px);
return self;
};
- this.onScrollTransitionEnd = function() {
- if (self.scrollendtrapped) self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
- self.scrollendtrapped = false;
- self.prepareTransition(0);
- if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
- self.timerscroll = false;
+
+ this.onScrollTransitionEnd = function () {
+
+ if (!self.scrollendtrapped) return;
+
var py = self.getScrollTop();
var px = self.getScrollLeft();
+
+ if (py < 0) py = 0;
+ else if (py > self.page.maxh) py = self.page.maxh;
+ if (px < 0) px = 0;
+ else if (px > self.page.maxw) px = self.page.maxw;
+ if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, opt.snapbackspeed);
+
+ if (self.scrollrunning) self.triggerScrollEnd();
+ self.scrollrunning = false;
+
+ self.scrollendtrapped = false;
+ self.resetTransition();
+ self.timerscroll = false;
self.setScrollTop(py); // fire event onscroll
if (self.railh) self.setScrollLeft(px); // fire event onscroll left
+ self.cursorupdate.stop();
self.noticeCursor(false, py, px);
self.cursorfreezed = false;
- if (py < 0) py = 0
- else if (py > self.page.maxh) py = self.page.maxh;
- if (px < 0) px = 0
- else if (px > self.page.maxw) px = self.page.maxw;
- if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, self.opt.snapbackspeed);
-
- if (self.onscrollend && self.scrollrunning) {
- self.triggerScrollEnd();
- }
- self.scrollrunning = false;
-
};
} else {
- this.doScrollLeft = function(x, spd) { //no-trans
+ this.doScrollLeft = function (x, spd) { //no-trans
var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
self.doScrollPos(x, y, spd);
};
- this.doScrollTop = function(y, spd) { //no-trans
+ this.doScrollTop = function (y, spd) { //no-trans
var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
self.doScrollPos(x, y, spd);
};
- this.doScrollPos = function(x, y, spd) { //no-trans
- var y = ((typeof y == "undefined") || (y === false)) ? self.getScrollTop(true) : y;
-
- if ((self.timer) && (self.newscrolly == y) && (self.newscrollx == x)) return true;
-
- if (self.timer) clearAnimationFrame(self.timer);
- self.timer = 0;
+ this.doScrollPos = function (x, y, spd) { //no-trans
var py = self.getScrollTop();
var px = self.getScrollLeft();
if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
- self.newscrolly = y;
- self.newscrollx = x;
+ var clipped = false;
if (!self.bouncescroll || !self.rail.visibility) {
- if (self.newscrolly < 0) {
- self.newscrolly = 0;
- } else if (self.newscrolly > self.page.maxh) {
- self.newscrolly = self.page.maxh;
+ if (y < 0) {
+ y = 0;
+ clipped = true;
+ } else if (y > self.page.maxh) {
+ y = self.page.maxh;
+ clipped = true;
}
}
if (!self.bouncescroll || !self.railh.visibility) {
- if (self.newscrollx < 0) {
- self.newscrollx = 0;
- } else if (self.newscrollx > self.page.maxw) {
- self.newscrollx = self.page.maxw;
+ if (x < 0) {
+ x = 0;
+ clipped = true;
+ } else if (x > self.page.maxw) {
+ x = self.page.maxw;
+ clipped = true;
}
}
+ if (self.scrollrunning && (self.newscrolly === y) && (self.newscrollx === x)) return true;
+
+ self.newscrolly = y;
+ self.newscrollx = x;
+
self.dst = {};
self.dst.x = x - px;
self.dst.y = y - py;
self.dst.px = px;
self.dst.py = py;
- var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2)));
-
- self.dst.ax = self.dst.x / dst;
- self.dst.ay = self.dst.y / dst;
-
- var pa = 0;
- var pe = dst;
-
- if (self.dst.x == 0) {
- pa = py;
- pe = y;
- self.dst.ay = 1;
- self.dst.py = 0;
- } else if (self.dst.y == 0) {
- pa = px;
- pe = x;
- self.dst.ax = 1;
- self.dst.px = 0;
- }
-
- var ms = self.getTransitionSpeed(dst);
- if (spd && spd <= 1) ms *= spd;
- if (ms > 0) {
- self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe, ms) : new BezierClass(pa, pe, ms, 0, 1, 0, 1);
- } else {
- self.bzscroll = false;
- }
-
- if (self.timer) return;
-
- if ((py == self.page.maxh && y >= self.page.maxh) || (px == self.page.maxw && x >= self.page.maxw)) self.checkContentSize();
+ var dd = Math.sqrt((self.dst.x * self.dst.x) + (self.dst.y * self.dst.y)) | 0;
+ var ms = self.getTransitionSpeed(dd);
- var sync = 1;
+ self.bzscroll = {};
- function scrolling() {
- if (self.cancelAnimationFrame) return true;
+ var p3 = (clipped) ? 1 : 0.58;
+ self.bzscroll.x = new BezierClass(px, self.newscrollx, ms, 0, 0, p3, 1);
+ self.bzscroll.y = new BezierClass(py, self.newscrolly, ms, 0, 0, p3, 1);
- self.scrollrunning = true;
+ var loopid = now();
- sync = 1 - sync;
- if (sync) return (self.timer = setAnimationFrame(scrolling) || 1);
+ var loop = function () {
- var done = 0;
- var sx, sy;
+ if (!self.scrollrunning) return;
+ var x = self.bzscroll.y.getPos();
- var sc = sy = self.getScrollTop();
- if (self.dst.ay) {
- sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow() * self.dst.ay) : self.newscrolly;
- var dr = sc - sy;
- if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly)) sc = self.newscrolly;
- self.setScrollTop(sc);
- if (sc == self.newscrolly) done = 1;
- } else {
- done = 1;
- }
+ self.setScrollLeft(self.bzscroll.x.getNow());
+ self.setScrollTop(self.bzscroll.y.getNow());
- var scx = sx = self.getScrollLeft();
- if (self.dst.ax) {
- scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow() * self.dst.ax) : self.newscrollx;
- var dr = scx - sx;
- if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx)) scx = self.newscrollx;
- self.setScrollLeft(scx);
- if (scx == self.newscrollx) done += 1;
+ if (x <= 1) {
+ self.timer = setAnimationFrame(loop);
} else {
- done += 1;
- }
-
- if (done == 2) {
- self.timer = 0;
- self.cursorfreezed = false;
- self.bzscroll = false;
self.scrollrunning = false;
- if (sc < 0) sc = 0;
- else if (sc > self.page.maxh) sc = self.page.maxh;
- if (scx < 0) scx = 0;
- else if (scx > self.page.maxw) scx = self.page.maxw;
- if ((scx != self.newscrollx) || (sc != self.newscrolly)) self.doScrollPos(scx, sc);
- else {
- if (self.onscrollend) {
- self.triggerScrollEnd();
- }
- }
- } else {
- self.timer = setAnimationFrame(scrolling) || 1;
+ self.timer = 0;
+ self.triggerScrollEnd();
}
- };
- self.cancelAnimationFrame = false;
- self.timer = 1;
-
- if (self.onscrollstart && !self.scrollrunning) {
- var info = {
- "type": "scrollstart",
- "current": {
- "x": px,
- "y": py
- },
- "request": {
- "x": x,
- "y": y
- },
- "end": {
- "x": self.newscrollx,
- "y": self.newscrolly
- },
- "speed": ms
- };
- self.onscrollstart.call(self, info);
- }
- scrolling();
+ };
- if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px)) self.checkContentSize();
+ if (!self.scrollrunning) {
+ self.triggerScrollStart(px, py, x, y, ms);
+ self.scrollrunning = true;
+ self.timer = setAnimationFrame(loop);
+ }
- self.noticeCursor();
};
- this.cancelScroll = function() {
+ this.cancelScroll = function () {
if (self.timer) clearAnimationFrame(self.timer);
self.timer = 0;
self.bzscroll = false;
@@ -3106,54 +3242,15 @@
}
- this.doScrollBy = function(stp, relative) {
- var ny = 0;
- if (relative) {
- ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y)
- } else {
- var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);
- ny = sy - stp;
- }
- if (self.bouncescroll) {
- var haf = Math.round(self.view.h / 2);
- if (ny < -haf) ny = -haf
- else if (ny > (self.page.maxh + haf)) ny = (self.page.maxh + haf);
- }
- self.cursorfreezed = false;
-
- var py = self.getScrollTop(true);
- if (ny < 0 && py <= 0) return self.noticeCursor();
- else if (ny > self.page.maxh && py >= self.page.maxh) {
- self.checkContentSize();
- return self.noticeCursor();
- }
-
- self.doScrollTop(ny);
+ this.doScrollBy = function (stp, relative) {
+ doScrollRelative(0, stp);
};
- this.doScrollLeftBy = function(stp, relative) {
- var nx = 0;
- if (relative) {
- nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x)
- } else {
- var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);
- nx = sx - stp;
- }
- if (self.bouncescroll) {
- var haf = Math.round(self.view.w / 2);
- if (nx < -haf) nx = -haf;
- else if (nx > (self.page.maxw + haf)) nx = (self.page.maxw + haf);
- }
- self.cursorfreezed = false;
-
- var px = self.getScrollLeft(true);
- if (nx < 0 && px <= 0) return self.noticeCursor();
- else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor();
-
- self.doScrollLeft(nx);
+ this.doScrollLeftBy = function (stp, relative) {
+ doScrollRelative(stp, 0);
};
- this.doScrollTo = function(pos, relative) {
+ this.doScrollTo = function (pos, relative) {
var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos;
if (ny < 0) ny = 0;
else if (ny > self.page.maxh) ny = self.page.maxh;
@@ -3161,24 +3258,24 @@
self.doScrollTop(pos);
};
- this.checkContentSize = function() {
+ this.checkContentSize = function () {
var pg = self.getContentSize();
if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg);
};
- self.onscroll = function(e) {
+ self.onscroll = function (e) {
if (self.rail.drag) return;
if (!self.cursorfreezed) {
- self.synched('scroll', function() {
- self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
- if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
+ self.synched('scroll', function () {
+ self.scroll.y = Math.round(self.getScrollTop() / self.scrollratio.y);
+ if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() / self.scrollratio.x);
self.noticeCursor();
});
}
};
self.bind(self.docscroll, "scroll", self.onscroll);
- this.doZoomIn = function(e) {
+ this.doZoomIn = function (e) {
if (self.zoomactive) return;
self.zoomactive = true;
@@ -3189,7 +3286,7 @@
var win = self.win[0].style;
for (var a in lst) {
var pp = lst[a];
- self.zoomrestore.style[pp] = (typeof win[pp] != "undefined") ? win[pp] : '';
+ self.zoomrestore.style[pp] = (win[pp] !== undefined) ? win[pp] : '';
}
self.zoomrestore.style.width = self.win.css('width');
@@ -3201,26 +3298,26 @@
};
if (cap.isios4) {
- self.zoomrestore.scrollTop = $(window).scrollTop();
- $(window).scrollTop(0);
+ self.zoomrestore.scrollTop = $window.scrollTop();
+ $window.scrollTop(0);
}
self.win.css({
- "position": (cap.isios4) ? "absolute" : "fixed",
- "top": 0,
- "left": 0,
- "z-index": globalmaxzindex + 100,
- "margin": "0px"
+ position: (cap.isios4) ? "absolute" : "fixed",
+ top: 0,
+ left: 0,
+ zIndex: globalmaxzindex + 100,
+ margin: 0
});
var bkg = self.win.css("backgroundColor");
- if (bkg == "" || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
+ if ("" === bkg || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
self.rail.css({
- "z-index": globalmaxzindex + 101
+ zIndex: globalmaxzindex + 101
});
self.zoom.css({
- "z-index": globalmaxzindex + 102
+ zIndex: globalmaxzindex + 102
});
