New Upstream Release - golang-github-chromedp-cdproto
Ready changes
Summary
Merged new upstream version: 0.0~git20230816.17ee49f (was: 0.0~git20230109.6b041c6).
Resulting package
Built on 2023-08-25T13:38 (took 8m51s)
The resulting binary packages can be installed (if you have the apt repository enabled) by running one of:
apt install -t fresh-releases golang-github-chromedp-cdproto-dev
Lintian Result
- golang-github-chromedp-cdproto-dev_0.0~git20230816.17ee49f-1~jan+nur1_all.deb
- golang-github-chromedp-cdproto_0.0~git20230816.17ee49f-1~jan+nur1.dsc
- golang-github-chromedp-cdproto_0.0~git20230816.17ee49f-1~jan+nur1_amd64.buildinfo
- golang-github-chromedp-cdproto_0.0~git20230816.17ee49f-1~jan+nur1_amd64.changes
Diff
diff --git a/accessibility/accessibility.go b/accessibility/accessibility.go
index 375186f..73147ba 100644
--- a/accessibility/accessibility.go
+++ b/accessibility/accessibility.go
@@ -53,7 +53,7 @@ type GetPartialAXTreeParams struct {
NodeID cdp.NodeID `json:"nodeId,omitempty"` // Identifier of the node to get the partial accessibility tree for.
BackendNodeID cdp.BackendNodeID `json:"backendNodeId,omitempty"` // Identifier of the backend node to get the partial accessibility tree for.
ObjectID runtime.RemoteObjectID `json:"objectId,omitempty"` // JavaScript object id of the node wrapper to get the partial accessibility tree for.
- FetchRelatives bool `json:"fetchRelatives,omitempty"` // Whether to fetch this nodes ancestors, siblings and children. Defaults to true.
+ FetchRelatives bool `json:"fetchRelatives,omitempty"` // Whether to fetch this node's ancestors, siblings and children. Defaults to true.
}
// GetPartialAXTree fetches the accessibility node and partial accessibility
@@ -87,7 +87,7 @@ func (p GetPartialAXTreeParams) WithObjectID(objectID runtime.RemoteObjectID) *G
return &p
}
-// WithFetchRelatives whether to fetch this nodes ancestors, siblings and
+// WithFetchRelatives whether to fetch this node's ancestors, siblings and
// children. Defaults to true.
func (p GetPartialAXTreeParams) WithFetchRelatives(fetchRelatives bool) *GetPartialAXTreeParams {
p.FetchRelatives = fetchRelatives
diff --git a/audits/audits.go b/audits/audits.go
index c8b26ee..6dc9baf 100644
--- a/audits/audits.go
+++ b/audits/audits.go
@@ -147,10 +147,44 @@ func (p *CheckContrastParams) Do(ctx context.Context) (err error) {
return cdp.Execute(ctx, CommandCheckContrast, p, nil)
}
+// CheckFormsIssuesParams runs the form issues check for the target page.
+// Found issues are reported using Audits.issueAdded event.
+type CheckFormsIssuesParams struct{}
+
+// CheckFormsIssues runs the form issues check for the target page. Found
+// issues are reported using Audits.issueAdded event.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#method-checkFormsIssues
+func CheckFormsIssues() *CheckFormsIssuesParams {
+ return &CheckFormsIssuesParams{}
+}
+
+// CheckFormsIssuesReturns return values.
+type CheckFormsIssuesReturns struct {
+ FormIssues []*GenericIssueDetails `json:"formIssues,omitempty"`
+}
+
+// Do executes Audits.checkFormsIssues against the provided context.
+//
+// returns:
+//
+// formIssues
+func (p *CheckFormsIssuesParams) Do(ctx context.Context) (formIssues []*GenericIssueDetails, err error) {
+ // execute
+ var res CheckFormsIssuesReturns
+ err = cdp.Execute(ctx, CommandCheckFormsIssues, nil, &res)
+ if err != nil {
+ return nil, err
+ }
+
+ return res.FormIssues, nil
+}
+
// Command names.
const (
CommandGetEncodedResponse = "Audits.getEncodedResponse"
CommandDisable = "Audits.disable"
CommandEnable = "Audits.enable"
CommandCheckContrast = "Audits.checkContrast"
+ CommandCheckFormsIssues = "Audits.checkFormsIssues"
)
diff --git a/audits/easyjson.go b/audits/easyjson.go
index 2fb1fe9..fe421c7 100644
--- a/audits/easyjson.go
+++ b/audits/easyjson.go
@@ -20,7 +20,7 @@ var (
_ easyjson.Marshaler
)
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits(in *jlexer.Lexer, out *TrustedWebActivityIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits(in *jlexer.Lexer, out *StylesheetLoadingIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -39,16 +39,28 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits(in *jlexer.Lexer, out
continue
}
switch key {
- case "url":
- out.URL = string(in.String())
- case "violationType":
- (out.ViolationType).UnmarshalEasyJSON(in)
- case "httpStatusCode":
- out.HTTPStatusCode = int64(in.Int64())
- case "packageName":
- out.PackageName = string(in.String())
- case "signature":
- out.Signature = string(in.String())
+ case "sourceCodeLocation":
+ if in.IsNull() {
+ in.Skip()
+ out.SourceCodeLocation = nil
+ } else {
+ if out.SourceCodeLocation == nil {
+ out.SourceCodeLocation = new(SourceCodeLocation)
+ }
+ (*out.SourceCodeLocation).UnmarshalEasyJSON(in)
+ }
+ case "styleSheetLoadingIssueReason":
+ (out.StyleSheetLoadingIssueReason).UnmarshalEasyJSON(in)
+ case "failedRequestInfo":
+ if in.IsNull() {
+ in.Skip()
+ out.FailedRequestInfo = nil
+ } else {
+ if out.FailedRequestInfo == nil {
+ out.FailedRequestInfo = new(FailedRequestInfo)
+ }
+ (*out.FailedRequestInfo).UnmarshalEasyJSON(in)
+ }
default:
in.SkipRecursive()
}
@@ -59,59 +71,53 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits(out *jwriter.Writer, in TrustedWebActivityIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits(out *jwriter.Writer, in StylesheetLoadingIssueDetails) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"url\":"
+ const prefix string = ",\"sourceCodeLocation\":"
out.RawString(prefix[1:])
- out.String(string(in.URL))
+ if in.SourceCodeLocation == nil {
+ out.RawString("null")
+ } else {
+ (*in.SourceCodeLocation).MarshalEasyJSON(out)
+ }
}
{
- const prefix string = ",\"violationType\":"
- out.RawString(prefix)
- (in.ViolationType).MarshalEasyJSON(out)
- }
- if in.HTTPStatusCode != 0 {
- const prefix string = ",\"httpStatusCode\":"
- out.RawString(prefix)
- out.Int64(int64(in.HTTPStatusCode))
- }
- if in.PackageName != "" {
- const prefix string = ",\"packageName\":"
+ const prefix string = ",\"styleSheetLoadingIssueReason\":"
out.RawString(prefix)
- out.String(string(in.PackageName))
+ (in.StyleSheetLoadingIssueReason).MarshalEasyJSON(out)
}
- if in.Signature != "" {
- const prefix string = ",\"signature\":"
+ if in.FailedRequestInfo != nil {
+ const prefix string = ",\"failedRequestInfo\":"
out.RawString(prefix)
- out.String(string(in.Signature))
+ (*in.FailedRequestInfo).MarshalEasyJSON(out)
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v TrustedWebActivityIssueDetails) MarshalJSON() ([]byte, error) {
+func (v StylesheetLoadingIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v TrustedWebActivityIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
+func (v StylesheetLoadingIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *TrustedWebActivityIssueDetails) UnmarshalJSON(data []byte) error {
+func (v *StylesheetLoadingIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *TrustedWebActivityIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
+func (v *StylesheetLoadingIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits(l, v)
}
func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits1(in *jlexer.Lexer, out *SourceCodeLocation) {
@@ -393,88 +399,7 @@ func (v *QuirksModeIssueDetails) UnmarshalJSON(data []byte) error {
func (v *QuirksModeIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits3(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits4(in *jlexer.Lexer, out *NavigatorUserAgentIssueDetails) {
- isTopLevel := in.IsStart()
- if in.IsNull() {
- if isTopLevel {
- in.Consumed()
- }
- in.Skip()
- return
- }
- in.Delim('{')
- for !in.IsDelim('}') {
- key := in.UnsafeFieldName(false)
- in.WantColon()
- if in.IsNull() {
- in.Skip()
- in.WantComma()
- continue
- }
- switch key {
- case "url":
- out.URL = string(in.String())
- case "location":
- if in.IsNull() {
- in.Skip()
- out.Location = nil
- } else {
- if out.Location == nil {
- out.Location = new(SourceCodeLocation)
- }
- (*out.Location).UnmarshalEasyJSON(in)
- }
- default:
- in.SkipRecursive()
- }
- in.WantComma()
- }
- in.Delim('}')
- if isTopLevel {
- in.Consumed()
- }
-}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits4(out *jwriter.Writer, in NavigatorUserAgentIssueDetails) {
- out.RawByte('{')
- first := true
- _ = first
- {
- const prefix string = ",\"url\":"
- out.RawString(prefix[1:])
- out.String(string(in.URL))
- }
- if in.Location != nil {
- const prefix string = ",\"location\":"
- out.RawString(prefix)
- (*in.Location).MarshalEasyJSON(out)
- }
- out.RawByte('}')
-}
-
-// MarshalJSON supports json.Marshaler interface
-func (v NavigatorUserAgentIssueDetails) MarshalJSON() ([]byte, error) {
- w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits4(&w, v)
- return w.Buffer.BuildBytes(), w.Error
-}
-
-// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v NavigatorUserAgentIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits4(w, v)
-}
-
-// UnmarshalJSON supports json.Unmarshaler interface
-func (v *NavigatorUserAgentIssueDetails) UnmarshalJSON(data []byte) error {
- r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits4(&r, v)
- return r.Error()
-}
-
-// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *NavigatorUserAgentIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits4(l, v)
-}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits5(in *jlexer.Lexer, out *MixedContentIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits4(in *jlexer.Lexer, out *MixedContentIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -531,7 +456,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits5(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits5(out *jwriter.Writer, in MixedContentIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits4(out *jwriter.Writer, in MixedContentIssueDetails) {
out.RawByte('{')
first := true
_ = first
@@ -577,27 +502,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits5(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v MixedContentIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits5(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits4(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v MixedContentIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits5(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits4(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *MixedContentIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits5(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits4(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *MixedContentIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits5(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits4(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits6(in *jlexer.Lexer, out *LowTextContrastIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits5(in *jlexer.Lexer, out *LowTextContrastIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -640,7 +565,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits6(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits6(out *jwriter.Writer, in LowTextContrastIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits5(out *jwriter.Writer, in LowTextContrastIssueDetails) {
out.RawByte('{')
first := true
_ = first
@@ -685,27 +610,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits6(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v LowTextContrastIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits6(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits5(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v LowTextContrastIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits6(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits5(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *LowTextContrastIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits6(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits5(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *LowTextContrastIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits6(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits5(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits7(in *jlexer.Lexer, out *InspectorIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits6(in *jlexer.Lexer, out *InspectorIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -784,16 +709,6 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits7(in *jlexer.Lexer, out
}
(*out.SharedArrayBufferIssueDetails).UnmarshalEasyJSON(in)
}
- case "twaQualityEnforcementDetails":
- if in.IsNull() {
- in.Skip()
- out.TwaQualityEnforcementDetails = nil
- } else {
- if out.TwaQualityEnforcementDetails == nil {
- out.TwaQualityEnforcementDetails = new(TrustedWebActivityIssueDetails)
- }
- (*out.TwaQualityEnforcementDetails).UnmarshalEasyJSON(in)
- }
case "lowTextContrastIssueDetails":
if in.IsNull() {
in.Skip()
@@ -834,16 +749,6 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits7(in *jlexer.Lexer, out
}
(*out.QuirksModeIssueDetails).UnmarshalEasyJSON(in)
}
- case "navigatorUserAgentIssueDetails":
- if in.IsNull() {
- in.Skip()
- out.NavigatorUserAgentIssueDetails = nil
- } else {
- if out.NavigatorUserAgentIssueDetails == nil {
- out.NavigatorUserAgentIssueDetails = new(NavigatorUserAgentIssueDetails)
- }
- (*out.NavigatorUserAgentIssueDetails).UnmarshalEasyJSON(in)
- }
case "genericIssueDetails":
if in.IsNull() {
in.Skip()
@@ -884,6 +789,36 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits7(in *jlexer.Lexer, out
}
(*out.FederatedAuthRequestIssueDetails).UnmarshalEasyJSON(in)
}
+ case "bounceTrackingIssueDetails":
+ if in.IsNull() {
+ in.Skip()
+ out.BounceTrackingIssueDetails = nil
+ } else {
+ if out.BounceTrackingIssueDetails == nil {
+ out.BounceTrackingIssueDetails = new(BounceTrackingIssueDetails)
+ }
+ (*out.BounceTrackingIssueDetails).UnmarshalEasyJSON(in)
+ }
+ case "stylesheetLoadingIssueDetails":
+ if in.IsNull() {
+ in.Skip()
+ out.StylesheetLoadingIssueDetails = nil
+ } else {
+ if out.StylesheetLoadingIssueDetails == nil {
+ out.StylesheetLoadingIssueDetails = new(StylesheetLoadingIssueDetails)
+ }
+ (*out.StylesheetLoadingIssueDetails).UnmarshalEasyJSON(in)
+ }
+ case "federatedAuthUserInfoRequestIssueDetails":
+ if in.IsNull() {
+ in.Skip()
+ out.FederatedAuthUserInfoRequestIssueDetails = nil
+ } else {
+ if out.FederatedAuthUserInfoRequestIssueDetails == nil {
+ out.FederatedAuthUserInfoRequestIssueDetails = new(FederatedAuthUserInfoRequestIssueDetails)
+ }
+ (*out.FederatedAuthUserInfoRequestIssueDetails).UnmarshalEasyJSON(in)
+ }
default:
in.SkipRecursive()
}
@@ -894,7 +829,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits7(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits7(out *jwriter.Writer, in InspectorIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits6(out *jwriter.Writer, in InspectorIssueDetails) {
out.RawByte('{')
first := true
_ = first
@@ -954,16 +889,6 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits7(out *jwriter.Writer,
}
(*in.SharedArrayBufferIssueDetails).MarshalEasyJSON(out)
}
- if in.TwaQualityEnforcementDetails != nil {
- const prefix string = ",\"twaQualityEnforcementDetails\":"
- if first {
- first = false
- out.RawString(prefix[1:])
- } else {
- out.RawString(prefix)
- }
- (*in.TwaQualityEnforcementDetails).MarshalEasyJSON(out)
- }
if in.LowTextContrastIssueDetails != nil {
const prefix string = ",\"lowTextContrastIssueDetails\":"
if first {
@@ -1004,16 +929,6 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits7(out *jwriter.Writer,
}
(*in.QuirksModeIssueDetails).MarshalEasyJSON(out)
}
- if in.NavigatorUserAgentIssueDetails != nil {
- const prefix string = ",\"navigatorUserAgentIssueDetails\":"
- if first {
- first = false
- out.RawString(prefix[1:])
- } else {
- out.RawString(prefix)
- }
- (*in.NavigatorUserAgentIssueDetails).MarshalEasyJSON(out)
- }
if in.GenericIssueDetails != nil {
const prefix string = ",\"genericIssueDetails\":"
if first {
@@ -1054,33 +969,63 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits7(out *jwriter.Writer,
}
(*in.FederatedAuthRequestIssueDetails).MarshalEasyJSON(out)
}
+ if in.BounceTrackingIssueDetails != nil {
+ const prefix string = ",\"bounceTrackingIssueDetails\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (*in.BounceTrackingIssueDetails).MarshalEasyJSON(out)
+ }
+ if in.StylesheetLoadingIssueDetails != nil {
+ const prefix string = ",\"stylesheetLoadingIssueDetails\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (*in.StylesheetLoadingIssueDetails).MarshalEasyJSON(out)
+ }
+ if in.FederatedAuthUserInfoRequestIssueDetails != nil {
+ const prefix string = ",\"federatedAuthUserInfoRequestIssueDetails\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (*in.FederatedAuthUserInfoRequestIssueDetails).MarshalEasyJSON(out)
+ }
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
func (v InspectorIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits7(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits6(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v InspectorIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits7(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits6(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *InspectorIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits7(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits6(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *InspectorIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits7(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits6(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits8(in *jlexer.Lexer, out *InspectorIssue) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits7(in *jlexer.Lexer, out *InspectorIssue) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1123,7 +1068,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits8(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits8(out *jwriter.Writer, in InspectorIssue) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits7(out *jwriter.Writer, in InspectorIssue) {
out.RawByte('{')
first := true
_ = first
@@ -1152,27 +1097,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits8(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v InspectorIssue) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits8(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits7(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v InspectorIssue) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits8(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits7(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *InspectorIssue) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits8(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits7(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *InspectorIssue) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits8(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits7(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits9(in *jlexer.Lexer, out *HeavyAdIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits8(in *jlexer.Lexer, out *HeavyAdIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1215,7 +1160,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits9(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits9(out *jwriter.Writer, in HeavyAdIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits8(out *jwriter.Writer, in HeavyAdIssueDetails) {
out.RawByte('{')
first := true
_ = first
@@ -1244,27 +1189,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits9(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v HeavyAdIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits9(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits8(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v HeavyAdIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits9(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits8(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *HeavyAdIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits9(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits8(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *HeavyAdIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits9(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits8(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits10(in *jlexer.Lexer, out *GetEncodedResponseReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits9(in *jlexer.Lexer, out *GetEncodedResponseReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1299,7 +1244,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits10(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits10(out *jwriter.Writer, in GetEncodedResponseReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits9(out *jwriter.Writer, in GetEncodedResponseReturns) {
out.RawByte('{')
first := true
_ = first
@@ -1335,27 +1280,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits10(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v GetEncodedResponseReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits10(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits9(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetEncodedResponseReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits10(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits9(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetEncodedResponseReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits10(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits9(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetEncodedResponseReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits10(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits9(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits11(in *jlexer.Lexer, out *GetEncodedResponseParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits10(in *jlexer.Lexer, out *GetEncodedResponseParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1392,7 +1337,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits11(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits11(out *jwriter.Writer, in GetEncodedResponseParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits10(out *jwriter.Writer, in GetEncodedResponseParams) {
out.RawByte('{')
first := true
_ = first
@@ -1422,27 +1367,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits11(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v GetEncodedResponseParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits11(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits10(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetEncodedResponseParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits11(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits10(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetEncodedResponseParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits11(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits10(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetEncodedResponseParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits11(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits10(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits12(in *jlexer.Lexer, out *GenericIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits11(in *jlexer.Lexer, out *GenericIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1467,6 +1412,18 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits12(in *jlexer.Lexer, ou
(out.FrameID).UnmarshalEasyJSON(in)
case "violatingNodeId":
(out.ViolatingNodeID).UnmarshalEasyJSON(in)
+ case "violatingNodeAttribute":
+ out.ViolatingNodeAttribute = string(in.String())
+ case "request":
+ if in.IsNull() {
+ in.Skip()
+ out.Request = nil
+ } else {
+ if out.Request == nil {
+ out.Request = new(AffectedRequest)
+ }
+ (*out.Request).UnmarshalEasyJSON(in)
+ }
default:
in.SkipRecursive()
}
@@ -1477,7 +1434,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits12(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits12(out *jwriter.Writer, in GenericIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits11(out *jwriter.Writer, in GenericIssueDetails) {
out.RawByte('{')
first := true
_ = first
@@ -1496,33 +1453,43 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits12(out *jwriter.Writer,
out.RawString(prefix)
out.Int64(int64(in.ViolatingNodeID))
}
+ if in.ViolatingNodeAttribute != "" {
+ const prefix string = ",\"violatingNodeAttribute\":"
+ out.RawString(prefix)
+ out.String(string(in.ViolatingNodeAttribute))
+ }
+ if in.Request != nil {
+ const prefix string = ",\"request\":"
+ out.RawString(prefix)
+ (*in.Request).MarshalEasyJSON(out)
+ }
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
func (v GenericIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits12(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits11(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GenericIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits12(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits11(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GenericIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits12(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits11(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GenericIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits12(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits11(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits13(in *jlexer.Lexer, out *FederatedAuthRequestIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits12(in *jlexer.Lexer, out *FederatedAuthUserInfoRequestIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1541,8 +1508,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits13(in *jlexer.Lexer, ou
continue
}
switch key {
- case "federatedAuthRequestIssueReason":
- (out.FederatedAuthRequestIssueReason).UnmarshalEasyJSON(in)
+ case "federatedAuthUserInfoRequestIssueReason":
+ (out.FederatedAuthUserInfoRequestIssueReason).UnmarshalEasyJSON(in)
default:
in.SkipRecursive()
}
@@ -1553,20 +1520,86 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits13(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits13(out *jwriter.Writer, in FederatedAuthRequestIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits12(out *jwriter.Writer, in FederatedAuthUserInfoRequestIssueDetails) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"federatedAuthRequestIssueReason\":"
+ const prefix string = ",\"federatedAuthUserInfoRequestIssueReason\":"
out.RawString(prefix[1:])
- (in.FederatedAuthRequestIssueReason).MarshalEasyJSON(out)
+ (in.FederatedAuthUserInfoRequestIssueReason).MarshalEasyJSON(out)
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v FederatedAuthRequestIssueDetails) MarshalJSON() ([]byte, error) {
+func (v FederatedAuthUserInfoRequestIssueDetails) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits12(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v FederatedAuthUserInfoRequestIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits12(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *FederatedAuthUserInfoRequestIssueDetails) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits12(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *FederatedAuthUserInfoRequestIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits12(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits13(in *jlexer.Lexer, out *FederatedAuthRequestIssueDetails) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "federatedAuthRequestIssueReason":
+ (out.FederatedAuthRequestIssueReason).UnmarshalEasyJSON(in)
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits13(out *jwriter.Writer, in FederatedAuthRequestIssueDetails) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"federatedAuthRequestIssueReason\":"
+ out.RawString(prefix[1:])
+ (in.FederatedAuthRequestIssueReason).MarshalEasyJSON(out)
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v FederatedAuthRequestIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits13(&w, v)
return w.Buffer.BuildBytes(), w.Error
@@ -1588,7 +1621,87 @@ func (v *FederatedAuthRequestIssueDetails) UnmarshalJSON(data []byte) error {
func (v *FederatedAuthRequestIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits13(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits14(in *jlexer.Lexer, out *EventIssueAdded) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits14(in *jlexer.Lexer, out *FailedRequestInfo) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "url":
+ out.URL = string(in.String())
+ case "failureMessage":
+ out.FailureMessage = string(in.String())
+ case "requestId":
+ out.RequestID = network.RequestID(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits14(out *jwriter.Writer, in FailedRequestInfo) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"url\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.URL))
+ }
+ {
+ const prefix string = ",\"failureMessage\":"
+ out.RawString(prefix)
+ out.String(string(in.FailureMessage))
+ }
+ if in.RequestID != "" {
+ const prefix string = ",\"requestId\":"
+ out.RawString(prefix)
+ out.String(string(in.RequestID))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v FailedRequestInfo) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits14(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v FailedRequestInfo) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits14(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *FailedRequestInfo) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits14(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *FailedRequestInfo) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits14(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits15(in *jlexer.Lexer, out *EventIssueAdded) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1627,7 +1740,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits14(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits14(out *jwriter.Writer, in EventIssueAdded) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits15(out *jwriter.Writer, in EventIssueAdded) {
out.RawByte('{')
first := true
_ = first
@@ -1646,27 +1759,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits14(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v EventIssueAdded) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits14(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits15(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventIssueAdded) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits14(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits15(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventIssueAdded) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits14(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits15(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventIssueAdded) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits14(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits15(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits15(in *jlexer.Lexer, out *EnableParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits16(in *jlexer.Lexer, out *EnableParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1695,7 +1808,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits15(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits15(out *jwriter.Writer, in EnableParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits16(out *jwriter.Writer, in EnableParams) {
out.RawByte('{')
first := true
_ = first
@@ -1705,27 +1818,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits15(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v EnableParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits15(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits16(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EnableParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits15(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits16(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EnableParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits15(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits16(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EnableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits15(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits16(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits16(in *jlexer.Lexer, out *DisableParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits17(in *jlexer.Lexer, out *DisableParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1754,7 +1867,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits16(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits16(out *jwriter.Writer, in DisableParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits17(out *jwriter.Writer, in DisableParams) {
out.RawByte('{')
first := true
_ = first
@@ -1764,27 +1877,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits16(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v DisableParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits16(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits17(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v DisableParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits16(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits17(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *DisableParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits16(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits17(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *DisableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits16(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits17(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits17(in *jlexer.Lexer, out *DeprecationIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits18(in *jlexer.Lexer, out *DeprecationIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1824,7 +1937,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits17(in *jlexer.Lexer, ou
(*out.SourceCodeLocation).UnmarshalEasyJSON(in)
}
case "type":
- (out.Type).UnmarshalEasyJSON(in)
+ out.Type = string(in.String())
default:
in.SkipRecursive()
}
@@ -1835,7 +1948,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits17(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits17(out *jwriter.Writer, in DeprecationIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits18(out *jwriter.Writer, in DeprecationIssueDetails) {
out.RawByte('{')
first := true
_ = first
@@ -1862,7 +1975,7 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits17(out *jwriter.Writer,
{
const prefix string = ",\"type\":"
out.RawString(prefix)
- (in.Type).MarshalEasyJSON(out)
+ out.String(string(in.Type))
}
out.RawByte('}')
}
@@ -1870,27 +1983,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits17(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v DeprecationIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits17(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits18(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v DeprecationIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits17(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits18(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *DeprecationIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits17(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits18(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *DeprecationIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits17(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits18(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits18(in *jlexer.Lexer, out *CorsIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits19(in *jlexer.Lexer, out *CorsIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1965,7 +2078,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits18(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits18(out *jwriter.Writer, in CorsIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits19(out *jwriter.Writer, in CorsIssueDetails) {
out.RawByte('{')
first := true
_ = first
@@ -2018,27 +2131,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits18(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v CorsIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits18(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits19(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CorsIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits18(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits19(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CorsIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits18(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits19(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CorsIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits18(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits19(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits19(in *jlexer.Lexer, out *CookieIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits20(in *jlexer.Lexer, out *CookieIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2141,7 +2254,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits19(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits19(out *jwriter.Writer, in CookieIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits20(out *jwriter.Writer, in CookieIssueDetails) {
out.RawByte('{')
first := true
_ = first
@@ -2224,27 +2337,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits19(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v CookieIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits19(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits20(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CookieIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits19(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits20(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CookieIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits19(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits20(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CookieIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits19(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits20(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits20(in *jlexer.Lexer, out *ContentSecurityPolicyIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits21(in *jlexer.Lexer, out *ContentSecurityPolicyIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2303,7 +2416,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits20(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits20(out *jwriter.Writer, in ContentSecurityPolicyIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits21(out *jwriter.Writer, in ContentSecurityPolicyIssueDetails) {
out.RawByte('{')
first := true
_ = first
@@ -2354,27 +2467,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits20(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v ContentSecurityPolicyIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits20(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits21(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ContentSecurityPolicyIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits20(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits21(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ContentSecurityPolicyIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits20(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits21(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ContentSecurityPolicyIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits20(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits21(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits21(in *jlexer.Lexer, out *ClientHintIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits22(in *jlexer.Lexer, out *ClientHintIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2415,7 +2528,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits21(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits21(out *jwriter.Writer, in ClientHintIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits22(out *jwriter.Writer, in ClientHintIssueDetails) {
out.RawByte('{')
first := true
_ = first
@@ -2439,27 +2552,195 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits21(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v ClientHintIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits21(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits22(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ClientHintIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits21(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits22(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ClientHintIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits21(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits22(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ClientHintIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits21(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits22(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits22(in *jlexer.Lexer, out *CheckContrastParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits23(in *jlexer.Lexer, out *CheckFormsIssuesReturns) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "formIssues":
+ if in.IsNull() {
+ in.Skip()
+ out.FormIssues = nil
+ } else {
+ in.Delim('[')
+ if out.FormIssues == nil {
+ if !in.IsDelim(']') {
+ out.FormIssues = make([]*GenericIssueDetails, 0, 8)
+ } else {
+ out.FormIssues = []*GenericIssueDetails{}
+ }
+ } else {
+ out.FormIssues = (out.FormIssues)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v7 *GenericIssueDetails
+ if in.IsNull() {
+ in.Skip()
+ v7 = nil
+ } else {
+ if v7 == nil {
+ v7 = new(GenericIssueDetails)
+ }
+ (*v7).UnmarshalEasyJSON(in)
+ }
+ out.FormIssues = append(out.FormIssues, v7)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits23(out *jwriter.Writer, in CheckFormsIssuesReturns) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ if len(in.FormIssues) != 0 {
+ const prefix string = ",\"formIssues\":"
+ first = false
+ out.RawString(prefix[1:])
+ {
+ out.RawByte('[')
+ for v8, v9 := range in.FormIssues {
+ if v8 > 0 {
+ out.RawByte(',')
+ }
+ if v9 == nil {
+ out.RawString("null")
+ } else {
+ (*v9).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v CheckFormsIssuesReturns) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits23(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v CheckFormsIssuesReturns) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits23(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *CheckFormsIssuesReturns) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits23(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *CheckFormsIssuesReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits23(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits24(in *jlexer.Lexer, out *CheckFormsIssuesParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits24(out *jwriter.Writer, in CheckFormsIssuesParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v CheckFormsIssuesParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits24(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v CheckFormsIssuesParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits24(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *CheckFormsIssuesParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits24(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *CheckFormsIssuesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits24(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits25(in *jlexer.Lexer, out *CheckContrastParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2490,7 +2771,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits22(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits22(out *jwriter.Writer, in CheckContrastParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits25(out *jwriter.Writer, in CheckContrastParams) {
out.RawByte('{')
first := true
_ = first
@@ -2506,27 +2787,125 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits22(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v CheckContrastParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits22(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits25(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CheckContrastParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits22(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits25(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CheckContrastParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits22(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits25(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CheckContrastParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits22(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits25(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits26(in *jlexer.Lexer, out *BounceTrackingIssueDetails) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "trackingSites":
+ if in.IsNull() {
+ in.Skip()
+ out.TrackingSites = nil
+ } else {
+ in.Delim('[')
+ if out.TrackingSites == nil {
+ if !in.IsDelim(']') {
+ out.TrackingSites = make([]string, 0, 4)
+ } else {
+ out.TrackingSites = []string{}
+ }
+ } else {
+ out.TrackingSites = (out.TrackingSites)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v10 string
+ v10 = string(in.String())
+ out.TrackingSites = append(out.TrackingSites, v10)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits26(out *jwriter.Writer, in BounceTrackingIssueDetails) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"trackingSites\":"
+ out.RawString(prefix[1:])
+ if in.TrackingSites == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v11, v12 := range in.TrackingSites {
+ if v11 > 0 {
+ out.RawByte(',')
+ }
+ out.String(string(v12))
+ }
+ out.RawByte(']')
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v BounceTrackingIssueDetails) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits26(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v BounceTrackingIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits26(w, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits23(in *jlexer.Lexer, out *BlockedByResponseIssueDetails) {
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *BounceTrackingIssueDetails) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits26(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *BounceTrackingIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits26(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits27(in *jlexer.Lexer, out *BlockedByResponseIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2587,7 +2966,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits23(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits23(out *jwriter.Writer, in BlockedByResponseIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits27(out *jwriter.Writer, in BlockedByResponseIssueDetails) {
out.RawByte('{')
first := true
_ = first
@@ -2621,27 +3000,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits23(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v BlockedByResponseIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits23(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits27(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v BlockedByResponseIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits23(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits27(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *BlockedByResponseIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits23(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits27(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *BlockedByResponseIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits23(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits27(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits24(in *jlexer.Lexer, out *AttributionReportingIssueDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits28(in *jlexer.Lexer, out *AttributionReportingIssueDetails) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2686,7 +3065,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits24(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits24(out *jwriter.Writer, in AttributionReportingIssueDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits28(out *jwriter.Writer, in AttributionReportingIssueDetails) {
out.RawByte('{')
first := true
_ = first
@@ -2716,27 +3095,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits24(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v AttributionReportingIssueDetails) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits24(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits28(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AttributionReportingIssueDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits24(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits28(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AttributionReportingIssueDetails) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits24(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits28(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AttributionReportingIssueDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits24(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits28(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits25(in *jlexer.Lexer, out *AffectedRequest) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits29(in *jlexer.Lexer, out *AffectedRequest) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2769,7 +3148,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits25(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits25(out *jwriter.Writer, in AffectedRequest) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits29(out *jwriter.Writer, in AffectedRequest) {
out.RawByte('{')
first := true
_ = first
@@ -2789,27 +3168,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits25(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v AffectedRequest) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits25(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits29(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AffectedRequest) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits25(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits29(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AffectedRequest) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits25(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits29(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AffectedRequest) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits25(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits29(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits26(in *jlexer.Lexer, out *AffectedFrame) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits30(in *jlexer.Lexer, out *AffectedFrame) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2840,7 +3219,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits26(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits26(out *jwriter.Writer, in AffectedFrame) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits30(out *jwriter.Writer, in AffectedFrame) {
out.RawByte('{')
first := true
_ = first
@@ -2855,27 +3234,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits26(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v AffectedFrame) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits26(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits30(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AffectedFrame) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits26(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits30(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AffectedFrame) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits26(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits30(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AffectedFrame) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits26(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits30(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits27(in *jlexer.Lexer, out *AffectedCookie) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits31(in *jlexer.Lexer, out *AffectedCookie) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2910,7 +3289,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits27(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits27(out *jwriter.Writer, in AffectedCookie) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits31(out *jwriter.Writer, in AffectedCookie) {
out.RawByte('{')
first := true
_ = first
@@ -2935,23 +3314,23 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits27(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v AffectedCookie) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits27(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits31(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AffectedCookie) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits27(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAudits31(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AffectedCookie) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits27(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits31(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AffectedCookie) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits27(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAudits31(l, v)
}
diff --git a/audits/types.go b/audits/types.go
index 4a9907e..a3f9f59 100644
--- a/audits/types.go
+++ b/audits/types.go
@@ -59,6 +59,7 @@ const (
CookieExclusionReasonExcludeSamePartyCrossPartyContext CookieExclusionReason = "ExcludeSamePartyCrossPartyContext"
CookieExclusionReasonExcludeDomainNonASCII CookieExclusionReason = "ExcludeDomainNonASCII"
CookieExclusionReasonExcludeThirdPartyCookieBlockedInFirstPartySet CookieExclusionReason = "ExcludeThirdPartyCookieBlockedInFirstPartySet"
+ CookieExclusionReasonExcludeThirdPartyPhaseout CookieExclusionReason = "ExcludeThirdPartyPhaseout"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
@@ -91,6 +92,8 @@ func (t *CookieExclusionReason) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = CookieExclusionReasonExcludeDomainNonASCII
case CookieExclusionReasonExcludeThirdPartyCookieBlockedInFirstPartySet:
*t = CookieExclusionReasonExcludeThirdPartyCookieBlockedInFirstPartySet
+ case CookieExclusionReasonExcludeThirdPartyPhaseout:
+ *t = CookieExclusionReasonExcludeThirdPartyPhaseout
default:
in.AddError(fmt.Errorf("unknown CookieExclusionReason value: %v", v))
@@ -124,6 +127,7 @@ const (
CookieWarningReasonWarnSameSiteLaxCrossDowngradeLax CookieWarningReason = "WarnSameSiteLaxCrossDowngradeLax"
CookieWarningReasonWarnAttributeValueExceedsMaxSize CookieWarningReason = "WarnAttributeValueExceedsMaxSize"
CookieWarningReasonWarnDomainNonASCII CookieWarningReason = "WarnDomainNonASCII"
+ CookieWarningReasonWarnThirdPartyPhaseout CookieWarningReason = "WarnThirdPartyPhaseout"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
@@ -160,6 +164,8 @@ func (t *CookieWarningReason) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = CookieWarningReasonWarnAttributeValueExceedsMaxSize
case CookieWarningReasonWarnDomainNonASCII:
*t = CookieWarningReasonWarnDomainNonASCII
+ case CookieWarningReasonWarnThirdPartyPhaseout:
+ *t = CookieWarningReasonWarnThirdPartyPhaseout
default:
in.AddError(fmt.Errorf("unknown CookieWarningReason value: %v", v))
@@ -717,65 +723,6 @@ type SharedArrayBufferIssueDetails struct {
Type SharedArrayBufferIssueType `json:"type"`
}
-// TwaQualityEnforcementViolationType [no description].