- self.zoom.css('backgroundPosition', '0px -18px');
+ self.zoom.css('backgroundPosition', '0 -18px');
self.resizeZoom();
if (self.onzoomin) self.onzoomin.call(self);
@@ -3228,7 +3325,7 @@
return self.cancelEvent(e);
};
- this.doZoomOut = function(e) {
+ this.doZoomOut = function (e) {
if (!self.zoomactive) return;
self.zoomactive = false;
@@ -3236,7 +3333,7 @@
self.win.css(self.zoomrestore.style);
if (cap.isios4) {
- $(window).scrollTop(self.zoomrestore.scrollTop);
+ $window.scrollTop(self.zoomrestore.scrollTop);
}
self.rail.css({
@@ -3246,7 +3343,7 @@
"z-index": self.zindex
});
self.zoomrestore = false;
- self.zoom.css('backgroundPosition', '0px 0px');
+ self.zoom.css('backgroundPosition', '0 0');
self.onResize();
if (self.onzoomout) self.onzoomout.call(self);
@@ -3254,17 +3351,17 @@
return self.cancelEvent(e);
};
- this.doZoom = function(e) {
+ this.doZoom = function (e) {
return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
};
- this.resizeZoom = function() {
+ this.resizeZoom = function () {
if (!self.zoomactive) return;
var py = self.getScrollTop(); //preserve scrolling position
self.win.css({
- width: $(window).width() - self.zoomrestore.padding.w + "px",
- height: $(window).height() - self.zoomrestore.padding.h + "px"
+ width: $window.width() - self.zoomrestore.padding.w + "px",
+ height: $window.height() - self.zoomrestore.padding.h + "px"
});
self.onResize();
@@ -3279,9 +3376,7 @@
// Inspired by the work of Kin Blas
// http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js
-
-
- var ScrollMomentumClass2D = function(nc) {
+ var ScrollMomentumClass2D = function (nc) {
var self = this;
this.nc = nc;
@@ -3304,15 +3399,10 @@
this.timer = 0;
- this.time = function() {
- return +new Date(); //beautifull hack
- };
-
- this.reset = function(px, py) {
+ this.reset = function (px, py) {
self.stop();
- var now = self.time();
self.steptime = 0;
- self.lasttime = now;
+ self.lasttime = now();
self.speedx = 0;
self.speedy = 0;
self.lastx = px;
@@ -3321,10 +3411,10 @@
self.lastscrolly = -1;
};
- this.update = function(px, py) {
- var now = self.time();
- self.steptime = now - self.lasttime;
- self.lasttime = now;
+ this.update = function (px, py) {
+ var tm = now();
+ self.steptime = tm - self.lasttime;
+ self.lasttime = tm;
var dy = py - self.lasty;
var dx = px - self.lastx;
var sy = self.nc.getScrollTop();
@@ -3339,7 +3429,7 @@
self.lasty = py;
};
- this.stop = function() {
+ this.stop = function () {
self.nc.unsynched("domomentum2d");
if (self.timer) clearTimeout(self.timer);
self.timer = 0;
@@ -3347,7 +3437,7 @@
self.lastscrolly = -1;
};
- this.doSnapy = function(nx, ny) {
+ this.doSnapy = function (nx, ny) {
var snap = false;
if (ny < 0) {
@@ -3366,11 +3456,11 @@
snap = true;
}
- (snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed): self.nc.triggerScrollEnd();
+ (snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed) : self.nc.triggerScrollEnd();
};
- this.doMomentum = function(gp) {
- var t = self.time();
+ this.doMomentum = function (gp) {
+ var t = now();
var l = (gp) ? t + gp : self.lasttime;
var sl = self.nc.getScrollLeft();
@@ -3409,8 +3499,8 @@
var nx = self.lastscrollx;
var ny = self.lastscrolly;
- var onscroll = function() {
- var df = ((self.time() - t) > 600) ? 0.04 : 0.02;
+ var onscroll = function () {
+ var df = ((now() - t) > 600) ? 0.04 : 0.02;
if (self.speedx) {
nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy)));
@@ -3426,18 +3516,18 @@
self.demulxy = Math.min(1, self.demulxy + df);
- self.nc.synched("domomentum2d", function() {
+ self.nc.synched("domomentum2d", function () {
if (self.speedx) {
var scx = self.nc.getScrollLeft();
- if (scx != self.chkx) self.stop();
+ // if (scx != self.chkx) self.stop();
self.chkx = nx;
self.nc.setScrollLeft(nx);
}
if (self.speedy) {
var scy = self.nc.getScrollTop();
- if (scy != self.chky) self.stop();
+ // if (scy != self.chky) self.stop();
self.chky = ny;
self.nc.setScrollTop(ny);
}
@@ -3464,95 +3554,81 @@
self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop());
}
- }
+ };
};
// override jQuery scrollTop
-
var _scrollTop = jQuery.fn.scrollTop; // preserve original function
- jQuery.cssHooks["pageYOffset"] = {
- get: function(elem, computed, extra) {
+ jQuery.cssHooks.pageYOffset = {
+ get: function (elem, computed, extra) {
var nice = $.data(elem, '__nicescroll') || false;
return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
},
- set: function(elem, value) {
+ set: function (elem, value) {
var nice = $.data(elem, '__nicescroll') || false;
- (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call(elem, value);
+ (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem, value);
return this;
}
};
- /*
- $.fx.step["scrollTop"] = function(fx){
- $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
- };
-*/
-
- jQuery.fn.scrollTop = function(value) {
- if (typeof value == "undefined") {
+ jQuery.fn.scrollTop = function (value) {
+ if (value === undefined) {
var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
} else {
- return this.each(function() {
+ return this.each(function () {
var nice = $.data(this, '__nicescroll') || false;
- (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call($(this), value);
+ (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this), value);
});
}
};
// override jQuery scrollLeft
-
var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function
$.cssHooks.pageXOffset = {
- get: function(elem, computed, extra) {
+ get: function (elem, computed, extra) {
var nice = $.data(elem, '__nicescroll') || false;
return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
},
- set: function(elem, value) {
+ set: function (elem, value) {
var nice = $.data(elem, '__nicescroll') || false;
- (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call(elem, value);
+ (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem, value);
return this;
}
};
- /*
- $.fx.step["scrollLeft"] = function(fx){
- $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
- };
-*/
-
- jQuery.fn.scrollLeft = function(value) {
- if (typeof value == "undefined") {
+ jQuery.fn.scrollLeft = function (value) {
+ if (value === undefined) {
var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
} else {
- return this.each(function() {
+ return this.each(function () {
var nice = $.data(this, '__nicescroll') || false;
- (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call($(this), value);
+ (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this), value);
});
}
};
- var NiceScrollArray = function(doms) {
+ var NiceScrollArray = function (doms) {
var self = this;
this.length = 0;
this.name = "nicescrollarray";
- this.each = function(fn) {
- for (var a = 0, i = 0; a < self.length; a++) fn.call(self[a], i++);
+ this.each = function (fn) {
+ $.each(self, fn);
return self;
};
- this.push = function(nice) {
+ this.push = function (nice) {
self[self.length] = nice;
self.length++;
};
- this.eq = function(idx) {
+ this.eq = function (idx) {
return self[idx];
};
@@ -3563,75 +3639,76 @@
this[this.length] = nice;
this.length++;
}
- };
+ }
}
return this;
};
function mplex(el, lst, fn) {
- for (var a = 0; a < lst.length; a++) fn(el, lst[a]);
- };
+ for (var a = 0, l = lst.length; a < l; a++) fn(el, lst[a]);
+ }
mplex(
NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
- function(e, n) {
- e[n] = function() {
+ function (e, n) {
+ e[n] = function () {
var args = arguments;
- return this.each(function() {
+ return this.each(function () {
this[n].apply(this, args);
});
};
}
);
- jQuery.fn.getNiceScroll = function(index) {
- if (typeof index == "undefined") {
+ jQuery.fn.getNiceScroll = function (index) {
+ if (index === undefined) {
return new NiceScrollArray(this);
} else {
- var nice = this[index] && $.data(this[index], '__nicescroll') || false;
- return nice;
+ return this[index] && $.data(this[index], '__nicescroll') || false;
}
};
- jQuery.extend(jQuery.expr[':'], {
- nicescroll: function(a) {
- return ($.data(a, '__nicescroll')) ? true : false;
- }
- });
+ var pseudos = jQuery.expr.pseudos || jQuery.expr[':']; // jQuery 3 migration
+ pseudos.nicescroll = function (a) {
+ return $.data(a, '__nicescroll') !== undefined;
+ };
- $.fn.niceScroll = function(wrapper, opt) {
- if (typeof opt == "undefined") {
- if ((typeof wrapper == "object") && !("jquery" in wrapper)) {
- opt = wrapper;
- wrapper = false;
- }
+ $.fn.niceScroll = function (wrapper, _opt) {
+ if (_opt === undefined && typeof wrapper == "object" && !("jquery" in wrapper)) {
+ _opt = wrapper;
+ wrapper = false;
}
- opt = $.extend({},opt); // cloning
+
var ret = new NiceScrollArray();
- if (typeof opt == "undefined") opt = {};
- if (wrapper || false) {
- opt.doc = $(wrapper);
- opt.win = $(this);
- }
- var docundef = !("doc" in opt);
- if (!docundef && !("win" in opt)) opt.win = $(this);
+ this.each(function () {
+ var $this = $(this);
+
+ var opt = $.extend({}, _opt); // cloning
- this.each(function() {
- var nice = $(this).data('__nicescroll') || false;
+ if (wrapper || false) {
+ var wrp = $(wrapper);
+ opt.doc = (wrp.length > 1) ? $(wrapper, $this) : wrp;
+ opt.win = $this;
+ }
+ var docundef = !("doc" in opt);
+ if (!docundef && !("win" in opt)) opt.win = $this;
+
+ var nice = $this.data('__nicescroll') || false;
if (!nice) {
- opt.doc = (docundef) ? $(this) : opt.doc;
- nice = new NiceScrollClass(opt, $(this));
- $(this).data('__nicescroll', nice);
+ opt.doc = opt.doc || $this;
+ nice = new NiceScrollClass(opt, $this);
+ $this.data('__nicescroll', nice);
}
ret.push(nice);
});
- return (ret.length == 1) ? ret[0] : ret;
+
+ return (ret.length === 1) ? ret[0] : ret;
};
- window.NiceScroll = {
- getjQuery: function() {
- return jQuery
+ _win.NiceScroll = {
+ getjQuery: function () {
+ return jQuery;
}
};
@@ -3640,4 +3717,4 @@
$.nicescroll.options = _globaloptions;
}
-}));
+}));
\ No newline at end of file
diff --git a/app/assets/javascripts/jquery.nicescroll/jquery.nicescroll.min.js b/app/assets/javascripts/jquery.nicescroll/jquery.nicescroll.min.js
new file mode 100644
index 0000000..5ae63dd
--- /dev/null
+++ b/app/assets/javascripts/jquery.nicescroll/jquery.nicescroll.min.js
@@ -0,0 +1,2 @@
+/* jquery.nicescroll v3.7.6 InuYaksa - MIT - https://nicescroll.areaaperta.com */
+!function(e){"function"==typeof define&&define.amd?define(["jquery"],e):"object"==typeof exports?module.exports=e(require("jquery")):e(jQuery)}(function(e){"use strict";var o=!1,t=!1,r=0,i=2e3,s=0,n=e,l=document,a=window,c=n(a),d=[],u=a.requestAnimationFrame||a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||!1,h=a.cancelAnimationFrame||a.webkitCancelAnimationFrame||a.mozCancelAnimationFrame||!1;if(u)a.cancelAnimationFrame||(h=function(e){});else{var p=0;u=function(e,o){var t=(new Date).getTime(),r=Math.max(0,16-(t-p)),i=a.setTimeout(function(){e(t+r)},r);return p=t+r,i},h=function(e){a.clearTimeout(e)}}var m=a.MutationObserver||a.WebKitMutationObserver||!1,f=Date.now||function(){return(new Date).getTime()},g={zindex:"auto",cursoropacitymin:0,cursoropacitymax:1,cursorcolor:"#424242",cursorwidth:"6px",cursorborder:"1px solid #fff",cursorborderradius:"5px",scrollspeed:40,mousescrollstep:27,touchbehavior:!1,emulatetouch:!1,hwacceleration:!0,usetransition:!0,boxzoom:!1,dblclickzoom:!0,gesturezoom:!0,grabcursorenabled:!0,autohidemode:!0,background:"",iframeautoresize:!0,cursorminheight:32,preservenativescrolling:!0,railoffset:!1,railhoffset:!1,bouncescroll:!0,spacebarenabled:!0,railpadding:{top:0,right:0,left:0,bottom:0},disableoutline:!0,horizrailenabled:!0,railalign:"right",railvalign:"bottom",enabletranslate3d:!0,enablemousewheel:!0,enablekeyboard:!0,smoothscroll:!0,sensitiverail:!0,enablemouselockapi:!0,cursorfixedheight:!1,directionlockdeadzone:6,hidecursordelay:400,nativeparentscrolling:!0,enablescrollonselection:!0,overflowx:!0,overflowy:!0,cursordragspeed:.3,rtlmode:"auto",cursordragontouch:!1,oneaxismousemode:"auto",scriptpath:function(){var e=l.currentScript||function(){var e=l.getElementsByTagName("script");return!!e.length&&e[e.length-1]}(),o=e?e.src.split("?")[0]:"";return o.split("/").length>0?o.split("/").slice(0,-1).join("/")+"/":""}(),preventmultitouchscrolling:!0,disablemutationobserver:!1,enableobserver:!0,scrollbarid:!1},v=!1,w=function(){if(v)return v;var e=l.createElement("DIV"),o=e.style,t=navigator.userAgent,r=navigator.platform,i={};return i.haspointerlock="pointerLockElement"in l||"webkitPointerLockElement"in l||"mozPointerLockElement"in l,i.isopera="opera"in a,i.isopera12=i.isopera&&"getUserMedia"in navigator,i.isoperamini="[object OperaMini]"===Object.prototype.toString.call(a.operamini),i.isie="all"in l&&"attachEvent"in e&&!i.isopera,i.isieold=i.isie&&!("msInterpolationMode"in o),i.isie7=i.isie&&!i.isieold&&(!("documentMode"in l)||7===l.documentMode),i.isie8=i.isie&&"documentMode"in l&&8===l.documentMode,i.isie9=i.isie&&"performance"in a&&9===l.documentMode,i.isie10=i.isie&&"performance"in a&&10===l.documentMode,i.isie11="msRequestFullscreen"in e&&l.documentMode>=11,i.ismsedge="msCredentials"in a,i.ismozilla="MozAppearance"in o,i.iswebkit=!i.ismsedge&&"WebkitAppearance"in o,i.ischrome=i.iswebkit&&"chrome"in a,i.ischrome38=i.ischrome&&"touchAction"in o,i.ischrome22=!i.ischrome38&&i.ischrome&&i.haspointerlock,i.ischrome26=!i.ischrome38&&i.ischrome&&"transition"in o,i.cantouch="ontouchstart"in l.documentElement||"ontouchstart"in a,i.hasw3ctouch=(a.PointerEvent||!1)&&(navigator.maxTouchPoints>0||navigator.msMaxTouchPoints>0),i.hasmstouch=!i.hasw3ctouch&&(a.MSPointerEvent||!1),i.ismac=/^mac$/i.test(r),i.isios=i.cantouch&&/iphone|ipad|ipod/i.test(r),i.isios4=i.isios&&!("seal"in Object),i.isios7=i.isios&&"webkitHidden"in l,i.isios8=i.isios&&"hidden"in l,i.isios10=i.isios&&a.Proxy,i.isandroid=/android/i.test(t),i.haseventlistener="addEventListener"in e,i.trstyle=!1,i.hastransform=!1,i.hastranslate3d=!1,i.transitionstyle=!1,i.hastransition=!1,i.transitionend=!1,i.trstyle="transform",i.hastransform="transform"in o||function(){for(var e=["msTransform","webkitTransform","MozTransform","OTransform"],t=0,r=e.length;t<r;t++)if(void 0!==o[e[t]]){i.trstyle=e[t];break}i.hastransform=!!i.trstyle}(),i.hastransform&&(o[i.trstyle]="translate3d(1px,2px,3px)",i.hastranslate3d=/translate3d/.test(o[i.trstyle])),i.transitionstyle="transition",i.prefixstyle="",i.transitionend="transitionend",i.hastransition="transition"in o||function(){i.transitionend=!1;for(var e=["webkitTransition","msTransition","MozTransition","OTransition","OTransition","KhtmlTransition"],t=["-webkit-","-ms-","-moz-","-o-","-o","-khtml-"],r=["webkitTransitionEnd","msTransitionEnd","transitionend","otransitionend","oTransitionEnd","KhtmlTransitionEnd"],s=0,n=e.length;s<n;s++)if(e[s]in o){i.transitionstyle=e[s],i.prefixstyle=t[s],i.transitionend=r[s];break}i.ischrome26&&(i.prefixstyle=t[1]),i.hastransition=i.transitionstyle}(),i.cursorgrabvalue=function(){var e=["grab","-webkit-grab","-moz-grab"];(i.ischrome&&!i.ischrome38||i.isie)&&(e=[]);for(var t=0,r=e.length;t<r;t++){var s=e[t];if(o.cursor=s,o.cursor==s)return s}return"url(https://cdnjs.cloudflare.com/ajax/libs/slider-pro/1.3.0/css/images/openhand.cur),n-resize"}(),i.hasmousecapture="setCapture"in e,i.hasMutationObserver=!1!==m,e=null,v=i,i},b=function(e,p){function v(){var e=T.doc.css(P.trstyle);return!(!e||"matrix"!=e.substr(0,6))&&e.replace(/^.*\((.*)\)$/g,"$1").replace(/px/g,"").split(/, +/)}function b(){var e=T.win;if("zIndex"in e)return e.zIndex();for(;e.length>0;){if(9==e[0].nodeType)return!1;var o=e.css("zIndex");if(!isNaN(o)&&0!==o)return parseInt(o);e=e.parent()}return!1}function x(e,o,t){var r=e.css(o),i=parseFloat(r);if(isNaN(i)){var s=3==(i=I[r]||0)?t?T.win.outerHeight()-T.win.innerHeight():T.win.outerWidth()-T.win.innerWidth():1;return T.isie8&&i&&(i+=1),s?i:0}return i}function S(e,o,t,r){T._bind(e,o,function(r){var i={original:r=r||a.event,target:r.target||r.srcElement,type:"wheel",deltaMode:"MozMousePixelScroll"==r.type?0:1,deltaX:0,deltaZ:0,preventDefault:function(){return r.preventDefault?r.preventDefault():r.returnValue=!1,!1},stopImmediatePropagation:function(){r.stopImmediatePropagation?r.stopImmediatePropagation():r.cancelBubble=!0}};return"mousewheel"==o?(r.wheelDeltaX&&(i.deltaX=-.025*r.wheelDeltaX),r.wheelDeltaY&&(i.deltaY=-.025*r.wheelDeltaY),!i.deltaY&&!i.deltaX&&(i.deltaY=-.025*r.wheelDelta)):i.deltaY=r.detail,t.call(e,i)},r)}function z(e,o,t,r){T.scrollrunning||(T.newscrolly=T.getScrollTop(),T.newscrollx=T.getScrollLeft(),D=f());var i=f()-D;if(D=f(),i>350?A=1:A+=(2-A)/10,e=e*A|0,o=o*A|0,e){if(r)if(e<0){if(T.getScrollLeft()>=T.page.maxw)return!0}else if(T.getScrollLeft()<=0)return!0;var s=e>0?1:-1;X!==s&&(T.scrollmom&&T.scrollmom.stop(),T.newscrollx=T.getScrollLeft(),X=s),T.lastdeltax-=e}if(o){if(function(){var e=T.getScrollTop();if(o<0){if(e>=T.page.maxh)return!0}else if(e<=0)return!0}()){if(M.nativeparentscrolling&&t&&!T.ispage&&!T.zoomactive)return!0;var n=T.view.h>>1;T.newscrolly<-n?(T.newscrolly=-n,o=-1):T.newscrolly>T.page.maxh+n?(T.newscrolly=T.page.maxh+n,o=1):o=0}var l=o>0?1:-1;B!==l&&(T.scrollmom&&T.scrollmom.stop(),T.newscrolly=T.getScrollTop(),B=l),T.lastdeltay-=o}(o||e)&&T.synched("relativexy",function(){var e=T.lastdeltay+T.newscrolly;T.lastdeltay=0;var o=T.lastdeltax+T.newscrollx;T.lastdeltax=0,T.rail.drag||T.doScrollPos(o,e)})}function k(e,o,t){var r,i;return!(t||!q)||(0===e.deltaMode?(r=-e.deltaX*(M.mousescrollstep/54)|0,i=-e.deltaY*(M.mousescrollstep/54)|0):1===e.deltaMode&&(r=-e.deltaX*M.mousescrollstep*50/80|0,i=-e.deltaY*M.mousescrollstep*50/80|0),o&&M.oneaxismousemode&&0===r&&i&&(r=i,i=0,t&&(r<0?T.getScrollLeft()>=T.page.maxw:T.getScrollLeft()<=0)&&(i=r,r=0)),T.isrtlmode&&(r=-r),z(r,i,t,!0)?void(t&&(q=!0)):(q=!1,e.stopImmediatePropagation(),e.preventDefault()))}var T=this;this.version="3.7.6",this.name="nicescroll",this.me=p;var E=n("body"),M=this.opt={doc:E,win:!1};if(n.extend(M,g),M.snapbackspeed=80,e)for(var L in M)void 0!==e[L]&&(M[L]=e[L]);if(M.disablemutationobserver&&(m=!1),this.doc=M.doc,this.iddoc=this.doc&&this.doc[0]?this.doc[0].id||"":"",this.ispage=/^BODY|HTML/.test(M.win?M.win[0].nodeName:this.doc[0].nodeName),this.haswrapper=!1!==M.win,this.win=M.win||(this.ispage?c:this.doc),this.docscroll=this.ispage&&!this.haswrapper?c:this.win,this.body=E,this.viewport=!1,this.isfixed=!1,this.iframe=!1,this.isiframe="IFRAME"==this.doc[0].nodeName&&"IFRAME"==this.win[0].nodeName,this.istextarea="TEXTAREA"==this.win[0].nodeName,this.forcescreen=!1,this.canshowonmouseevent="scroll"!=M.autohidemode,this.onmousedown=!1,this.onmouseup=!1,this.onmousemove=!1,this.onmousewheel=!1,this.onkeypress=!1,this.ongesturezoom=!1,this.onclick=!1,this.onscrollstart=!1,this.onscrollend=!1,this.onscrollcancel=!1,this.onzoomin=!1,this.onzoomout=!1,this.view=!1,this.page=!1,this.scroll={x:0,y:0},this.scrollratio={x:0,y:0},this.cursorheight=20,this.scrollvaluemax=0,"auto"==M.rtlmode){var C=this.win[0]==a?this.body:this.win,N=C.css("writing-mode")||C.css("-webkit-writing-mode")||C.css("-ms-writing-mode")||C.css("-moz-writing-mode");"horizontal-tb"==N||"lr-tb"==N||""===N?(this.isrtlmode="rtl"==C.css("direction"),this.isvertical=!1):(this.isrtlmode="vertical-rl"==N||"tb"==N||"tb-rl"==N||"rl-tb"==N,this.isvertical="vertical-rl"==N||"tb"==N||"tb-rl"==N)}else this.isrtlmode=!0===M.rtlmode,this.isvertical=!1;if(this.scrollrunning=!1,this.scrollmom=!1,this.observer=!1,this.observerremover=!1,this.observerbody=!1,!1!==M.scrollbarid)this.id=M.scrollbarid;else do{this.id="ascrail"+i++}while(l.getElementById(this.id));this.rail=!1,this.cursor=!1,this.cursorfreezed=!1,this.selectiondrag=!1,this.zoom=!1,this.zoomactive=!1,this.hasfocus=!1,this.hasmousefocus=!1,this.railslocked=!1,this.locked=!1,this.hidden=!1,this.cursoractive=!0,this.wheelprevented=!1,this.overflowx=M.overflowx,this.overflowy=M.overflowy,this.nativescrollingarea=!1,this.checkarea=0,this.events=[],this.saved={},this.delaylist={},this.synclist={},this.lastdeltax=0,this.lastdeltay=0,this.detected=w();var P=n.extend({},this.detected);this.canhwscroll=P.hastransform&&M.hwacceleration,this.ishwscroll=this.canhwscroll&&T.haswrapper,this.isrtlmode?this.isvertical?this.hasreversehr=!(P.iswebkit||P.isie||P.isie11):this.hasreversehr=!(P.iswebkit||P.isie&&!P.isie10&&!P.isie11):this.hasreversehr=!1,this.istouchcapable=!1,P.cantouch||!P.hasw3ctouch&&!P.hasmstouch?!P.cantouch||P.isios||P.isandroid||!P.iswebkit&&!P.ismozilla||(this.istouchcapable=!0):this.istouchcapable=!0,M.enablemouselockapi||(P.hasmousecapture=!1,P.haspointerlock=!1),this.debounced=function(e,o,t){T&&(T.delaylist[e]||!1||(T.delaylist[e]={h:u(function(){T.delaylist[e].fn.call(T),T.delaylist[e]=!1},t)},o.call(T)),T.delaylist[e].fn=o)},this.synched=function(e,o){T.synclist[e]?T.synclist[e]=o:(T.synclist[e]=o,u(function(){T&&(T.synclist[e]&&T.synclist[e].call(T),T.synclist[e]=null)}))},this.unsynched=function(e){T.synclist[e]&&(T.synclist[e]=!1)},this.css=function(e,o){for(var t in o)T.saved.css.push([e,t,e.css(t)]),e.css(t,o[t])},this.scrollTop=function(e){return void 0===e?T.getScrollTop():T.setScrollTop(e)},this.scrollLeft=function(e){return void 0===e?T.getScrollLeft():T.setScrollLeft(e)};var R=function(e,o,t,r,i,s,n){this.st=e,this.ed=o,this.spd=t,this.p1=r||0,this.p2=i||1,this.p3=s||0,this.p4=n||1,this.ts=f(),this.df=o-e};if(R.prototype={B2:function(e){return 3*(1-e)*(1-e)*e},B3:function(e){return 3*(1-e)*e*e},B4:function(e){return e*e*e},getPos:function(){return(f()-this.ts)/this.spd},getNow:function(){var e=(f()-this.ts)/this.spd,o=this.B2(e)+this.B3(e)+this.B4(e);return e>=1?this.ed:this.st+this.df*o|0},update:function(e,o){return this.st=this.getNow(),this.ed=e,this.spd=o,this.ts=f(),this.df=this.ed-this.st,this}},this.ishwscroll){this.doc.translate={x:0,y:0,tx:"0px",ty:"0px"},P.hastranslate3d&&P.isios&&this.doc.css("-webkit-backface-visibility","hidden"),this.getScrollTop=function(e){if(!e){var o=v();if(o)return 16==o.length?