-//
-// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-TwaQualityEnforcementViolationType
-type TwaQualityEnforcementViolationType string
-
-// String returns the TwaQualityEnforcementViolationType as string value.
-func (t TwaQualityEnforcementViolationType) String() string {
- return string(t)
-}
-
-// TwaQualityEnforcementViolationType values.
-const (
- TwaQualityEnforcementViolationTypeKHTTPError TwaQualityEnforcementViolationType = "kHttpError"
- TwaQualityEnforcementViolationTypeKUnavailableOffline TwaQualityEnforcementViolationType = "kUnavailableOffline"
- TwaQualityEnforcementViolationTypeKDigitalAssetLinks TwaQualityEnforcementViolationType = "kDigitalAssetLinks"
-)
-
-// MarshalEasyJSON satisfies easyjson.Marshaler.
-func (t TwaQualityEnforcementViolationType) MarshalEasyJSON(out *jwriter.Writer) {
- out.String(string(t))
-}
-
-// MarshalJSON satisfies json.Marshaler.
-func (t TwaQualityEnforcementViolationType) MarshalJSON() ([]byte, error) {
- return easyjson.Marshal(t)
-}
-
-// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
-func (t *TwaQualityEnforcementViolationType) UnmarshalEasyJSON(in *jlexer.Lexer) {
- v := in.String()
- switch TwaQualityEnforcementViolationType(v) {
- case TwaQualityEnforcementViolationTypeKHTTPError:
- *t = TwaQualityEnforcementViolationTypeKHTTPError
- case TwaQualityEnforcementViolationTypeKUnavailableOffline:
- *t = TwaQualityEnforcementViolationTypeKUnavailableOffline
- case TwaQualityEnforcementViolationTypeKDigitalAssetLinks:
- *t = TwaQualityEnforcementViolationTypeKDigitalAssetLinks
-
- default:
- in.AddError(fmt.Errorf("unknown TwaQualityEnforcementViolationType value: %v", v))
- }
-}
-
-// UnmarshalJSON satisfies json.Unmarshaler.
-func (t *TwaQualityEnforcementViolationType) UnmarshalJSON(buf []byte) error {
- return easyjson.Unmarshal(buf, t)
-}
-
-// TrustedWebActivityIssueDetails [no description].
-//
-// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-TrustedWebActivityIssueDetails
-type TrustedWebActivityIssueDetails struct {
- URL string `json:"url"` // The url that triggers the violation.
- ViolationType TwaQualityEnforcementViolationType `json:"violationType"`
- HTTPStatusCode int64 `json:"httpStatusCode,omitempty"`
- PackageName string `json:"packageName,omitempty"` // The package name of the Trusted Web Activity client app. This field is only used when violation type is kDigitalAssetLinks.
- Signature string `json:"signature,omitempty"` // The signature of the Trusted Web Activity client app. This field is only used when violation type is kDigitalAssetLinks.
-}
-
// LowTextContrastIssueDetails [no description].
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-LowTextContrastIssueDetails
@@ -815,17 +762,21 @@ func (t AttributionReportingIssueType) String() string {
// AttributionReportingIssueType values.
const (
- AttributionReportingIssueTypePermissionPolicyDisabled AttributionReportingIssueType = "PermissionPolicyDisabled"
- AttributionReportingIssueTypePermissionPolicyNotDelegated AttributionReportingIssueType = "PermissionPolicyNotDelegated"
- AttributionReportingIssueTypeUntrustworthyReportingOrigin AttributionReportingIssueType = "UntrustworthyReportingOrigin"
- AttributionReportingIssueTypeInsecureContext AttributionReportingIssueType = "InsecureContext"
- AttributionReportingIssueTypeInvalidHeader AttributionReportingIssueType = "InvalidHeader"
- AttributionReportingIssueTypeInvalidRegisterTriggerHeader AttributionReportingIssueType = "InvalidRegisterTriggerHeader"
- AttributionReportingIssueTypeInvalidEligibleHeader AttributionReportingIssueType = "InvalidEligibleHeader"
- AttributionReportingIssueTypeTooManyConcurrentRequests AttributionReportingIssueType = "TooManyConcurrentRequests"
- AttributionReportingIssueTypeSourceAndTriggerHeaders AttributionReportingIssueType = "SourceAndTriggerHeaders"
- AttributionReportingIssueTypeSourceIgnored AttributionReportingIssueType = "SourceIgnored"
- AttributionReportingIssueTypeTriggerIgnored AttributionReportingIssueType = "TriggerIgnored"
+ AttributionReportingIssueTypePermissionPolicyDisabled AttributionReportingIssueType = "PermissionPolicyDisabled"
+ AttributionReportingIssueTypeUntrustworthyReportingOrigin AttributionReportingIssueType = "UntrustworthyReportingOrigin"
+ AttributionReportingIssueTypeInsecureContext AttributionReportingIssueType = "InsecureContext"
+ AttributionReportingIssueTypeInvalidHeader AttributionReportingIssueType = "InvalidHeader"
+ AttributionReportingIssueTypeInvalidRegisterTriggerHeader AttributionReportingIssueType = "InvalidRegisterTriggerHeader"
+ AttributionReportingIssueTypeSourceAndTriggerHeaders AttributionReportingIssueType = "SourceAndTriggerHeaders"
+ AttributionReportingIssueTypeSourceIgnored AttributionReportingIssueType = "SourceIgnored"
+ AttributionReportingIssueTypeTriggerIgnored AttributionReportingIssueType = "TriggerIgnored"
+ AttributionReportingIssueTypeOsSourceIgnored AttributionReportingIssueType = "OsSourceIgnored"
+ AttributionReportingIssueTypeOsTriggerIgnored AttributionReportingIssueType = "OsTriggerIgnored"
+ AttributionReportingIssueTypeInvalidRegisterOsSourceHeader AttributionReportingIssueType = "InvalidRegisterOsSourceHeader"
+ AttributionReportingIssueTypeInvalidRegisterOsTriggerHeader AttributionReportingIssueType = "InvalidRegisterOsTriggerHeader"
+ AttributionReportingIssueTypeWebAndOsHeaders AttributionReportingIssueType = "WebAndOsHeaders"
+ AttributionReportingIssueTypeNoWebOrOsSupport AttributionReportingIssueType = "NoWebOrOsSupport"
+ AttributionReportingIssueTypeNavigationRegistrationWithoutTransientUserActivation AttributionReportingIssueType = "NavigationRegistrationWithoutTransientUserActivation"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
@@ -844,8 +795,6 @@ func (t *AttributionReportingIssueType) UnmarshalEasyJSON(in *jlexer.Lexer) {
switch AttributionReportingIssueType(v) {
case AttributionReportingIssueTypePermissionPolicyDisabled:
*t = AttributionReportingIssueTypePermissionPolicyDisabled
- case AttributionReportingIssueTypePermissionPolicyNotDelegated:
- *t = AttributionReportingIssueTypePermissionPolicyNotDelegated
case AttributionReportingIssueTypeUntrustworthyReportingOrigin:
*t = AttributionReportingIssueTypeUntrustworthyReportingOrigin
case AttributionReportingIssueTypeInsecureContext:
@@ -854,16 +803,26 @@ func (t *AttributionReportingIssueType) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = AttributionReportingIssueTypeInvalidHeader
case AttributionReportingIssueTypeInvalidRegisterTriggerHeader:
*t = AttributionReportingIssueTypeInvalidRegisterTriggerHeader
- case AttributionReportingIssueTypeInvalidEligibleHeader:
- *t = AttributionReportingIssueTypeInvalidEligibleHeader
- case AttributionReportingIssueTypeTooManyConcurrentRequests:
- *t = AttributionReportingIssueTypeTooManyConcurrentRequests
case AttributionReportingIssueTypeSourceAndTriggerHeaders:
*t = AttributionReportingIssueTypeSourceAndTriggerHeaders
case AttributionReportingIssueTypeSourceIgnored:
*t = AttributionReportingIssueTypeSourceIgnored
case AttributionReportingIssueTypeTriggerIgnored:
*t = AttributionReportingIssueTypeTriggerIgnored
+ case AttributionReportingIssueTypeOsSourceIgnored:
+ *t = AttributionReportingIssueTypeOsSourceIgnored
+ case AttributionReportingIssueTypeOsTriggerIgnored:
+ *t = AttributionReportingIssueTypeOsTriggerIgnored
+ case AttributionReportingIssueTypeInvalidRegisterOsSourceHeader:
+ *t = AttributionReportingIssueTypeInvalidRegisterOsSourceHeader
+ case AttributionReportingIssueTypeInvalidRegisterOsTriggerHeader:
+ *t = AttributionReportingIssueTypeInvalidRegisterOsTriggerHeader
+ case AttributionReportingIssueTypeWebAndOsHeaders:
+ *t = AttributionReportingIssueTypeWebAndOsHeaders
+ case AttributionReportingIssueTypeNoWebOrOsSupport:
+ *t = AttributionReportingIssueTypeNoWebOrOsSupport
+ case AttributionReportingIssueTypeNavigationRegistrationWithoutTransientUserActivation:
+ *t = AttributionReportingIssueTypeNavigationRegistrationWithoutTransientUserActivation
default:
in.AddError(fmt.Errorf("unknown AttributionReportingIssueType value: %v", v))
@@ -899,14 +858,6 @@ type QuirksModeIssueDetails struct {
LoaderID cdp.LoaderID `json:"loaderId"`
}
-// NavigatorUserAgentIssueDetails [no description].
-//
-// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-NavigatorUserAgentIssueDetails
-type NavigatorUserAgentIssueDetails struct {
- URL string `json:"url"`
- Location *SourceCodeLocation `json:"location,omitempty"`
-}
-
// GenericIssueErrorType [no description].
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-GenericIssueErrorType
@@ -919,8 +870,18 @@ func (t GenericIssueErrorType) String() string {
// GenericIssueErrorType values.
const (
- GenericIssueErrorTypeCrossOriginPortalPostMessageError GenericIssueErrorType = "CrossOriginPortalPostMessageError"
- GenericIssueErrorTypeFormLabelForNameError GenericIssueErrorType = "FormLabelForNameError"
+ GenericIssueErrorTypeCrossOriginPortalPostMessageError GenericIssueErrorType = "CrossOriginPortalPostMessageError"
+ GenericIssueErrorTypeFormLabelForNameError GenericIssueErrorType = "FormLabelForNameError"
+ GenericIssueErrorTypeFormDuplicateIDForInputError GenericIssueErrorType = "FormDuplicateIdForInputError"
+ GenericIssueErrorTypeFormInputWithNoLabelError GenericIssueErrorType = "FormInputWithNoLabelError"
+ GenericIssueErrorTypeFormAutocompleteAttributeEmptyError GenericIssueErrorType = "FormAutocompleteAttributeEmptyError"
+ GenericIssueErrorTypeFormEmptyIDAndNameAttributesForInputError GenericIssueErrorType = "FormEmptyIdAndNameAttributesForInputError"
+ GenericIssueErrorTypeFormAriaLabelledByToNonExistingID GenericIssueErrorType = "FormAriaLabelledByToNonExistingId"
+ GenericIssueErrorTypeFormInputAssignedAutocompleteValueToIDOrNameAttributeError GenericIssueErrorType = "FormInputAssignedAutocompleteValueToIdOrNameAttributeError"
+ GenericIssueErrorTypeFormLabelHasNeitherForNorNestedInput GenericIssueErrorType = "FormLabelHasNeitherForNorNestedInput"
+ GenericIssueErrorTypeFormLabelForMatchesNonExistingIDError GenericIssueErrorType = "FormLabelForMatchesNonExistingIdError"
+ GenericIssueErrorTypeFormInputHasWrongButWellIntendedAutocompleteValueError GenericIssueErrorType = "FormInputHasWrongButWellIntendedAutocompleteValueError"
+ GenericIssueErrorTypeResponseWasBlockedByORB GenericIssueErrorType = "ResponseWasBlockedByORB"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
@@ -941,6 +902,26 @@ func (t *GenericIssueErrorType) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = GenericIssueErrorTypeCrossOriginPortalPostMessageError
case GenericIssueErrorTypeFormLabelForNameError:
*t = GenericIssueErrorTypeFormLabelForNameError
+ case GenericIssueErrorTypeFormDuplicateIDForInputError:
+ *t = GenericIssueErrorTypeFormDuplicateIDForInputError
+ case GenericIssueErrorTypeFormInputWithNoLabelError:
+ *t = GenericIssueErrorTypeFormInputWithNoLabelError
+ case GenericIssueErrorTypeFormAutocompleteAttributeEmptyError:
+ *t = GenericIssueErrorTypeFormAutocompleteAttributeEmptyError
+ case GenericIssueErrorTypeFormEmptyIDAndNameAttributesForInputError:
+ *t = GenericIssueErrorTypeFormEmptyIDAndNameAttributesForInputError
+ case GenericIssueErrorTypeFormAriaLabelledByToNonExistingID:
+ *t = GenericIssueErrorTypeFormAriaLabelledByToNonExistingID
+ case GenericIssueErrorTypeFormInputAssignedAutocompleteValueToIDOrNameAttributeError:
+ *t = GenericIssueErrorTypeFormInputAssignedAutocompleteValueToIDOrNameAttributeError
+ case GenericIssueErrorTypeFormLabelHasNeitherForNorNestedInput:
+ *t = GenericIssueErrorTypeFormLabelHasNeitherForNorNestedInput
+ case GenericIssueErrorTypeFormLabelForMatchesNonExistingIDError:
+ *t = GenericIssueErrorTypeFormLabelForMatchesNonExistingIDError
+ case GenericIssueErrorTypeFormInputHasWrongButWellIntendedAutocompleteValueError:
+ *t = GenericIssueErrorTypeFormInputHasWrongButWellIntendedAutocompleteValueError
+ case GenericIssueErrorTypeResponseWasBlockedByORB:
+ *t = GenericIssueErrorTypeResponseWasBlockedByORB
default:
in.AddError(fmt.Errorf("unknown GenericIssueErrorType value: %v", v))
@@ -957,213 +938,11 @@ func (t *GenericIssueErrorType) UnmarshalJSON(buf []byte) error {
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-GenericIssueDetails
type GenericIssueDetails struct {
- ErrorType GenericIssueErrorType `json:"errorType"` // Issues with the same errorType are aggregated in the frontend.
- FrameID cdp.FrameID `json:"frameId,omitempty"`
- ViolatingNodeID cdp.BackendNodeID `json:"violatingNodeId,omitempty"`
-}
-
-// DeprecationIssueType [no description].
-//
-// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-DeprecationIssueType
-type DeprecationIssueType string
-
-// String returns the DeprecationIssueType as string value.
-func (t DeprecationIssueType) String() string {
- return string(t)
-}
-
-// DeprecationIssueType values.
-const (
- DeprecationIssueTypeAuthorizationCoveredByWildcard DeprecationIssueType = "AuthorizationCoveredByWildcard"
- DeprecationIssueTypeCanRequestURLHTTPContainingNewline DeprecationIssueType = "CanRequestURLHTTPContainingNewline"
- DeprecationIssueTypeChromeLoadTimesConnectionInfo DeprecationIssueType = "ChromeLoadTimesConnectionInfo"
- DeprecationIssueTypeChromeLoadTimesFirstPaintAfterLoadTime DeprecationIssueType = "ChromeLoadTimesFirstPaintAfterLoadTime"
- DeprecationIssueTypeChromeLoadTimesWasAlternateProtocolAvailable DeprecationIssueType = "ChromeLoadTimesWasAlternateProtocolAvailable"
- DeprecationIssueTypeCookieWithTruncatingChar DeprecationIssueType = "CookieWithTruncatingChar"
- DeprecationIssueTypeCrossOriginAccessBasedOnDocumentDomain DeprecationIssueType = "CrossOriginAccessBasedOnDocumentDomain"
- DeprecationIssueTypeCrossOriginWindowAlert DeprecationIssueType = "CrossOriginWindowAlert"
- DeprecationIssueTypeCrossOriginWindowConfirm DeprecationIssueType = "CrossOriginWindowConfirm"
- DeprecationIssueTypeCSSSelectorInternalMediaControlsOverlayCastButton DeprecationIssueType = "CSSSelectorInternalMediaControlsOverlayCastButton"
- DeprecationIssueTypeDeprecationExample DeprecationIssueType = "DeprecationExample"
- DeprecationIssueTypeDocumentDomainSettingWithoutOriginAgentClusterHeader DeprecationIssueType = "DocumentDomainSettingWithoutOriginAgentClusterHeader"
- DeprecationIssueTypeEventPath DeprecationIssueType = "EventPath"
- DeprecationIssueTypeExpectCTHeader DeprecationIssueType = "ExpectCTHeader"
- DeprecationIssueTypeGeolocationInsecureOrigin DeprecationIssueType = "GeolocationInsecureOrigin"
- DeprecationIssueTypeGeolocationInsecureOriginDeprecatedNotRemoved DeprecationIssueType = "GeolocationInsecureOriginDeprecatedNotRemoved"
- DeprecationIssueTypeGetUserMediaInsecureOrigin DeprecationIssueType = "GetUserMediaInsecureOrigin"
- DeprecationIssueTypeHostCandidateAttributeGetter DeprecationIssueType = "HostCandidateAttributeGetter"
- DeprecationIssueTypeIdentityInCanMakePaymentEvent DeprecationIssueType = "IdentityInCanMakePaymentEvent"
- DeprecationIssueTypeInsecurePrivateNetworkSubresourceRequest DeprecationIssueType = "InsecurePrivateNetworkSubresourceRequest"
- DeprecationIssueTypeLocalCSSFileExtensionRejected DeprecationIssueType = "LocalCSSFileExtensionRejected"
- DeprecationIssueTypeMediaSourceAbortRemove DeprecationIssueType = "MediaSourceAbortRemove"
- DeprecationIssueTypeMediaSourceDurationTruncatingBuffered DeprecationIssueType = "MediaSourceDurationTruncatingBuffered"
- DeprecationIssueTypeNoSysexWebMIDIWithoutPermission DeprecationIssueType = "NoSysexWebMIDIWithoutPermission"
- DeprecationIssueTypeNotificationInsecureOrigin DeprecationIssueType = "NotificationInsecureOrigin"
- DeprecationIssueTypeNotificationPermissionRequestedIframe DeprecationIssueType = "NotificationPermissionRequestedIframe"
- DeprecationIssueTypeObsoleteWebRtcCipherSuite DeprecationIssueType = "ObsoleteWebRtcCipherSuite"
- DeprecationIssueTypeOpenWebDatabaseInsecureContext DeprecationIssueType = "OpenWebDatabaseInsecureContext"
- DeprecationIssueTypeOverflowVisibleOnReplacedElement DeprecationIssueType = "OverflowVisibleOnReplacedElement"
- DeprecationIssueTypePaymentInstruments DeprecationIssueType = "PaymentInstruments"
- DeprecationIssueTypePaymentRequestCSPViolation DeprecationIssueType = "PaymentRequestCSPViolation"
- DeprecationIssueTypePersistentQuotaType DeprecationIssueType = "PersistentQuotaType"
- DeprecationIssueTypePictureSourceSrc DeprecationIssueType = "PictureSourceSrc"
- DeprecationIssueTypePrefixedCancelAnimationFrame DeprecationIssueType = "PrefixedCancelAnimationFrame"
- DeprecationIssueTypePrefixedRequestAnimationFrame DeprecationIssueType = "PrefixedRequestAnimationFrame"
- DeprecationIssueTypePrefixedStorageInfo DeprecationIssueType = "PrefixedStorageInfo"
- DeprecationIssueTypePrefixedVideoDisplayingFullscreen DeprecationIssueType = "PrefixedVideoDisplayingFullscreen"
- DeprecationIssueTypePrefixedVideoEnterFullscreen DeprecationIssueType = "PrefixedVideoEnterFullscreen"
- DeprecationIssueTypePrefixedVideoEnterFullScreen DeprecationIssueType = "PrefixedVideoEnterFullScreen"
- DeprecationIssueTypePrefixedVideoExitFullscreen DeprecationIssueType = "PrefixedVideoExitFullscreen"
- DeprecationIssueTypePrefixedVideoExitFullScreen DeprecationIssueType = "PrefixedVideoExitFullScreen"
- DeprecationIssueTypePrefixedVideoSupportsFullscreen DeprecationIssueType = "PrefixedVideoSupportsFullscreen"
- DeprecationIssueTypeRangeExpand DeprecationIssueType = "RangeExpand"
- DeprecationIssueTypeRequestedSubresourceWithEmbeddedCredentials DeprecationIssueType = "RequestedSubresourceWithEmbeddedCredentials"
- DeprecationIssueTypeRTCConstraintEnableDtlsSrtpFalse DeprecationIssueType = "RTCConstraintEnableDtlsSrtpFalse"
- DeprecationIssueTypeRTCConstraintEnableDtlsSrtpTrue DeprecationIssueType = "RTCConstraintEnableDtlsSrtpTrue"
- DeprecationIssueTypeRTCPeerConnectionComplexPlanBSdpUsingDefaultSdpSemantics DeprecationIssueType = "RTCPeerConnectionComplexPlanBSdpUsingDefaultSdpSemantics"
- DeprecationIssueTypeRTCPeerConnectionSdpSemanticsPlanB DeprecationIssueType = "RTCPeerConnectionSdpSemanticsPlanB"
- DeprecationIssueTypeRtcpMuxPolicyNegotiate DeprecationIssueType = "RtcpMuxPolicyNegotiate"
- DeprecationIssueTypeSharedArrayBufferConstructedWithoutIsolation DeprecationIssueType = "SharedArrayBufferConstructedWithoutIsolation"
- DeprecationIssueTypeTextToSpeechDisallowedByAutoplay DeprecationIssueType = "TextToSpeech_DisallowedByAutoplay"
- DeprecationIssueTypeV8sharedArrayBufferConstructedInExtensionWithoutIsolation DeprecationIssueType = "V8SharedArrayBufferConstructedInExtensionWithoutIsolation"
- DeprecationIssueTypeXHRJSONEncodingDetection DeprecationIssueType = "XHRJSONEncodingDetection"
- DeprecationIssueTypeXMLHTTPRequestSynchronousInNonWorkerOutsideBeforeUnload DeprecationIssueType = "XMLHttpRequestSynchronousInNonWorkerOutsideBeforeUnload"
- DeprecationIssueTypeXRSupportsSession DeprecationIssueType = "XRSupportsSession"
-)
-
-// MarshalEasyJSON satisfies easyjson.Marshaler.
-func (t DeprecationIssueType) MarshalEasyJSON(out *jwriter.Writer) {
- out.String(string(t))
-}
-
-// MarshalJSON satisfies json.Marshaler.
-func (t DeprecationIssueType) MarshalJSON() ([]byte, error) {
- return easyjson.Marshal(t)
-}
-
-// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
-func (t *DeprecationIssueType) UnmarshalEasyJSON(in *jlexer.Lexer) {
- v := in.String()
- switch DeprecationIssueType(v) {
- case DeprecationIssueTypeAuthorizationCoveredByWildcard:
- *t = DeprecationIssueTypeAuthorizationCoveredByWildcard
- case DeprecationIssueTypeCanRequestURLHTTPContainingNewline:
- *t = DeprecationIssueTypeCanRequestURLHTTPContainingNewline
- case DeprecationIssueTypeChromeLoadTimesConnectionInfo:
- *t = DeprecationIssueTypeChromeLoadTimesConnectionInfo
- case DeprecationIssueTypeChromeLoadTimesFirstPaintAfterLoadTime:
- *t = DeprecationIssueTypeChromeLoadTimesFirstPaintAfterLoadTime
- case DeprecationIssueTypeChromeLoadTimesWasAlternateProtocolAvailable:
- *t = DeprecationIssueTypeChromeLoadTimesWasAlternateProtocolAvailable
- case DeprecationIssueTypeCookieWithTruncatingChar:
- *t = DeprecationIssueTypeCookieWithTruncatingChar
- case DeprecationIssueTypeCrossOriginAccessBasedOnDocumentDomain:
- *t = DeprecationIssueTypeCrossOriginAccessBasedOnDocumentDomain
- case DeprecationIssueTypeCrossOriginWindowAlert:
- *t = DeprecationIssueTypeCrossOriginWindowAlert
- case DeprecationIssueTypeCrossOriginWindowConfirm:
- *t = DeprecationIssueTypeCrossOriginWindowConfirm
- case DeprecationIssueTypeCSSSelectorInternalMediaControlsOverlayCastButton:
- *t = DeprecationIssueTypeCSSSelectorInternalMediaControlsOverlayCastButton
- case DeprecationIssueTypeDeprecationExample:
- *t = DeprecationIssueTypeDeprecationExample
- case DeprecationIssueTypeDocumentDomainSettingWithoutOriginAgentClusterHeader:
- *t = DeprecationIssueTypeDocumentDomainSettingWithoutOriginAgentClusterHeader
- case DeprecationIssueTypeEventPath:
- *t = DeprecationIssueTypeEventPath
- case DeprecationIssueTypeExpectCTHeader:
- *t = DeprecationIssueTypeExpectCTHeader
- case DeprecationIssueTypeGeolocationInsecureOrigin:
- *t = DeprecationIssueTypeGeolocationInsecureOrigin
- case DeprecationIssueTypeGeolocationInsecureOriginDeprecatedNotRemoved:
- *t = DeprecationIssueTypeGeolocationInsecureOriginDeprecatedNotRemoved
- case DeprecationIssueTypeGetUserMediaInsecureOrigin:
- *t = DeprecationIssueTypeGetUserMediaInsecureOrigin
- case DeprecationIssueTypeHostCandidateAttributeGetter:
- *t = DeprecationIssueTypeHostCandidateAttributeGetter
- case DeprecationIssueTypeIdentityInCanMakePaymentEvent:
- *t = DeprecationIssueTypeIdentityInCanMakePaymentEvent
- case DeprecationIssueTypeInsecurePrivateNetworkSubresourceRequest:
- *t = DeprecationIssueTypeInsecurePrivateNetworkSubresourceRequest
- case DeprecationIssueTypeLocalCSSFileExtensionRejected:
- *t = DeprecationIssueTypeLocalCSSFileExtensionRejected
- case DeprecationIssueTypeMediaSourceAbortRemove:
- *t = DeprecationIssueTypeMediaSourceAbortRemove
- case DeprecationIssueTypeMediaSourceDurationTruncatingBuffered:
- *t = DeprecationIssueTypeMediaSourceDurationTruncatingBuffered
- case DeprecationIssueTypeNoSysexWebMIDIWithoutPermission:
- *t = DeprecationIssueTypeNoSysexWebMIDIWithoutPermission
- case DeprecationIssueTypeNotificationInsecureOrigin:
- *t = DeprecationIssueTypeNotificationInsecureOrigin
- case DeprecationIssueTypeNotificationPermissionRequestedIframe:
- *t = DeprecationIssueTypeNotificationPermissionRequestedIframe
- case DeprecationIssueTypeObsoleteWebRtcCipherSuite:
- *t = DeprecationIssueTypeObsoleteWebRtcCipherSuite
- case DeprecationIssueTypeOpenWebDatabaseInsecureContext:
- *t = DeprecationIssueTypeOpenWebDatabaseInsecureContext
- case DeprecationIssueTypeOverflowVisibleOnReplacedElement:
- *t = DeprecationIssueTypeOverflowVisibleOnReplacedElement
- case DeprecationIssueTypePaymentInstruments:
- *t = DeprecationIssueTypePaymentInstruments
- case DeprecationIssueTypePaymentRequestCSPViolation:
- *t = DeprecationIssueTypePaymentRequestCSPViolation
- case DeprecationIssueTypePersistentQuotaType:
- *t = DeprecationIssueTypePersistentQuotaType
- case DeprecationIssueTypePictureSourceSrc:
- *t = DeprecationIssueTypePictureSourceSrc
- case DeprecationIssueTypePrefixedCancelAnimationFrame:
- *t = DeprecationIssueTypePrefixedCancelAnimationFrame
- case DeprecationIssueTypePrefixedRequestAnimationFrame:
- *t = DeprecationIssueTypePrefixedRequestAnimationFrame
- case DeprecationIssueTypePrefixedStorageInfo:
- *t = DeprecationIssueTypePrefixedStorageInfo
- case DeprecationIssueTypePrefixedVideoDisplayingFullscreen:
- *t = DeprecationIssueTypePrefixedVideoDisplayingFullscreen
- case DeprecationIssueTypePrefixedVideoEnterFullscreen:
- *t = DeprecationIssueTypePrefixedVideoEnterFullscreen
- case DeprecationIssueTypePrefixedVideoEnterFullScreen:
- *t = DeprecationIssueTypePrefixedVideoEnterFullScreen
- case DeprecationIssueTypePrefixedVideoExitFullscreen:
- *t = DeprecationIssueTypePrefixedVideoExitFullscreen
- case DeprecationIssueTypePrefixedVideoExitFullScreen:
- *t = DeprecationIssueTypePrefixedVideoExitFullScreen
- case DeprecationIssueTypePrefixedVideoSupportsFullscreen:
- *t = DeprecationIssueTypePrefixedVideoSupportsFullscreen
- case DeprecationIssueTypeRangeExpand:
- *t = DeprecationIssueTypeRangeExpand
- case DeprecationIssueTypeRequestedSubresourceWithEmbeddedCredentials:
- *t = DeprecationIssueTypeRequestedSubresourceWithEmbeddedCredentials
- case DeprecationIssueTypeRTCConstraintEnableDtlsSrtpFalse:
- *t = DeprecationIssueTypeRTCConstraintEnableDtlsSrtpFalse
- case DeprecationIssueTypeRTCConstraintEnableDtlsSrtpTrue:
- *t = DeprecationIssueTypeRTCConstraintEnableDtlsSrtpTrue
- case DeprecationIssueTypeRTCPeerConnectionComplexPlanBSdpUsingDefaultSdpSemantics:
- *t = DeprecationIssueTypeRTCPeerConnectionComplexPlanBSdpUsingDefaultSdpSemantics
- case DeprecationIssueTypeRTCPeerConnectionSdpSemanticsPlanB:
- *t = DeprecationIssueTypeRTCPeerConnectionSdpSemanticsPlanB
- case DeprecationIssueTypeRtcpMuxPolicyNegotiate:
- *t = DeprecationIssueTypeRtcpMuxPolicyNegotiate
- case DeprecationIssueTypeSharedArrayBufferConstructedWithoutIsolation:
- *t = DeprecationIssueTypeSharedArrayBufferConstructedWithoutIsolation
- case DeprecationIssueTypeTextToSpeechDisallowedByAutoplay:
- *t = DeprecationIssueTypeTextToSpeechDisallowedByAutoplay
- case DeprecationIssueTypeV8sharedArrayBufferConstructedInExtensionWithoutIsolation:
- *t = DeprecationIssueTypeV8sharedArrayBufferConstructedInExtensionWithoutIsolation
- case DeprecationIssueTypeXHRJSONEncodingDetection:
- *t = DeprecationIssueTypeXHRJSONEncodingDetection
- case DeprecationIssueTypeXMLHTTPRequestSynchronousInNonWorkerOutsideBeforeUnload:
- *t = DeprecationIssueTypeXMLHTTPRequestSynchronousInNonWorkerOutsideBeforeUnload
- case DeprecationIssueTypeXRSupportsSession:
- *t = DeprecationIssueTypeXRSupportsSession
-
- default:
- in.AddError(fmt.Errorf("unknown DeprecationIssueType value: %v", v))
- }
-}
-
-// UnmarshalJSON satisfies json.Unmarshaler.
-func (t *DeprecationIssueType) UnmarshalJSON(buf []byte) error {
- return easyjson.Unmarshal(buf, t)
+ ErrorType GenericIssueErrorType `json:"errorType"` // Issues with the same errorType are aggregated in the frontend.
+ FrameID cdp.FrameID `json:"frameId,omitempty"`
+ ViolatingNodeID cdp.BackendNodeID `json:"violatingNodeId,omitempty"`
+ ViolatingNodeAttribute string `json:"violatingNodeAttribute,omitempty"`
+ Request *AffectedRequest `json:"request,omitempty"`
}
// DeprecationIssueDetails this issue tracks information needed to print a
@@ -1172,9 +951,21 @@ func (t *DeprecationIssueType) UnmarshalJSON(buf []byte) error {
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-DeprecationIssueDetails
type DeprecationIssueDetails struct {
- AffectedFrame *AffectedFrame `json:"affectedFrame,omitempty"`
- SourceCodeLocation *SourceCodeLocation `json:"sourceCodeLocation"`
- Type DeprecationIssueType `json:"type"`
+ AffectedFrame *AffectedFrame `json:"affectedFrame,omitempty"`
+ SourceCodeLocation *SourceCodeLocation `json:"sourceCodeLocation"`
+ Type string `json:"type"` // One of the deprecation names from third_party/blink/renderer/core/frame/deprecation/deprecation.json5
+}
+
+// BounceTrackingIssueDetails this issue warns about sites in the redirect
+// chain of a finished navigation that may be flagged as trackers and have their
+// state cleared if they don't receive a user interaction. Note that in this
+// context 'site' means eTLD+1. For example, if the URL
+// https://example.test:80/bounce was in the redirect chain, the site reported
+// would be example.test.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-BounceTrackingIssueDetails
+type BounceTrackingIssueDetails struct {
+ TrackingSites []string `json:"trackingSites"`
}
// ClientHintIssueReason [no description].
@@ -1245,34 +1036,41 @@ func (t FederatedAuthRequestIssueReason) String() string {
// FederatedAuthRequestIssueReason values.
const (
- FederatedAuthRequestIssueReasonShouldEmbargo FederatedAuthRequestIssueReason = "ShouldEmbargo"
- FederatedAuthRequestIssueReasonTooManyRequests FederatedAuthRequestIssueReason = "TooManyRequests"
- FederatedAuthRequestIssueReasonWellKnownHTTPNotFound FederatedAuthRequestIssueReason = "WellKnownHttpNotFound"
- FederatedAuthRequestIssueReasonWellKnownNoResponse FederatedAuthRequestIssueReason = "WellKnownNoResponse"
- FederatedAuthRequestIssueReasonWellKnownInvalidResponse FederatedAuthRequestIssueReason = "WellKnownInvalidResponse"
- FederatedAuthRequestIssueReasonWellKnownListEmpty FederatedAuthRequestIssueReason = "WellKnownListEmpty"
- FederatedAuthRequestIssueReasonConfigNotInWellKnown FederatedAuthRequestIssueReason = "ConfigNotInWellKnown"
- FederatedAuthRequestIssueReasonWellKnownTooBig FederatedAuthRequestIssueReason = "WellKnownTooBig"
- FederatedAuthRequestIssueReasonConfigHTTPNotFound FederatedAuthRequestIssueReason = "ConfigHttpNotFound"
- FederatedAuthRequestIssueReasonConfigNoResponse FederatedAuthRequestIssueReason = "ConfigNoResponse"
- FederatedAuthRequestIssueReasonConfigInvalidResponse FederatedAuthRequestIssueReason = "ConfigInvalidResponse"
- FederatedAuthRequestIssueReasonClientMetadataHTTPNotFound FederatedAuthRequestIssueReason = "ClientMetadataHttpNotFound"
- FederatedAuthRequestIssueReasonClientMetadataNoResponse FederatedAuthRequestIssueReason = "ClientMetadataNoResponse"
- FederatedAuthRequestIssueReasonClientMetadataInvalidResponse FederatedAuthRequestIssueReason = "ClientMetadataInvalidResponse"
- FederatedAuthRequestIssueReasonDisabledInSettings FederatedAuthRequestIssueReason = "DisabledInSettings"
- FederatedAuthRequestIssueReasonErrorFetchingSignin FederatedAuthRequestIssueReason = "ErrorFetchingSignin"
- FederatedAuthRequestIssueReasonInvalidSigninResponse FederatedAuthRequestIssueReason = "InvalidSigninResponse"
- FederatedAuthRequestIssueReasonAccountsHTTPNotFound FederatedAuthRequestIssueReason = "AccountsHttpNotFound"
- FederatedAuthRequestIssueReasonAccountsNoResponse FederatedAuthRequestIssueReason = "AccountsNoResponse"
- FederatedAuthRequestIssueReasonAccountsInvalidResponse FederatedAuthRequestIssueReason = "AccountsInvalidResponse"
- FederatedAuthRequestIssueReasonAccountsListEmpty FederatedAuthRequestIssueReason = "AccountsListEmpty"
- FederatedAuthRequestIssueReasonIDTokenHTTPNotFound FederatedAuthRequestIssueReason = "IdTokenHttpNotFound"
- FederatedAuthRequestIssueReasonIDTokenNoResponse FederatedAuthRequestIssueReason = "IdTokenNoResponse"
- FederatedAuthRequestIssueReasonIDTokenInvalidResponse FederatedAuthRequestIssueReason = "IdTokenInvalidResponse"
- FederatedAuthRequestIssueReasonIDTokenInvalidRequest FederatedAuthRequestIssueReason = "IdTokenInvalidRequest"
- FederatedAuthRequestIssueReasonErrorIDToken FederatedAuthRequestIssueReason = "ErrorIdToken"
- FederatedAuthRequestIssueReasonCanceled FederatedAuthRequestIssueReason = "Canceled"
- FederatedAuthRequestIssueReasonRpPageNotVisible FederatedAuthRequestIssueReason = "RpPageNotVisible"
+ FederatedAuthRequestIssueReasonShouldEmbargo FederatedAuthRequestIssueReason = "ShouldEmbargo"
+ FederatedAuthRequestIssueReasonTooManyRequests FederatedAuthRequestIssueReason = "TooManyRequests"
+ FederatedAuthRequestIssueReasonWellKnownHTTPNotFound FederatedAuthRequestIssueReason = "WellKnownHttpNotFound"
+ FederatedAuthRequestIssueReasonWellKnownNoResponse FederatedAuthRequestIssueReason = "WellKnownNoResponse"
+ FederatedAuthRequestIssueReasonWellKnownInvalidResponse FederatedAuthRequestIssueReason = "WellKnownInvalidResponse"
+ FederatedAuthRequestIssueReasonWellKnownListEmpty FederatedAuthRequestIssueReason = "WellKnownListEmpty"
+ FederatedAuthRequestIssueReasonWellKnownInvalidContentType FederatedAuthRequestIssueReason = "WellKnownInvalidContentType"
+ FederatedAuthRequestIssueReasonConfigNotInWellKnown FederatedAuthRequestIssueReason = "ConfigNotInWellKnown"
+ FederatedAuthRequestIssueReasonWellKnownTooBig FederatedAuthRequestIssueReason = "WellKnownTooBig"
+ FederatedAuthRequestIssueReasonConfigHTTPNotFound FederatedAuthRequestIssueReason = "ConfigHttpNotFound"
+ FederatedAuthRequestIssueReasonConfigNoResponse FederatedAuthRequestIssueReason = "ConfigNoResponse"
+ FederatedAuthRequestIssueReasonConfigInvalidResponse FederatedAuthRequestIssueReason = "ConfigInvalidResponse"
+ FederatedAuthRequestIssueReasonConfigInvalidContentType FederatedAuthRequestIssueReason = "ConfigInvalidContentType"
+ FederatedAuthRequestIssueReasonClientMetadataHTTPNotFound FederatedAuthRequestIssueReason = "ClientMetadataHttpNotFound"
+ FederatedAuthRequestIssueReasonClientMetadataNoResponse FederatedAuthRequestIssueReason = "ClientMetadataNoResponse"
+ FederatedAuthRequestIssueReasonClientMetadataInvalidResponse FederatedAuthRequestIssueReason = "ClientMetadataInvalidResponse"
+ FederatedAuthRequestIssueReasonClientMetadataInvalidContentType FederatedAuthRequestIssueReason = "ClientMetadataInvalidContentType"
+ FederatedAuthRequestIssueReasonDisabledInSettings FederatedAuthRequestIssueReason = "DisabledInSettings"
+ FederatedAuthRequestIssueReasonErrorFetchingSignin FederatedAuthRequestIssueReason = "ErrorFetchingSignin"
+ FederatedAuthRequestIssueReasonInvalidSigninResponse FederatedAuthRequestIssueReason = "InvalidSigninResponse"
+ FederatedAuthRequestIssueReasonAccountsHTTPNotFound FederatedAuthRequestIssueReason = "AccountsHttpNotFound"
+ FederatedAuthRequestIssueReasonAccountsNoResponse FederatedAuthRequestIssueReason = "AccountsNoResponse"
+ FederatedAuthRequestIssueReasonAccountsInvalidResponse FederatedAuthRequestIssueReason = "AccountsInvalidResponse"
+ FederatedAuthRequestIssueReasonAccountsListEmpty FederatedAuthRequestIssueReason = "AccountsListEmpty"
+ FederatedAuthRequestIssueReasonAccountsInvalidContentType FederatedAuthRequestIssueReason = "AccountsInvalidContentType"
+ FederatedAuthRequestIssueReasonIDTokenHTTPNotFound FederatedAuthRequestIssueReason = "IdTokenHttpNotFound"
+ FederatedAuthRequestIssueReasonIDTokenNoResponse FederatedAuthRequestIssueReason = "IdTokenNoResponse"
+ FederatedAuthRequestIssueReasonIDTokenInvalidResponse FederatedAuthRequestIssueReason = "IdTokenInvalidResponse"
+ FederatedAuthRequestIssueReasonIDTokenInvalidRequest FederatedAuthRequestIssueReason = "IdTokenInvalidRequest"
+ FederatedAuthRequestIssueReasonIDTokenInvalidContentType FederatedAuthRequestIssueReason = "IdTokenInvalidContentType"
+ FederatedAuthRequestIssueReasonErrorIDToken FederatedAuthRequestIssueReason = "ErrorIdToken"
+ FederatedAuthRequestIssueReasonCanceled FederatedAuthRequestIssueReason = "Canceled"
+ FederatedAuthRequestIssueReasonRpPageNotVisible FederatedAuthRequestIssueReason = "RpPageNotVisible"
+ FederatedAuthRequestIssueReasonSilentMediationFailure FederatedAuthRequestIssueReason = "SilentMediationFailure"
+ FederatedAuthRequestIssueReasonThirdPartyCookiesBlocked FederatedAuthRequestIssueReason = "ThirdPartyCookiesBlocked"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
@@ -1301,6 +1099,8 @@ func (t *FederatedAuthRequestIssueReason) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = FederatedAuthRequestIssueReasonWellKnownInvalidResponse
case FederatedAuthRequestIssueReasonWellKnownListEmpty:
*t = FederatedAuthRequestIssueReasonWellKnownListEmpty
+ case FederatedAuthRequestIssueReasonWellKnownInvalidContentType:
+ *t = FederatedAuthRequestIssueReasonWellKnownInvalidContentType
case FederatedAuthRequestIssueReasonConfigNotInWellKnown:
*t = FederatedAuthRequestIssueReasonConfigNotInWellKnown
case FederatedAuthRequestIssueReasonWellKnownTooBig:
@@ -1311,12 +1111,16 @@ func (t *FederatedAuthRequestIssueReason) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = FederatedAuthRequestIssueReasonConfigNoResponse
case FederatedAuthRequestIssueReasonConfigInvalidResponse:
*t = FederatedAuthRequestIssueReasonConfigInvalidResponse
+ case FederatedAuthRequestIssueReasonConfigInvalidContentType:
+ *t = FederatedAuthRequestIssueReasonConfigInvalidContentType
case FederatedAuthRequestIssueReasonClientMetadataHTTPNotFound:
*t = FederatedAuthRequestIssueReasonClientMetadataHTTPNotFound
case FederatedAuthRequestIssueReasonClientMetadataNoResponse:
*t = FederatedAuthRequestIssueReasonClientMetadataNoResponse
case FederatedAuthRequestIssueReasonClientMetadataInvalidResponse:
*t = FederatedAuthRequestIssueReasonClientMetadataInvalidResponse
+ case FederatedAuthRequestIssueReasonClientMetadataInvalidContentType:
+ *t = FederatedAuthRequestIssueReasonClientMetadataInvalidContentType
case FederatedAuthRequestIssueReasonDisabledInSettings:
*t = FederatedAuthRequestIssueReasonDisabledInSettings
case FederatedAuthRequestIssueReasonErrorFetchingSignin:
@@ -1331,6 +1135,8 @@ func (t *FederatedAuthRequestIssueReason) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = FederatedAuthRequestIssueReasonAccountsInvalidResponse
case FederatedAuthRequestIssueReasonAccountsListEmpty:
*t = FederatedAuthRequestIssueReasonAccountsListEmpty
+ case FederatedAuthRequestIssueReasonAccountsInvalidContentType:
+ *t = FederatedAuthRequestIssueReasonAccountsInvalidContentType
case FederatedAuthRequestIssueReasonIDTokenHTTPNotFound:
*t = FederatedAuthRequestIssueReasonIDTokenHTTPNotFound
case FederatedAuthRequestIssueReasonIDTokenNoResponse:
@@ -1339,12 +1145,18 @@ func (t *FederatedAuthRequestIssueReason) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = FederatedAuthRequestIssueReasonIDTokenInvalidResponse
case FederatedAuthRequestIssueReasonIDTokenInvalidRequest:
*t = FederatedAuthRequestIssueReasonIDTokenInvalidRequest
+ case FederatedAuthRequestIssueReasonIDTokenInvalidContentType:
+ *t = FederatedAuthRequestIssueReasonIDTokenInvalidContentType
case FederatedAuthRequestIssueReasonErrorIDToken:
*t = FederatedAuthRequestIssueReasonErrorIDToken
case FederatedAuthRequestIssueReasonCanceled:
*t = FederatedAuthRequestIssueReasonCanceled
case FederatedAuthRequestIssueReasonRpPageNotVisible:
*t = FederatedAuthRequestIssueReasonRpPageNotVisible
+ case FederatedAuthRequestIssueReasonSilentMediationFailure:
+ *t = FederatedAuthRequestIssueReasonSilentMediationFailure
+ case FederatedAuthRequestIssueReasonThirdPartyCookiesBlocked:
+ *t = FederatedAuthRequestIssueReasonThirdPartyCookiesBlocked
default:
in.AddError(fmt.Errorf("unknown FederatedAuthRequestIssueReason value: %v", v))
@@ -1356,6 +1168,82 @@ func (t *FederatedAuthRequestIssueReason) UnmarshalJSON(buf []byte) error {
return easyjson.Unmarshal(buf, t)
}
+// FederatedAuthUserInfoRequestIssueDetails [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-FederatedAuthUserInfoRequestIssueDetails
+type FederatedAuthUserInfoRequestIssueDetails struct {
+ FederatedAuthUserInfoRequestIssueReason FederatedAuthUserInfoRequestIssueReason `json:"federatedAuthUserInfoRequestIssueReason"`
+}
+
+// FederatedAuthUserInfoRequestIssueReason represents the failure reason when
+// a getUserInfo() call fails. Should be updated alongside
+// FederatedAuthUserInfoRequestResult in
+// third_party/blink/public/mojom/devtools/inspector_issue.mojom.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-FederatedAuthUserInfoRequestIssueReason
+type FederatedAuthUserInfoRequestIssueReason string
+
+// String returns the FederatedAuthUserInfoRequestIssueReason as string value.
+func (t FederatedAuthUserInfoRequestIssueReason) String() string {
+ return string(t)
+}
+
+// FederatedAuthUserInfoRequestIssueReason values.
+const (
+ FederatedAuthUserInfoRequestIssueReasonNotSameOrigin FederatedAuthUserInfoRequestIssueReason = "NotSameOrigin"
+ FederatedAuthUserInfoRequestIssueReasonNotIframe FederatedAuthUserInfoRequestIssueReason = "NotIframe"
+ FederatedAuthUserInfoRequestIssueReasonNotPotentiallyTrustworthy FederatedAuthUserInfoRequestIssueReason = "NotPotentiallyTrustworthy"
+ FederatedAuthUserInfoRequestIssueReasonNoAPIPermission FederatedAuthUserInfoRequestIssueReason = "NoApiPermission"
+ FederatedAuthUserInfoRequestIssueReasonNotSignedInWithIdp FederatedAuthUserInfoRequestIssueReason = "NotSignedInWithIdp"
+ FederatedAuthUserInfoRequestIssueReasonNoAccountSharingPermission FederatedAuthUserInfoRequestIssueReason = "NoAccountSharingPermission"
+ FederatedAuthUserInfoRequestIssueReasonInvalidConfigOrWellKnown FederatedAuthUserInfoRequestIssueReason = "InvalidConfigOrWellKnown"
+ FederatedAuthUserInfoRequestIssueReasonInvalidAccountsResponse FederatedAuthUserInfoRequestIssueReason = "InvalidAccountsResponse"
+ FederatedAuthUserInfoRequestIssueReasonNoReturningUserFromFetchedAccounts FederatedAuthUserInfoRequestIssueReason = "NoReturningUserFromFetchedAccounts"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t FederatedAuthUserInfoRequestIssueReason) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t FederatedAuthUserInfoRequestIssueReason) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *FederatedAuthUserInfoRequestIssueReason) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch FederatedAuthUserInfoRequestIssueReason(v) {
+ case FederatedAuthUserInfoRequestIssueReasonNotSameOrigin:
+ *t = FederatedAuthUserInfoRequestIssueReasonNotSameOrigin
+ case FederatedAuthUserInfoRequestIssueReasonNotIframe:
+ *t = FederatedAuthUserInfoRequestIssueReasonNotIframe
+ case FederatedAuthUserInfoRequestIssueReasonNotPotentiallyTrustworthy:
+ *t = FederatedAuthUserInfoRequestIssueReasonNotPotentiallyTrustworthy
+ case FederatedAuthUserInfoRequestIssueReasonNoAPIPermission:
+ *t = FederatedAuthUserInfoRequestIssueReasonNoAPIPermission
+ case FederatedAuthUserInfoRequestIssueReasonNotSignedInWithIdp:
+ *t = FederatedAuthUserInfoRequestIssueReasonNotSignedInWithIdp
+ case FederatedAuthUserInfoRequestIssueReasonNoAccountSharingPermission:
+ *t = FederatedAuthUserInfoRequestIssueReasonNoAccountSharingPermission
+ case FederatedAuthUserInfoRequestIssueReasonInvalidConfigOrWellKnown:
+ *t = FederatedAuthUserInfoRequestIssueReasonInvalidConfigOrWellKnown
+ case FederatedAuthUserInfoRequestIssueReasonInvalidAccountsResponse:
+ *t = FederatedAuthUserInfoRequestIssueReasonInvalidAccountsResponse
+ case FederatedAuthUserInfoRequestIssueReasonNoReturningUserFromFetchedAccounts:
+ *t = FederatedAuthUserInfoRequestIssueReasonNoReturningUserFromFetchedAccounts
+
+ default:
+ in.AddError(fmt.Errorf("unknown FederatedAuthUserInfoRequestIssueReason value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *FederatedAuthUserInfoRequestIssueReason) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
// ClientHintIssueDetails this issue tracks client hints related issues. It's
// used to deprecate old features, encourage the use of new ones, and provide
// general guidance.
@@ -1366,6 +1254,70 @@ type ClientHintIssueDetails struct {
ClientHintIssueReason ClientHintIssueReason `json:"clientHintIssueReason"`
}
+// FailedRequestInfo [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-FailedRequestInfo
+type FailedRequestInfo struct {
+ URL string `json:"url"` // The URL that failed to load.
+ FailureMessage string `json:"failureMessage"` // The failure message for the failed request.
+ RequestID network.RequestID `json:"requestId,omitempty"`
+}
+
+// StyleSheetLoadingIssueReason [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-StyleSheetLoadingIssueReason
+type StyleSheetLoadingIssueReason string
+
+// String returns the StyleSheetLoadingIssueReason as string value.
+func (t StyleSheetLoadingIssueReason) String() string {
+ return string(t)
+}
+
+// StyleSheetLoadingIssueReason values.
+const (
+ StyleSheetLoadingIssueReasonLateImportRule StyleSheetLoadingIssueReason = "LateImportRule"
+ StyleSheetLoadingIssueReasonRequestFailed StyleSheetLoadingIssueReason = "RequestFailed"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t StyleSheetLoadingIssueReason) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t StyleSheetLoadingIssueReason) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *StyleSheetLoadingIssueReason) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch StyleSheetLoadingIssueReason(v) {
+ case StyleSheetLoadingIssueReasonLateImportRule:
+ *t = StyleSheetLoadingIssueReasonLateImportRule
+ case StyleSheetLoadingIssueReasonRequestFailed:
+ *t = StyleSheetLoadingIssueReasonRequestFailed
+
+ default:
+ in.AddError(fmt.Errorf("unknown StyleSheetLoadingIssueReason value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *StyleSheetLoadingIssueReason) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
+// StylesheetLoadingIssueDetails this issue warns when a referenced
+// stylesheet couldn't be loaded.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-StylesheetLoadingIssueDetails
+type StylesheetLoadingIssueDetails struct {
+ SourceCodeLocation *SourceCodeLocation `json:"sourceCodeLocation"` // Source code position that referenced the failing stylesheet.
+ StyleSheetLoadingIssueReason StyleSheetLoadingIssueReason `json:"styleSheetLoadingIssueReason"` // Reason why the stylesheet couldn't be loaded.
+ FailedRequestInfo *FailedRequestInfo `json:"failedRequestInfo,omitempty"` // Contains additional info when the failure was due to a request.
+}
+
// InspectorIssueCode a unique identifier for the type of issue. Each type
// may use one of the optional fields in InspectorIssueDetails to convey more
// specific information about the kind of issue.