-o[13]:-o[5];if(T.timerscroll&&T.timerscroll.bz)return T.timerscroll.bz.getNow()}return T.doc.translate.y},this.getScrollLeft=function(e){if(!e){var o=v();if(o)return 16==o.length?-o[12]:-o[4];if(T.timerscroll&&T.timerscroll.bh)return T.timerscroll.bh.getNow()}return T.doc.translate.x},this.notifyScrollEvent=function(e){var o=l.createEvent("UIEvents");o.initUIEvent("scroll",!1,!1,a,1),o.niceevent=!0,e.dispatchEvent(o)};var _=this.isrtlmode?1:-1;P.hastranslate3d&&M.enabletranslate3d?(this.setScrollTop=function(e,o){T.doc.translate.y=e,T.doc.translate.ty=-1*e+"px",T.doc.css(P.trstyle,"translate3d("+T.doc.translate.tx+","+T.doc.translate.ty+",0)"),o||T.notifyScrollEvent(T.win[0])},this.setScrollLeft=function(e,o){T.doc.translate.x=e,T.doc.translate.tx=e*_+"px",T.doc.css(P.trstyle,"translate3d("+T.doc.translate.tx+","+T.doc.translate.ty+",0)"),o||T.notifyScrollEvent(T.win[0])}):(this.setScrollTop=function(e,o){T.doc.translate.y=e,T.doc.translate.ty=-1*e+"px",T.doc.css(P.trstyle,"translate("+T.doc.translate.tx+","+T.doc.translate.ty+")"),o||T.notifyScrollEvent(T.win[0])},this.setScrollLeft=function(e,o){T.doc.translate.x=e,T.doc.translate.tx=e*_+"px",T.doc.css(P.trstyle,"translate("+T.doc.translate.tx+","+T.doc.translate.ty+")"),o||T.notifyScrollEvent(T.win[0])})}else this.getScrollTop=function(){return T.docscroll.scrollTop()},this.setScrollTop=function(e){T.docscroll.scrollTop(e)},this.getScrollLeft=function(){return T.hasreversehr?T.detected.ismozilla?T.page.maxw-Math.abs(T.docscroll.scrollLeft()):T.page.maxw-T.docscroll.scrollLeft():T.docscroll.scrollLeft()},this.setScrollLeft=function(e){return setTimeout(function(){if(T)return T.hasreversehr&&(e=T.detected.ismozilla?-(T.page.maxw-e):T.page.maxw-e),T.docscroll.scrollLeft(e)},1)};this.getTarget=function(e){return!!e&&(e.target?e.target:!!e.srcElement&&e.srcElement)},this.hasParent=function(e,o){if(!e)return!1;for(var t=e.target||e.srcElement||e||!1;t&&t.id!=o;)t=t.parentNode||!1;return!1!==t};var I={thin:1,medium:3,thick:5};this.getDocumentScrollOffset=function(){return{top:a.pageYOffset||l.documentElement.scrollTop,left:a.pageXOffset||l.documentElement.scrollLeft}},this.getOffset=function(){if(T.isfixed){var e=T.win.offset(),o=T.getDocumentScrollOffset();return e.top-=o.top,e.left-=o.left,e}var t=T.win.offset();if(!T.viewport)return t;var r=T.viewport.offset();return{top:t.top-r.top,left:t.left-r.left}},this.updateScrollBar=function(e){var o,t;if(T.ishwscroll)T.rail.css({height:T.win.innerHeight()-(M.railpadding.top+M.railpadding.bottom)}),T.railh&&T.railh.css({width:T.win.innerWidth()-(M.railpadding.left+M.railpadding.right)});else{var r=T.getOffset();if(o={top:r.top,left:r.left-(M.railpadding.left+M.railpadding.right)},o.top+=x(T.win,"border-top-width",!0),o.left+=T.rail.align?T.win.outerWidth()-x(T.win,"border-right-width")-T.rail.width:x(T.win,"border-left-width"),(t=M.railoffset)&&(t.top&&(o.top+=t.top),t.left&&(o.left+=t.left)),T.railslocked||T.rail.css({top:o.top,left:o.left,height:(e?e.h:T.win.innerHeight())-(M.railpadding.top+M.railpadding.bottom)}),T.zoom&&T.zoom.css({top:o.top+1,left:1==T.rail.align?o.left-20:o.left+T.rail.width+4}),T.railh&&!T.railslocked){o={top:r.top,left:r.left},(t=M.railhoffset)&&(t.top&&(o.top+=t.top),t.left&&(o.left+=t.left));var i=T.railh.align?o.top+x(T.win,"border-top-width",!0)+T.win.innerHeight()-T.railh.height:o.top+x(T.win,"border-top-width",!0),s=o.left+x(T.win,"border-left-width");T.railh.css({top:i-(M.railpadding.top+M.railpadding.bottom),left:s,width:T.railh.width})}}},this.doRailClick=function(e,o,t){var r,i,s,n;T.railslocked||(T.cancelEvent(e),"pageY"in e||(e.pageX=e.clientX+l.documentElement.scrollLeft,e.pageY=e.clientY+l.documentElement.scrollTop),o?(r=t?T.doScrollLeft:T.doScrollTop,s=t?(e.pageX-T.railh.offset().left-T.cursorwidth/2)*T.scrollratio.x:(e.pageY-T.rail.offset().top-T.cursorheight/2)*T.scrollratio.y,T.unsynched("relativexy"),r(0|s)):(r=t?T.doScrollLeftBy:T.doScrollBy,s=t?T.scroll.x:T.scroll.y,n=t?e.pageX-T.railh.offset().left:e.pageY-T.rail.offset().top,i=t?T.view.w:T.view.h,r(s>=n?i:-i)))},T.newscrolly=T.newscrollx=0,T.hasanimationframe="requestAnimationFrame"in a,T.hascancelanimationframe="cancelAnimationFrame"in a,T.hasborderbox=!1,this.init=function(){if(T.saved.css=[],P.isoperamini)return!0;if(P.isandroid&&!("hidden"in l))return!0;M.emulatetouch=M.emulatetouch||M.touchbehavior,T.hasborderbox=a.getComputedStyle&&"border-box"===a.getComputedStyle(l.body)["box-sizing"];var e={"overflow-y":"hidden"};if((P.isie11||P.isie10)&&(e["-ms-overflow-style"]="none"),T.ishwscroll&&(this.doc.css(P.transitionstyle,P.prefixstyle+"transform 0ms ease-out"),P.transitionend&&T.bind(T.doc,P.transitionend,T.onScrollTransitionEnd,!1)),T.zindex="auto",T.ispage||"auto"!=M.zindex?T.zindex=M.zindex:T.zindex=b()||"auto",!T.ispage&&"auto"!=T.zindex&&T.zindex>s&&(s=T.zindex),T.isie&&0===T.zindex&&"auto"==M.zindex&&(T.zindex="auto"),!T.ispage||!P.isieold){var i=T.docscroll;T.ispage&&(i=T.haswrapper?T.win:T.doc),T.css(i,e),T.ispage&&(P.isie11||P.isie)&&T.css(n("html"),e),!P.isios||T.ispage||T.haswrapper||T.css(E,{"-webkit-overflow-scrolling":"touch"});var d=n(l.createElement("div"));d.css({position:"relative",top:0,float:"right",width:M.cursorwidth,height:0,"background-color":M.cursorcolor,border:M.cursorborder,"background-clip":"padding-box","-webkit-border-radius":M.cursorborderradius,"-moz-border-radius":M.cursorborderradius,"border-radius":M.cursorborderradius}),d.addClass("nicescroll-cursors"),T.cursor=d;var u=n(l.createElement("div"));u.attr("id",T.id),u.addClass("nicescroll-rails nicescroll-rails-vr");var h,p,f=["left","right","top","bottom"];for(var g in f)p=f[g],(h=M.railpadding[p]||0)&&u.css("padding-"+p,h+"px");u.append(d),u.width=Math.max(parseFloat(M.cursorwidth),d.outerWidth()),u.css({width:u.width+"px",zIndex:T.zindex,background:M.background,cursor:"default"}),u.visibility=!0,u.scrollable=!0,u.align="left"==M.railalign?0:1,T.rail=u,T.rail.drag=!1;var v=!1;!M.boxzoom||T.ispage||P.isieold||(v=l.createElement("div"),T.bind(v,"click",T.doZoom),T.bind(v,"mouseenter",function(){T.zoom.css("opacity",M.cursoropacitymax)}),T.bind(v,"mouseleave",function(){T.zoom.css("opacity",M.cursoropacitymin)}),T.zoom=n(v),T.zoom.css({cursor:"pointer",zIndex:T.zindex,backgroundImage:"url("+M.scriptpath+"zoomico.png)",height:18,width:18,backgroundPosition:"0 0"}),M.dblclickzoom&&T.bind(T.win,"dblclick",T.doZoom),P.cantouch&&M.gesturezoom&&(T.ongesturezoom=function(e){return e.scale>1.5&&T.doZoomIn(e),e.scale<.8&&T.doZoomOut(e),T.cancelEvent(e)},T.bind(T.win,"gestureend",T.ongesturezoom))),T.railh=!1;var w;if(M.horizrailenabled&&(T.css(i,{overflowX:"hidden"}),(d=n(l.createElement("div"))).css({position:"absolute",top:0,height:M.cursorwidth,width:0,backgroundColor:M.cursorcolor,border:M.cursorborder,backgroundClip:"padding-box","-webkit-border-radius":M.cursorborderradius,"-moz-border-radius":M.cursorborderradius,"border-radius":M.cursorborderradius}),P.isieold&&d.css("overflow","hidden"),d.addClass("nicescroll-cursors"),T.cursorh=d,(w=n(l.createElement("div"))).attr("id",T.id+"-hr"),w.addClass("nicescroll-rails nicescroll-rails-hr"),w.height=Math.max(parseFloat(M.cursorwidth),d.outerHeight()),w.css({height:w.height+"px",zIndex:T.zindex,background:M.background}),w.append(d),w.visibility=!0,w.scrollable=!0,w.align="top"==M.railvalign?0:1,T.railh=w,T.railh.drag=!1),T.ispage)u.css({position:"fixed",top:0,height:"100%"}),u.css(u.align?{right:0}:{left:0}),T.body.append(u),T.railh&&(w.css({position:"fixed",left:0,width:"100%"}),w.css(w.align?{bottom:0}:{top:0}),T.body.append(w));else{if(T.ishwscroll){"static"==T.win.css("position")&&T.css(T.win,{position:"relative"});var x="HTML"==T.win[0].nodeName?T.body:T.win;n(x).scrollTop(0).scrollLeft(0),T.zoom&&(T.zoom.css({position:"absolute",top:1,right:0,"margin-right":u.width+4}),x.append(T.zoom)),u.css({position:"absolute",top:0}),u.css(u.align?{right:0}:{left:0}),x.append(u),w&&(w.css({position:"absolute",left:0,bottom:0}),w.css(w.align?{bottom:0}:{top:0}),x.append(w))}else{T.isfixed="fixed"==T.win.css("position");var S=T.isfixed?"fixed":"absolute";T.isfixed||(T.viewport=T.getViewport(T.win[0])),T.viewport&&(T.body=T.viewport,/fixed|absolute/.test(T.viewport.css("position"))||T.css(T.viewport,{position:"relative"})),u.css({position:S}),T.zoom&&T.zoom.css({position:S}),T.updateScrollBar(),T.body.append(u),T.zoom&&T.body.append(T.zoom),T.railh&&(w.css({position:S}),T.body.append(w))}P.isios&&T.css(T.win,{"-webkit-tap-highlight-color":"rgba(0,0,0,0)","-webkit-touch-callout":"none"}),M.disableoutline&&(P.isie&&T.win.attr("hideFocus","true"),P.iswebkit&&T.win.css("outline","none"))}if(!1===M.autohidemode?(T.autohidedom=!1,T.rail.css({opacity:M.cursoropacitymax}),T.railh&&T.railh.css({opacity:M.cursoropacitymax})):!0===M.autohidemode||"leave"===M.autohidemode?(T.autohidedom=n().add(T.rail),P.isie8&&(T.autohidedom=T.autohidedom.add(T.cursor)),T.railh&&(T.autohidedom=T.autohidedom.add(T.railh)),T.railh&&P.isie8&&(T.autohidedom=T.autohidedom.add(T.cursorh))):"scroll"==M.autohidemode?(T.autohidedom=n().add(T.rail),T.railh&&(T.autohidedom=T.autohidedom.add(T.railh))):"cursor"==M.autohidemode?(T.autohidedom=n().add(T.cursor),T.railh&&(T.autohidedom=T.autohidedom.add(T.cursorh))):"hidden"==M.autohidemode&&(T.autohidedom=!1,T.hide(),T.railslocked=!1),P.cantouch||T.istouchcapable||M.emulatetouch||P.hasmstouch){T.scrollmom=new y(T);T.ontouchstart=function(e){if(T.locked)return!1;if(e.pointerType&&("mouse"===e.pointerType||e.pointerType===e.MSPOINTER_TYPE_MOUSE))return!1;if(T.hasmoving=!1,T.scrollmom.timer&&(T.triggerScrollEnd(),T.scrollmom.stop()),!T.railslocked){var o=T.getTarget(e);if(o&&/INPUT/i.test(o.nodeName)&&/range/i.test(o.type))return T.stopPropagation(e);var t="mousedown"===e.type;if(!