@@ -1380,22 +1332,24 @@ func (t InspectorIssueCode) String() string {
// InspectorIssueCode values.
const (
- InspectorIssueCodeCookieIssue InspectorIssueCode = "CookieIssue"
- InspectorIssueCodeMixedContentIssue InspectorIssueCode = "MixedContentIssue"
- InspectorIssueCodeBlockedByResponseIssue InspectorIssueCode = "BlockedByResponseIssue"
- InspectorIssueCodeHeavyAdIssue InspectorIssueCode = "HeavyAdIssue"
- InspectorIssueCodeContentSecurityPolicyIssue InspectorIssueCode = "ContentSecurityPolicyIssue"
- InspectorIssueCodeSharedArrayBufferIssue InspectorIssueCode = "SharedArrayBufferIssue"
- InspectorIssueCodeTrustedWebActivityIssue InspectorIssueCode = "TrustedWebActivityIssue"
- InspectorIssueCodeLowTextContrastIssue InspectorIssueCode = "LowTextContrastIssue"
- InspectorIssueCodeCorsIssue InspectorIssueCode = "CorsIssue"
- InspectorIssueCodeAttributionReportingIssue InspectorIssueCode = "AttributionReportingIssue"
- InspectorIssueCodeQuirksModeIssue InspectorIssueCode = "QuirksModeIssue"
- InspectorIssueCodeNavigatorUserAgentIssue InspectorIssueCode = "NavigatorUserAgentIssue"
- InspectorIssueCodeGenericIssue InspectorIssueCode = "GenericIssue"
- InspectorIssueCodeDeprecationIssue InspectorIssueCode = "DeprecationIssue"
- InspectorIssueCodeClientHintIssue InspectorIssueCode = "ClientHintIssue"
- InspectorIssueCodeFederatedAuthRequestIssue InspectorIssueCode = "FederatedAuthRequestIssue"
+ InspectorIssueCodeCookieIssue InspectorIssueCode = "CookieIssue"
+ InspectorIssueCodeMixedContentIssue InspectorIssueCode = "MixedContentIssue"
+ InspectorIssueCodeBlockedByResponseIssue InspectorIssueCode = "BlockedByResponseIssue"
+ InspectorIssueCodeHeavyAdIssue InspectorIssueCode = "HeavyAdIssue"
+ InspectorIssueCodeContentSecurityPolicyIssue InspectorIssueCode = "ContentSecurityPolicyIssue"
+ InspectorIssueCodeSharedArrayBufferIssue InspectorIssueCode = "SharedArrayBufferIssue"
+ InspectorIssueCodeLowTextContrastIssue InspectorIssueCode = "LowTextContrastIssue"
+ InspectorIssueCodeCorsIssue InspectorIssueCode = "CorsIssue"
+ InspectorIssueCodeAttributionReportingIssue InspectorIssueCode = "AttributionReportingIssue"
+ InspectorIssueCodeQuirksModeIssue InspectorIssueCode = "QuirksModeIssue"
+ InspectorIssueCodeNavigatorUserAgentIssue InspectorIssueCode = "NavigatorUserAgentIssue"
+ InspectorIssueCodeGenericIssue InspectorIssueCode = "GenericIssue"
+ InspectorIssueCodeDeprecationIssue InspectorIssueCode = "DeprecationIssue"
+ InspectorIssueCodeClientHintIssue InspectorIssueCode = "ClientHintIssue"
+ InspectorIssueCodeFederatedAuthRequestIssue InspectorIssueCode = "FederatedAuthRequestIssue"
+ InspectorIssueCodeBounceTrackingIssue InspectorIssueCode = "BounceTrackingIssue"
+ InspectorIssueCodeStylesheetLoadingIssue InspectorIssueCode = "StylesheetLoadingIssue"
+ InspectorIssueCodeFederatedAuthUserInfoRequestIssue InspectorIssueCode = "FederatedAuthUserInfoRequestIssue"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
@@ -1424,8 +1378,6 @@ func (t *InspectorIssueCode) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = InspectorIssueCodeContentSecurityPolicyIssue
case InspectorIssueCodeSharedArrayBufferIssue:
*t = InspectorIssueCodeSharedArrayBufferIssue
- case InspectorIssueCodeTrustedWebActivityIssue:
- *t = InspectorIssueCodeTrustedWebActivityIssue
case InspectorIssueCodeLowTextContrastIssue:
*t = InspectorIssueCodeLowTextContrastIssue
case InspectorIssueCodeCorsIssue:
@@ -1444,6 +1396,12 @@ func (t *InspectorIssueCode) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = InspectorIssueCodeClientHintIssue
case InspectorIssueCodeFederatedAuthRequestIssue:
*t = InspectorIssueCodeFederatedAuthRequestIssue
+ case InspectorIssueCodeBounceTrackingIssue:
+ *t = InspectorIssueCodeBounceTrackingIssue
+ case InspectorIssueCodeStylesheetLoadingIssue:
+ *t = InspectorIssueCodeStylesheetLoadingIssue
+ case InspectorIssueCodeFederatedAuthUserInfoRequestIssue:
+ *t = InspectorIssueCodeFederatedAuthUserInfoRequestIssue
default:
in.AddError(fmt.Errorf("unknown InspectorIssueCode value: %v", v))
@@ -1461,22 +1419,23 @@ func (t *InspectorIssueCode) UnmarshalJSON(buf []byte) error {
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Audits#type-InspectorIssueDetails
type InspectorIssueDetails struct {
- CookieIssueDetails *CookieIssueDetails `json:"cookieIssueDetails,omitempty"`
- MixedContentIssueDetails *MixedContentIssueDetails `json:"mixedContentIssueDetails,omitempty"`
- BlockedByResponseIssueDetails *BlockedByResponseIssueDetails `json:"blockedByResponseIssueDetails,omitempty"`
- HeavyAdIssueDetails *HeavyAdIssueDetails `json:"heavyAdIssueDetails,omitempty"`
- ContentSecurityPolicyIssueDetails *ContentSecurityPolicyIssueDetails `json:"contentSecurityPolicyIssueDetails,omitempty"`
- SharedArrayBufferIssueDetails *SharedArrayBufferIssueDetails `json:"sharedArrayBufferIssueDetails,omitempty"`
- TwaQualityEnforcementDetails *TrustedWebActivityIssueDetails `json:"twaQualityEnforcementDetails,omitempty"`
- LowTextContrastIssueDetails *LowTextContrastIssueDetails `json:"lowTextContrastIssueDetails,omitempty"`
- CorsIssueDetails *CorsIssueDetails `json:"corsIssueDetails,omitempty"`
- AttributionReportingIssueDetails *AttributionReportingIssueDetails `json:"attributionReportingIssueDetails,omitempty"`
- QuirksModeIssueDetails *QuirksModeIssueDetails `json:"quirksModeIssueDetails,omitempty"`
- NavigatorUserAgentIssueDetails *NavigatorUserAgentIssueDetails `json:"navigatorUserAgentIssueDetails,omitempty"`
- GenericIssueDetails *GenericIssueDetails `json:"genericIssueDetails,omitempty"`
- DeprecationIssueDetails *DeprecationIssueDetails `json:"deprecationIssueDetails,omitempty"`
- ClientHintIssueDetails *ClientHintIssueDetails `json:"clientHintIssueDetails,omitempty"`
- FederatedAuthRequestIssueDetails *FederatedAuthRequestIssueDetails `json:"federatedAuthRequestIssueDetails,omitempty"`
+ CookieIssueDetails *CookieIssueDetails `json:"cookieIssueDetails,omitempty"`
+ MixedContentIssueDetails *MixedContentIssueDetails `json:"mixedContentIssueDetails,omitempty"`
+ BlockedByResponseIssueDetails *BlockedByResponseIssueDetails `json:"blockedByResponseIssueDetails,omitempty"`
+ HeavyAdIssueDetails *HeavyAdIssueDetails `json:"heavyAdIssueDetails,omitempty"`
+ ContentSecurityPolicyIssueDetails *ContentSecurityPolicyIssueDetails `json:"contentSecurityPolicyIssueDetails,omitempty"`
+ SharedArrayBufferIssueDetails *SharedArrayBufferIssueDetails `json:"sharedArrayBufferIssueDetails,omitempty"`
+ LowTextContrastIssueDetails *LowTextContrastIssueDetails `json:"lowTextContrastIssueDetails,omitempty"`
+ CorsIssueDetails *CorsIssueDetails `json:"corsIssueDetails,omitempty"`
+ AttributionReportingIssueDetails *AttributionReportingIssueDetails `json:"attributionReportingIssueDetails,omitempty"`
+ QuirksModeIssueDetails *QuirksModeIssueDetails `json:"quirksModeIssueDetails,omitempty"`
+ GenericIssueDetails *GenericIssueDetails `json:"genericIssueDetails,omitempty"`
+ DeprecationIssueDetails *DeprecationIssueDetails `json:"deprecationIssueDetails,omitempty"`
+ ClientHintIssueDetails *ClientHintIssueDetails `json:"clientHintIssueDetails,omitempty"`
+ FederatedAuthRequestIssueDetails *FederatedAuthRequestIssueDetails `json:"federatedAuthRequestIssueDetails,omitempty"`
+ BounceTrackingIssueDetails *BounceTrackingIssueDetails `json:"bounceTrackingIssueDetails,omitempty"`
+ StylesheetLoadingIssueDetails *StylesheetLoadingIssueDetails `json:"stylesheetLoadingIssueDetails,omitempty"`
+ FederatedAuthUserInfoRequestIssueDetails *FederatedAuthUserInfoRequestIssueDetails `json:"federatedAuthUserInfoRequestIssueDetails,omitempty"`
}
// IssueID a unique id for a DevTools inspector issue. Allows other entities
diff --git a/autofill/autofill.go b/autofill/autofill.go
new file mode 100644
index 0000000..629b38e
--- /dev/null
+++ b/autofill/autofill.go
@@ -0,0 +1,81 @@
+// Package autofill provides the Chrome DevTools Protocol
+// commands, types, and events for the Autofill domain.
+//
+// Defines commands and events for Autofill.
+//
+// Generated by the cdproto-gen command.
+package autofill
+
+// Code generated by cdproto-gen. DO NOT EDIT.
+
+import (
+ "context"
+
+ "github.com/chromedp/cdproto/cdp"
+)
+
+// TriggerParams trigger autofill on a form identified by the fieldId. If the
+// field and related form cannot be autofilled, returns an error.
+type TriggerParams struct {
+ FieldID cdp.BackendNodeID `json:"fieldId"` // Identifies a field that serves as an anchor for autofill.
+ FrameID cdp.FrameID `json:"frameId,omitempty"` // Identifies the frame that field belongs to.
+ Card *CreditCard `json:"card"` // Credit card information to fill out the form. Credit card data is not saved.
+}
+
+// Trigger trigger autofill on a form identified by the fieldId. If the field
+// and related form cannot be autofilled, returns an error.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Autofill#method-trigger
+//
+// parameters:
+//
+// fieldID - Identifies a field that serves as an anchor for autofill.
+// card - Credit card information to fill out the form. Credit card data is not saved.
+func Trigger(fieldID cdp.BackendNodeID, card *CreditCard) *TriggerParams {
+ return &TriggerParams{
+ FieldID: fieldID,
+ Card: card,
+ }
+}
+
+// WithFrameID identifies the frame that field belongs to.
+func (p TriggerParams) WithFrameID(frameID cdp.FrameID) *TriggerParams {
+ p.FrameID = frameID
+ return &p
+}
+
+// Do executes Autofill.trigger against the provided context.
+func (p *TriggerParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandTrigger, p, nil)
+}
+
+// SetAddressesParams set addresses so that developers can verify their forms
+// implementation.
+type SetAddressesParams struct {
+ Addresses []*Address `json:"addresses"`
+}
+
+// SetAddresses set addresses so that developers can verify their forms
+// implementation.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Autofill#method-setAddresses
+//
+// parameters:
+//
+// addresses
+func SetAddresses(addresses []*Address) *SetAddressesParams {
+ return &SetAddressesParams{
+ Addresses: addresses,
+ }
+}
+
+// Do executes Autofill.setAddresses against the provided context.
+func (p *SetAddressesParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandSetAddresses, p, nil)
+}
+
+// Command names.
+const (
+ CommandTrigger = "Autofill.trigger"
+ CommandSetAddresses = "Autofill.setAddresses"
+)
diff --git a/autofill/easyjson.go b/autofill/easyjson.go
new file mode 100644
index 0000000..24a6d7a
--- /dev/null
+++ b/autofill/easyjson.go
@@ -0,0 +1,498 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package autofill
+
+import (
+ json "encoding/json"
+ easyjson "github.com/mailru/easyjson"
+ jlexer "github.com/mailru/easyjson/jlexer"
+ jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+ _ *json.RawMessage
+ _ *jlexer.Lexer
+ _ *jwriter.Writer
+ _ easyjson.Marshaler
+)
+
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill(in *jlexer.Lexer, out *TriggerParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "fieldId":
+ (out.FieldID).UnmarshalEasyJSON(in)
+ case "frameId":
+ (out.FrameID).UnmarshalEasyJSON(in)
+ case "card":
+ if in.IsNull() {
+ in.Skip()
+ out.Card = nil
+ } else {
+ if out.Card == nil {
+ out.Card = new(CreditCard)
+ }
+ (*out.Card).UnmarshalEasyJSON(in)
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill(out *jwriter.Writer, in TriggerParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"fieldId\":"
+ out.RawString(prefix[1:])
+ out.Int64(int64(in.FieldID))
+ }
+ if in.FrameID != "" {
+ const prefix string = ",\"frameId\":"
+ out.RawString(prefix)
+ out.String(string(in.FrameID))
+ }
+ {
+ const prefix string = ",\"card\":"
+ out.RawString(prefix)
+ if in.Card == nil {
+ out.RawString("null")
+ } else {
+ (*in.Card).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v TriggerParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v TriggerParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *TriggerParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *TriggerParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill1(in *jlexer.Lexer, out *SetAddressesParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "addresses":
+ if in.IsNull() {
+ in.Skip()
+ out.Addresses = nil
+ } else {
+ in.Delim('[')
+ if out.Addresses == nil {
+ if !in.IsDelim(']') {
+ out.Addresses = make([]*Address, 0, 8)
+ } else {
+ out.Addresses = []*Address{}
+ }
+ } else {
+ out.Addresses = (out.Addresses)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v1 *Address
+ if in.IsNull() {
+ in.Skip()
+ v1 = nil
+ } else {
+ if v1 == nil {
+ v1 = new(Address)
+ }
+ (*v1).UnmarshalEasyJSON(in)
+ }
+ out.Addresses = append(out.Addresses, v1)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill1(out *jwriter.Writer, in SetAddressesParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"addresses\":"
+ out.RawString(prefix[1:])
+ if in.Addresses == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v2, v3 := range in.Addresses {
+ if v2 > 0 {
+ out.RawByte(',')
+ }
+ if v3 == nil {
+ out.RawString("null")
+ } else {
+ (*v3).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v SetAddressesParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill1(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v SetAddressesParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill1(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *SetAddressesParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill1(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *SetAddressesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill1(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill2(in *jlexer.Lexer, out *CreditCard) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "number":
+ out.Number = string(in.String())
+ case "name":
+ out.Name = string(in.String())
+ case "expiryMonth":
+ out.ExpiryMonth = string(in.String())
+ case "expiryYear":
+ out.ExpiryYear = string(in.String())
+ case "cvc":
+ out.Cvc = string(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill2(out *jwriter.Writer, in CreditCard) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"number\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.Number))
+ }
+ {
+ const prefix string = ",\"name\":"
+ out.RawString(prefix)
+ out.String(string(in.Name))
+ }
+ {
+ const prefix string = ",\"expiryMonth\":"
+ out.RawString(prefix)
+ out.String(string(in.ExpiryMonth))
+ }
+ {
+ const prefix string = ",\"expiryYear\":"
+ out.RawString(prefix)
+ out.String(string(in.ExpiryYear))
+ }
+ {
+ const prefix string = ",\"cvc\":"
+ out.RawString(prefix)
+ out.String(string(in.Cvc))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v CreditCard) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill2(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v CreditCard) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill2(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *CreditCard) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill2(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *CreditCard) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill2(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill3(in *jlexer.Lexer, out *AddressField) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "name":
+ out.Name = string(in.String())
+ case "value":
+ out.Value = string(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill3(out *jwriter.Writer, in AddressField) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"name\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.Name))
+ }
+ {
+ const prefix string = ",\"value\":"
+ out.RawString(prefix)
+ out.String(string(in.Value))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v AddressField) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill3(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v AddressField) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill3(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *AddressField) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill3(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *AddressField) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill3(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill4(in *jlexer.Lexer, out *Address) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "fields":
+ if in.IsNull() {
+ in.Skip()
+ out.Fields = nil
+ } else {
+ in.Delim('[')
+ if out.Fields == nil {
+ if !in.IsDelim(']') {
+ out.Fields = make([]*AddressField, 0, 8)
+ } else {
+ out.Fields = []*AddressField{}
+ }
+ } else {
+ out.Fields = (out.Fields)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v4 *AddressField
+ if in.IsNull() {
+ in.Skip()
+ v4 = nil
+ } else {
+ if v4 == nil {
+ v4 = new(AddressField)
+ }
+ (*v4).UnmarshalEasyJSON(in)
+ }
+ out.Fields = append(out.Fields, v4)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill4(out *jwriter.Writer, in Address) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"fields\":"
+ out.RawString(prefix[1:])
+ if in.Fields == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v5, v6 := range in.Fields {
+ if v5 > 0 {
+ out.RawByte(',')
+ }
+ if v6 == nil {
+ out.RawString("null")
+ } else {
+ (*v6).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v Address) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill4(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v Address) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoAutofill4(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *Address) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill4(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *Address) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoAutofill4(l, v)
+}
diff --git a/autofill/types.go b/autofill/types.go
new file mode 100644
index 0000000..3901fc7
--- /dev/null
+++ b/autofill/types.go
@@ -0,0 +1,29 @@
+package autofill
+
+// Code generated by cdproto-gen. DO NOT EDIT.
+
+// CreditCard [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Autofill#type-CreditCard
+type CreditCard struct {
+ Number string `json:"number"` // 16-digit credit card number.
+ Name string `json:"name"` // Name of the credit card owner.
+ ExpiryMonth string `json:"expiryMonth"` // 2-digit expiry month.
+ ExpiryYear string `json:"expiryYear"` // 4-digit expiry year.
+ Cvc string `json:"cvc"` // 3-digit card verification code.
+}
+
+// AddressField [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Autofill#type-AddressField
+type AddressField struct {
+ Name string `json:"name"` // address field name, for example GIVEN_NAME.
+ Value string `json:"value"` // address field name, for example Jon Doe.
+}
+
+// Address [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Autofill#type-Address
+type Address struct {
+ Fields []*AddressField `json:"fields"` // fields and values defining a test address.
+}
diff --git a/browser/browser.go b/browser/browser.go
index d45ad75..bcc64fa 100644
--- a/browser/browser.go
+++ b/browser/browser.go
@@ -319,7 +319,7 @@ func (p *GetBrowserCommandLineParams) Do(ctx context.Context) (arguments []strin
// GetHistogramsParams get Chrome histograms.
type GetHistogramsParams struct {
Query string `json:"query,omitempty"` // Requested substring in name. Only histograms which have query as a substring in their name are extracted. An empty or absent query returns all histograms.
- Delta bool `json:"delta,omitempty"` // If true, retrieve delta since last call.
+ Delta bool `json:"delta,omitempty"` // If true, retrieve delta since last delta call.
}
// GetHistograms get Chrome histograms.
@@ -339,7 +339,7 @@ func (p GetHistogramsParams) WithQuery(query string) *GetHistogramsParams {
return &p
}
-// WithDelta if true, retrieve delta since last call.
+// WithDelta if true, retrieve delta since last delta call.
func (p GetHistogramsParams) WithDelta(delta bool) *GetHistogramsParams {
p.Delta = delta
return &p
@@ -369,7 +369,7 @@ func (p *GetHistogramsParams) Do(ctx context.Context) (histograms []*Histogram,
// GetHistogramParams get a Chrome histogram by name.
type GetHistogramParams struct {
Name string `json:"name"` // Requested histogram name.
- Delta bool `json:"delta,omitempty"` // If true, retrieve delta since last call.
+ Delta bool `json:"delta,omitempty"` // If true, retrieve delta since last delta call.
}
// GetHistogram get a Chrome histogram by name.
@@ -385,7 +385,7 @@ func GetHistogram(name string) *GetHistogramParams {
}
}
-// WithDelta if true, retrieve delta since last call.
+// WithDelta if true, retrieve delta since last delta call.
func (p GetHistogramParams) WithDelta(delta bool) *GetHistogramParams {
p.Delta = delta
return &p
@@ -579,23 +579,51 @@ func (p *ExecuteBrowserCommandParams) Do(ctx context.Context) (err error) {
return cdp.Execute(ctx, CommandExecuteBrowserCommand, p, nil)
}
+// AddPrivacySandboxEnrollmentOverrideParams allows a site to use privacy
+// sandbox features that require enrollment without the site actually being
+// enrolled. Only supported on page targets.
+type AddPrivacySandboxEnrollmentOverrideParams struct {
+ URL string `json:"url"`
+}
+
+// AddPrivacySandboxEnrollmentOverride allows a site to use privacy sandbox
+// features that require enrollment without the site actually being enrolled.
+// Only supported on page targets.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Browser#method-addPrivacySandboxEnrollmentOverride
+//
+// parameters:
+//
+// url
+func AddPrivacySandboxEnrollmentOverride(url string) *AddPrivacySandboxEnrollmentOverrideParams {
+ return &AddPrivacySandboxEnrollmentOverrideParams{
+ URL: url,
+ }
+}
+
+// Do executes Browser.addPrivacySandboxEnrollmentOverride against the provided context.
+func (p *AddPrivacySandboxEnrollmentOverrideParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandAddPrivacySandboxEnrollmentOverride, p, nil)
+}
+
// Command names.
const (
- CommandSetPermission = "Browser.setPermission"
- CommandGrantPermissions = "Browser.grantPermissions"
- CommandResetPermissions = "Browser.resetPermissions"
- CommandSetDownloadBehavior = "Browser.setDownloadBehavior"
- CommandCancelDownload = "Browser.cancelDownload"
- CommandClose = "Browser.close"
- CommandCrash = "Browser.crash"
- CommandCrashGpuProcess = "Browser.crashGpuProcess"
- CommandGetVersion = "Browser.getVersion"
- CommandGetBrowserCommandLine = "Browser.getBrowserCommandLine"
- CommandGetHistograms = "Browser.getHistograms"
- CommandGetHistogram = "Browser.getHistogram"
- CommandGetWindowBounds = "Browser.getWindowBounds"
- CommandGetWindowForTarget = "Browser.getWindowForTarget"
- CommandSetWindowBounds = "Browser.setWindowBounds"
- CommandSetDockTile = "Browser.setDockTile"
- CommandExecuteBrowserCommand = "Browser.executeBrowserCommand"
+ CommandSetPermission = "Browser.setPermission"
+ CommandGrantPermissions = "Browser.grantPermissions"
+ CommandResetPermissions = "Browser.resetPermissions"
+ CommandSetDownloadBehavior = "Browser.setDownloadBehavior"
+ CommandCancelDownload = "Browser.cancelDownload"
+ CommandClose = "Browser.close"
+ CommandCrash = "Browser.crash"
+ CommandCrashGpuProcess = "Browser.crashGpuProcess"
+ CommandGetVersion = "Browser.getVersion"
+ CommandGetBrowserCommandLine = "Browser.getBrowserCommandLine"
+ CommandGetHistograms = "Browser.getHistograms"
+ CommandGetHistogram = "Browser.getHistogram"
+ CommandGetWindowBounds = "Browser.getWindowBounds"
+ CommandGetWindowForTarget = "Browser.getWindowForTarget"
+ CommandSetWindowBounds = "Browser.setWindowBounds"
+ CommandSetDockTile = "Browser.setDockTile"
+ CommandExecuteBrowserCommand = "Browser.executeBrowserCommand"
+ CommandAddPrivacySandboxEnrollmentOverride = "Browser.addPrivacySandboxEnrollmentOverride"
)
diff --git a/browser/easyjson.go b/browser/easyjson.go
index 95854e0..82374ec 100644
--- a/browser/easyjson.go
+++ b/browser/easyjson.go
@@ -2419,3 +2419,69 @@ func (v *Bounds) UnmarshalJSON(data []byte) error {
func (v *Bounds) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoBrowser28(l, v)
}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoBrowser29(in *jlexer.Lexer, out *AddPrivacySandboxEnrollmentOverrideParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "url":
+ out.URL = string(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoBrowser29(out *jwriter.Writer, in AddPrivacySandboxEnrollmentOverrideParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"url\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.URL))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v AddPrivacySandboxEnrollmentOverrideParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoBrowser29(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v AddPrivacySandboxEnrollmentOverrideParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoBrowser29(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *AddPrivacySandboxEnrollmentOverrideParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoBrowser29(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *AddPrivacySandboxEnrollmentOverrideParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoBrowser29(l, v)
+}
diff --git a/cachestorage/cachestorage.go b/cachestorage/cachestorage.go
index 46c6ace..c0d36dc 100644
--- a/cachestorage/cachestorage.go
+++ b/cachestorage/cachestorage.go
@@ -10,6 +10,7 @@ import (
"context"
"github.com/chromedp/cdproto/cdp"
+ "github.com/chromedp/cdproto/storage"
)
// DeleteCacheParams deletes a cache.
@@ -63,8 +64,9 @@ func (p *DeleteEntryParams) Do(ctx context.Context) (err error) {
// RequestCacheNamesParams requests cache names.
type RequestCacheNamesParams struct {
- SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey must be specified. Security origin.
- StorageKey string `json:"storageKey,omitempty"` // Storage key.
+ SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey, storageBucket must be specified. Security origin.
+ StorageKey string `json:"storageKey,omitempty"` // Storage key.
+ StorageBucket *storage.Bucket `json:"storageBucket,omitempty"` // Storage bucket. If not specified, it uses the default bucket.
}
// RequestCacheNames requests cache names.
@@ -76,8 +78,8 @@ func RequestCacheNames() *RequestCacheNamesParams {
return &RequestCacheNamesParams{}
}
-// WithSecurityOrigin at least and at most one of securityOrigin, storageKey
-// must be specified. Security origin.
+// WithSecurityOrigin at least and at most one of securityOrigin, storageKey,
+// storageBucket must be specified. Security origin.
func (p RequestCacheNamesParams) WithSecurityOrigin(securityOrigin string) *RequestCacheNamesParams {
p.SecurityOrigin = securityOrigin
return &p
@@ -89,6 +91,13 @@ func (p RequestCacheNamesParams) WithStorageKey(storageKey string) *RequestCache
return &p
}
+// WithStorageBucket storage bucket. If not specified, it uses the default
+// bucket.
+func (p RequestCacheNamesParams) WithStorageBucket(storageBucket *storage.Bucket) *RequestCacheNamesParams {
+ p.StorageBucket = storageBucket
+ return &p
+}
+
// RequestCacheNamesReturns return values.
type RequestCacheNamesReturns struct {
Caches []*Cache `json:"caches,omitempty"` // Caches for the security origin.
diff --git a/cachestorage/easyjson.go b/cachestorage/easyjson.go
index 3958cf1..0b3ca72 100644
--- a/cachestorage/easyjson.go
+++ b/cachestorage/easyjson.go
@@ -4,6 +4,7 @@ package cachestorage
import (
json "encoding/json"
+ storage "github.com/chromedp/cdproto/storage"
easyjson "github.com/mailru/easyjson"
jlexer "github.com/mailru/easyjson/jlexer"
jwriter "github.com/mailru/easyjson/jwriter"
@@ -556,6 +557,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCachestorage5(in *jlexer.Lexe
out.SecurityOrigin = string(in.String())
case "storageKey":
out.StorageKey = string(in.String())
+ case "storageBucket":
+ if in.IsNull() {
+ in.Skip()
+ out.StorageBucket = nil
+ } else {
+ if out.StorageBucket == nil {
+ out.StorageBucket = new(storage.Bucket)
+ }
+ (*out.StorageBucket).UnmarshalEasyJSON(in)
+ }
default:
in.SkipRecursive()
}
@@ -586,6 +597,16 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCachestorage5(out *jwriter.Wr
}
out.String(string(in.StorageKey))
}
+ if in.StorageBucket != nil {
+ const prefix string = ",\"storageBucket\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (*in.StorageBucket).MarshalEasyJSON(out)
+ }
out.RawByte('}')
}
@@ -1118,6 +1139,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCachestorage11(in *jlexer.Lex
out.SecurityOrigin = string(in.String())
case "storageKey":
out.StorageKey = string(in.String())
+ case "storageBucket":
+ if in.IsNull() {
+ in.Skip()
+ out.StorageBucket = nil
+ } else {
+ if out.StorageBucket == nil {
+ out.StorageBucket = new(storage.Bucket)
+ }
+ (*out.StorageBucket).UnmarshalEasyJSON(in)
+ }
case "cacheName":
out.CacheName = string(in.String())
default:
@@ -1149,6 +1180,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCachestorage11(out *jwriter.W
out.RawString(prefix)
out.String(string(in.StorageKey))
}
+ if in.StorageBucket != nil {
+ const prefix string = ",\"storageBucket\":"
+ out.RawString(prefix)
+ (*in.StorageBucket).MarshalEasyJSON(out)
+ }
{
const prefix string = ",\"cacheName\":"
out.RawString(prefix)
diff --git a/cachestorage/types.go b/cachestorage/types.go
index 92c0216..84c0ad7 100644
--- a/cachestorage/types.go
+++ b/cachestorage/types.go
@@ -5,6 +5,7 @@ package cachestorage
import (
"fmt"
+ "github.com/chromedp/cdproto/storage"
"github.com/mailru/easyjson"
"github.com/mailru/easyjson/jlexer"
"github.com/mailru/easyjson/jwriter"
@@ -95,10 +96,11 @@ type DataEntry struct {
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/CacheStorage#type-Cache
type Cache struct {
- CacheID CacheID `json:"cacheId"` // An opaque unique id of the cache.
- SecurityOrigin string `json:"securityOrigin"` // Security origin of the cache.
- StorageKey string `json:"storageKey"` // Storage key of the cache.
- CacheName string `json:"cacheName"` // The name of the cache.
+ CacheID CacheID `json:"cacheId"` // An opaque unique id of the cache.
+ SecurityOrigin string `json:"securityOrigin"` // Security origin of the cache.
+ StorageKey string `json:"storageKey"` // Storage key of the cache.
+ StorageBucket *storage.Bucket `json:"storageBucket,omitempty"` // Storage bucket of the cache.
+ CacheName string `json:"cacheName"` // The name of the cache.
}
// Header [no description].
diff --git a/cdp/types.go b/cdp/types.go
index 390e99c..8b9014a 100644
--- a/cdp/types.go
+++ b/cdp/types.go
@@ -790,6 +790,40 @@ func (t *MonotonicTime) UnmarshalJSON(buf []byte) error {
return easyjson.Unmarshal(buf, t)
}
+// TimeSinceEpochMilli special timestamp type for Response's responseTime
+// field.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Network#type-TimeSinceEpochMilli
+type TimeSinceEpochMilli time.Time
+
+// Time returns the TimeSinceEpochMilli as time.Time value.
+func (t TimeSinceEpochMilli) Time() time.Time {
+ return time.Time(t)
+}
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t TimeSinceEpochMilli) MarshalEasyJSON(out *jwriter.Writer) {
+ v := float64(time.Time(t).UnixNano() / int64(time.Millisecond))
+
+ out.Buffer.EnsureSpace(20)
+ out.Buffer.Buf = strconv.AppendFloat(out.Buffer.Buf, v, 'f', -1, 64)
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t TimeSinceEpochMilli) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *TimeSinceEpochMilli) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ *t = TimeSinceEpochMilli(time.Unix(0, int64(in.Float64()*float64(time.Millisecond))))
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *TimeSinceEpochMilli) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
// FrameID unique frame identifier.