("clientX"in e)&&"changedTouches"in e&&(e.clientX=e.changedTouches[0].clientX,e.clientY=e.changedTouches[0].clientY),T.forcescreen){var r=e;(e={original:e.original?e.original:e}).clientX=r.screenX,e.clientY=r.screenY}if(T.rail.drag={x:e.clientX,y:e.clientY,sx:T.scroll.x,sy:T.scroll.y,st:T.getScrollTop(),sl:T.getScrollLeft(),pt:2,dl:!1,tg:o},T.ispage||!M.directionlockdeadzone)T.rail.drag.dl="f";else{var i={w:c.width(),h:c.height()},s=T.getContentSize(),l=s.h-i.h,a=s.w-i.w;T.rail.scrollable&&!T.railh.scrollable?T.rail.drag.ck=l>0&&"v":!T.rail.scrollable&&T.railh.scrollable?T.rail.drag.ck=a>0&&"h":T.rail.drag.ck=!1}if(M.emulatetouch&&T.isiframe&&P.isie){var d=T.win.position();T.rail.drag.x+=d.left,T.rail.drag.y+=d.top}if(T.hasmoving=!1,T.lastmouseup=!1,T.scrollmom.reset(e.clientX,e.clientY),o&&t){if(!/INPUT|SELECT|BUTTON|TEXTAREA/i.test(o.nodeName))return P.hasmousecapture&&o.setCapture(),M.emulatetouch?(o.onclick&&!o._onclick&&(o._onclick=o.onclick,o.onclick=function(e){if(T.hasmoving)return!1;o._onclick.call(this,e)}),T.cancelEvent(e)):T.stopPropagation(e);/SUBMIT|CANCEL|BUTTON/i.test(n(o).attr("type"))&&(T.preventclick={tg:o,click:!1})}}},T.ontouchend=function(e){if(!T.rail.drag)return!0;if(2==T.rail.drag.pt){if(e.pointerType&&("mouse"===e.pointerType||e.pointerType===e.MSPOINTER_TYPE_MOUSE))return!1;T.rail.drag=!1;var o="mouseup"===e.type;if(T.hasmoving&&(T.scrollmom.doMomentum(),T.lastmouseup=!0,T.hideCursor(),P.hasmousecapture&&l.releaseCapture(),o))return T.cancelEvent(e)}else if(1==T.rail.drag.pt)return T.onmouseup(e)};var z=M.emulatetouch&&T.isiframe&&!P.hasmousecapture,k=.3*M.directionlockdeadzone|0;T.ontouchmove=function(e,o){if(!T.rail.drag)return!0;if(e.targetTouches&&M.preventmultitouchscrolling&&e.targetTouches.length>1)return!0;if(e.pointerType&&("mouse"===e.pointerType||e.pointerType===e.MSPOINTER_TYPE_MOUSE))return!0;if(2==T.rail.drag.pt){"changedTouches"in e&&(e.clientX=e.changedTouches[0].clientX,e.clientY=e.changedTouches[0].clientY);var t,r;if(r=t=0,z&&!o){var i=T.win.position();r=-i.left,t=-i.top}var s=e.clientY+t,n=s-T.rail.drag.y,a=e.clientX+r,c=a-T.rail.drag.x,d=T.rail.drag.st-n;if(T.ishwscroll&&M.bouncescroll)d<0?d=Math.round(d/2):d>T.page.maxh&&(d=T.page.maxh+Math.round((d-T.page.maxh)/2));else if(d<0?(d=0,s=0):d>T.page.maxh&&(d=T.page.maxh,s=0),0===s&&!T.hasmoving)return T.ispage||(T.rail.drag=!1),!0;var u=T.getScrollLeft();if(T.railh&&T.railh.scrollable&&(u=T.isrtlmode?c-T.rail.drag.sl:T.rail.drag.sl-c,T.ishwscroll&&M.bouncescroll?u<0?u=Math.round(u/2):u>T.page.maxw&&(u=T.page.maxw+Math.round((u-T.page.maxw)/2)):(u<0&&(u=0,a=0),u>T.page.maxw&&(u=T.page.maxw,a=0))),!T.hasmoving){if(T.rail.drag.y===e.clientY&&T.rail.drag.x===e.clientX)return T.cancelEvent(e);var h=Math.abs(n),p=Math.abs(c),m=M.directionlockdeadzone;if(T.rail.drag.ck?"v"==T.rail.drag.ck?p>m&&h<=k?T.rail.drag=!1:h>m&&(T.rail.drag.dl="v"):"h"==T.rail.drag.ck&&(h>m&&p<=k?T.rail.drag=!1:p>m&&(T.rail.drag.dl="h")):h>m&&p>m?T.rail.drag.dl="f":h>m?T.rail.drag.dl=p>k?"f":"v":p>m&&(T.rail.drag.dl=h>k?"f":"h"),!T.rail.drag.dl)return T.cancelEvent(e);T.triggerScrollStart(e.clientX,e.clientY,0,0,0),T.hasmoving=!0}return T.preventclick&&!T.preventclick.click&&(T.preventclick.click=T.preventclick.tg.onclick||!1,T.preventclick.tg.onclick=T.onpreventclick),T.rail.drag.dl&&("v"==T.rail.drag.dl?u=T.rail.drag.sl:"h"==T.rail.drag.dl&&(d=T.rail.drag.st)),T.synched("touchmove",function(){T.rail.drag&&2==T.rail.drag.pt&&(T.prepareTransition&&T.resetTransition(),T.rail.scrollable&&T.setScrollTop(d),T.scrollmom.update(a,s),T.railh&&T.railh.scrollable?(T.setScrollLeft(u),T.showCursor(d,u)):T.showCursor(d),P.isie10&&l.selection.clear())}),T.cancelEvent(e)}return 1==T.rail.drag.pt?T.onmousemove(e):void 0},T.ontouchstartCursor=function(e,o){if(!T.rail.drag||3==T.rail.drag.pt){if(T.locked)return T.cancelEvent(e);T.cancelScroll(),T.rail.drag={x:e.touches[0].clientX,y:e.touches[0].clientY,sx:T.scroll.x,sy:T.scroll.y,pt:3,hr:!!o};var t=T.getTarget(e);return!T.ispage&&P.hasmousecapture&&t.setCapture(),T.isiframe&&!P.hasmousecapture&&(T.saved.csspointerevents=T.doc.css("pointer-events"),T.css(T.doc,{"pointer-events":"none"})),T.cancelEvent(e)}},T.ontouchendCursor=function(e){if(T.rail.drag){if(P.hasmousecapture&&l.releaseCapture(),T.isiframe&&!P.hasmousecapture&&T.doc.css("pointer-events",T.saved.csspointerevents),3!=T.rail.drag.pt)return;return T.rail.drag=!1,T.cancelEvent(e)}},T.ontouchmoveCursor=function(e){if(T.rail.drag){if(3!=T.rail.drag.pt)return;if(T.cursorfreezed=!0,T.rail.drag.hr){T.scroll.x=T.rail.drag.sx+(e.touches[0].clientX-T.rail.drag.x),T.scroll.x<0&&(T.scroll.x=0);var o=T.scrollvaluemaxw;T.scroll.x>o&&(T.scroll.x=o)}else{T.scroll.y=T.rail.drag.sy+(e.touches[0].clientY-T.rail.drag.y),T.scroll.y<0&&(T.scroll.y=0);var t=T.scrollvaluemax;T.scroll.y>t&&(T.scroll.y=t)}return T.synched("touchmove",function(){T.rail.drag&&3==T.rail.drag.pt&&(T.showCursor(),T.rail.drag.hr?T.doScrollLeft(Math.round(T.scroll.x*T.scrollratio.x),M.cursordragspeed):T.doScrollTop(Math.round(T.scroll.y*T.scrollratio.y),M.cursordragspeed))}),T.cancelEvent(e)}}}if(T.onmousedown=function(e,o){if(!T.rail.drag||1==T.rail.drag.pt){if(T.railslocked)return T.cancelEvent(e);T.cancelScroll(),T.rail.drag={x:e.clientX,y:e.clientY,sx:T.scroll.x,sy:T.scroll.y,pt:1,hr:o||!1};var t=T.getTarget(e);return P.hasmousecapture&&t.setCapture(),T.isiframe&&!P.hasmousecapture&&(T.saved.csspointerevents=T.doc.css("pointer-events"),T.css(T.doc,{"pointer-events":"none"})),T.hasmoving=!1,T.cancelEvent(e)}},T.onmouseup=function(e){if(T.rail.drag)return 1!=T.rail.drag.pt||(P.hasmousecapture&&l.releaseCapture(),T.isiframe&&!P.hasmousecapture&&T.doc.css("pointer-events",T.saved.csspointerevents),T.rail.drag=!1,T.cursorfreezed=!1,T.hasmoving&&T.triggerScrollEnd(),T.cancelEvent(e))},T.onmousemove=function(e){if(T.rail.drag){if(1!==T.rail.drag.pt)return;if(P.ischrome&&0===e.which)return T.onmouseup(e);if(T.cursorfreezed=!0,T.hasmoving||T.triggerScrollStart(e.clientX,e.clientY,0,0,0),T.hasmoving=!0,T.rail.drag.hr){T.scroll.x=T.rail.drag.sx+(e.clientX-T.rail.drag.x),T.scroll.x<0&&(T.scroll.x=0);var o=T.scrollvaluemaxw;T.scroll.x>o&&(T.scroll.x=o)}else{T.scroll.y=T.rail.drag.sy+(e.clientY-T.rail.drag.y),T.scroll.y<0&&(T.scroll.y=0);var t=T.scrollvaluemax;T.scroll.y>t&&(T.scroll.y=t)}return T.synched("mousemove",function(){T.cursorfreezed&&(T.showCursor(),T.rail.drag.hr?T.scrollLeft(Math.round(T.scroll.x*T.scrollratio.x)):T.scrollTop(Math.round(T.scroll.y*T.scrollratio.y)))}),T.cancelEvent(e)}T.checkarea=0},P.cantouch||M.emulatetouch)T.onpreventclick=function(e){if(T.preventclick)return T.preventclick.tg.onclick=T.preventclick.click,T.preventclick=!1,T.cancelEvent(e)},T.onclick=!P.isios&&function(e){return!T.lastmouseup||(T.lastmouseup=!1,T.cancelEvent(e))},M.grabcursorenabled&&P.cursorgrabvalue&&(T.css(T.ispage?T.doc:T.win,{cursor:P.cursorgrabvalue}),T.css(T.rail,{cursor:P.cursorgrabvalue}));else{var L=function(e){if(T.selectiondrag){if(e){var o=T.win.outerHeight(),t=e.pageY-T.selectiondrag.top;t>0&&t<o&&(t=0),t>=o&&(t-=o),T.selectiondrag.df=t}if(0!==T.selectiondrag.df){var r=-2*T.selectiondrag.df/6|0;T.doScrollBy(r),T.debounced("doselectionscroll",function(){L()},50)}}};T.hasTextSelected="getSelection"in l?function(){return l.getSelection().rangeCount>0}:"selection"in l?function(){return"None"!=l.selection.type}:function(){return!1},T.onselectionstart=function(e){T.ispage||(T.selectiondrag=T.win.offset())},T.onselectionend=function(e){T.selectiondrag=!1},T.onselectiondrag=function(e){T.selectiondrag&&T.hasTextSelected()&&T.debounced("selectionscroll",function(){L(e)},250)}}if(P.hasw3ctouch?(T.css(T.ispage?n("html"):T.win,{"touch-action":"none"}),T.css(T.rail,{"touch-action":"none"}),T.css(T.cursor,{"touch-action":"none"}),T.bind(T.win,"pointerdown",T.ontouchstart),T.bind(l,"pointerup",T.ontouchend),T.delegate(l,"pointermove",T.ontouchmove)):P.hasmstouch?(T.css(T.ispage?n("html"):T.win,{"-ms-touch-action":"none"}),T.css(T.rail,{"-ms-touch-action":"none"}),T.css(T.cursor,{"-ms-touch-action":"none"}),T.bind(T.win,"MSPointerDown",T.ontouchstart),T.bind(l,"MSPointerUp",T.ontouchend),T.delegate(l,"MSPointerMove",T.ontouchmove),T.bind(T.cursor,"MSGestureHold",function(e){e.preventDefault()}),T.bind(T.cursor,"contextmenu",function(e){e.preventDefault()})):P.cantouch&&(T.bind(T.win,"touchstart",T.ontouchstart,!1,!0),T.bind(l,"touchend",T.ontouchend,!1,!0),T.bind(l,"touchcancel",T.ontouchend,!1,!0),T.delegate(l,"touchmove",T.ontouchmove,!1,!0)),M.emulatetouch&&(T.bind(T.win,"mousedown",T.ontouchstart,!1,!0),T.bind(l,"mouseup",T.ontouchend,!1,!0),T.bind(l,"mousemove",T.ontouchmove,!1,!0)),(M.cursordragontouch||!P.cantouch&&!M.emulatetouch)&&(T.rail.css({cursor:"default"}),T.railh&&T.railh.css({cursor:"default"}),T.jqbind(T.rail,"mouseenter",function(){if(!T.ispage&&!T.win.is(":visible"))return!1;T.canshowonmouseevent&&T.showCursor(),T.rail.active=!0}),T.jqbind(T.rail,"mouseleave",function(){T.rail.active=!1,T.rail.drag||T.hideCursor()}),M.sensitiverail&&(T.bind(T.rail,"click",function(e){T.doRailClick(e,!1,!1)}),T.bind(T.rail,"dblclick",function(e){T.doRailClick(e,!0,!1)}),T.bind(T.cursor,"click",function(e){T.cancelEvent(e)}),T.bind(T.cursor,"dblclick",function(e){T.cancelEvent(e)})),T.railh&&(T.jqbind(T.railh,"mouseenter",function(){if(!T.ispage&&!T.win.is(":visible"))return!1;T.canshowonmouseevent&&T.showCursor(),T.rail.active=!0}),T.jqbind(T.railh,"mouseleave",function(){T.rail.active=!1,T.rail.drag||T.hideCursor()}),M.sensitiverail&&(T.bind(T.railh,"click",function(e){T.doRailClick(e,!1,!0)}),T.bind(T.railh,"dblclick",function(e){T.doRailClick(e,!0,!0)}),T.bind(T.cursorh,"click",function(e){T.cancelEvent(e)}),T.bind(T.cursorh,"dblclick",function(e){T.cancelEvent(e)})))),M.cursordragontouch&&(this.istouchcapable||P.cantouch)&&(T.bind(T.cursor,"touchstart",T.ontouchstartCursor),T.bind(T.cursor,"touchmove",T.ontouchmoveCursor),T.bind(T.cursor,"touchend",T.ontouchendCursor),T.cursorh&&T.bind(T.cursorh,"touchstart",function(e){T.ontouchstartCursor(e,!0)}),T.cursorh&&T.bind(T.cursorh,"touchmove",T.ontouchmoveCursor),T.cursorh&&T.bind(T.cursorh,"touchend",T.ontouchendCursor)),M.emulatetouch||P.isandroid||P.isios?(T.bind(P.hasmousecapture?T.win:l,"mouseup",T.ontouchend),T.onclick&&T.bind(l,"click",T.onclick),M.cursordragontouch?