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Page#type-FrameId
diff --git a/cdproto.go b/cdproto.go
index 4012b57..0a9e80b 100644
--- a/cdproto.go
+++ b/cdproto.go
@@ -15,6 +15,7 @@ import (
"github.com/chromedp/cdproto/accessibility"
"github.com/chromedp/cdproto/animation"
"github.com/chromedp/cdproto/audits"
+ "github.com/chromedp/cdproto/autofill"
"github.com/chromedp/cdproto/backgroundservice"
"github.com/chromedp/cdproto/browser"
"github.com/chromedp/cdproto/cachestorage"
@@ -23,6 +24,7 @@ import (
"github.com/chromedp/cdproto/css"
"github.com/chromedp/cdproto/database"
"github.com/chromedp/cdproto/debugger"
+ "github.com/chromedp/cdproto/deviceaccess"
"github.com/chromedp/cdproto/deviceorientation"
"github.com/chromedp/cdproto/dom"
"github.com/chromedp/cdproto/domdebugger"
@@ -30,6 +32,7 @@ import (
"github.com/chromedp/cdproto/domstorage"
"github.com/chromedp/cdproto/emulation"
"github.com/chromedp/cdproto/eventbreakpoints"
+ "github.com/chromedp/cdproto/fedcm"
"github.com/chromedp/cdproto/fetch"
"github.com/chromedp/cdproto/headlessexperimental"
"github.com/chromedp/cdproto/heapprofiler"
@@ -46,6 +49,7 @@ import (
"github.com/chromedp/cdproto/page"
"github.com/chromedp/cdproto/performance"
"github.com/chromedp/cdproto/performancetimeline"
+ "github.com/chromedp/cdproto/preload"
"github.com/chromedp/cdproto/profiler"
"github.com/chromedp/cdproto/runtime"
"github.com/chromedp/cdproto/security"
@@ -103,7 +107,10 @@ const (
CommandAuditsDisable = audits.CommandDisable
CommandAuditsEnable = audits.CommandEnable
CommandAuditsCheckContrast = audits.CommandCheckContrast
+ CommandAuditsCheckFormsIssues = audits.CommandCheckFormsIssues
EventAuditsIssueAdded = "Audits.issueAdded"
+ CommandAutofillTrigger = autofill.CommandTrigger
+ CommandAutofillSetAddresses = autofill.CommandSetAddresses
CommandBackgroundServiceStartObserving = backgroundservice.CommandStartObserving
CommandBackgroundServiceStopObserving = backgroundservice.CommandStopObserving
CommandBackgroundServiceSetRecording = backgroundservice.CommandSetRecording
@@ -127,6 +134,7 @@ const (
CommandBrowserSetWindowBounds = browser.CommandSetWindowBounds
CommandBrowserSetDockTile = browser.CommandSetDockTile
CommandBrowserExecuteBrowserCommand = browser.CommandExecuteBrowserCommand
+ CommandBrowserAddPrivacySandboxEnrollmentOverride = browser.CommandAddPrivacySandboxEnrollmentOverride
EventBrowserDownloadWillBegin = "Browser.downloadWillBegin"
EventBrowserDownloadProgress = "Browser.downloadProgress"
CommandCSSAddRule = css.CommandAddRule
@@ -299,6 +307,11 @@ const (
EventDebuggerResumed = "Debugger.resumed"
EventDebuggerScriptFailedToParse = "Debugger.scriptFailedToParse"
EventDebuggerScriptParsed = "Debugger.scriptParsed"
+ CommandDeviceAccessEnable = deviceaccess.CommandEnable
+ CommandDeviceAccessDisable = deviceaccess.CommandDisable
+ CommandDeviceAccessSelectPrompt = deviceaccess.CommandSelectPrompt
+ CommandDeviceAccessCancelPrompt = deviceaccess.CommandCancelPrompt
+ EventDeviceAccessDeviceRequestPrompted = "DeviceAccess.deviceRequestPrompted"
CommandDeviceOrientationClearDeviceOrientationOverride = deviceorientation.CommandClearDeviceOrientationOverride
CommandDeviceOrientationSetDeviceOrientationOverride = deviceorientation.CommandSetDeviceOrientationOverride
CommandEmulationCanEmulate = emulation.CommandCanEmulate
@@ -331,6 +344,12 @@ const (
EventEmulationVirtualTimeBudgetExpired = "Emulation.virtualTimeBudgetExpired"
CommandEventBreakpointsSetInstrumentationBreakpoint = eventbreakpoints.CommandSetInstrumentationBreakpoint
CommandEventBreakpointsRemoveInstrumentationBreakpoint = eventbreakpoints.CommandRemoveInstrumentationBreakpoint
+ CommandFedCmEnable = fedcm.CommandEnable
+ CommandFedCmDisable = fedcm.CommandDisable
+ CommandFedCmSelectAccount = fedcm.CommandSelectAccount
+ CommandFedCmDismissDialog = fedcm.CommandDismissDialog
+ CommandFedCmResetCooldown = fedcm.CommandResetCooldown
+ EventFedCmDialogShown = "FedCm.dialogShown"
CommandFetchDisable = fetch.CommandDisable
CommandFetchEnable = fetch.CommandEnable
CommandFetchFailRequest = fetch.CommandFailRequest
@@ -378,6 +397,7 @@ const (
CommandInputImeSetComposition = input.CommandImeSetComposition
CommandInputDispatchMouseEvent = input.CommandDispatchMouseEvent
CommandInputDispatchTouchEvent = input.CommandDispatchTouchEvent
+ CommandInputCancelDragging = input.CommandCancelDragging
CommandInputEmulateTouchFromMouseEvent = input.CommandEmulateTouchFromMouseEvent
CommandInputSetIgnoreInputEvents = input.CommandSetIgnoreInputEvents
CommandInputSetInterceptDrags = input.CommandSetInterceptDrags
@@ -518,7 +538,6 @@ const (
CommandPageEnable = page.CommandEnable
CommandPageGetAppManifest = page.CommandGetAppManifest
CommandPageGetInstallabilityErrors = page.CommandGetInstallabilityErrors
- CommandPageGetManifestIcons = page.CommandGetManifestIcons
CommandPageGetAppID = page.CommandGetAppID
CommandPageGetAdScriptID = page.CommandGetAdScriptID
CommandPageGetFrameTree = page.CommandGetFrameTree
@@ -553,9 +572,11 @@ const (
CommandPageAddCompilationCache = page.CommandAddCompilationCache
CommandPageClearCompilationCache = page.CommandClearCompilationCache
CommandPageSetSPCTransactionMode = page.CommandSetSPCTransactionMode
+ CommandPageSetRPHRegistrationMode = page.CommandSetRPHRegistrationMode
CommandPageGenerateTestReport = page.CommandGenerateTestReport
CommandPageWaitForDebugger = page.CommandWaitForDebugger
CommandPageSetInterceptFileChooserDialog = page.CommandSetInterceptFileChooserDialog
+ CommandPageSetPrerenderingAllowed = page.CommandSetPrerenderingAllowed
EventPageDomContentEventFired = "Page.domContentEventFired"
EventPageFileChooserOpened = "Page.fileChooserOpened"
EventPageFrameAttached = "Page.frameAttached"
@@ -572,7 +593,6 @@ const (
EventPageJavascriptDialogOpening = "Page.javascriptDialogOpening"
EventPageLifecycleEvent = "Page.lifecycleEvent"
EventPageBackForwardCacheNotUsed = "Page.backForwardCacheNotUsed"
- EventPagePrerenderAttemptCompleted = "Page.prerenderAttemptCompleted"
EventPageLoadEventFired = "Page.loadEventFired"
EventPageNavigatedWithinDocument = "Page.navigatedWithinDocument"
EventPageScreencastFrame = "Page.screencastFrame"
@@ -585,6 +605,15 @@ const (
EventPerformanceMetrics = "Performance.metrics"
CommandPerformanceTimelineEnable = performancetimeline.CommandEnable
EventPerformanceTimelineTimelineEventAdded = "PerformanceTimeline.timelineEventAdded"
+ CommandPreloadEnable = preload.CommandEnable
+ CommandPreloadDisable = preload.CommandDisable
+ EventPreloadRuleSetUpdated = "Preload.ruleSetUpdated"
+ EventPreloadRuleSetRemoved = "Preload.ruleSetRemoved"
+ EventPreloadPrerenderAttemptCompleted = "Preload.prerenderAttemptCompleted"
+ EventPreloadPreloadEnabledStateUpdated = "Preload.preloadEnabledStateUpdated"
+ EventPreloadPrefetchStatusUpdated = "Preload.prefetchStatusUpdated"
+ EventPreloadPrerenderStatusUpdated = "Preload.prerenderStatusUpdated"
+ EventPreloadPreloadingAttemptSourcesUpdated = "Preload.preloadingAttemptSourcesUpdated"
CommandProfilerDisable = profiler.CommandDisable
CommandProfilerEnable = profiler.CommandEnable
CommandProfilerGetBestEffortCoverage = profiler.CommandGetBestEffortCoverage
@@ -674,12 +703,20 @@ const (
CommandStorageClearSharedStorageEntries = storage.CommandClearSharedStorageEntries
CommandStorageResetSharedStorageBudget = storage.CommandResetSharedStorageBudget
CommandStorageSetSharedStorageTracking = storage.CommandSetSharedStorageTracking
+ CommandStorageSetStorageBucketTracking = storage.CommandSetStorageBucketTracking
+ CommandStorageDeleteStorageBucket = storage.CommandDeleteStorageBucket
+ CommandStorageRunBounceTrackingMitigations = storage.CommandRunBounceTrackingMitigations
+ CommandStorageSetAttributionReportingLocalTestingMode = storage.CommandSetAttributionReportingLocalTestingMode
+ CommandStorageSetAttributionReportingTracking = storage.CommandSetAttributionReportingTracking
EventStorageCacheStorageContentUpdated = "Storage.cacheStorageContentUpdated"
EventStorageCacheStorageListUpdated = "Storage.cacheStorageListUpdated"
EventStorageIndexedDBContentUpdated = "Storage.indexedDBContentUpdated"
EventStorageIndexedDBListUpdated = "Storage.indexedDBListUpdated"
EventStorageInterestGroupAccessed = "Storage.interestGroupAccessed"
EventStorageSharedStorageAccessed = "Storage.sharedStorageAccessed"
+ EventStorageStorageBucketCreatedOrUpdated = "Storage.storageBucketCreatedOrUpdated"
+ EventStorageStorageBucketDeleted = "Storage.storageBucketDeleted"
+ EventStorageAttributionReportingSourceRegistered = "Storage.attributionReportingSourceRegistered"
CommandSystemInfoGetInfo = systeminfo.CommandGetInfo
CommandSystemInfoGetFeatureState = systeminfo.CommandGetFeatureState
CommandSystemInfoGetProcessInfo = systeminfo.CommandGetProcessInfo
@@ -860,9 +897,18 @@ func UnmarshalMessage(msg *Message) (interface{}, error) {
case CommandAuditsCheckContrast:
return emptyVal, nil
+ case CommandAuditsCheckFormsIssues:
+ v = new(audits.CheckFormsIssuesReturns)
+
case EventAuditsIssueAdded:
v = new(audits.EventIssueAdded)
+ case CommandAutofillTrigger:
+ return emptyVal, nil
+
+ case CommandAutofillSetAddresses:
+ return emptyVal, nil
+
case CommandBackgroundServiceStartObserving:
return emptyVal, nil
@@ -932,6 +978,9 @@ func UnmarshalMessage(msg *Message) (interface{}, error) {
case CommandBrowserExecuteBrowserCommand:
return emptyVal, nil
+ case CommandBrowserAddPrivacySandboxEnrollmentOverride:
+ return emptyVal, nil
+
case EventBrowserDownloadWillBegin:
v = new(browser.EventDownloadWillBegin)
@@ -1448,6 +1497,21 @@ func UnmarshalMessage(msg *Message) (interface{}, error) {
case EventDebuggerScriptParsed:
v = new(debugger.EventScriptParsed)
+ case CommandDeviceAccessEnable:
+ return emptyVal, nil
+
+ case CommandDeviceAccessDisable:
+ return emptyVal, nil
+
+ case CommandDeviceAccessSelectPrompt:
+ return emptyVal, nil
+
+ case CommandDeviceAccessCancelPrompt:
+ return emptyVal, nil
+
+ case EventDeviceAccessDeviceRequestPrompted:
+ v = new(deviceaccess.EventDeviceRequestPrompted)
+
case CommandDeviceOrientationClearDeviceOrientationOverride:
return emptyVal, nil
@@ -1544,6 +1608,24 @@ func UnmarshalMessage(msg *Message) (interface{}, error) {
case CommandEventBreakpointsRemoveInstrumentationBreakpoint:
return emptyVal, nil
+ case CommandFedCmEnable:
+ return emptyVal, nil
+
+ case CommandFedCmDisable:
+ return emptyVal, nil
+
+ case CommandFedCmSelectAccount:
+ return emptyVal, nil
+
+ case CommandFedCmDismissDialog:
+ return emptyVal, nil
+
+ case CommandFedCmResetCooldown:
+ return emptyVal, nil
+
+ case EventFedCmDialogShown:
+ v = new(fedcm.EventDialogShown)
+
case CommandFetchDisable:
return emptyVal, nil
@@ -1685,6 +1767,9 @@ func UnmarshalMessage(msg *Message) (interface{}, error) {
case CommandInputDispatchTouchEvent:
return emptyVal, nil
+ case CommandInputCancelDragging:
+ return emptyVal, nil
+
case CommandInputEmulateTouchFromMouseEvent:
return emptyVal, nil
@@ -2105,9 +2190,6 @@ func UnmarshalMessage(msg *Message) (interface{}, error) {
case CommandPageGetInstallabilityErrors:
v = new(page.GetInstallabilityErrorsReturns)
- case CommandPageGetManifestIcons:
- v = new(page.GetManifestIconsReturns)
-
case CommandPageGetAppID:
v = new(page.GetAppIDReturns)
@@ -2210,6 +2292,9 @@ func UnmarshalMessage(msg *Message) (interface{}, error) {
case CommandPageSetSPCTransactionMode:
return emptyVal, nil
+ case CommandPageSetRPHRegistrationMode:
+ return emptyVal, nil
+
case CommandPageGenerateTestReport:
return emptyVal, nil
@@ -2219,6 +2304,9 @@ func UnmarshalMessage(msg *Message) (interface{}, error) {
case CommandPageSetInterceptFileChooserDialog:
return emptyVal, nil
+ case CommandPageSetPrerenderingAllowed:
+ return emptyVal, nil
+
case EventPageDomContentEventFired:
v = new(page.EventDomContentEventFired)
@@ -2267,9 +2355,6 @@ func UnmarshalMessage(msg *Message) (interface{}, error) {
case EventPageBackForwardCacheNotUsed:
v = new(page.EventBackForwardCacheNotUsed)
- case EventPagePrerenderAttemptCompleted:
- v = new(page.EventPrerenderAttemptCompleted)
-
case EventPageLoadEventFired:
v = new(page.EventLoadEventFired)
@@ -2306,6 +2391,33 @@ func UnmarshalMessage(msg *Message) (interface{}, error) {
case EventPerformanceTimelineTimelineEventAdded:
v = new(performancetimeline.EventTimelineEventAdded)
+ case CommandPreloadEnable:
+ return emptyVal, nil
+
+ case CommandPreloadDisable:
+ return emptyVal, nil
+
+ case EventPreloadRuleSetUpdated:
+ v = new(preload.EventRuleSetUpdated)
+
+ case EventPreloadRuleSetRemoved:
+ v = new(preload.EventRuleSetRemoved)
+
+ case EventPreloadPrerenderAttemptCompleted:
+ v = new(preload.EventPrerenderAttemptCompleted)
+
+ case EventPreloadPreloadEnabledStateUpdated:
+ v = new(preload.EventPreloadEnabledStateUpdated)
+
+ case EventPreloadPrefetchStatusUpdated:
+ v = new(preload.EventPrefetchStatusUpdated)
+
+ case EventPreloadPrerenderStatusUpdated:
+ v = new(preload.EventPrerenderStatusUpdated)
+
+ case EventPreloadPreloadingAttemptSourcesUpdated:
+ v = new(preload.EventPreloadingAttemptSourcesUpdated)
+
case CommandProfilerDisable:
return emptyVal, nil
@@ -2573,6 +2685,21 @@ func UnmarshalMessage(msg *Message) (interface{}, error) {
case CommandStorageSetSharedStorageTracking:
return emptyVal, nil
+ case CommandStorageSetStorageBucketTracking:
+ return emptyVal, nil
+
+ case CommandStorageDeleteStorageBucket:
+ return emptyVal, nil
+
+ case CommandStorageRunBounceTrackingMitigations:
+ v = new(storage.RunBounceTrackingMitigationsReturns)
+
+ case CommandStorageSetAttributionReportingLocalTestingMode:
+ return emptyVal, nil
+
+ case CommandStorageSetAttributionReportingTracking:
+ return emptyVal, nil
+
case EventStorageCacheStorageContentUpdated:
v = new(storage.EventCacheStorageContentUpdated)
@@ -2591,6 +2718,15 @@ func UnmarshalMessage(msg *Message) (interface{}, error) {
case EventStorageSharedStorageAccessed:
v = new(storage.EventSharedStorageAccessed)
+ case EventStorageStorageBucketCreatedOrUpdated:
+ v = new(storage.EventStorageBucketCreatedOrUpdated)
+
+ case EventStorageStorageBucketDeleted:
+ v = new(storage.EventStorageBucketDeleted)
+
+ case EventStorageAttributionReportingSourceRegistered:
+ v = new(storage.EventAttributionReportingSourceRegistered)
+
case CommandSystemInfoGetInfo:
v = new(systeminfo.GetInfoReturns)
diff --git a/css/css.go b/css/css.go
index c8ddbdb..4dad0bf 100644
--- a/css/css.go
+++ b/css/css.go
@@ -361,14 +361,17 @@ func GetMatchedStylesForNode(nodeID cdp.NodeID) *GetMatchedStylesForNodeParams {
// GetMatchedStylesForNodeReturns return values.
type GetMatchedStylesForNodeReturns struct {
- InlineStyle *Style `json:"inlineStyle,omitempty"` // Inline style for the specified DOM node.
- AttributesStyle *Style `json:"attributesStyle,omitempty"` // Attribute-defined element style (e.g. resulting from "width=20 height=100%").
- MatchedCSSRules []*RuleMatch `json:"matchedCSSRules,omitempty"` // CSS rules matching this node, from all applicable stylesheets.
- PseudoElements []*PseudoElementMatches `json:"pseudoElements,omitempty"` // Pseudo style matches for this node.
- Inherited []*InheritedStyleEntry `json:"inherited,omitempty"` // A chain of inherited styles (from the immediate node parent up to the DOM tree root).
- InheritedPseudoElements []*InheritedPseudoElementMatches `json:"inheritedPseudoElements,omitempty"` // A chain of inherited pseudo element styles (from the immediate node parent up to the DOM tree root).
- CSSKeyframesRules []*KeyframesRule `json:"cssKeyframesRules,omitempty"` // A list of CSS keyframed animations matching this node.
- ParentLayoutNodeID cdp.NodeID `json:"parentLayoutNodeId,omitempty"` // Id of the first parent element that does not have display: contents.
+ InlineStyle *Style `json:"inlineStyle,omitempty"` // Inline style for the specified DOM node.
+ AttributesStyle *Style `json:"attributesStyle,omitempty"` // Attribute-defined element style (e.g. resulting from "width=20 height=100%").
+ MatchedCSSRules []*RuleMatch `json:"matchedCSSRules,omitempty"` // CSS rules matching this node, from all applicable stylesheets.
+ PseudoElements []*PseudoElementMatches `json:"pseudoElements,omitempty"` // Pseudo style matches for this node.
+ Inherited []*InheritedStyleEntry `json:"inherited,omitempty"` // A chain of inherited styles (from the immediate node parent up to the DOM tree root).
+ InheritedPseudoElements []*InheritedPseudoElementMatches `json:"inheritedPseudoElements,omitempty"` // A chain of inherited pseudo element styles (from the immediate node parent up to the DOM tree root).
+ CSSKeyframesRules []*KeyframesRule `json:"cssKeyframesRules,omitempty"` // A list of CSS keyframed animations matching this node.
+ CSSPositionFallbackRules []*PositionFallbackRule `json:"cssPositionFallbackRules,omitempty"` // A list of CSS position fallbacks matching this node.
+ CSSPropertyRules []*PropertyRule `json:"cssPropertyRules,omitempty"` // A list of CSS at-property rules matching this node.
+ CSSPropertyRegistrations []*PropertyRegistration `json:"cssPropertyRegistrations,omitempty"` // A list of CSS property registrations matching this node.
+ ParentLayoutNodeID cdp.NodeID `json:"parentLayoutNodeId,omitempty"` // Id of the first parent element that does not have display: contents.
}
// Do executes CSS.getMatchedStylesForNode against the provided context.
@@ -382,16 +385,19 @@ type GetMatchedStylesForNodeReturns struct {
// inherited - A chain of inherited styles (from the immediate node parent up to the DOM tree root).
// inheritedPseudoElements - A chain of inherited pseudo element styles (from the immediate node parent up to the DOM tree root).
// cssKeyframesRules - A list of CSS keyframed animations matching this node.
+// cssPositionFallbackRules - A list of CSS position fallbacks matching this node.
+// cssPropertyRules - A list of CSS at-property rules matching this node.
+// cssPropertyRegistrations - A list of CSS property registrations matching this node.
// parentLayoutNodeID - Id of the first parent element that does not have display: contents.
-func (p *GetMatchedStylesForNodeParams) Do(ctx context.Context) (inlineStyle *Style, attributesStyle *Style, matchedCSSRules []*RuleMatch, pseudoElements []*PseudoElementMatches, inherited []*InheritedStyleEntry, inheritedPseudoElements []*InheritedPseudoElementMatches, cssKeyframesRules []*KeyframesRule, parentLayoutNodeID cdp.NodeID, err error) {
+func (p *GetMatchedStylesForNodeParams) Do(ctx context.Context) (inlineStyle *Style, attributesStyle *Style, matchedCSSRules []*RuleMatch, pseudoElements []*PseudoElementMatches, inherited []*InheritedStyleEntry, inheritedPseudoElements []*InheritedPseudoElementMatches, cssKeyframesRules []*KeyframesRule, cssPositionFallbackRules []*PositionFallbackRule, cssPropertyRules []*PropertyRule, cssPropertyRegistrations []*PropertyRegistration, parentLayoutNodeID cdp.NodeID, err error) {
// execute
var res GetMatchedStylesForNodeReturns
err = cdp.Execute(ctx, CommandGetMatchedStylesForNode, p, &res)
if err != nil {
- return nil, nil, nil, nil, nil, nil, nil, 0, err
+ return nil, nil, nil, nil, nil, nil, nil, nil, nil, nil, 0, err
}
- return res.InlineStyle, res.AttributesStyle, res.MatchedCSSRules, res.PseudoElements, res.Inherited, res.InheritedPseudoElements, res.CSSKeyframesRules, res.ParentLayoutNodeID, nil
+ return res.InlineStyle, res.AttributesStyle, res.MatchedCSSRules, res.PseudoElements, res.Inherited, res.InheritedPseudoElements, res.CSSKeyframesRules, res.CSSPositionFallbackRules, res.CSSPropertyRules, res.CSSPropertyRegistrations, res.ParentLayoutNodeID, nil
}
// GetMediaQueriesParams returns all media queries parsed by the rendering
@@ -604,14 +610,14 @@ func TakeComputedStyleUpdates() *TakeComputedStyleUpdatesParams {
// TakeComputedStyleUpdatesReturns return values.
type TakeComputedStyleUpdatesReturns struct {
- NodeIDs []cdp.NodeID `json:"nodeIds,omitempty"` // The list of node Ids that have their tracked computed styles updated
+ NodeIDs []cdp.NodeID `json:"nodeIds,omitempty"` // The list of node Ids that have their tracked computed styles updated.
}
// Do executes CSS.takeComputedStyleUpdates against the provided context.
//
// returns:
//
-// nodeIDs - The list of node Ids that have their tracked computed styles updated
+// nodeIDs - The list of node Ids that have their tracked computed styles updated.
func (p *TakeComputedStyleUpdatesParams) Do(ctx context.Context) (nodeIDs []cdp.NodeID, err error) {
// execute
var res TakeComputedStyleUpdatesReturns
diff --git a/css/easyjson.go b/css/easyjson.go
index f186571..29b326d 100644
--- a/css/easyjson.go
+++ b/css/easyjson.go
@@ -49,6 +49,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss(in *jlexer.Lexer, out *Va
}
(*out.Range).UnmarshalEasyJSON(in)
}
+ case "specificity":
+ if in.IsNull() {
+ in.Skip()
+ out.Specificity = nil
+ } else {
+ if out.Specificity == nil {
+ out.Specificity = new(Specificity)
+ }
+ (*out.Specificity).UnmarshalEasyJSON(in)
+ }
default:
in.SkipRecursive()
}
@@ -73,6 +83,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss(out *jwriter.Writer, in V
out.RawString(prefix)
(*in.Range).MarshalEasyJSON(out)
}
+ if in.Specificity != nil {
+ const prefix string = ",\"specificity\":"
+ out.RawString(prefix)
+ (*in.Specificity).MarshalEasyJSON(out)
+ }
out.RawByte('}')
}
@@ -99,7 +114,105 @@ func (v *Value) UnmarshalJSON(data []byte) error {
func (v *Value) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss1(in *jlexer.Lexer, out *TrackComputedStyleUpdatesParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss1(in *jlexer.Lexer, out *TryRule) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "styleSheetId":
+ out.StyleSheetID = StyleSheetID(in.String())
+ case "origin":
+ (out.Origin).UnmarshalEasyJSON(in)
+ case "style":
+ if in.IsNull() {
+ in.Skip()
+ out.Style = nil
+ } else {
+ if out.Style == nil {
+ out.Style = new(Style)
+ }
+ (*out.Style).UnmarshalEasyJSON(in)
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss1(out *jwriter.Writer, in TryRule) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ if in.StyleSheetID != "" {
+ const prefix string = ",\"styleSheetId\":"
+ first = false
+ out.RawString(prefix[1:])
+ out.String(string(in.StyleSheetID))
+ }
+ {
+ const prefix string = ",\"origin\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (in.Origin).MarshalEasyJSON(out)
+ }
+ {
+ const prefix string = ",\"style\":"
+ out.RawString(prefix)
+ if in.Style == nil {
+ out.RawString("null")
+ } else {
+ (*in.Style).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v TryRule) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss1(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v TryRule) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss1(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *TryRule) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss1(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *TryRule) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss1(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss2(in *jlexer.Lexer, out *TrackComputedStyleUpdatesParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -159,7 +272,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss1(in *jlexer.Lexer, out *T
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss1(out *jwriter.Writer, in TrackComputedStyleUpdatesParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss2(out *jwriter.Writer, in TrackComputedStyleUpdatesParams) {
out.RawByte('{')
first := true
_ = first
@@ -189,27 +302,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss1(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v TrackComputedStyleUpdatesParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss1(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss2(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v TrackComputedStyleUpdatesParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss1(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss2(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *TrackComputedStyleUpdatesParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss1(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss2(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *TrackComputedStyleUpdatesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss1(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss2(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss2(in *jlexer.Lexer, out *TakeCoverageDeltaReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss3(in *jlexer.Lexer, out *TakeCoverageDeltaReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -271,7 +384,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss2(in *jlexer.Lexer, out *T
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss2(out *jwriter.Writer, in TakeCoverageDeltaReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss3(out *jwriter.Writer, in TakeCoverageDeltaReturns) {
out.RawByte('{')
first := true
_ = first
@@ -310,27 +423,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss2(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v TakeCoverageDeltaReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss2(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss3(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v TakeCoverageDeltaReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss2(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss3(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *TakeCoverageDeltaReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss2(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss3(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *TakeCoverageDeltaReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss2(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss3(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss3(in *jlexer.Lexer, out *TakeCoverageDeltaParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss4(in *jlexer.Lexer, out *TakeCoverageDeltaParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -359,7 +472,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss3(in *jlexer.Lexer, out *T
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss3(out *jwriter.Writer, in TakeCoverageDeltaParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss4(out *jwriter.Writer, in TakeCoverageDeltaParams) {
out.RawByte('{')
first := true
_ = first
@@ -369,27 +482,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss3(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v TakeCoverageDeltaParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss3(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss4(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v TakeCoverageDeltaParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss3(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss4(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *TakeCoverageDeltaParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss3(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss4(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *TakeCoverageDeltaParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss3(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss4(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss4(in *jlexer.Lexer, out *TakeComputedStyleUpdatesReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss5(in *jlexer.Lexer, out *TakeComputedStyleUpdatesReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -441,7 +554,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss4(in *jlexer.Lexer, out *T
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss4(out *jwriter.Writer, in TakeComputedStyleUpdatesReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss5(out *jwriter.Writer, in TakeComputedStyleUpdatesReturns) {
out.RawByte('{')
first := true
_ = first
@@ -466,27 +579,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss4(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v TakeComputedStyleUpdatesReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss4(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss5(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v TakeComputedStyleUpdatesReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss4(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss5(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *TakeComputedStyleUpdatesReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss4(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss5(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *TakeComputedStyleUpdatesReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss4(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss5(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss5(in *jlexer.Lexer, out *TakeComputedStyleUpdatesParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss6(in *jlexer.Lexer, out *TakeComputedStyleUpdatesParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -515,7 +628,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss5(in *jlexer.Lexer, out *T
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss5(out *jwriter.Writer, in TakeComputedStyleUpdatesParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss6(out *jwriter.Writer, in TakeComputedStyleUpdatesParams) {
out.RawByte('{')
first := true
_ = first
@@ -525,27 +638,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss5(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v TakeComputedStyleUpdatesParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss5(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss6(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v TakeComputedStyleUpdatesParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss5(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss6(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *TakeComputedStyleUpdatesParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss5(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss6(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *TakeComputedStyleUpdatesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss5(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss6(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss6(in *jlexer.Lexer, out *Supports) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss7(in *jlexer.Lexer, out *Supports) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -590,7 +703,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss6(in *jlexer.Lexer, out *S
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss6(out *jwriter.Writer, in Supports) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss7(out *jwriter.Writer, in Supports) {
out.RawByte('{')
first := true
_ = first
@@ -620,27 +733,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss6(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v Supports) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss6(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss7(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v Supports) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss6(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss7(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *Supports) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss6(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss7(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *Supports) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss6(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss7(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss7(in *jlexer.Lexer, out *StyleSheetHeader) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss8(in *jlexer.Lexer, out *StyleSheetHeader) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -693,6 +806,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss7(in *jlexer.Lexer, out *S
out.EndLine = float64(in.Float64())
case "endColumn":
out.EndColumn = float64(in.Float64())
+ case "loadingFailed":
+ out.LoadingFailed = bool(in.Bool())
default:
in.SkipRecursive()
}
@@ -703,7 +818,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss7(in *jlexer.Lexer, out *S
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss7(out *jwriter.Writer, in StyleSheetHeader) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss8(out *jwriter.Writer, in StyleSheetHeader) {
out.RawByte('{')
first := true
_ = first
@@ -792,33 +907,38 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss7(out *jwriter.Writer, in
out.RawString(prefix)
out.Float64(float64(in.EndColumn))
}
+ if in.LoadingFailed {
+ const prefix string = ",\"loadingFailed\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.LoadingFailed))
+ }
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
func (v StyleSheetHeader) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss7(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss8(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v StyleSheetHeader) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss7(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss8(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *StyleSheetHeader) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss7(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss8(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *StyleSheetHeader) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss7(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss8(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss8(in *jlexer.Lexer, out *StyleDeclarationEdit) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss9(in *jlexer.Lexer, out *StyleDeclarationEdit) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -861,7 +981,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss8(in *jlexer.Lexer, out *S
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss8(out *jwriter.Writer, in StyleDeclarationEdit) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss9(out *jwriter.Writer, in StyleDeclarationEdit) {
out.RawByte('{')
first := true
_ = first
@@ -890,27 +1010,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss8(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v StyleDeclarationEdit) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss8(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss9(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v StyleDeclarationEdit) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss8(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss9(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *StyleDeclarationEdit) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss8(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss9(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *StyleDeclarationEdit) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss8(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss9(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss9(in *jlexer.Lexer, out *Style) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss10(in *jlexer.Lexer, out *Style) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1015,7 +1135,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss9(in *jlexer.Lexer, out *S
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss9(out *jwriter.Writer, in Style) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss10(out *jwriter.Writer, in Style) {
out.RawByte('{')
first := true
_ = first
@@ -1086,27 +1206,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss9(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v Style) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss9(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss10(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v Style) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss9(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss10(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *Style) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss9(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss10(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *Style) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss9(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss10(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss10(in *jlexer.Lexer, out *StopRuleUsageTrackingReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss11(in *jlexer.Lexer, out *StopRuleUsageTrackingReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1166,7 +1286,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss10(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss10(out *jwriter.Writer, in StopRuleUsageTrackingReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss11(out *jwriter.Writer, in StopRuleUsageTrackingReturns) {
out.RawByte('{')
first := true
_ = first
@@ -1195,27 +1315,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss10(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v StopRuleUsageTrackingReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss10(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss11(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v StopRuleUsageTrackingReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss10(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss11(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *StopRuleUsageTrackingReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss10(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss11(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *StopRuleUsageTrackingReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss10(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss11(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss11(in *jlexer.Lexer, out *StopRuleUsageTrackingParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss12(in *jlexer.Lexer, out *StopRuleUsageTrackingParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1244,7 +1364,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss11(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss11(out *jwriter.Writer, in StopRuleUsageTrackingParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss12(out *jwriter.Writer, in StopRuleUsageTrackingParams) {
out.RawByte('{')
first := true
_ = first
@@ -1254,27 +1374,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss11(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v StopRuleUsageTrackingParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss11(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss12(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v StopRuleUsageTrackingParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss11(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss12(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *StopRuleUsageTrackingParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss11(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss12(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *StopRuleUsageTrackingParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss11(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss12(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss12(in *jlexer.Lexer, out *StartRuleUsageTrackingParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss13(in *jlexer.Lexer, out *StartRuleUsageTrackingParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1303,7 +1423,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss12(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss12(out *jwriter.Writer, in StartRuleUsageTrackingParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss13(out *jwriter.Writer, in StartRuleUsageTrackingParams) {
out.RawByte('{')
first := true
_ = first
@@ -1313,27 +1433,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss12(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v StartRuleUsageTrackingParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss12(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss13(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v StartRuleUsageTrackingParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss12(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss13(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *StartRuleUsageTrackingParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss12(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss13(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *StartRuleUsageTrackingParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss12(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss13(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss13(in *jlexer.Lexer, out *SourceRange) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss14(in *jlexer.Lexer, out *Specificity) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1352,14 +1472,12 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss13(in *jlexer.Lexer, out *
continue
}
switch key {
- case "startLine":
- out.StartLine = int64(in.Int64())
- case "startColumn":
- out.StartColumn = int64(in.Int64())
- case "endLine":
- out.EndLine = int64(in.Int64())
- case "endColumn":
- out.EndColumn = int64(in.Int64())
+ case "a":
+ out.A = int64(in.Int64())
+ case "b":
+ out.B = int64(in.Int64())
+ case "c":
+ out.C = int64(in.Int64())
default:
in.SkipRecursive()
}
@@ -1370,57 +1488,52 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss13(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss13(out *jwriter.Writer, in SourceRange) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss14(out *jwriter.Writer, in Specificity) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"startLine\":"
+ const prefix string = ",\"a\":"
out.RawString(prefix[1:])
- out.Int64(int64(in.StartLine))
- }
- {
- const prefix string = ",\"startColumn\":"
- out.RawString(prefix)
- out.Int64(int64(in.StartColumn))
+ out.Int64(int64(in.A))
}
{
- const prefix string = ",\"endLine\":"
+ const prefix string = ",\"b\":"
out.RawString(prefix)
- out.Int64(int64(in.EndLine))
+ out.Int64(int64(in.B))
}
{
- const prefix string = ",\"endColumn\":"
+ const prefix string = ",\"c\":"
out.RawString(prefix)
- out.Int64(int64(in.EndColumn))
+ out.Int64(int64(in.C))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v SourceRange) MarshalJSON() ([]byte, error) {
+func (v Specificity) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss13(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss14(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v SourceRange) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss13(w, v)
+func (v Specificity) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss14(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *SourceRange) UnmarshalJSON(data []byte) error {
+func (v *Specificity) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss13(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss14(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *SourceRange) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss13(l, v)
+func (v *Specificity) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss14(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss14(in *jlexer.Lexer, out *ShorthandEntry) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss15(in *jlexer.Lexer, out *SourceRange) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1439,12 +1552,14 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss14(in *jlexer.Lexer, out *
continue
}
switch key {
- case "name":
- out.Name = string(in.String())
- case "value":
- out.Value = string(in.String())
- case "important":
- out.Important = bool(in.Bool())
+ case "startLine":
+ out.StartLine = int64(in.Int64())
+ case "startColumn":
+ out.StartColumn = int64(in.Int64())
+ case "endLine":
+ out.EndLine = int64(in.Int64())
+ case "endColumn":
+ out.EndColumn = int64(in.Int64())
default:
in.SkipRecursive()
}
@@ -1455,24 +1570,109 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss14(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss14(out *jwriter.Writer, in ShorthandEntry) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss15(out *jwriter.Writer, in SourceRange) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"name\":"
+ const prefix string = ",\"startLine\":"
out.RawString(prefix[1:])
- out.String(string(in.Name))
+ out.Int64(int64(in.StartLine))
}
{
- const prefix string = ",\"value\":"
+ const prefix string = ",\"startColumn\":"
out.RawString(prefix)
- out.String(string(in.Value))
+ out.Int64(int64(in.StartColumn))
}
- if in.Important {
- const prefix string = ",\"important\":"
+ {
+ const prefix string = ",\"endLine\":"
out.RawString(prefix)
- out.Bool(bool(in.Important))
+ out.Int64(int64(in.EndLine))
+ }
+ {
+ const prefix string = ",\"endColumn\":"
+ out.RawString(prefix)
+ out.Int64(int64(in.EndColumn))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v SourceRange) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss15(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v SourceRange) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss15(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *SourceRange) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss15(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *SourceRange) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss15(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss16(in *jlexer.Lexer, out *ShorthandEntry) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "name":
+ out.Name = string(in.String())
+ case "value":
+ out.Value = string(in.String())
+ case "important":
+ out.Important = bool(in.Bool())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss16(out *jwriter.Writer, in ShorthandEntry) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"name\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.Name))
+ }
+ {
+ const prefix string = ",\"value\":"
+ out.RawString(prefix)
+ out.String(string(in.Value))
+ }
+ if in.Important {
+ const prefix string = ",\"important\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.Important))
}
out.RawByte('}')
}
@@ -1480,27 +1680,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss14(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v ShorthandEntry) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss14(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss16(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ShorthandEntry) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss14(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss16(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ShorthandEntry) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss14(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss16(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ShorthandEntry) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss14(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss16(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss15(in *jlexer.Lexer, out *SetSupportsTextReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss17(in *jlexer.Lexer, out *SetSupportsTextReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1539,7 +1739,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss15(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss15(out *jwriter.Writer, in SetSupportsTextReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss17(out *jwriter.Writer, in SetSupportsTextReturns) {
out.RawByte('{')
first := true
_ = first
@@ -1555,27 +1755,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss15(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetSupportsTextReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss15(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss17(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetSupportsTextReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss15(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss17(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetSupportsTextReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss15(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss17(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetSupportsTextReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss15(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss17(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss16(in *jlexer.Lexer, out *SetSupportsTextParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss18(in *jlexer.Lexer, out *SetSupportsTextParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1618,7 +1818,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss16(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss16(out *jwriter.Writer, in SetSupportsTextParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss18(out *jwriter.Writer, in SetSupportsTextParams) {
out.RawByte('{')
first := true
_ = first
@@ -1647,27 +1847,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss16(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetSupportsTextParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss16(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss18(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetSupportsTextParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss16(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss18(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetSupportsTextParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss16(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss18(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetSupportsTextParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss16(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss18(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss17(in *jlexer.Lexer, out *SetStyleTextsReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss19(in *jlexer.Lexer, out *SetStyleTextsReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1727,7 +1927,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss17(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss17(out *jwriter.Writer, in SetStyleTextsReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss19(out *jwriter.Writer, in SetStyleTextsReturns) {
out.RawByte('{')
first := true
_ = first
@@ -1756,27 +1956,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss17(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetStyleTextsReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss17(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss19(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetStyleTextsReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss17(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss19(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetStyleTextsReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss17(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss19(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetStyleTextsReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss17(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss19(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss18(in *jlexer.Lexer, out *SetStyleTextsParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss20(in *jlexer.Lexer, out *SetStyleTextsParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1836,7 +2036,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss18(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss18(out *jwriter.Writer, in SetStyleTextsParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss20(out *jwriter.Writer, in SetStyleTextsParams) {
out.RawByte('{')
first := true
_ = first
@@ -1866,27 +2066,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss18(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetStyleTextsParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss18(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss20(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetStyleTextsParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss18(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss20(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetStyleTextsParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss18(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss20(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetStyleTextsParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss18(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss20(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss19(in *jlexer.Lexer, out *SetStyleSheetTextReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss21(in *jlexer.Lexer, out *SetStyleSheetTextReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1917,7 +2117,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss19(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss19(out *jwriter.Writer, in SetStyleSheetTextReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss21(out *jwriter.Writer, in SetStyleSheetTextReturns) {
out.RawByte('{')
first := true
_ = first
@@ -1933,27 +2133,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss19(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetStyleSheetTextReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss19(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss21(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetStyleSheetTextReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss19(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss21(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetStyleSheetTextReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss19(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss21(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetStyleSheetTextReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss19(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss21(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss20(in *jlexer.Lexer, out *SetStyleSheetTextParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss22(in *jlexer.Lexer, out *SetStyleSheetTextParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1986,7 +2186,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss20(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss20(out *jwriter.Writer, in SetStyleSheetTextParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss22(out *jwriter.Writer, in SetStyleSheetTextParams) {
out.RawByte('{')
first := true
_ = first
@@ -2006,27 +2206,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss20(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetStyleSheetTextParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss20(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss22(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetStyleSheetTextParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss20(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss22(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetStyleSheetTextParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss20(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss22(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetStyleSheetTextParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss20(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss22(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss21(in *jlexer.Lexer, out *SetScopeTextReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss23(in *jlexer.Lexer, out *SetScopeTextReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2065,7 +2265,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss21(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss21(out *jwriter.Writer, in SetScopeTextReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss23(out *jwriter.Writer, in SetScopeTextReturns) {
out.RawByte('{')
first := true
_ = first
@@ -2081,27 +2281,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss21(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetScopeTextReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss21(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss23(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetScopeTextReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss21(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss23(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetScopeTextReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss21(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss23(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetScopeTextReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss21(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss23(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss22(in *jlexer.Lexer, out *SetScopeTextParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss24(in *jlexer.Lexer, out *SetScopeTextParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2144,7 +2344,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss22(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss22(out *jwriter.Writer, in SetScopeTextParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss24(out *jwriter.Writer, in SetScopeTextParams) {
out.RawByte('{')
first := true
_ = first
@@ -2173,27 +2373,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss22(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetScopeTextParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss22(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss24(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetScopeTextParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss22(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss24(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetScopeTextParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss22(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss24(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetScopeTextParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss22(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss24(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss23(in *jlexer.Lexer, out *SetRuleSelectorReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss25(in *jlexer.Lexer, out *SetRuleSelectorReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2232,7 +2432,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss23(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss23(out *jwriter.Writer, in SetRuleSelectorReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss25(out *jwriter.Writer, in SetRuleSelectorReturns) {
out.RawByte('{')
first := true
_ = first
@@ -2248,27 +2448,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss23(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetRuleSelectorReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss23(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss25(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetRuleSelectorReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss23(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss25(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetRuleSelectorReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss23(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss25(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetRuleSelectorReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss23(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss25(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss24(in *jlexer.Lexer, out *SetRuleSelectorParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss26(in *jlexer.Lexer, out *SetRuleSelectorParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2311,7 +2511,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss24(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss24(out *jwriter.Writer, in SetRuleSelectorParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss26(out *jwriter.Writer, in SetRuleSelectorParams) {
out.RawByte('{')
first := true
_ = first
@@ -2340,27 +2540,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss24(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetRuleSelectorParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss24(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss26(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetRuleSelectorParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss24(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss26(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetRuleSelectorParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss24(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss26(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetRuleSelectorParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss24(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss26(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss25(in *jlexer.Lexer, out *SetMediaTextReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss27(in *jlexer.Lexer, out *SetMediaTextReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2399,7 +2599,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss25(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss25(out *jwriter.Writer, in SetMediaTextReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss27(out *jwriter.Writer, in SetMediaTextReturns) {
out.RawByte('{')
first := true
_ = first
@@ -2415,27 +2615,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss25(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetMediaTextReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss25(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss27(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetMediaTextReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss25(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss27(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetMediaTextReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss25(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss27(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetMediaTextReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss25(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss27(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss26(in *jlexer.Lexer, out *SetMediaTextParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss28(in *jlexer.Lexer, out *SetMediaTextParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2478,7 +2678,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss26(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss26(out *jwriter.Writer, in SetMediaTextParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss28(out *jwriter.Writer, in SetMediaTextParams) {
out.RawByte('{')
first := true
_ = first
@@ -2507,27 +2707,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss26(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetMediaTextParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss26(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss28(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetMediaTextParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss26(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss28(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetMediaTextParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss26(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss28(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetMediaTextParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss26(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss28(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss27(in *jlexer.Lexer, out *SetLocalFontsEnabledParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss29(in *jlexer.Lexer, out *SetLocalFontsEnabledParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2558,7 +2758,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss27(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss27(out *jwriter.Writer, in SetLocalFontsEnabledParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss29(out *jwriter.Writer, in SetLocalFontsEnabledParams) {
out.RawByte('{')
first := true
_ = first
@@ -2573,27 +2773,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss27(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetLocalFontsEnabledParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss27(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss29(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetLocalFontsEnabledParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss27(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss29(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetLocalFontsEnabledParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss27(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss29(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetLocalFontsEnabledParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss27(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss29(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss28(in *jlexer.Lexer, out *SetKeyframeKeyReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss30(in *jlexer.Lexer, out *SetKeyframeKeyReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2632,7 +2832,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss28(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss28(out *jwriter.Writer, in SetKeyframeKeyReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss30(out *jwriter.Writer, in SetKeyframeKeyReturns) {
out.RawByte('{')
first := true
_ = first
@@ -2648,27 +2848,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss28(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetKeyframeKeyReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss28(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss30(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetKeyframeKeyReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss28(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss30(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetKeyframeKeyReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss28(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss30(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetKeyframeKeyReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss28(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss30(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss29(in *jlexer.Lexer, out *SetKeyframeKeyParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss31(in *jlexer.Lexer, out *SetKeyframeKeyParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2711,7 +2911,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss29(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss29(out *jwriter.Writer, in SetKeyframeKeyParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss31(out *jwriter.Writer, in SetKeyframeKeyParams) {
out.RawByte('{')
first := true
_ = first
@@ -2740,27 +2940,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss29(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetKeyframeKeyParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss29(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss31(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetKeyframeKeyParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss29(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss31(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetKeyframeKeyParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss29(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss31(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetKeyframeKeyParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss29(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss31(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss30(in *jlexer.Lexer, out *SetEffectivePropertyValueForNodeParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss32(in *jlexer.Lexer, out *SetEffectivePropertyValueForNodeParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2795,7 +2995,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss30(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss30(out *jwriter.Writer, in SetEffectivePropertyValueForNodeParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss32(out *jwriter.Writer, in SetEffectivePropertyValueForNodeParams) {
out.RawByte('{')
first := true
_ = first
@@ -2820,27 +3020,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss30(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetEffectivePropertyValueForNodeParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss30(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss32(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetEffectivePropertyValueForNodeParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss30(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss32(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetEffectivePropertyValueForNodeParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss30(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss32(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetEffectivePropertyValueForNodeParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss30(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss32(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss31(in *jlexer.Lexer, out *SetContainerQueryTextReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss33(in *jlexer.Lexer, out *SetContainerQueryTextReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2879,7 +3079,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss31(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss31(out *jwriter.Writer, in SetContainerQueryTextReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss33(out *jwriter.Writer, in SetContainerQueryTextReturns) {
out.RawByte('{')
first := true
_ = first
@@ -2895,27 +3095,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss31(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetContainerQueryTextReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss31(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss33(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetContainerQueryTextReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss31(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss33(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetContainerQueryTextReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss31(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss33(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetContainerQueryTextReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss31(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss33(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss32(in *jlexer.Lexer, out *SetContainerQueryTextParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss34(in *jlexer.Lexer, out *SetContainerQueryTextParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2958,7 +3158,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss32(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss32(out *jwriter.Writer, in SetContainerQueryTextParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss34(out *jwriter.Writer, in SetContainerQueryTextParams) {
out.RawByte('{')
first := true
_ = first
@@ -2987,27 +3187,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss32(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetContainerQueryTextParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss32(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss34(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetContainerQueryTextParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss32(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss34(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetContainerQueryTextParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss32(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss34(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetContainerQueryTextParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss32(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss34(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss33(in *jlexer.Lexer, out *SelectorList) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss35(in *jlexer.Lexer, out *SelectorList) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3069,7 +3269,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss33(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss33(out *jwriter.Writer, in SelectorList) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss35(out *jwriter.Writer, in SelectorList) {
out.RawByte('{')
first := true
_ = first
@@ -3104,27 +3304,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss33(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SelectorList) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss33(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss35(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SelectorList) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss33(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss35(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SelectorList) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss33(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss35(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SelectorList) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss33(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss35(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss34(in *jlexer.Lexer, out *Scope) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss36(in *jlexer.Lexer, out *Scope) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3167,7 +3367,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss34(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss34(out *jwriter.Writer, in Scope) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss36(out *jwriter.Writer, in Scope) {