(T.bind(T.cursor,"mousedown",T.onmousedown),T.bind(T.cursor,"mouseup",T.onmouseup),T.cursorh&&T.bind(T.cursorh,"mousedown",function(e){T.onmousedown(e,!0)}),T.cursorh&&T.bind(T.cursorh,"mouseup",T.onmouseup)):(T.bind(T.rail,"mousedown",function(e){e.preventDefault()}),T.railh&&T.bind(T.railh,"mousedown",function(e){e.preventDefault()}))):(T.bind(P.hasmousecapture?T.win:l,"mouseup",T.onmouseup),T.bind(l,"mousemove",T.onmousemove),T.onclick&&T.bind(l,"click",T.onclick),T.bind(T.cursor,"mousedown",T.onmousedown),T.bind(T.cursor,"mouseup",T.onmouseup),T.railh&&(T.bind(T.cursorh,"mousedown",function(e){T.onmousedown(e,!0)}),T.bind(T.cursorh,"mouseup",T.onmouseup)),!T.ispage&&M.enablescrollonselection&&(T.bind(T.win[0],"mousedown",T.onselectionstart),T.bind(l,"mouseup",T.onselectionend),T.bind(T.cursor,"mouseup",T.onselectionend),T.cursorh&&T.bind(T.cursorh,"mouseup",T.onselectionend),T.bind(l,"mousemove",T.onselectiondrag)),T.zoom&&(T.jqbind(T.zoom,"mouseenter",function(){T.canshowonmouseevent&&T.showCursor(),T.rail.active=!0}),T.jqbind(T.zoom,"mouseleave",function(){T.rail.active=!1,T.rail.drag||T.hideCursor()}))),M.enablemousewheel&&(T.isiframe||T.mousewheel(P.isie&&T.ispage?l:T.win,T.onmousewheel),T.mousewheel(T.rail,T.onmousewheel),T.railh&&T.mousewheel(T.railh,T.onmousewheelhr)),T.ispage||P.cantouch||/HTML|^BODY/.test(T.win[0].nodeName)||(T.win.attr("tabindex")||T.win.attr({tabindex:++r}),T.bind(T.win,"focus",function(e){o=T.getTarget(e).id||T.getTarget(e)||!1,T.hasfocus=!0,T.canshowonmouseevent&&T.noticeCursor()}),T.bind(T.win,"blur",function(e){o=!1,T.hasfocus=!1}),T.bind(T.win,"mouseenter",function(e){t=T.getTarget(e).id||T.getTarget(e)||!1,T.hasmousefocus=!0,T.canshowonmouseevent&&T.noticeCursor()}),T.bind(T.win,"mouseleave",function(e){t=!1,T.hasmousefocus=!1,T.rail.drag||T.hideCursor()})),T.onkeypress=function(e){if(T.railslocked&&0===T.page.maxh)return!0;e=e||a.event;var r=T.getTarget(e);if(r&&/INPUT|TEXTAREA|SELECT|OPTION/.test(r.nodeName)&&(!(r.getAttribute("type")||r.type||!1)||!/submit|button|cancel/i.tp))return!0;if(n(r).attr("contenteditable"))return!0;if(T.hasfocus||T.hasmousefocus&&!o||T.ispage&&!o&&!t){var i=e.keyCode;if(T.railslocked&&27!=i)return T.cancelEvent(e);var s=e.ctrlKey||!1,l=e.shiftKey||!1,c=!1;switch(i){case 38:case 63233:T.doScrollBy(72),c=!0;break;case 40:case 63235:T.doScrollBy(-72),c=!0;break;case 37:case 63232:T.railh&&(s?T.doScrollLeft(0):T.doScrollLeftBy(72),c=!0);break;case 39:case 63234:T.railh&&(s?T.doScrollLeft(T.page.maxw):T.doScrollLeftBy(-72),c=!0);break;case 33:case 63276:T.doScrollBy(T.view.h),c=!0;break;case 34:case 63277:T.doScrollBy(-T.view.h),c=!0;break;case 36:case 63273:T.railh&&s?T.doScrollPos(0,0):T.doScrollTo(0),c=!0;break;case 35:case 63275:T.railh&&s?T.doScrollPos(T.page.maxw,T.page.maxh):T.doScrollTo(T.page.maxh),c=!0;break;case 32:M.spacebarenabled&&(l?T.doScrollBy(T.view.h):T.doScrollBy(-T.view.h),c=!0);break;case 27:T.zoomactive&&(T.doZoom(),c=!0)}if(c)return T.cancelEvent(e)}},M.enablekeyboard&&T.bind(l,P.isopera&&!P.isopera12?"keypress":"keydown",T.onkeypress),T.bind(l,"keydown",function(e){(e.ctrlKey||!1)&&(T.wheelprevented=!0)}),T.bind(l,"keyup",function(e){e.ctrlKey||!1||(T.wheelprevented=!1)}),T.bind(a,"blur",function(e){T.wheelprevented=!1}),T.bind(a,"resize",T.onscreenresize),T.bind(a,"orientationchange",T.onscreenresize),T.bind(a,"load",T.lazyResize),P.ischrome&&!T.ispage&&!T.haswrapper){var C=T.win.attr("style"),N=parseFloat(T.win.css("width"))+1;T.win.css("width",N),T.synched("chromefix",function(){T.win.attr("style",C)})}if(T.onAttributeChange=function(e){T.lazyResize(T.isieold?250:30)},M.enableobserver&&(T.isie11||!1===m||(T.observerbody=new m(function(e){if(e.forEach(function(e){if("attributes"==e.type)return E.hasClass("modal-open")&&E.hasClass("modal-dialog")&&!n.contains(n(".modal-dialog")[0],T.doc[0])?T.hide():T.show()}),T.me.clientWidth!=T.page.width||T.me.clientHeight!=T.page.height)return T.lazyResize(30)}),T.observerbody.observe(l.body,{childList:!0,subtree:!0,characterData:!1,attributes:!0,attributeFilter:["class"]})),!T.ispage&&!T.haswrapper)){var R=T.win[0];!1!==m?(T.observer=new m(function(e){e.forEach(T.onAttributeChange)}),T.observer.observe(R,{childList:!0,characterData:!1,attributes:!0,subtree:!1}),T.observerremover=new m(function(e){e.forEach(function(e){if(e.removedNodes.length>0)for(var o in e.removedNodes)if(T&&e.removedNodes[o]===R)return T.remove()})}),T.observerremover.observe(R.parentNode,{childList:!0,characterData:!1,attributes:!1,subtree:!1})):(T.bind(R,P.isie&&!P.isie9?"propertychange":"DOMAttrModified",T.onAttributeChange),P.isie9&&R.attachEvent("onpropertychange",T.onAttributeChange),T.bind(R,"DOMNodeRemoved",function(e){e.target===R&&T.remove()}))}!T.ispage&&M.boxzoom&&T.bind(a,"resize",T.resizeZoom),T.istextarea&&(T.bind(T.win,"keydown",T.lazyResize),T.bind(T.win,"mouseup",T.lazyResize)),T.lazyResize(30)}if("IFRAME"==this.doc[0].nodeName){var _=function(){T.iframexd=!1;var o;try{(o="contentDocument"in this?this.contentDocument:this.contentWindow._doc).domain}catch(e){T.iframexd=!0,o=!1}if(T.iframexd)return"console"in a&&console.log("NiceScroll error: policy restriced iframe"),!0;if(T.forcescreen=!0,T.isiframe&&(T.iframe={doc:n(o),html:T.doc.contents().find("html")[0],body:T.doc.contents().find("body")[0]},T.getContentSize=function(){return{w:Math.max(T.iframe.html.scrollWidth,T.iframe.body.scrollWidth),h:Math.max(T.iframe.html.scrollHeight,T.iframe.body.scrollHeight)}},T.docscroll=n(T.iframe.body)),!P.isios&&M.iframeautoresize&&!T.isiframe){T.win.scrollTop(0),T.doc.height("");var t=Math.max(o.getElementsByTagName("html")[0].scrollHeight,o.body.scrollHeight);T.doc.height(t)}T.lazyResize(30),T.css(n(T.iframe.body),e),P.isios&&T.haswrapper&&T.css(n(o.body),{"-webkit-transform":"translate3d(0,0,0)"}),"contentWindow"in this?T.bind(this.contentWindow,"scroll",T.onscroll):T.bind(o,"scroll",T.onscroll),M.enablemousewheel&&T.mousewheel(o,T.onmousewheel),M.enablekeyboard&&T.bind(o,P.isopera?"keypress":"keydown",T.onkeypress),P.cantouch?(T.bind(o,"touchstart",T.ontouchstart),T.bind(o,"touchmove",T.ontouchmove)):M.emulatetouch&&(T.bind(o,"mousedown",T.ontouchstart),T.bind(o,"mousemove",function(e){return T.ontouchmove(e,!0)}),M.grabcursorenabled&&P.cursorgrabvalue&&T.css(n(o.body),{cursor:P.cursorgrabvalue})),T.bind(o,"mouseup",T.ontouchend),T.zoom&&(M.dblclickzoom&&T.bind(o,"dblclick",T.doZoom),T.ongesturezoom&&T.bind(o,"gestureend",T.ongesturezoom))};this.doc[0].readyState&&"complete"===this.doc[0].readyState&&setTimeout(function(){_.call(T.doc[0],!1)},500),T.bind(this.doc,"load",_)}},this.showCursor=function(e,o){if(T.cursortimeout&&(clearTimeout(T.cursortimeout),T.cursortimeout=0),T.rail){if(T.autohidedom&&(T.autohidedom.stop().css({opacity:M.cursoropacitymax}),T.cursoractive=!0),T.rail.drag&&1==T.rail.drag.pt||(void 0!==e&&!1!==e&&(T.scroll.y=e/T.scrollratio.y|0),void 0!==o&&(T.scroll.x=o/T.scrollratio.x|0)),T.cursor.css({height:T.cursorheight,top:T.scroll.y}),T.cursorh){var t=T.hasreversehr?T.scrollvaluemaxw-T.scroll.x:T.scroll.x;T.cursorh.css({width:T.cursorwidth,left:!T.rail.align&&T.rail.visibility?t+T.rail.width:t}),T.cursoractive=!0}T.zoom&&T.zoom.stop().css({opacity:M.cursoropacitymax})}},this.hideCursor=function(e){T.cursortimeout||T.rail&&T.autohidedom&&(T.hasmousefocus&&"leave"===M.autohidemode||(T.cursortimeout=setTimeout(function(){T.rail.active&&T.showonmouseevent||(T.autohidedom.stop().animate({opacity:M.cursoropacitymin}),T.zoom&&T.zoom.stop().animate({opacity:M.cursoropacitymin}),T.cursoractive=!1),T.cursortimeout=0},e||M.hidecursordelay)))},this.noticeCursor=function(e,o,t){T.showCursor(o,t),T.rail.active||T.hideCursor(e)},this.getContentSize=T.ispage?function(){return{w:Math.max(l.body.scrollWidth,l.documentElement.scrollWidth),h:Math.max(l.body.scrollHeight,l.documentElement.scrollHeight)}}:T.haswrapper?function(){return{w:T.doc[0].offsetWidth,h:T.doc[0].offsetHeight}}:function(){return{w:T.docscroll[0].scrollWidth,h:T.docscroll[0].scrollHeight}},this.onResize=function(e,o){if(!T||!T.win)return!1;var t=T.page.maxh,r=T.page.maxw,i=T.view.h,s=T.view.w;if(T.view={w:T.ispage?T.win.width():T.win[0].clientWidth,h:T.ispage?T.win.height():T.win[0].clientHeight},T.page=o||T.getContentSize(),T.page.maxh=Math.max(0,T.page.h-T.view.h),T.page.maxw=Math.max(0,T.page.w-T.view.w),T.page.maxh==t&&T.page.maxw==r&&T.view.w==s&&T.view.h==i){if(T.ispage)return T;var n=T.win.offset();if(T.lastposition){var l=T.lastposition;if(l.top==n.top&&l.left==n.left)return T}T.lastposition=n}return 0===T.page.maxh?(T.hideRail(),T.scrollvaluemax=0,T.scroll.y=0,T.scrollratio.y=0,T.cursorheight=0,T.setScrollTop(0),T.rail&&(T.rail.scrollable=!1)):(T.page.maxh-=M.railpadding.top+M.railpadding.bottom,T.rail.scrollable=!0),0===T.page.maxw?(T.hideRailHr(),T.scrollvaluemaxw=0,T.scroll.x=0,T.scrollratio.x=0,T.cursorwidth=0,T.setScrollLeft(0),T.railh&&(T.railh.scrollable=!1)):(T.page.maxw-=M.railpadding.left+M.railpadding.right,T.railh&&(T.railh.scrollable=M.horizrailenabled)),T.railslocked=T.locked||0===T.page.maxh&&0===T.page.maxw,T.railslocked?(T.ispage||T.updateScrollBar(T.view),!1):(T.hidden||(T.rail.visibility||T.showRail(),T.railh&&!T.railh.visibility&&T.showRailHr()),T.istextarea&&T.win.css("resize")&&"none"!=T.win.css("resize")&&(T.view.h-=20),T.cursorheight=Math.min(T.view.h,Math.round(T.view.h*(T.view.h/T.page.h))),T.cursorheight=M.cursorfixedheight?M.cursorfixedheight:Math.max(M.cursorminheight,T.cursorheight),T.cursorwidth=Math.min(T.view.w,Math.round(T.view.w*(T.view.w/T.page.w))),T.cursorwidth=M.cursorfixedheight?M.cursorfixedheight:Math.max(M.cursorminheight,T.cursorwidth),T.scrollvaluemax=T.view.h-T.cursorheight-(M.railpadding.top+M.railpadding.bottom),T.hasborderbox||(T.scrollvaluemax-=T.cursor[0].offsetHeight-T.cursor[0].clientHeight),T.railh&&(T.railh.width=T.page.maxh>0?T.view.w-T.rail.width:T.view.w,T.scrollvaluemaxw=T.railh.width-T.cursorwidth-(M.railpadding.left+M.railpadding.right)),T.ispage||T.updateScrollBar(T.view),T.scrollratio={x:T.page.maxw/T.scrollvaluemaxw,y:T.page.maxh/T.scrollvaluemax},T.getScrollTop()>T.page.maxh?T.doScrollTop(T.page.maxh):(T.scroll.y=T.getScrollTop()/T.scrollratio.y|0,T.scroll.x=T.getScrollLeft()/T.scrollratio.x|0,T.cursoractive&&T.noticeCursor()),T.scroll.y&&0===T.getScrollTop()&&T.doScrollTo(T.scroll.y*T.scrollratio.y|0),T)},this.resize=T.onResize;var O=0;this.onscreenresize=function(e){clearTimeout(O);var o=!T.ispage&&!T.haswrapper;o&&T.hideRails(),O=setTimeout(function(){T&&(o&&T.showRails(),T.resize()),O=0},120)},this.lazyResize=function(e){return clearTimeout(O),e=isNaN(e)?240:e,O=setTimeout(function(){T&&T.resize(),O=0},e),T},this.jqbind=function(e,o,t){T.events.push({e:e,n:o,f:t,q:!0}),n(e).on(o,t)},this.mousewheel=function(e,o,t){var r="jquery"in e?e[0]:e;if("onwheel"in l.createElement("div"))T._bind(r,"wheel",o,t||!1);else{var i=void 0!==l.onmousewheel?"mousewheel":"DOMMouseScroll";S(r,i,o,t||!1),"DOMMouseScroll"==i&&S(r,"MozMousePixelScroll",o,t||!1)}};var Y=!1;if(P.haseventlistener){try{var H=Object.defineProperty({},"passive",{get:function(){Y=!0}});a.addEventListener("test",null,H)}catch(e){}this.stopPropagation=function(e){return!!e&&((e=e.original?e.original:e).stopPropagation(),!1)},this.cancelEvent=function(e){return e.cancelable&&e.preventDefault(),e.stopImmediatePropagation(),e.preventManipulation&&e.preventManipulation(),!1}}else Event.prototype.preventDefault=function(){this.returnValue=!1},Event.prototype.stopPropagation=function(){this.cancelBubble=!0},a.constructor.prototype.addEventListener=l.constructor.prototype.addEventListener=Element.prototype.addEventListener=function(e,o,t){this.attachEvent("on"+e,o)},a.constructor.prototype.removeEventListener=l.constructor.prototype.removeEventListener=Element.prototype.removeEventListener=function(e,o,t){this.detachEvent("on"+e,o)},this.cancelEvent=function(e){return(e=e||a.event)&&(e.cancelBubble=!0,e.cancel=!0,e.returnValue=!1),!1},this.stopPropagation=function(e){return(e=e||a.event)&&(e.cancelBubble=!0),!1};this.delegate=function(e,o,t,r,i){var s=d[o]||!1;s||(s={a:[],l:[],f:function(e){for(var o=s.l,t=!1,r=o.length-1;r>=0;r--)if(!1===(t=o[r].call(e.target,e)))return!1;return t}},T.bind(e,o,s.f,r,i),d[o]=s),T.ispage?(s.a=[T.id].concat(s.a),s.l=[t].concat(s.l)):(s.a.push(T.id),s.l.push(t))},this.undelegate=function(e,o,t,r,i){var s=d[o]||!1;if(s&&s.l)for(var n=0,l=s.l.length;n<l;n++)s.a[n]===T.id&&(s.a.splice(n),s.l.splice(n),0===s.a.length&&(T._unbind(e,o,s.l.f),d[o]=null))},this.bind=function(e,o,t,r,i){var s="jquery"in e?e[0]:e;T._bind(s,o,t,r||!1,i||!1)},this._bind=function(e,o,t,r,i){T.events.push({e:e,n:o,f:t,b:r,q:!1}),Y&&i?e.addEventListener(o,t,{passive:!1,capture:r}):e.addEventListener(o,t,r||!1)},this._unbind=function(e,o,t,r){d[o]?T.undelegate(e,o,t,r):e.removeEventListener(o,t,r)},this.unbindAll=function(){for(var e=0;e<T.events.length;e++){var o=T.events[e];o.q?o.e.unbind(o.n,o.f):T._unbind(o.e,o.n,o.f,o.b)}},this.showRails=function(){return T.showRail().showRailHr()},this.showRail=function(){return 0===T.page.maxh||!T.ispage&&"none"==T.win.css("display")||(T.rail.visibility=!0,T.rail.css("display","block")),T},this.showRailHr=function(){return T.railh&&(0===T.page.maxw||!T.ispage&&"none"==T.win.css("display")||(T.railh.visibility=!0,T.railh.css("display","block"))),T},this.hideRails=function(){return T.hideRail().hideRailHr()},this.hideRail=function(){return T.rail.visibility=!1,T.rail.css("display","none"),T},this.hideRailHr=function(){return T.railh&&(T.railh.visibility=!1,T.railh.css("display","none")),T},this.show=function(){return T.hidden=!1,T.railslocked=!1,T.showRails()},this.hide=function(){return T.hidden=!0,T.railslocked=!0,T.hideRails()},this.toggle=function(){return T.hidden?T.show():T.hide()},this.remove=function(){T.stop(),T.cursortimeout&&clearTimeout(T.cursortimeout);for(var e in T.delaylist)T.delaylist[e]&&h(T.delaylist[e].h);T.doZoomOut(),T.unbindAll(),P.isie9&&T.win[0].detachEvent("onpropertychange",T.onAttributeChange),!1!==T.observer&&T.observer.disconnect(),!1!==T.observerremover&&T.observerremover.disconnect(),!1!==T.observerbody&&T.observerbody.disconnect(),T.events=null,T.cursor&&T.cursor.remove(),T.cursorh&&T.cursorh.remove(),T.rail&&T.rail.remove(),T.railh&&T.railh.remove(),T.zoom&&T.zoom.remove();for(var o=0;o<T.saved.css.length;o++){var t=T.saved.css[o];t[0].css(t[1],void 0===t[2]?"":t[2])}T.saved=!1,T.me.data("__nicescroll","");var r=n.nicescroll;r.each(function(e){if(this&&this.id===T.id){delete r[e];for(var o=++e;o<r.length;o++,e++)r[e]=r[o];--r.length&&delete r[r.length]}});for(var i in T)T[i]=null,delete T[i];T=null},this.scrollstart=function(e){return this.onscrollstart=e,T},this.scrollend=function(e){return this.onscrollend=e,T},this.scrollcancel=function(e){return this.onscrollcancel=e,T},this.zoomin=function(e){return this.onzoomin=e,T},this.zoomout=function(e){return this.onzoomout=e,T},this.isScrollable=function(e){var o=e.target?e.target:e;if("OPTION"==o.nodeName)return!0;for(;o&&1==o.nodeType&&o!==this.me[0]&&!/^BODY|HTML/.test(o.nodeName);){var t=n(o),r=t.css("overflowY")||t.css("overflowX")||t.css("overflow")||"";if(/scroll|auto/.test(r))return o.clientHeight!=o.scrollHeight;o=!!o.parentNode&&o.parentNode}return!1},this.getViewport=function(e){for(var o=!(!e||!e.parentNode)&&e.parentNode;o&&1==o.nodeType&&!/^BODY|HTML/.test(o.nodeName);){var t=n(o);if(/fixed|absolute/.test(t.css("position")))return t;var r=t.css("overflowY")||t.css("overflowX")||t.css("overflow")||"";if(/scroll|auto/.test(r)&&o.clientHeight!=o.scrollHeight)return t;if(t.getNiceScroll().length>0)return t;o=!!o.parentNode&&o.parentNode}return!1},this.triggerScrollStart=function(e,o,t,r,i){if(T.onscrollstart){var s={type:"scrollstart",current:{x:e,y:o},request:{x:t,y:r},end:{x:T.newscrollx,y:T.newscrolly},speed:i};T.onscrollstart.call(T,s)}},this.triggerScrollEnd=function(){if(T.onscrollend){var e=T.getScrollLeft(),o=T.getScrollTop(),t={type:"scrollend",current:{x:e,y:o},end:{x:e,y:o}};T.onscrollend.call(T,t)}};var B=0,X=0,D=0,A=1,q=!1;if(this.onmousewheel=function(e){if(T.wheelprevented||T.locked)return!1;if(T.railslocked)return T.debounced("checkunlock",T.resize,250),!1;if(T.rail.drag)return T.cancelEvent(e);if("auto"===M.oneaxismousemode&&0!==e.deltaX&&(M.oneaxismousemode=!1),M.oneaxismousemode&&0===e.deltaX&&!T.rail.scrollable)return!T.railh||!T.railh.scrollable||T.onmousewheelhr(e);var o=f(),t=!1;if(M.preservenativescrolling&&T.checkarea+600<o&&(T.nativescrollingarea=T.isScrollable(e),t=!0),T.checkarea=o,T.nativescrollingarea)return!0;var r=k(e,!1,t);return r&&(T.checkarea=0),r},this.onmousewheelhr=function(e){if(!T.wheelprevented){if(T.railslocked||!T.railh.scrollable)return!0;if(T.rail.drag)return T.cancelEvent(e);var o=f(),t=!1;return M.preservenativescrolling&&T.checkarea+600<o&&(T.nativescrollingarea=T.isScrollable(e),t=!0),T.checkarea=o,!!T.nativescrollingarea||(T.railslocked?T.cancelEvent(e):k(e,!0,t))}},this.stop=function(){return T.cancelScroll(),T.scrollmon&&T.scrollmon.stop(),T.cursorfreezed=!1,T.scroll.y=Math.round(T.getScrollTop()*(1/T.scrollratio.y)),T.noticeCursor(),T},this.getTransitionSpeed=function(e){return 80+e/72*M.scrollspeed|0},M.smoothscroll)if(T.ishwscroll&&P.hastransition&&M.usetransition&&M.smoothscroll){var j="";this.resetTransition=function(){j="",T.doc.css(P.prefixstyle+"transition-duration","0ms")},this.prepareTransition=function(e,o){var t=o?e:T.getTransitionSpeed(e),r=t+"ms";return j!==r&&(j=r,T.doc.css(P.prefixstyle+"transition-duration",r)),t},this.doScrollLeft=function(e,o){var t=T.scrollrunning?T.newscrolly:T.getScrollTop();T.doScrollPos(e,t,o)},this.doScrollTop=function(e,o){var t=T.scrollrunning?T.newscrollx:T.getScrollLeft();T.doScrollPos(t,e,o)},this.cursorupdate={running:!1,start:function(){var e=this;if(!e.running){e.running=!0;var o=function(){e.running&&u(o),T.showCursor(T.getScrollTop(),T.getScrollLeft()),T.notifyScrollEvent(T.win[0])};u(o)}},stop:function(){this.running=!1}},this.doScrollPos=function(e,o,t){var r=T.getScrollTop(),i=T.getScrollLeft();if(((T.newscrolly-r)*(o-r)<0||(T.newscrollx-i)*(e-i)<0)&&T.cancelScroll(),M.bouncescroll?(o<0?o=o/2|0:o>T.page.maxh&&(o=T.page.maxh+(o-T.page.maxh)/2|0),e<0?e=e/2|0:e>T.page.maxw&&(e=T.page.maxw+(e-T.page.maxw)/2|0)):(o<0?o=0:o>T.page.maxh&&(o=T.page.maxh),e<0?e=0:e>T.page.maxw&&(e=T.page.maxw)),T.scrollrunning&&e==T.newscrollx&&o==T.newscrolly)return!1;T.newscrolly=o,T.newscrollx=e;var s=T.getScrollTop(),n=T.getScrollLeft(),l={};l.x=e-n,l.y=o-s;var a=0|Math.sqrt(l.x*l.x+l.y*l.y),c=T.prepareTransition(a);T.scrollrunning||(T.scrollrunning=!0,T.triggerScrollStart(n,s,e,o,c),T.cursorupdate.start()),T.scrollendtrapped=!0,P.transitionend||(T.scrollendtrapped&&clearTimeout(T.scrollendtrapped),T.scrollendtrapped=setTimeout(T.onScrollTransitionEnd,c)),T.setScrollTop(T.newscrolly),T.setScrollLeft(T.newscrollx)},this.cancelScroll=function(){if(!T.scrollendtrapped)return!0;var e=T.getScrollTop(),o=T.getScrollLeft();return T.scrollrunning=!1,P.transitionend||clearTimeout(P.transitionend),T.scrollendtrapped=!1,T.resetTransition(),T.setScrollTop(e),T.railh&&T.setScrollLeft(o),T.timerscroll&&T.timerscroll.tm&&clearInterval(T.timerscroll.tm),T.timerscroll=!1,T.cursorfreezed=!1,T.cursorupdate.stop(),T.showCursor(e,o),T},this.onScrollTransitionEnd=function(){if(T.scrollendtrapped){var e=T.getScrollTop(),o=T.getScrollLeft();if(e<0?e=0:e>T.page.maxh&&(e=T.page.maxh),o<0?o=0:o>T.page.maxw&&(o=T.page.maxw),e!=T.newscrolly||o!=T.newscrollx)return T.doScrollPos(o,e,M.snapbackspeed);T.scrollrunning&&T.triggerScrollEnd(),T.scrollrunning=!1,T.scrollendtrapped=!1,T.resetTransition(),T.timerscroll=!1,T.setScrollTop(e),T.railh&&T.setScrollLeft(o),T.cursorupdate.stop(),T.noticeCursor(!1,e,o),T.cursorfreezed=!1}}}else this.doScrollLeft=function(e,o){var t=T.scrollrunning?T.newscrolly:T.getScrollTop();T.doScrollPos(e,t,o)},this.doScrollTop=function(e,o){var t=T.scrollrunning?T.newscrollx:T.getScrollLeft();T.doScrollPos(t,e,o)},this.doScrollPos=function(e,o,t){var r=T.getScrollTop(),i=T.getScrollLeft();((T.newscrolly-r)*(o-r)<0||(T.newscrollx-i)*(e-i)<0)&&T.cancelScroll();var s=!1;if(T.bouncescroll&&T.rail.visibility||(o<0?(o=0,s=!0):o>T.page.maxh&&(o=T.page.maxh,s=!0)),T.bouncescroll&&T.railh.visibility||(e<0?