out.RawByte('{')
first := true
_ = first
@@ -3192,27 +3392,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss34(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v Scope) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss34(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss36(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v Scope) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss34(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss36(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *Scope) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss34(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss36(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *Scope) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss34(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss36(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss35(in *jlexer.Lexer, out *RuleUsage) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(in *jlexer.Lexer, out *RuleUsage) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3249,7 +3449,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss35(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss35(out *jwriter.Writer, in RuleUsage) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss37(out *jwriter.Writer, in RuleUsage) {
out.RawByte('{')
first := true
_ = first
@@ -3279,27 +3479,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss35(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v RuleUsage) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss35(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss37(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v RuleUsage) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss35(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss37(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *RuleUsage) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss35(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *RuleUsage) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss35(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss36(in *jlexer.Lexer, out *RuleMatch) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss38(in *jlexer.Lexer, out *RuleMatch) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3361,7 +3561,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss36(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss36(out *jwriter.Writer, in RuleMatch) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss38(out *jwriter.Writer, in RuleMatch) {
out.RawByte('{')
first := true
_ = first
@@ -3396,27 +3596,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss36(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v RuleMatch) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss36(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss38(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v RuleMatch) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss36(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss38(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *RuleMatch) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss36(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss38(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *RuleMatch) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss36(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss38(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(in *jlexer.Lexer, out *Rule) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss39(in *jlexer.Lexer, out *Rule) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3447,6 +3647,29 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(in *jlexer.Lexer, out *
}
(*out.SelectorList).UnmarshalEasyJSON(in)
}
+ case "nestingSelectors":
+ if in.IsNull() {
+ in.Skip()
+ out.NestingSelectors = nil
+ } else {
+ in.Delim('[')
+ if out.NestingSelectors == nil {
+ if !in.IsDelim(']') {
+ out.NestingSelectors = make([]string, 0, 4)
+ } else {
+ out.NestingSelectors = []string{}
+ }
+ } else {
+ out.NestingSelectors = (out.NestingSelectors)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v31 string
+ v31 = string(in.String())
+ out.NestingSelectors = append(out.NestingSelectors, v31)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
case "origin":
(out.Origin).UnmarshalEasyJSON(in)
case "style":
@@ -3475,17 +3698,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(in *jlexer.Lexer, out *
out.Media = (out.Media)[:0]
}
for !in.IsDelim(']') {
- var v31 *Media
+ var v32 *Media
if in.IsNull() {
in.Skip()
- v31 = nil
+ v32 = nil
} else {
- if v31 == nil {
- v31 = new(Media)
+ if v32 == nil {
+ v32 = new(Media)
}
- (*v31).UnmarshalEasyJSON(in)
+ (*v32).UnmarshalEasyJSON(in)
}
- out.Media = append(out.Media, v31)
+ out.Media = append(out.Media, v32)
in.WantComma()
}
in.Delim(']')
@@ -3506,17 +3729,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(in *jlexer.Lexer, out *
out.ContainerQueries = (out.ContainerQueries)[:0]
}
for !in.IsDelim(']') {
- var v32 *ContainerQuery
+ var v33 *ContainerQuery
if in.IsNull() {
in.Skip()
- v32 = nil
+ v33 = nil
} else {
- if v32 == nil {
- v32 = new(ContainerQuery)
+ if v33 == nil {
+ v33 = new(ContainerQuery)
}
- (*v32).UnmarshalEasyJSON(in)
+ (*v33).UnmarshalEasyJSON(in)
}
- out.ContainerQueries = append(out.ContainerQueries, v32)
+ out.ContainerQueries = append(out.ContainerQueries, v33)
in.WantComma()
}
in.Delim(']')
@@ -3537,17 +3760,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(in *jlexer.Lexer, out *
out.Supports = (out.Supports)[:0]
}
for !in.IsDelim(']') {
- var v33 *Supports
+ var v34 *Supports
if in.IsNull() {
in.Skip()
- v33 = nil
+ v34 = nil
} else {
- if v33 == nil {
- v33 = new(Supports)
+ if v34 == nil {
+ v34 = new(Supports)
}
- (*v33).UnmarshalEasyJSON(in)
+ (*v34).UnmarshalEasyJSON(in)
}
- out.Supports = append(out.Supports, v33)
+ out.Supports = append(out.Supports, v34)
in.WantComma()
}
in.Delim(']')
@@ -3568,17 +3791,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(in *jlexer.Lexer, out *
out.Layers = (out.Layers)[:0]
}
for !in.IsDelim(']') {
- var v34 *Layer
+ var v35 *Layer
if in.IsNull() {
in.Skip()
- v34 = nil
+ v35 = nil
} else {
- if v34 == nil {
- v34 = new(Layer)
+ if v35 == nil {
+ v35 = new(Layer)
}
- (*v34).UnmarshalEasyJSON(in)
+ (*v35).UnmarshalEasyJSON(in)
}
- out.Layers = append(out.Layers, v34)
+ out.Layers = append(out.Layers, v35)
in.WantComma()
}
in.Delim(']')
@@ -3599,17 +3822,40 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(in *jlexer.Lexer, out *
out.Scopes = (out.Scopes)[:0]
}
for !in.IsDelim(']') {
- var v35 *Scope
+ var v36 *Scope
if in.IsNull() {
in.Skip()
- v35 = nil
+ v36 = nil
} else {
- if v35 == nil {
- v35 = new(Scope)
+ if v36 == nil {
+ v36 = new(Scope)
}
- (*v35).UnmarshalEasyJSON(in)
+ (*v36).UnmarshalEasyJSON(in)
}
- out.Scopes = append(out.Scopes, v35)
+ out.Scopes = append(out.Scopes, v36)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ case "ruleTypes":
+ if in.IsNull() {
+ in.Skip()
+ out.RuleTypes = nil
+ } else {
+ in.Delim('[')
+ if out.RuleTypes == nil {
+ if !in.IsDelim(']') {
+ out.RuleTypes = make([]RuleType, 0, 4)
+ } else {
+ out.RuleTypes = []RuleType{}
+ }
+ } else {
+ out.RuleTypes = (out.RuleTypes)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v37 RuleType
+ (v37).UnmarshalEasyJSON(in)
+ out.RuleTypes = append(out.RuleTypes, v37)
in.WantComma()
}
in.Delim(']')
@@ -3624,7 +3870,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss37(out *jwriter.Writer, in Rule) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss39(out *jwriter.Writer, in Rule) {
out.RawByte('{')
first := true
_ = first
@@ -3648,6 +3894,20 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss37(out *jwriter.Writer, in
(*in.SelectorList).MarshalEasyJSON(out)
}
}
+ if len(in.NestingSelectors) != 0 {
+ const prefix string = ",\"nestingSelectors\":"
+ out.RawString(prefix)
+ {
+ out.RawByte('[')
+ for v38, v39 := range in.NestingSelectors {
+ if v38 > 0 {
+ out.RawByte(',')
+ }
+ out.String(string(v39))
+ }
+ out.RawByte(']')
+ }
+ }
{
const prefix string = ",\"origin\":"
out.RawString(prefix)
@@ -3667,14 +3927,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss37(out *jwriter.Writer, in
out.RawString(prefix)
{
out.RawByte('[')
- for v36, v37 := range in.Media {
- if v36 > 0 {
+ for v40, v41 := range in.Media {
+ if v40 > 0 {
out.RawByte(',')
}
- if v37 == nil {
+ if v41 == nil {
out.RawString("null")
} else {
- (*v37).MarshalEasyJSON(out)
+ (*v41).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -3685,14 +3945,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss37(out *jwriter.Writer, in
out.RawString(prefix)
{
out.RawByte('[')
- for v38, v39 := range in.ContainerQueries {
- if v38 > 0 {
+ for v42, v43 := range in.ContainerQueries {
+ if v42 > 0 {
out.RawByte(',')
}
- if v39 == nil {
+ if v43 == nil {
out.RawString("null")
} else {
- (*v39).MarshalEasyJSON(out)
+ (*v43).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -3703,14 +3963,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss37(out *jwriter.Writer, in
out.RawString(prefix)
{
out.RawByte('[')
- for v40, v41 := range in.Supports {
- if v40 > 0 {
+ for v44, v45 := range in.Supports {
+ if v44 > 0 {
out.RawByte(',')
}
- if v41 == nil {
+ if v45 == nil {
out.RawString("null")
} else {
- (*v41).MarshalEasyJSON(out)
+ (*v45).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -3721,14 +3981,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss37(out *jwriter.Writer, in
out.RawString(prefix)
{
out.RawByte('[')
- for v42, v43 := range in.Layers {
- if v42 > 0 {
+ for v46, v47 := range in.Layers {
+ if v46 > 0 {
out.RawByte(',')
}
- if v43 == nil {
+ if v47 == nil {
out.RawString("null")
} else {
- (*v43).MarshalEasyJSON(out)
+ (*v47).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -3739,46 +3999,60 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss37(out *jwriter.Writer, in
out.RawString(prefix)
{
out.RawByte('[')
- for v44, v45 := range in.Scopes {
- if v44 > 0 {
+ for v48, v49 := range in.Scopes {
+ if v48 > 0 {
out.RawByte(',')
}
- if v45 == nil {
+ if v49 == nil {
out.RawString("null")
} else {
- (*v45).MarshalEasyJSON(out)
+ (*v49).MarshalEasyJSON(out)
}
}
out.RawByte(']')
}
}
+ if len(in.RuleTypes) != 0 {
+ const prefix string = ",\"ruleTypes\":"
+ out.RawString(prefix)
+ {
+ out.RawByte('[')
+ for v50, v51 := range in.RuleTypes {
+ if v50 > 0 {
+ out.RawByte(',')
+ }
+ (v51).MarshalEasyJSON(out)
+ }
+ out.RawByte(']')
+ }
+ }
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
func (v Rule) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss37(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss39(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v Rule) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss37(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss39(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *Rule) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss39(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *Rule) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss37(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss39(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss38(in *jlexer.Lexer, out *PseudoElementMatches) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss40(in *jlexer.Lexer, out *PseudoElementMatches) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3817,17 +4091,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss38(in *jlexer.Lexer, out *
out.Matches = (out.Matches)[:0]
}
for !in.IsDelim(']') {
- var v46 *RuleMatch
+ var v52 *RuleMatch
if in.IsNull() {
in.Skip()
- v46 = nil
+ v52 = nil
} else {
- if v46 == nil {
- v46 = new(RuleMatch)
+ if v52 == nil {
+ v52 = new(RuleMatch)
}
- (*v46).UnmarshalEasyJSON(in)
+ (*v52).UnmarshalEasyJSON(in)
}
- out.Matches = append(out.Matches, v46)
+ out.Matches = append(out.Matches, v52)
in.WantComma()
}
in.Delim(']')
@@ -3842,7 +4116,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss38(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss38(out *jwriter.Writer, in PseudoElementMatches) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss40(out *jwriter.Writer, in PseudoElementMatches) {
out.RawByte('{')
first := true
_ = first
@@ -3863,14 +4137,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss38(out *jwriter.Writer, in
out.RawString("null")
} else {
out.RawByte('[')
- for v47, v48 := range in.Matches {
- if v47 > 0 {
+ for v53, v54 := range in.Matches {
+ if v53 > 0 {
out.RawByte(',')
}
- if v48 == nil {
+ if v54 == nil {
out.RawString("null")
} else {
- (*v48).MarshalEasyJSON(out)
+ (*v54).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -3882,27 +4156,239 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss38(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v PseudoElementMatches) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss38(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss40(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v PseudoElementMatches) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss38(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss40(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *PseudoElementMatches) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss38(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss40(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *PseudoElementMatches) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss38(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss40(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss41(in *jlexer.Lexer, out *PropertyRule) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "styleSheetId":
+ out.StyleSheetID = StyleSheetID(in.String())
+ case "origin":
+ (out.Origin).UnmarshalEasyJSON(in)
+ case "propertyName":
+ if in.IsNull() {
+ in.Skip()
+ out.PropertyName = nil
+ } else {
+ if out.PropertyName == nil {
+ out.PropertyName = new(Value)
+ }
+ (*out.PropertyName).UnmarshalEasyJSON(in)
+ }
+ case "style":
+ if in.IsNull() {
+ in.Skip()
+ out.Style = nil
+ } else {
+ if out.Style == nil {
+ out.Style = new(Style)
+ }
+ (*out.Style).UnmarshalEasyJSON(in)
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss41(out *jwriter.Writer, in PropertyRule) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ if in.StyleSheetID != "" {
+ const prefix string = ",\"styleSheetId\":"
+ first = false
+ out.RawString(prefix[1:])
+ out.String(string(in.StyleSheetID))
+ }
+ {
+ const prefix string = ",\"origin\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (in.Origin).MarshalEasyJSON(out)
+ }
+ {
+ const prefix string = ",\"propertyName\":"
+ out.RawString(prefix)
+ if in.PropertyName == nil {
+ out.RawString("null")
+ } else {
+ (*in.PropertyName).MarshalEasyJSON(out)
+ }
+ }
+ {
+ const prefix string = ",\"style\":"
+ out.RawString(prefix)
+ if in.Style == nil {
+ out.RawString("null")
+ } else {
+ (*in.Style).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v PropertyRule) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss41(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v PropertyRule) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss41(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *PropertyRule) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss41(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *PropertyRule) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss41(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss42(in *jlexer.Lexer, out *PropertyRegistration) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "propertyName":
+ out.PropertyName = string(in.String())
+ case "initialValue":
+ if in.IsNull() {
+ in.Skip()
+ out.InitialValue = nil
+ } else {
+ if out.InitialValue == nil {
+ out.InitialValue = new(Value)
+ }
+ (*out.InitialValue).UnmarshalEasyJSON(in)
+ }
+ case "inherits":
+ out.Inherits = bool(in.Bool())
+ case "syntax":
+ out.Syntax = string(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss39(in *jlexer.Lexer, out *Property) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss42(out *jwriter.Writer, in PropertyRegistration) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"propertyName\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.PropertyName))
+ }
+ if in.InitialValue != nil {
+ const prefix string = ",\"initialValue\":"
+ out.RawString(prefix)
+ (*in.InitialValue).MarshalEasyJSON(out)
+ }
+ {
+ const prefix string = ",\"inherits\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.Inherits))
+ }
+ {
+ const prefix string = ",\"syntax\":"
+ out.RawString(prefix)
+ out.String(string(in.Syntax))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v PropertyRegistration) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss42(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v PropertyRegistration) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss42(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *PropertyRegistration) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss42(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *PropertyRegistration) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss42(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss43(in *jlexer.Lexer, out *Property) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3961,17 +4447,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss39(in *jlexer.Lexer, out *
out.LonghandProperties = (out.LonghandProperties)[:0]
}
for !in.IsDelim(']') {
- var v49 *Property
+ var v55 *Property
if in.IsNull() {
in.Skip()
- v49 = nil
+ v55 = nil
} else {
- if v49 == nil {
- v49 = new(Property)
+ if v55 == nil {
+ v55 = new(Property)
}
- (*v49).UnmarshalEasyJSON(in)
+ (*v55).UnmarshalEasyJSON(in)
}
- out.LonghandProperties = append(out.LonghandProperties, v49)
+ out.LonghandProperties = append(out.LonghandProperties, v55)
in.WantComma()
}
in.Delim(']')
@@ -3986,7 +4472,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss39(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss39(out *jwriter.Writer, in Property) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss43(out *jwriter.Writer, in Property) {
out.RawByte('{')
first := true
_ = first
@@ -4035,14 +4521,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss39(out *jwriter.Writer, in
out.RawString(prefix)
{
out.RawByte('[')
- for v50, v51 := range in.LonghandProperties {
- if v50 > 0 {
+ for v56, v57 := range in.LonghandProperties {
+ if v56 > 0 {
out.RawByte(',')
}
- if v51 == nil {
+ if v57 == nil {
out.RawString("null")
} else {
- (*v51).MarshalEasyJSON(out)
+ (*v57).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -4054,27 +4540,156 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss39(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v Property) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss39(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss43(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v Property) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss39(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss43(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *Property) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss39(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss43(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *Property) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss39(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss43(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss40(in *jlexer.Lexer, out *PlatformFontUsage) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss44(in *jlexer.Lexer, out *PositionFallbackRule) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "name":
+ if in.IsNull() {
+ in.Skip()
+ out.Name = nil
+ } else {
+ if out.Name == nil {
+ out.Name = new(Value)
+ }
+ (*out.Name).UnmarshalEasyJSON(in)
+ }
+ case "tryRules":
+ if in.IsNull() {
+ in.Skip()
+ out.TryRules = nil
+ } else {
+ in.Delim('[')
+ if out.TryRules == nil {
+ if !in.IsDelim(']') {
+ out.TryRules = make([]*TryRule, 0, 8)
+ } else {
+ out.TryRules = []*TryRule{}
+ }
+ } else {
+ out.TryRules = (out.TryRules)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v58 *TryRule
+ if in.IsNull() {
+ in.Skip()
+ v58 = nil
+ } else {
+ if v58 == nil {
+ v58 = new(TryRule)
+ }
+ (*v58).UnmarshalEasyJSON(in)
+ }
+ out.TryRules = append(out.TryRules, v58)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss44(out *jwriter.Writer, in PositionFallbackRule) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"name\":"
+ out.RawString(prefix[1:])
+ if in.Name == nil {
+ out.RawString("null")
+ } else {
+ (*in.Name).MarshalEasyJSON(out)
+ }
+ }
+ {
+ const prefix string = ",\"tryRules\":"
+ out.RawString(prefix)
+ if in.TryRules == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v59, v60 := range in.TryRules {
+ if v59 > 0 {
+ out.RawByte(',')
+ }
+ if v60 == nil {
+ out.RawString("null")
+ } else {
+ (*v60).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v PositionFallbackRule) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss44(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v PositionFallbackRule) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss44(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *PositionFallbackRule) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss44(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *PositionFallbackRule) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss44(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss45(in *jlexer.Lexer, out *PlatformFontUsage) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4109,7 +4724,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss40(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss40(out *jwriter.Writer, in PlatformFontUsage) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss45(out *jwriter.Writer, in PlatformFontUsage) {
out.RawByte('{')
first := true
_ = first
@@ -4134,27 +4749,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss40(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v PlatformFontUsage) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss40(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss45(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v PlatformFontUsage) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss40(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss45(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *PlatformFontUsage) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss40(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss45(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *PlatformFontUsage) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss40(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss45(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss41(in *jlexer.Lexer, out *MediaQueryExpression) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss46(in *jlexer.Lexer, out *MediaQueryExpression) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4201,7 +4816,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss41(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss41(out *jwriter.Writer, in MediaQueryExpression) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss46(out *jwriter.Writer, in MediaQueryExpression) {
out.RawByte('{')
first := true
_ = first
@@ -4236,27 +4851,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss41(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v MediaQueryExpression) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss41(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss46(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v MediaQueryExpression) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss41(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss46(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *MediaQueryExpression) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss41(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss46(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *MediaQueryExpression) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss41(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss46(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss42(in *jlexer.Lexer, out *MediaQuery) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss47(in *jlexer.Lexer, out *MediaQuery) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4291,17 +4906,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss42(in *jlexer.Lexer, out *
out.Expressions = (out.Expressions)[:0]
}
for !in.IsDelim(']') {
- var v52 *MediaQueryExpression
+ var v61 *MediaQueryExpression
if in.IsNull() {
in.Skip()
- v52 = nil
+ v61 = nil
} else {
- if v52 == nil {
- v52 = new(MediaQueryExpression)
+ if v61 == nil {
+ v61 = new(MediaQueryExpression)
}
- (*v52).UnmarshalEasyJSON(in)
+ (*v61).UnmarshalEasyJSON(in)
}
- out.Expressions = append(out.Expressions, v52)
+ out.Expressions = append(out.Expressions, v61)
in.WantComma()
}
in.Delim(']')
@@ -4318,7 +4933,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss42(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss42(out *jwriter.Writer, in MediaQuery) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss47(out *jwriter.Writer, in MediaQuery) {
out.RawByte('{')
first := true
_ = first
@@ -4329,14 +4944,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss42(out *jwriter.Writer, in
out.RawString("null")
} else {
out.RawByte('[')
- for v53, v54 := range in.Expressions {
- if v53 > 0 {
+ for v62, v63 := range in.Expressions {
+ if v62 > 0 {
out.RawByte(',')
}
- if v54 == nil {
+ if v63 == nil {
out.RawString("null")
} else {
- (*v54).MarshalEasyJSON(out)
+ (*v63).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -4353,27 +4968,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss42(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v MediaQuery) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss42(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss47(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v MediaQuery) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss42(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss47(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *MediaQuery) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss42(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss47(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *MediaQuery) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss42(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss47(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss43(in *jlexer.Lexer, out *Media) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss48(in *jlexer.Lexer, out *Media) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4426,17 +5041,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss43(in *jlexer.Lexer, out *
out.MediaList = (out.MediaList)[:0]
}
for !in.IsDelim(']') {
- var v55 *MediaQuery
+ var v64 *MediaQuery
if in.IsNull() {
in.Skip()
- v55 = nil
+ v64 = nil
} else {
- if v55 == nil {
- v55 = new(MediaQuery)
+ if v64 == nil {
+ v64 = new(MediaQuery)
}
- (*v55).UnmarshalEasyJSON(in)
+ (*v64).UnmarshalEasyJSON(in)
}
- out.MediaList = append(out.MediaList, v55)
+ out.MediaList = append(out.MediaList, v64)
in.WantComma()
}
in.Delim(']')
@@ -4451,7 +5066,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss43(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss43(out *jwriter.Writer, in Media) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss48(out *jwriter.Writer, in Media) {
out.RawByte('{')
first := true
_ = first
@@ -4485,14 +5100,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss43(out *jwriter.Writer, in
out.RawString(prefix)
{
out.RawByte('[')
- for v56, v57 := range in.MediaList {
- if v56 > 0 {
+ for v65, v66 := range in.MediaList {
+ if v65 > 0 {
out.RawByte(',')
}
- if v57 == nil {
+ if v66 == nil {
out.RawString("null")
} else {
- (*v57).MarshalEasyJSON(out)
+ (*v66).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -4504,27 +5119,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss43(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v Media) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss43(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss48(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v Media) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss43(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss48(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *Media) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss43(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss48(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *Media) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss43(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss48(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss44(in *jlexer.Lexer, out *LayerData) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss49(in *jlexer.Lexer, out *LayerData) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4561,17 +5176,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss44(in *jlexer.Lexer, out *
out.SubLayers = (out.SubLayers)[:0]
}
for !in.IsDelim(']') {
- var v58 *LayerData
+ var v67 *LayerData
if in.IsNull() {
in.Skip()
- v58 = nil
+ v67 = nil
} else {
- if v58 == nil {
- v58 = new(LayerData)
+ if v67 == nil {
+ v67 = new(LayerData)
}
- (*v58).UnmarshalEasyJSON(in)
+ (*v67).UnmarshalEasyJSON(in)
}
- out.SubLayers = append(out.SubLayers, v58)
+ out.SubLayers = append(out.SubLayers, v67)
in.WantComma()
}
in.Delim(']')
@@ -4588,7 +5203,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss44(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss44(out *jwriter.Writer, in LayerData) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss49(out *jwriter.Writer, in LayerData) {
out.RawByte('{')
first := true
_ = first
@@ -4602,14 +5217,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss44(out *jwriter.Writer, in
out.RawString(prefix)
{
out.RawByte('[')
- for v59, v60 := range in.SubLayers {
- if v59 > 0 {
+ for v68, v69 := range in.SubLayers {
+ if v68 > 0 {
out.RawByte(',')
}
- if v60 == nil {
+ if v69 == nil {
out.RawString("null")
} else {
- (*v60).MarshalEasyJSON(out)
+ (*v69).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -4626,27 +5241,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss44(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v LayerData) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss44(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss49(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v LayerData) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss44(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss49(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *LayerData) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss44(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss49(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *LayerData) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss44(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss49(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss45(in *jlexer.Lexer, out *Layer) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss50(in *jlexer.Lexer, out *Layer) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4689,7 +5304,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss45(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss45(out *jwriter.Writer, in Layer) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss50(out *jwriter.Writer, in Layer) {
out.RawByte('{')
first := true
_ = first
@@ -4714,27 +5329,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss45(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v Layer) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss45(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss50(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v Layer) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss45(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss50(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *Layer) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss45(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss50(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *Layer) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss45(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss50(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss46(in *jlexer.Lexer, out *KeyframesRule) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss51(in *jlexer.Lexer, out *KeyframesRule) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4779,17 +5394,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss46(in *jlexer.Lexer, out *
out.Keyframes = (out.Keyframes)[:0]
}
for !in.IsDelim(']') {
- var v61 *KeyframeRule
+ var v70 *KeyframeRule
if in.IsNull() {
in.Skip()
- v61 = nil
+ v70 = nil
} else {
- if v61 == nil {
- v61 = new(KeyframeRule)
+ if v70 == nil {
+ v70 = new(KeyframeRule)
}
- (*v61).UnmarshalEasyJSON(in)
+ (*v70).UnmarshalEasyJSON(in)
}
- out.Keyframes = append(out.Keyframes, v61)
+ out.Keyframes = append(out.Keyframes, v70)
in.WantComma()
}
in.Delim(']')
@@ -4804,7 +5419,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss46(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss46(out *jwriter.Writer, in KeyframesRule) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss51(out *jwriter.Writer, in KeyframesRule) {
out.RawByte('{')
first := true
_ = first
@@ -4824,14 +5439,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss46(out *jwriter.Writer, in
out.RawString("null")
} else {
out.RawByte('[')
- for v62, v63 := range in.Keyframes {
- if v62 > 0 {
+ for v71, v72 := range in.Keyframes {
+ if v71 > 0 {
out.RawByte(',')
}
- if v63 == nil {
+ if v72 == nil {
out.RawString("null")
} else {
- (*v63).MarshalEasyJSON(out)
+ (*v72).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -4843,27 +5458,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss46(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v KeyframesRule) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss46(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss51(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v KeyframesRule) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss46(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss51(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *KeyframesRule) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss46(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss51(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *KeyframesRule) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss46(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss51(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss47(in *jlexer.Lexer, out *KeyframeRule) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss52(in *jlexer.Lexer, out *KeyframeRule) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4916,7 +5531,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss47(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss47(out *jwriter.Writer, in KeyframeRule) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss52(out *jwriter.Writer, in KeyframeRule) {
out.RawByte('{')
first := true
_ = first
@@ -4960,27 +5575,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss47(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v KeyframeRule) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss47(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss52(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v KeyframeRule) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss47(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss52(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *KeyframeRule) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss47(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss52(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *KeyframeRule) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss47(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss52(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss48(in *jlexer.Lexer, out *InheritedStyleEntry) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss53(in *jlexer.Lexer, out *InheritedStyleEntry) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -5025,17 +5640,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss48(in *jlexer.Lexer, out *
out.MatchedCSSRules = (out.MatchedCSSRules)[:0]
}
for !in.IsDelim(']') {
- var v64 *RuleMatch
+ var v73 *RuleMatch
if in.IsNull() {
in.Skip()
- v64 = nil
+ v73 = nil
} else {
- if v64 == nil {
- v64 = new(RuleMatch)
+ if v73 == nil {
+ v73 = new(RuleMatch)
}
- (*v64).UnmarshalEasyJSON(in)
+ (*v73).UnmarshalEasyJSON(in)
}
- out.MatchedCSSRules = append(out.MatchedCSSRules, v64)
+ out.MatchedCSSRules = append(out.MatchedCSSRules, v73)
in.WantComma()
}
in.Delim(']')
@@ -5050,7 +5665,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss48(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss48(out *jwriter.Writer, in InheritedStyleEntry) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss53(out *jwriter.Writer, in InheritedStyleEntry) {
out.RawByte('{')
first := true
_ = first
@@ -5072,14 +5687,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss48(out *jwriter.Writer, in
out.RawString("null")
} else {
out.RawByte('[')
- for v65, v66 := range in.MatchedCSSRules {
- if v65 > 0 {
+ for v74, v75 := range in.MatchedCSSRules {
+ if v74 > 0 {
out.RawByte(',')
}
- if v66 == nil {
+ if v75 == nil {
out.RawString("null")
} else {
- (*v66).MarshalEasyJSON(out)
+ (*v75).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -5091,27 +5706,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss48(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v InheritedStyleEntry) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss48(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss53(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v InheritedStyleEntry) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss48(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss53(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *InheritedStyleEntry) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss48(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss53(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *InheritedStyleEntry) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss48(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss53(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss49(in *jlexer.Lexer, out *InheritedPseudoElementMatches) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss54(in *jlexer.Lexer, out *InheritedPseudoElementMatches) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -5146,17 +5761,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss49(in *jlexer.Lexer, out *
out.PseudoElements = (out.PseudoElements)[:0]
}
for !in.IsDelim(']') {
- var v67 *PseudoElementMatches
+ var v76 *PseudoElementMatches
if in.IsNull() {
in.Skip()
- v67 = nil
+ v76 = nil
} else {
- if v67 == nil {
- v67 = new(PseudoElementMatches)
+ if v76 == nil {
+ v76 = new(PseudoElementMatches)
}
- (*v67).UnmarshalEasyJSON(in)
+ (*v76).UnmarshalEasyJSON(in)
}
- out.PseudoElements = append(out.PseudoElements, v67)
+ out.PseudoElements = append(out.PseudoElements, v76)
in.WantComma()
}
in.Delim(']')
@@ -5171,7 +5786,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss49(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss49(out *jwriter.Writer, in InheritedPseudoElementMatches) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss54(out *jwriter.Writer, in InheritedPseudoElementMatches) {
out.RawByte('{')
first := true
_ = first
@@ -5182,14 +5797,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss49(out *jwriter.Writer, in
out.RawString("null")
} else {
out.RawByte('[')
- for v68, v69 := range in.PseudoElements {
- if v68 > 0 {
+ for v77, v78 := range in.PseudoElements {
+ if v77 > 0 {
out.RawByte(',')
}
- if v69 == nil {
+ if v78 == nil {
out.RawString("null")
} else {
- (*v69).MarshalEasyJSON(out)
+ (*v78).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -5201,27 +5816,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss49(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v InheritedPseudoElementMatches) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss49(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss54(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v InheritedPseudoElementMatches) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss49(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss54(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *InheritedPseudoElementMatches) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss49(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss54(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *InheritedPseudoElementMatches) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss49(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss54(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss50(in *jlexer.Lexer, out *GetStyleSheetTextReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss55(in *jlexer.Lexer, out *GetStyleSheetTextReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -5252,7 +5867,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss50(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss50(out *jwriter.Writer, in GetStyleSheetTextReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss55(out *jwriter.Writer, in GetStyleSheetTextReturns) {
out.RawByte('{')
first := true
_ = first
@@ -5268,27 +5883,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss50(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetStyleSheetTextReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss50(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss55(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetStyleSheetTextReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss50(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss55(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetStyleSheetTextReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss50(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss55(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetStyleSheetTextReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss50(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss55(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss51(in *jlexer.Lexer, out *GetStyleSheetTextParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss56(in *jlexer.Lexer, out *GetStyleSheetTextParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -5319,7 +5934,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss51(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss51(out *jwriter.Writer, in GetStyleSheetTextParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(out *jwriter.Writer, in GetStyleSheetTextParams) {
out.RawByte('{')
first := true
_ = first
@@ -5334,27 +5949,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss51(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetStyleSheetTextParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss51(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetStyleSheetTextParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss51(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetStyleSheetTextParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss51(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss56(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetStyleSheetTextParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss51(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss56(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss52(in *jlexer.Lexer, out *GetPlatformFontsForNodeReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss57(in *jlexer.Lexer, out *GetPlatformFontsForNodeReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -5389,17 +6004,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss52(in *jlexer.Lexer, out *
out.Fonts = (out.Fonts)[:0]
}
for !in.IsDelim(']') {
- var v70 *PlatformFontUsage
+ var v79 *PlatformFontUsage
if in.IsNull() {
in.Skip()
- v70 = nil
+ v79 = nil
} else {
- if v70 == nil {
- v70 = new(PlatformFontUsage)
+ if v79 == nil {
+ v79 = new(PlatformFontUsage)
}
- (*v70).UnmarshalEasyJSON(in)
+ (*v79).UnmarshalEasyJSON(in)
}
- out.Fonts = append(out.Fonts, v70)
+ out.Fonts = append(out.Fonts, v79)
in.WantComma()
}
in.Delim(']')
@@ -5414,7 +6029,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss52(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss52(out *jwriter.Writer, in GetPlatformFontsForNodeReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss57(out *jwriter.Writer, in GetPlatformFontsForNodeReturns) {
out.RawByte('{')
first := true
_ = first
@@ -5424,14 +6039,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss52(out *jwriter.Writer, in
out.RawString(prefix[1:])
{
out.RawByte('[')
- for v71, v72 := range in.Fonts {
- if v71 > 0 {
+ for v80, v81 := range in.Fonts {
+ if v80 > 0 {
out.RawByte(',')
}
- if v72 == nil {
+ if v81 == nil {
out.RawString("null")
} else {
- (*v72).MarshalEasyJSON(out)
+ (*v81).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -5443,27 +6058,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss52(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetPlatformFontsForNodeReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss52(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss57(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetPlatformFontsForNodeReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss52(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss57(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetPlatformFontsForNodeReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss52(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss57(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetPlatformFontsForNodeReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss52(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss57(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss53(in *jlexer.Lexer, out *GetPlatformFontsForNodeParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss58(in *jlexer.Lexer, out *GetPlatformFontsForNodeParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -5494,7 +6109,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss53(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss53(out *jwriter.Writer, in GetPlatformFontsForNodeParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss58(out *jwriter.Writer, in GetPlatformFontsForNodeParams) {
out.RawByte('{')
first := true
_ = first
@@ -5509,27 +6124,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss53(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetPlatformFontsForNodeParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss53(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss58(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetPlatformFontsForNodeParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss53(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss58(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetPlatformFontsForNodeParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss53(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss58(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetPlatformFontsForNodeParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss53(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss58(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss54(in *jlexer.Lexer, out *GetMediaQueriesReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss59(in *jlexer.Lexer, out *GetMediaQueriesReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -5564,17 +6179,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss54(in *jlexer.Lexer, out *
out.Medias = (out.Medias)[:0]
}
for !in.IsDelim(']') {
- var v73 *Media
+ var v82 *Media
if in.IsNull() {
in.Skip()
- v73 = nil
+ v82 = nil
} else {
- if v73 == nil {
- v73 = new(Media)
+ if v82 == nil {
+ v82 = new(Media)
}
- (*v73).UnmarshalEasyJSON(in)
+ (*v82).UnmarshalEasyJSON(in)
}
- out.Medias = append(out.Medias, v73)
+ out.Medias = append(out.Medias, v82)
in.WantComma()
}
in.Delim(']')
@@ -5589,7 +6204,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss54(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss54(out *jwriter.Writer, in GetMediaQueriesReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss59(out *jwriter.Writer, in GetMediaQueriesReturns) {
out.RawByte('{')
first := true
_ = first
@@ -5599,14 +6214,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss54(out *jwriter.Writer, in
out.RawString(prefix[1:])
{
out.RawByte('[')
- for v74, v75 := range in.Medias {
- if v74 > 0 {
+ for v83, v84 := range in.Medias {
+ if v83 > 0 {
out.RawByte(',')
}
- if v75 == nil {
+ if v84 == nil {
out.RawString("null")
} else {
- (*v75).MarshalEasyJSON(out)
+ (*v84).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -5618,27 +6233,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss54(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetMediaQueriesReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss54(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss59(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetMediaQueriesReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss54(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss59(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetMediaQueriesReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss54(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss59(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetMediaQueriesReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss54(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss59(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss55(in *jlexer.Lexer, out *GetMediaQueriesParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss60(in *jlexer.Lexer, out *GetMediaQueriesParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -5667,7 +6282,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss55(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss55(out *jwriter.Writer, in GetMediaQueriesParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss60(out *jwriter.Writer, in GetMediaQueriesParams) {
out.RawByte('{')
first := true
_ = first
@@ -5677,27 +6292,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss55(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetMediaQueriesParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss55(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss60(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetMediaQueriesParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss55(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss60(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetMediaQueriesParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss55(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss60(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetMediaQueriesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss55(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss60(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss56(in *jlexer.Lexer, out *GetMatchedStylesForNodeReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss61(in *jlexer.Lexer, out *GetMatchedStylesForNodeReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -5752,17 +6367,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss56(in *jlexer.Lexer, out *
out.MatchedCSSRules = (out.MatchedCSSRules)[:0]
}
for !in.IsDelim(']') {
- var v76 *RuleMatch
+ var v85 *RuleMatch
if in.IsNull() {
in.Skip()
- v76 = nil
+ v85 = nil
} else {
- if v76 == nil {
- v76 = new(RuleMatch)
+ if v85 == nil {
+ v85 = new(RuleMatch)
}
- (*v76).UnmarshalEasyJSON(in)
+ (*v85).UnmarshalEasyJSON(in)
}
- out.MatchedCSSRules = append(out.MatchedCSSRules, v76)
+ out.MatchedCSSRules = append(out.MatchedCSSRules, v85)
in.WantComma()
}
in.Delim(']')
@@ -5783,17 +6398,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss56(in *jlexer.Lexer, out *