(e=0,s=!0):e>T.page.maxw&&(e=T.page.maxw,s=!0)),T.scrollrunning&&T.newscrolly===o&&T.newscrollx===e)return!0;T.newscrolly=o,T.newscrollx=e,T.dst={},T.dst.x=e-i,T.dst.y=o-r,T.dst.px=i,T.dst.py=r;var n=0|Math.sqrt(T.dst.x*T.dst.x+T.dst.y*T.dst.y),l=T.getTransitionSpeed(n);T.bzscroll={};var a=s?1:.58;T.bzscroll.x=new R(i,T.newscrollx,l,0,0,a,1),T.bzscroll.y=new R(r,T.newscrolly,l,0,0,a,1);f();var c=function(){if(T.scrollrunning){var e=T.bzscroll.y.getPos();T.setScrollLeft(T.bzscroll.x.getNow()),T.setScrollTop(T.bzscroll.y.getNow()),e<=1?T.timer=u(c):(T.scrollrunning=!1,T.timer=0,T.triggerScrollEnd())}};T.scrollrunning||(T.triggerScrollStart(i,r,e,o,l),T.scrollrunning=!0,T.timer=u(c))},this.cancelScroll=function(){return T.timer&&h(T.timer),T.timer=0,T.bzscroll=!1,T.scrollrunning=!1,T};else this.doScrollLeft=function(e,o){var t=T.getScrollTop();T.doScrollPos(e,t,o)},this.doScrollTop=function(e,o){var t=T.getScrollLeft();T.doScrollPos(t,e,o)},this.doScrollPos=function(e,o,t){var r=e>T.page.maxw?T.page.maxw:e;r<0&&(r=0);var i=o>T.page.maxh?T.page.maxh:o;i<0&&(i=0),T.synched("scroll",function(){T.setScrollTop(i),T.setScrollLeft(r)})},this.cancelScroll=function(){};this.doScrollBy=function(e,o){z(0,e)},this.doScrollLeftBy=function(e,o){z(e,0)},this.doScrollTo=function(e,o){var t=o?Math.round(e*T.scrollratio.y):e;t<0?t=0:t>T.page.maxh&&(t=T.page.maxh),T.cursorfreezed=!1,T.doScrollTop(e)},this.checkContentSize=function(){var e=T.getContentSize();e.h==T.page.h&&e.w==T.page.w||T.resize(!1,e)},T.onscroll=function(e){T.rail.drag||T.cursorfreezed||T.synched("scroll",function(){T.scroll.y=Math.round(T.getScrollTop()/T.scrollratio.y),T.railh&&(T.scroll.x=Math.round(T.getScrollLeft()/T.scrollratio.x)),T.noticeCursor()})},T.bind(T.docscroll,"scroll",T.onscroll),this.doZoomIn=function(e){if(!T.zoomactive){T.zoomactive=!0,T.zoomrestore={style:{}};var o=["position","top","left","zIndex","backgroundColor","marginTop","marginBottom","marginLeft","marginRight"],t=T.win[0].style;for(var r in o){var i=o[r];T.zoomrestore.style[i]=void 0!==t[i]?t[i]:""}T.zoomrestore.style.width=T.win.css("width"),T.zoomrestore.style.height=T.win.css("height"),T.zoomrestore.padding={w:T.win.outerWidth()-T.win.width(),h:T.win.outerHeight()-T.win.height()},P.isios4&&(T.zoomrestore.scrollTop=c.scrollTop(),c.scrollTop(0)),T.win.css({position:P.isios4?"absolute":"fixed",top:0,left:0,zIndex:s+100,margin:0});var n=T.win.css("backgroundColor");return(""===n||/transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(n))&&T.win.css("backgroundColor","#fff"),T.rail.css({zIndex:s+101}),T.zoom.css({zIndex:s+102}),T.zoom.css("backgroundPosition","0 -18px"),T.resizeZoom(),T.onzoomin&&T.onzoomin.call(T),T.cancelEvent(e)}},this.doZoomOut=function(e){if(T.zoomactive)return T.zoomactive=!1,T.win.css("margin",""),T.win.css(T.zoomrestore.style),P.isios4&&c.scrollTop(T.zoomrestore.scrollTop),T.rail.css({"z-index":T.zindex}),T.zoom.css({"z-index":T.zindex}),T.zoomrestore=!1,T.zoom.css("backgroundPosition","0 0"),T.onResize(),T.onzoomout&&T.onzoomout.call(T),T.cancelEvent(e)},this.doZoom=function(e){return T.zoomactive?T.doZoomOut(e):T.doZoomIn(e)},this.resizeZoom=function(){if(T.zoomactive){var e=T.getScrollTop();T.win.css({width:c.width()-T.zoomrestore.padding.w+"px",height:c.height()-T.zoomrestore.padding.h+"px"}),T.onResize(),T.setScrollTop(Math.min(T.page.maxh,e))}},this.init(),n.nicescroll.push(this)},y=function(e){var o=this;this.nc=e,this.lastx=0,this.lasty=0,this.speedx=0,this.speedy=0,this.lasttime=0,this.steptime=0,this.snapx=!1,this.snapy=!1,this.demulx=0,this.demuly=0,this.lastscrollx=-1,this.lastscrolly=-1,this.chkx=0,this.chky=0,this.timer=0,this.reset=function(e,t){o.stop(),o.steptime=0,o.lasttime=f(),o.speedx=0,o.speedy=0,o.lastx=e,o.lasty=t,o.lastscrollx=-1,o.lastscrolly=-1},this.update=function(e,t){var r=f();o.steptime=r-o.lasttime,o.lasttime=r;var i=t-o.lasty,s=e-o.lastx,n=o.nc.getScrollTop()+i,l=o.nc.getScrollLeft()+s;o.snapx=l<0||l>o.nc.page.maxw,o.snapy=n<0||n>o.nc.page.maxh,o.speedx=s,o.speedy=i,o.lastx=e,o.lasty=t},this.stop=function(){o.nc.unsynched("domomentum2d"),o.timer&&clearTimeout(o.timer),o.timer=0,o.lastscrollx=-1,o.lastscrolly=-1},this.doSnapy=function(e,t){var r=!1;t<0?(t=0,r=!0):t>o.nc.page.maxh&&(t=o.nc.page.maxh,r=!0),e<0?(e=0,r=!0):e>o.nc.page.maxw&&(e=o.nc.page.maxw,r=!0),r?o.nc.doScrollPos(e,t,o.nc.opt.snapbackspeed):o.nc.triggerScrollEnd()},this.doMomentum=function(e){var t=f(),r=e?t+e:o.lasttime,i=o.nc.getScrollLeft(),s=o.nc.getScrollTop(),n=o.nc.page.maxh,l=o.nc.page.maxw;o.speedx=l>0?Math.min(60,o.speedx):0,o.speedy=n>0?Math.min(60,o.speedy):0;var a=r&&t-r<=60;(s<0||s>n||i<0||i>l)&&(a=!1);var c=!(!o.speedy||!a)&&o.speedy,d=!(!o.speedx||!a)&&o.speedx;if(c||d){var u=Math.max(16,o.steptime);if(u>50){var h=u/50;o.speedx*=h,o.speedy*=h,u=50}o.demulxy=0,o.lastscrollx=o.nc.getScrollLeft(),o.chkx=o.lastscrollx,o.lastscrolly=o.nc.getScrollTop(),o.chky=o.lastscrolly;var p=o.lastscrollx,m=o.lastscrolly,g=function(){var e=f()-t>600?.04:.02;o.speedx&&(p=Math.floor(o.lastscrollx-o.speedx*(1-o.demulxy)),o.lastscrollx=p,(p<0||p>l)&&(e=.1)),o.speedy&&(m=Math.floor(o.lastscrolly-o.speedy*(1-o.demulxy)),o.lastscrolly=m,(m<0||m>n)&&(e=.1)),o.demulxy=Math.min(1,o.demulxy+e),o.nc.synched("domomentum2d",function(){if(o.speedx){o.nc.getScrollLeft();o.chkx=p,o.nc.setScrollLeft(p)}if(o.speedy){o.nc.getScrollTop();o.chky=m,o.nc.setScrollTop(m)}o.timer||(o.nc.hideCursor(),o.doSnapy(p,m))}),o.demulxy<1?o.timer=setTimeout(g,u):(o.stop(),o.nc.hideCursor(),o.doSnapy(p,m))};g()}else o.doSnapy(o.nc.getScrollLeft(),o.nc.getScrollTop())}},x=e.fn.scrollTop;e.cssHooks.pageYOffset={get:function(e,o,t){var r=n.data(e,"__nicescroll")||!1;return r&&r.ishwscroll?r.getScrollTop():x.call(e)},set:function(e,o){var t=n.data(e,"__nicescroll")||!1;return t&&t.ishwscroll?t.setScrollTop(parseInt(o)):x.call(e,o),this}},e.fn.scrollTop=function(e){if(void 0===e){var o=!!this[0]&&(n.data(this[0],"__nicescroll")||!1);return o&&o.ishwscroll?o.getScrollTop():x.call(this)}return this.each(function(){var o=n.data(this,"__nicescroll")||!1;o&&o.ishwscroll?o.setScrollTop(parseInt(e)):x.call(n(this),e)})};var S=e.fn.scrollLeft;n.cssHooks.pageXOffset={get:function(e,o,t){var r=n.data(e,"__nicescroll")||!1;return r&&r.ishwscroll?r.getScrollLeft():S.call(e)},set:function(e,o){var t=n.data(e,"__nicescroll")||!1;return t&&t.ishwscroll?t.setScrollLeft(parseInt(o)):S.call(e,o),this}},e.fn.scrollLeft=function(e){if(void 0===e){var o=!!this[0]&&(n.data(this[0],"__nicescroll")||!1);return o&&o.ishwscroll?o.getScrollLeft():S.call(this)}return this.each(function(){var o=n.data(this,"__nicescroll")||!1;o&&o.ishwscroll?o.setScrollLeft(parseInt(e)):S.call(n(this),e)})};var z=function(e){var o=this;if(this.length=0,this.name="nicescrollarray",this.each=function(e){return n.each(o,e),o},this.push=function(e){o[o.length]=e,o.length++},this.eq=function(e){return o[e]},e)for(var t=0;t<e.length;t++){var r=n.data(e[t],"__nicescroll")||!1;r&&(this[this.length]=r,this.length++)}return this};!function(e,o,t){for(var r=0,i=o.length;r<i;r++)t(e,o[r])}(z.prototype,["show","hide","toggle","onResize","resize","remove","stop","doScrollPos"],function(e,o){e[o]=function(){var e=arguments;return this.each(function(){this[o].apply(this,e)})}}),e.fn.getNiceScroll=function(e){return void 0===e?new z(this):this[e]&&n.data(this[e],"__nicescroll")||!1},(e.expr.pseudos||e.expr[":"]).nicescroll=function(e){return void 0!==n.data(e,"__nicescroll")},n.fn.niceScroll=function(e,o){void 0!==o||"object"!=typeof e||"jquery"in e||(o=e,e=!1);var t=new z;return this.each(function(){var r=n(this),i=n.extend({},o);if(e){var s=n(e);i.doc=s.length>1?n(e,r):s,i.win=r}!("doc"in i)||"win"in i||(i.win=r);var l=r.data("__nicescroll")||!1;l||(i.doc=i.doc||r,l=new b(i,r),r.data("__nicescroll",l)),t.push(l)}),1===t.length?t[0]:t},a.NiceScroll={getjQuery:function(){return e}},n.nicescroll||(n.nicescroll=new z,n.nicescroll.options=g)});
\ No newline at end of file
diff --git a/debian/changelog b/debian/changelog
index a9b4587..910ab40 100644
--- a/debian/changelog
+++ b/debian/changelog
@@ -1,3 +1,9 @@
+ruby-rails-assets-jquery-nicescroll (3.7.6+dfsg-1) UNRELEASED; urgency=low
+
+ * New upstream release.
+
+ -- Debian Janitor <janitor@jelmer.uk> Wed, 04 Jan 2023 16:53:03 -0000
+
ruby-rails-assets-jquery-nicescroll (3.6.6+dfsg-3) unstable; urgency=medium
* Team upload
diff --git a/debian/patches/set-engine-root.patch b/debian/patches/set-engine-root.patch
index 75bb42f..9984707 100644
--- a/debian/patches/set-engine-root.patch
+++ b/debian/patches/set-engine-root.patch
@@ -1,9 +1,9 @@
Description: Set's engine's root to /usr/share/ruby-rails-assets-jquery-nicescroll
-Index: ruby-rails-assets-jquery.nicescroll-3.6.6/lib/rails-assets-jquery.nicescroll.rb
+Index: ruby-rails-assets-jquery-nicescroll.git/lib/rails-assets-jquery.nicescroll.rb
===================================================================
---- ruby-rails-assets-jquery.nicescroll-3.6.6.orig/lib/rails-assets-jquery.nicescroll.rb
-+++ ruby-rails-assets-jquery.nicescroll-3.6.6/lib/rails-assets-jquery.nicescroll.rb
+--- ruby-rails-assets-jquery-nicescroll.git.orig/lib/rails-assets-jquery.nicescroll.rb
++++ ruby-rails-assets-jquery-nicescroll.git/lib/rails-assets-jquery.nicescroll.rb
@@ -26,6 +26,7 @@ module RailsAssetsJqueryNicescroll
if defined?(Rails)
diff --git a/lib/rails-assets-jquery.nicescroll/version.rb b/lib/rails-assets-jquery.nicescroll/version.rb
index f1e917d..5108906 100644
--- a/lib/rails-assets-jquery.nicescroll/version.rb
+++ b/lib/rails-assets-jquery.nicescroll/version.rb
@@ -1,3 +1,3 @@
module RailsAssetsJqueryNicescroll
- VERSION = "3.6.6"
+ VERSION = "3.7.6"
end
diff --git a/rails-assets-jquery.nicescroll.json b/rails-assets-jquery.nicescroll.json
new file mode 100644
index 0000000..9bb76b0
--- /dev/null
+++ b/rails-assets-jquery.nicescroll.json
@@ -0,0 +1,37 @@
+{
+ "name": "rails-assets-jquery.nicescroll",
+ "downloads": null,
+ "version": "3.7.6",
+ "version_downloads": null,
+ "platform": "ruby",
+ "authors": "rails-assets.org",
+ "info": "",
+
+ "metadata": {
+
+ },
+ "sha": null,
+ "project_uri": "https://github.com/inuyaksa/jquery.nicescroll",
+ "gem_uri": null,
+ "homepage_uri": "https://github.com/inuyaksa/jquery.nicescroll",
+ "wiki_uri": null,
+ "documentation_uri": null,
+ "mailing_list_uri": null,
+ "source_code_uri": "https://github.com/inuyaksa/jquery.nicescroll",
+ "bug_tracker_uri": null,
+ "dependencies": {
+ "development": [
+
+
+ {
+ "name": "rails-assets-jquery",
+ "requirements": ">= 1.8.3"
+ },
+
+
+ ],
+ "runtime": [
+
+ ]
+ }
+}
Debdiff
[The following lists of changes regard files as different if they have different names, permissions or owners.]
Files in second set of .debs but not in first
-rw-r--r-- root/root /usr/share/ruby-rails-assets-jquery-nicescroll/app/assets/javascripts/jquery.nicescroll/jquery.nicescroll.iframehelper.js -rw-r--r-- root/root /usr/share/ruby-rails-assets-jquery-nicescroll/app/assets/javascripts/jquery.nicescroll/jquery.nicescroll.min.js -rw-r--r-- root/root /usr/share/rubygems-integration/all/specifications/rails-assets-jquery.nicescroll-3.7.6.gemspec
Files in first set of .debs but not in second
-rw-r--r-- root/root /usr/share/rubygems-integration/all/specifications/rails-assets-jquery.nicescroll-3.6.6.gemspec
No differences were encountered between the control files of package libjs-jquery-nicescroll
No differences were encountered between the control files of package ruby-rails-assets-jquery-nicescroll