out.PseudoElements = (out.PseudoElements)[:0]
}
for !in.IsDelim(']') {
- var v77 *PseudoElementMatches
+ var v86 *PseudoElementMatches
if in.IsNull() {
in.Skip()
- v77 = nil
+ v86 = nil
} else {
- if v77 == nil {
- v77 = new(PseudoElementMatches)
+ if v86 == nil {
+ v86 = new(PseudoElementMatches)
}
- (*v77).UnmarshalEasyJSON(in)
+ (*v86).UnmarshalEasyJSON(in)
}
- out.PseudoElements = append(out.PseudoElements, v77)
+ out.PseudoElements = append(out.PseudoElements, v86)
in.WantComma()
}
in.Delim(']')
@@ -5814,17 +6429,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss56(in *jlexer.Lexer, out *
out.Inherited = (out.Inherited)[:0]
}
for !in.IsDelim(']') {
- var v78 *InheritedStyleEntry
+ var v87 *InheritedStyleEntry
if in.IsNull() {
in.Skip()
- v78 = nil
+ v87 = nil
} else {
- if v78 == nil {
- v78 = new(InheritedStyleEntry)
+ if v87 == nil {
+ v87 = new(InheritedStyleEntry)
}
- (*v78).UnmarshalEasyJSON(in)
+ (*v87).UnmarshalEasyJSON(in)
}
- out.Inherited = append(out.Inherited, v78)
+ out.Inherited = append(out.Inherited, v87)
in.WantComma()
}
in.Delim(']')
@@ -5845,17 +6460,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss56(in *jlexer.Lexer, out *
out.InheritedPseudoElements = (out.InheritedPseudoElements)[:0]
}
for !in.IsDelim(']') {
- var v79 *InheritedPseudoElementMatches
+ var v88 *InheritedPseudoElementMatches
if in.IsNull() {
in.Skip()
- v79 = nil
+ v88 = nil
} else {
- if v79 == nil {
- v79 = new(InheritedPseudoElementMatches)
+ if v88 == nil {
+ v88 = new(InheritedPseudoElementMatches)
}
- (*v79).UnmarshalEasyJSON(in)
+ (*v88).UnmarshalEasyJSON(in)
}
- out.InheritedPseudoElements = append(out.InheritedPseudoElements, v79)
+ out.InheritedPseudoElements = append(out.InheritedPseudoElements, v88)
in.WantComma()
}
in.Delim(']')
@@ -5876,17 +6491,110 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss56(in *jlexer.Lexer, out *
out.CSSKeyframesRules = (out.CSSKeyframesRules)[:0]
}
for !in.IsDelim(']') {
- var v80 *KeyframesRule
+ var v89 *KeyframesRule
+ if in.IsNull() {
+ in.Skip()
+ v89 = nil
+ } else {
+ if v89 == nil {
+ v89 = new(KeyframesRule)
+ }
+ (*v89).UnmarshalEasyJSON(in)
+ }
+ out.CSSKeyframesRules = append(out.CSSKeyframesRules, v89)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ case "cssPositionFallbackRules":
+ if in.IsNull() {
+ in.Skip()
+ out.CSSPositionFallbackRules = nil
+ } else {
+ in.Delim('[')
+ if out.CSSPositionFallbackRules == nil {
+ if !in.IsDelim(']') {
+ out.CSSPositionFallbackRules = make([]*PositionFallbackRule, 0, 8)
+ } else {
+ out.CSSPositionFallbackRules = []*PositionFallbackRule{}
+ }
+ } else {
+ out.CSSPositionFallbackRules = (out.CSSPositionFallbackRules)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v90 *PositionFallbackRule
+ if in.IsNull() {
+ in.Skip()
+ v90 = nil
+ } else {
+ if v90 == nil {
+ v90 = new(PositionFallbackRule)
+ }
+ (*v90).UnmarshalEasyJSON(in)
+ }
+ out.CSSPositionFallbackRules = append(out.CSSPositionFallbackRules, v90)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ case "cssPropertyRules":
+ if in.IsNull() {
+ in.Skip()
+ out.CSSPropertyRules = nil
+ } else {
+ in.Delim('[')
+ if out.CSSPropertyRules == nil {
+ if !in.IsDelim(']') {
+ out.CSSPropertyRules = make([]*PropertyRule, 0, 8)
+ } else {
+ out.CSSPropertyRules = []*PropertyRule{}
+ }
+ } else {
+ out.CSSPropertyRules = (out.CSSPropertyRules)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v91 *PropertyRule
+ if in.IsNull() {
+ in.Skip()
+ v91 = nil
+ } else {
+ if v91 == nil {
+ v91 = new(PropertyRule)
+ }
+ (*v91).UnmarshalEasyJSON(in)
+ }
+ out.CSSPropertyRules = append(out.CSSPropertyRules, v91)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ case "cssPropertyRegistrations":
+ if in.IsNull() {
+ in.Skip()
+ out.CSSPropertyRegistrations = nil
+ } else {
+ in.Delim('[')
+ if out.CSSPropertyRegistrations == nil {
+ if !in.IsDelim(']') {
+ out.CSSPropertyRegistrations = make([]*PropertyRegistration, 0, 8)
+ } else {
+ out.CSSPropertyRegistrations = []*PropertyRegistration{}
+ }
+ } else {
+ out.CSSPropertyRegistrations = (out.CSSPropertyRegistrations)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v92 *PropertyRegistration
if in.IsNull() {
in.Skip()
- v80 = nil
+ v92 = nil
} else {
- if v80 == nil {
- v80 = new(KeyframesRule)
+ if v92 == nil {
+ v92 = new(PropertyRegistration)
}
- (*v80).UnmarshalEasyJSON(in)
+ (*v92).UnmarshalEasyJSON(in)
}
- out.CSSKeyframesRules = append(out.CSSKeyframesRules, v80)
+ out.CSSPropertyRegistrations = append(out.CSSPropertyRegistrations, v92)
in.WantComma()
}
in.Delim(']')
@@ -5903,7 +6611,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss56(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(out *jwriter.Writer, in GetMatchedStylesForNodeReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss61(out *jwriter.Writer, in GetMatchedStylesForNodeReturns) {
out.RawByte('{')
first := true
_ = first
@@ -5913,18 +6621,87 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(out *jwriter.Writer, in
out.RawString(prefix[1:])
(*in.InlineStyle).MarshalEasyJSON(out)
}
- if in.AttributesStyle != nil {
- const prefix string = ",\"attributesStyle\":"
+ if in.AttributesStyle != nil {
+ const prefix string = ",\"attributesStyle\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (*in.AttributesStyle).MarshalEasyJSON(out)
+ }
+ if len(in.MatchedCSSRules) != 0 {
+ const prefix string = ",\"matchedCSSRules\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ {
+ out.RawByte('[')
+ for v93, v94 := range in.MatchedCSSRules {
+ if v93 > 0 {
+ out.RawByte(',')
+ }
+ if v94 == nil {
+ out.RawString("null")
+ } else {
+ (*v94).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ if len(in.PseudoElements) != 0 {
+ const prefix string = ",\"pseudoElements\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ {
+ out.RawByte('[')
+ for v95, v96 := range in.PseudoElements {
+ if v95 > 0 {
+ out.RawByte(',')
+ }
+ if v96 == nil {
+ out.RawString("null")
+ } else {
+ (*v96).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ if len(in.Inherited) != 0 {
+ const prefix string = ",\"inherited\":"
if first {
first = false
out.RawString(prefix[1:])
} else {
out.RawString(prefix)
}
- (*in.AttributesStyle).MarshalEasyJSON(out)
+ {
+ out.RawByte('[')
+ for v97, v98 := range in.Inherited {
+ if v97 > 0 {
+ out.RawByte(',')
+ }
+ if v98 == nil {
+ out.RawString("null")
+ } else {
+ (*v98).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
}
- if len(in.MatchedCSSRules) != 0 {
- const prefix string = ",\"matchedCSSRules\":"
+ if len(in.InheritedPseudoElements) != 0 {
+ const prefix string = ",\"inheritedPseudoElements\":"
if first {
first = false
out.RawString(prefix[1:])
@@ -5933,21 +6710,21 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(out *jwriter.Writer, in
}
{
out.RawByte('[')
- for v81, v82 := range in.MatchedCSSRules {
- if v81 > 0 {
+ for v99, v100 := range in.InheritedPseudoElements {
+ if v99 > 0 {
out.RawByte(',')
}
- if v82 == nil {
+ if v100 == nil {
out.RawString("null")
} else {
- (*v82).MarshalEasyJSON(out)
+ (*v100).MarshalEasyJSON(out)
}
}
out.RawByte(']')
}
}
- if len(in.PseudoElements) != 0 {
- const prefix string = ",\"pseudoElements\":"
+ if len(in.CSSKeyframesRules) != 0 {
+ const prefix string = ",\"cssKeyframesRules\":"
if first {
first = false
out.RawString(prefix[1:])
@@ -5956,21 +6733,21 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(out *jwriter.Writer, in
}
{
out.RawByte('[')
- for v83, v84 := range in.PseudoElements {
- if v83 > 0 {
+ for v101, v102 := range in.CSSKeyframesRules {
+ if v101 > 0 {
out.RawByte(',')
}
- if v84 == nil {
+ if v102 == nil {
out.RawString("null")
} else {
- (*v84).MarshalEasyJSON(out)
+ (*v102).MarshalEasyJSON(out)
}
}
out.RawByte(']')
}
}
- if len(in.Inherited) != 0 {
- const prefix string = ",\"inherited\":"
+ if len(in.CSSPositionFallbackRules) != 0 {
+ const prefix string = ",\"cssPositionFallbackRules\":"
if first {
first = false
out.RawString(prefix[1:])
@@ -5979,21 +6756,21 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(out *jwriter.Writer, in
}
{
out.RawByte('[')
- for v85, v86 := range in.Inherited {
- if v85 > 0 {
+ for v103, v104 := range in.CSSPositionFallbackRules {
+ if v103 > 0 {
out.RawByte(',')
}
- if v86 == nil {
+ if v104 == nil {
out.RawString("null")
} else {
- (*v86).MarshalEasyJSON(out)
+ (*v104).MarshalEasyJSON(out)
}
}
out.RawByte(']')
}
}
- if len(in.InheritedPseudoElements) != 0 {
- const prefix string = ",\"inheritedPseudoElements\":"
+ if len(in.CSSPropertyRules) != 0 {
+ const prefix string = ",\"cssPropertyRules\":"
if first {
first = false
out.RawString(prefix[1:])
@@ -6002,21 +6779,21 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(out *jwriter.Writer, in
}
{
out.RawByte('[')
- for v87, v88 := range in.InheritedPseudoElements {
- if v87 > 0 {
+ for v105, v106 := range in.CSSPropertyRules {
+ if v105 > 0 {
out.RawByte(',')
}
- if v88 == nil {
+ if v106 == nil {
out.RawString("null")
} else {
- (*v88).MarshalEasyJSON(out)
+ (*v106).MarshalEasyJSON(out)
}
}
out.RawByte(']')
}
}
- if len(in.CSSKeyframesRules) != 0 {
- const prefix string = ",\"cssKeyframesRules\":"
+ if len(in.CSSPropertyRegistrations) != 0 {
+ const prefix string = ",\"cssPropertyRegistrations\":"
if first {
first = false
out.RawString(prefix[1:])
@@ -6025,14 +6802,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(out *jwriter.Writer, in
}
{
out.RawByte('[')
- for v89, v90 := range in.CSSKeyframesRules {
- if v89 > 0 {
+ for v107, v108 := range in.CSSPropertyRegistrations {
+ if v107 > 0 {
out.RawByte(',')
}
- if v90 == nil {
+ if v108 == nil {
out.RawString("null")
} else {
- (*v90).MarshalEasyJSON(out)
+ (*v108).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -6054,27 +6831,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetMatchedStylesForNodeReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss61(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetMatchedStylesForNodeReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss56(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss61(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetMatchedStylesForNodeReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss56(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss61(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetMatchedStylesForNodeReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss56(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss61(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss57(in *jlexer.Lexer, out *GetMatchedStylesForNodeParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss62(in *jlexer.Lexer, out *GetMatchedStylesForNodeParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6105,7 +6882,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss57(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss57(out *jwriter.Writer, in GetMatchedStylesForNodeParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss62(out *jwriter.Writer, in GetMatchedStylesForNodeParams) {
out.RawByte('{')
first := true
_ = first
@@ -6120,27 +6897,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss57(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetMatchedStylesForNodeParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss57(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss62(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetMatchedStylesForNodeParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss57(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss62(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetMatchedStylesForNodeParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss57(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss62(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetMatchedStylesForNodeParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss57(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss62(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss58(in *jlexer.Lexer, out *GetLayersForNodeReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss63(in *jlexer.Lexer, out *GetLayersForNodeReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6179,7 +6956,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss58(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss58(out *jwriter.Writer, in GetLayersForNodeReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss63(out *jwriter.Writer, in GetLayersForNodeReturns) {
out.RawByte('{')
first := true
_ = first
@@ -6195,27 +6972,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss58(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetLayersForNodeReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss58(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss63(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetLayersForNodeReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss58(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss63(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetLayersForNodeReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss58(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss63(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetLayersForNodeReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss58(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss63(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss59(in *jlexer.Lexer, out *GetLayersForNodeParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss64(in *jlexer.Lexer, out *GetLayersForNodeParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6246,7 +7023,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss59(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss59(out *jwriter.Writer, in GetLayersForNodeParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss64(out *jwriter.Writer, in GetLayersForNodeParams) {
out.RawByte('{')
first := true
_ = first
@@ -6261,27 +7038,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss59(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetLayersForNodeParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss59(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss64(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetLayersForNodeParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss59(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss64(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetLayersForNodeParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss59(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss64(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetLayersForNodeParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss59(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss64(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss60(in *jlexer.Lexer, out *GetInlineStylesForNodeReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss65(in *jlexer.Lexer, out *GetInlineStylesForNodeReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6330,7 +7107,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss60(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss60(out *jwriter.Writer, in GetInlineStylesForNodeReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss65(out *jwriter.Writer, in GetInlineStylesForNodeReturns) {
out.RawByte('{')
first := true
_ = first
@@ -6356,27 +7133,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss60(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetInlineStylesForNodeReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss60(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss65(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetInlineStylesForNodeReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss60(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss65(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetInlineStylesForNodeReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss60(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss65(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetInlineStylesForNodeReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss60(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss65(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss61(in *jlexer.Lexer, out *GetInlineStylesForNodeParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss66(in *jlexer.Lexer, out *GetInlineStylesForNodeParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6407,7 +7184,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss61(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss61(out *jwriter.Writer, in GetInlineStylesForNodeParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss66(out *jwriter.Writer, in GetInlineStylesForNodeParams) {
out.RawByte('{')
first := true
_ = first
@@ -6422,27 +7199,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss61(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetInlineStylesForNodeParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss61(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss66(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetInlineStylesForNodeParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss61(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss66(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetInlineStylesForNodeParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss61(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss66(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetInlineStylesForNodeParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss61(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss66(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss62(in *jlexer.Lexer, out *GetComputedStyleForNodeReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss67(in *jlexer.Lexer, out *GetComputedStyleForNodeReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6477,17 +7254,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss62(in *jlexer.Lexer, out *
out.ComputedStyle = (out.ComputedStyle)[:0]
}
for !in.IsDelim(']') {
- var v91 *ComputedStyleProperty
+ var v109 *ComputedStyleProperty
if in.IsNull() {
in.Skip()
- v91 = nil
+ v109 = nil
} else {
- if v91 == nil {
- v91 = new(ComputedStyleProperty)
+ if v109 == nil {
+ v109 = new(ComputedStyleProperty)
}
- (*v91).UnmarshalEasyJSON(in)
+ (*v109).UnmarshalEasyJSON(in)
}
- out.ComputedStyle = append(out.ComputedStyle, v91)
+ out.ComputedStyle = append(out.ComputedStyle, v109)
in.WantComma()
}
in.Delim(']')
@@ -6502,7 +7279,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss62(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss62(out *jwriter.Writer, in GetComputedStyleForNodeReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss67(out *jwriter.Writer, in GetComputedStyleForNodeReturns) {
out.RawByte('{')
first := true
_ = first
@@ -6512,14 +7289,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss62(out *jwriter.Writer, in
out.RawString(prefix[1:])
{
out.RawByte('[')
- for v92, v93 := range in.ComputedStyle {
- if v92 > 0 {
+ for v110, v111 := range in.ComputedStyle {
+ if v110 > 0 {
out.RawByte(',')
}
- if v93 == nil {
+ if v111 == nil {
out.RawString("null")
} else {
- (*v93).MarshalEasyJSON(out)
+ (*v111).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -6531,27 +7308,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss62(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetComputedStyleForNodeReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss62(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss67(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetComputedStyleForNodeReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss62(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss67(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetComputedStyleForNodeReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss62(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss67(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetComputedStyleForNodeReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss62(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss67(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss63(in *jlexer.Lexer, out *GetComputedStyleForNodeParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss68(in *jlexer.Lexer, out *GetComputedStyleForNodeParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6582,7 +7359,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss63(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss63(out *jwriter.Writer, in GetComputedStyleForNodeParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss68(out *jwriter.Writer, in GetComputedStyleForNodeParams) {
out.RawByte('{')
first := true
_ = first
@@ -6597,27 +7374,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss63(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetComputedStyleForNodeParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss63(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss68(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetComputedStyleForNodeParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss63(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss68(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetComputedStyleForNodeParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss63(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss68(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetComputedStyleForNodeParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss63(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss68(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss64(in *jlexer.Lexer, out *GetBackgroundColorsReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss69(in *jlexer.Lexer, out *GetBackgroundColorsReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6652,9 +7429,9 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss64(in *jlexer.Lexer, out *
out.BackgroundColors = (out.BackgroundColors)[:0]
}
for !in.IsDelim(']') {
- var v94 string
- v94 = string(in.String())
- out.BackgroundColors = append(out.BackgroundColors, v94)
+ var v112 string
+ v112 = string(in.String())
+ out.BackgroundColors = append(out.BackgroundColors, v112)
in.WantComma()
}
in.Delim(']')
@@ -6673,7 +7450,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss64(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss64(out *jwriter.Writer, in GetBackgroundColorsReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss69(out *jwriter.Writer, in GetBackgroundColorsReturns) {
out.RawByte('{')
first := true
_ = first
@@ -6683,11 +7460,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss64(out *jwriter.Writer, in
out.RawString(prefix[1:])
{
out.RawByte('[')
- for v95, v96 := range in.BackgroundColors {
- if v95 > 0 {
+ for v113, v114 := range in.BackgroundColors {
+ if v113 > 0 {
out.RawByte(',')
}
- out.String(string(v96))
+ out.String(string(v114))
}
out.RawByte(']')
}
@@ -6718,27 +7495,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss64(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetBackgroundColorsReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss64(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss69(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetBackgroundColorsReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss64(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss69(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetBackgroundColorsReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss64(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss69(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetBackgroundColorsReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss64(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss69(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss65(in *jlexer.Lexer, out *GetBackgroundColorsParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss70(in *jlexer.Lexer, out *GetBackgroundColorsParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6769,7 +7546,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss65(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss65(out *jwriter.Writer, in GetBackgroundColorsParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss70(out *jwriter.Writer, in GetBackgroundColorsParams) {
out.RawByte('{')
first := true
_ = first
@@ -6784,27 +7561,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss65(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v GetBackgroundColorsParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss65(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss70(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetBackgroundColorsParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss65(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss70(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetBackgroundColorsParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss65(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss70(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetBackgroundColorsParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss65(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss70(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss66(in *jlexer.Lexer, out *ForcePseudoStateParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss71(in *jlexer.Lexer, out *ForcePseudoStateParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6841,9 +7618,9 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss66(in *jlexer.Lexer, out *
out.ForcedPseudoClasses = (out.ForcedPseudoClasses)[:0]
}
for !in.IsDelim(']') {
- var v97 string
- v97 = string(in.String())
- out.ForcedPseudoClasses = append(out.ForcedPseudoClasses, v97)
+ var v115 string
+ v115 = string(in.String())
+ out.ForcedPseudoClasses = append(out.ForcedPseudoClasses, v115)
in.WantComma()
}
in.Delim(']')
@@ -6858,7 +7635,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss66(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss66(out *jwriter.Writer, in ForcePseudoStateParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss71(out *jwriter.Writer, in ForcePseudoStateParams) {
out.RawByte('{')
first := true
_ = first
@@ -6874,11 +7651,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss66(out *jwriter.Writer, in
out.RawString("null")
} else {
out.RawByte('[')
- for v98, v99 := range in.ForcedPseudoClasses {
- if v98 > 0 {
+ for v116, v117 := range in.ForcedPseudoClasses {
+ if v116 > 0 {
out.RawByte(',')
}
- out.String(string(v99))
+ out.String(string(v117))
}
out.RawByte(']')
}
@@ -6889,27 +7666,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss66(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v ForcePseudoStateParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss66(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss71(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ForcePseudoStateParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss66(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss71(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ForcePseudoStateParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss66(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss71(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ForcePseudoStateParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss66(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss71(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss67(in *jlexer.Lexer, out *FontVariationAxis) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss72(in *jlexer.Lexer, out *FontVariationAxis) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6948,7 +7725,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss67(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss67(out *jwriter.Writer, in FontVariationAxis) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss72(out *jwriter.Writer, in FontVariationAxis) {
out.RawByte('{')
first := true
_ = first
@@ -6983,27 +7760,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss67(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v FontVariationAxis) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss67(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss72(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v FontVariationAxis) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss67(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss72(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *FontVariationAxis) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss67(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss72(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *FontVariationAxis) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss67(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss72(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss68(in *jlexer.Lexer, out *FontFace) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss73(in *jlexer.Lexer, out *FontFace) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7056,17 +7833,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss68(in *jlexer.Lexer, out *
out.FontVariationAxes = (out.FontVariationAxes)[:0]
}
for !in.IsDelim(']') {
- var v100 *FontVariationAxis
+ var v118 *FontVariationAxis
if in.IsNull() {
in.Skip()
- v100 = nil
+ v118 = nil
} else {
- if v100 == nil {
- v100 = new(FontVariationAxis)
+ if v118 == nil {
+ v118 = new(FontVariationAxis)
}
- (*v100).UnmarshalEasyJSON(in)
+ (*v118).UnmarshalEasyJSON(in)
}
- out.FontVariationAxes = append(out.FontVariationAxes, v100)
+ out.FontVariationAxes = append(out.FontVariationAxes, v118)
in.WantComma()
}
in.Delim(']')
@@ -7081,7 +7858,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss68(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss68(out *jwriter.Writer, in FontFace) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss73(out *jwriter.Writer, in FontFace) {
out.RawByte('{')
first := true
_ = first
@@ -7135,14 +7912,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss68(out *jwriter.Writer, in
out.RawString(prefix)
{
out.RawByte('[')
- for v101, v102 := range in.FontVariationAxes {
- if v101 > 0 {
+ for v119, v120 := range in.FontVariationAxes {
+ if v119 > 0 {
out.RawByte(',')
}
- if v102 == nil {
+ if v120 == nil {
out.RawString("null")
} else {
- (*v102).MarshalEasyJSON(out)
+ (*v120).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -7154,27 +7931,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss68(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v FontFace) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss68(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss73(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v FontFace) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss68(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss73(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *FontFace) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss68(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss73(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *FontFace) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss68(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss73(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss69(in *jlexer.Lexer, out *EventStyleSheetRemoved) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss74(in *jlexer.Lexer, out *EventStyleSheetRemoved) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7205,7 +7982,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss69(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss69(out *jwriter.Writer, in EventStyleSheetRemoved) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss74(out *jwriter.Writer, in EventStyleSheetRemoved) {
out.RawByte('{')
first := true
_ = first
@@ -7220,27 +7997,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss69(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v EventStyleSheetRemoved) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss69(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss74(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventStyleSheetRemoved) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss69(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss74(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventStyleSheetRemoved) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss69(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss74(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventStyleSheetRemoved) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss69(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss74(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss70(in *jlexer.Lexer, out *EventStyleSheetChanged) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss75(in *jlexer.Lexer, out *EventStyleSheetChanged) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7271,7 +8048,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss70(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss70(out *jwriter.Writer, in EventStyleSheetChanged) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss75(out *jwriter.Writer, in EventStyleSheetChanged) {
out.RawByte('{')
first := true
_ = first
@@ -7286,27 +8063,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss70(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v EventStyleSheetChanged) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss70(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss75(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventStyleSheetChanged) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss70(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss75(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventStyleSheetChanged) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss70(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss75(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventStyleSheetChanged) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss70(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss75(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss71(in *jlexer.Lexer, out *EventStyleSheetAdded) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss76(in *jlexer.Lexer, out *EventStyleSheetAdded) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7345,7 +8122,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss71(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss71(out *jwriter.Writer, in EventStyleSheetAdded) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss76(out *jwriter.Writer, in EventStyleSheetAdded) {
out.RawByte('{')
first := true
_ = first
@@ -7364,27 +8141,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss71(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v EventStyleSheetAdded) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss71(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss76(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventStyleSheetAdded) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss71(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss76(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventStyleSheetAdded) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss71(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss76(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventStyleSheetAdded) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss71(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss76(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss72(in *jlexer.Lexer, out *EventMediaQueryResultChanged) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss77(in *jlexer.Lexer, out *EventMediaQueryResultChanged) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7413,7 +8190,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss72(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss72(out *jwriter.Writer, in EventMediaQueryResultChanged) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss77(out *jwriter.Writer, in EventMediaQueryResultChanged) {
out.RawByte('{')
first := true
_ = first
@@ -7423,27 +8200,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss72(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v EventMediaQueryResultChanged) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss72(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss77(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventMediaQueryResultChanged) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss72(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss77(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventMediaQueryResultChanged) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss72(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss77(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventMediaQueryResultChanged) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss72(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss77(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss73(in *jlexer.Lexer, out *EventFontsUpdated) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss78(in *jlexer.Lexer, out *EventFontsUpdated) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7482,7 +8259,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss73(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss73(out *jwriter.Writer, in EventFontsUpdated) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss78(out *jwriter.Writer, in EventFontsUpdated) {
out.RawByte('{')
first := true
_ = first
@@ -7498,27 +8275,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss73(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v EventFontsUpdated) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss73(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss78(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventFontsUpdated) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss73(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss78(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventFontsUpdated) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss73(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss78(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventFontsUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss73(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss78(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss74(in *jlexer.Lexer, out *EnableParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss79(in *jlexer.Lexer, out *EnableParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7547,7 +8324,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss74(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss74(out *jwriter.Writer, in EnableParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss79(out *jwriter.Writer, in EnableParams) {
out.RawByte('{')
first := true
_ = first
@@ -7557,27 +8334,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss74(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v EnableParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss74(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss79(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EnableParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss74(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss79(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EnableParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss74(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss79(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EnableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss74(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss79(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss75(in *jlexer.Lexer, out *DisableParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss80(in *jlexer.Lexer, out *DisableParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7606,7 +8383,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss75(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss75(out *jwriter.Writer, in DisableParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss80(out *jwriter.Writer, in DisableParams) {
out.RawByte('{')
first := true
_ = first
@@ -7616,27 +8393,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss75(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v DisableParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss75(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss80(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v DisableParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss75(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss80(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *DisableParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss75(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss80(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *DisableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss75(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss80(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss76(in *jlexer.Lexer, out *CreateStyleSheetReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss81(in *jlexer.Lexer, out *CreateStyleSheetReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7667,7 +8444,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss76(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss76(out *jwriter.Writer, in CreateStyleSheetReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss81(out *jwriter.Writer, in CreateStyleSheetReturns) {
out.RawByte('{')
first := true
_ = first
@@ -7683,27 +8460,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss76(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v CreateStyleSheetReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss76(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss81(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CreateStyleSheetReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss76(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss81(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CreateStyleSheetReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss76(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss81(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CreateStyleSheetReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss76(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss81(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss77(in *jlexer.Lexer, out *CreateStyleSheetParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss82(in *jlexer.Lexer, out *CreateStyleSheetParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7734,7 +8511,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss77(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss77(out *jwriter.Writer, in CreateStyleSheetParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss82(out *jwriter.Writer, in CreateStyleSheetParams) {
out.RawByte('{')
first := true
_ = first
@@ -7749,27 +8526,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss77(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v CreateStyleSheetParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss77(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss82(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CreateStyleSheetParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss77(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss82(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CreateStyleSheetParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss77(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss82(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CreateStyleSheetParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss77(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss82(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss78(in *jlexer.Lexer, out *ContainerQuery) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss83(in *jlexer.Lexer, out *ContainerQuery) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7818,7 +8595,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss78(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss78(out *jwriter.Writer, in ContainerQuery) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss83(out *jwriter.Writer, in ContainerQuery) {
out.RawByte('{')
first := true
_ = first
@@ -7858,27 +8635,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss78(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v ContainerQuery) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss78(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss83(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ContainerQuery) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss78(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss83(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ContainerQuery) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss78(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss83(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ContainerQuery) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss78(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss83(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss79(in *jlexer.Lexer, out *ComputedStyleProperty) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss84(in *jlexer.Lexer, out *ComputedStyleProperty) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7911,7 +8688,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss79(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss79(out *jwriter.Writer, in ComputedStyleProperty) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss84(out *jwriter.Writer, in ComputedStyleProperty) {
out.RawByte('{')
first := true
_ = first
@@ -7931,27 +8708,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss79(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v ComputedStyleProperty) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss79(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss84(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ComputedStyleProperty) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss79(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss84(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ComputedStyleProperty) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss79(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss84(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ComputedStyleProperty) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss79(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss84(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss80(in *jlexer.Lexer, out *CollectClassNamesReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss85(in *jlexer.Lexer, out *CollectClassNamesReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7986,9 +8763,9 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss80(in *jlexer.Lexer, out *
out.ClassNames = (out.ClassNames)[:0]
}
for !in.IsDelim(']') {
- var v103 string
- v103 = string(in.String())
- out.ClassNames = append(out.ClassNames, v103)
+ var v121 string
+ v121 = string(in.String())
+ out.ClassNames = append(out.ClassNames, v121)
in.WantComma()
}
in.Delim(']')
@@ -8003,7 +8780,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss80(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss80(out *jwriter.Writer, in CollectClassNamesReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss85(out *jwriter.Writer, in CollectClassNamesReturns) {
out.RawByte('{')
first := true
_ = first
@@ -8013,11 +8790,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss80(out *jwriter.Writer, in
out.RawString(prefix[1:])
{
out.RawByte('[')
- for v104, v105 := range in.ClassNames {
- if v104 > 0 {
+ for v122, v123 := range in.ClassNames {
+ if v122 > 0 {
out.RawByte(',')
}
- out.String(string(v105))
+ out.String(string(v123))
}
out.RawByte(']')
}
@@ -8028,27 +8805,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss80(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v CollectClassNamesReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss80(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss85(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CollectClassNamesReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss80(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss85(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CollectClassNamesReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss80(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss85(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CollectClassNamesReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss80(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss85(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss81(in *jlexer.Lexer, out *CollectClassNamesParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss86(in *jlexer.Lexer, out *CollectClassNamesParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8079,7 +8856,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss81(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss81(out *jwriter.Writer, in CollectClassNamesParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss86(out *jwriter.Writer, in CollectClassNamesParams) {
out.RawByte('{')
first := true
_ = first
@@ -8094,27 +8871,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss81(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v CollectClassNamesParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss81(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss86(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CollectClassNamesParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss81(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss86(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CollectClassNamesParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss81(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss86(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CollectClassNamesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss81(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss86(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss82(in *jlexer.Lexer, out *AddRuleReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss87(in *jlexer.Lexer, out *AddRuleReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8153,7 +8930,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss82(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss82(out *jwriter.Writer, in AddRuleReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss87(out *jwriter.Writer, in AddRuleReturns) {
out.RawByte('{')
first := true
_ = first
@@ -8169,27 +8946,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss82(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v AddRuleReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss82(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss87(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AddRuleReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss82(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss87(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AddRuleReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss82(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss87(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AddRuleReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss82(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss87(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss83(in *jlexer.Lexer, out *AddRuleParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss88(in *jlexer.Lexer, out *AddRuleParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8232,7 +9009,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss83(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss83(out *jwriter.Writer, in AddRuleParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss88(out *jwriter.Writer, in AddRuleParams) {
out.RawByte('{')
first := true
_ = first
@@ -8261,23 +9038,23 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss83(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v AddRuleParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss83(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss88(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AddRuleParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss83(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoCss88(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AddRuleParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss83(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss88(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AddRuleParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss83(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoCss88(l, v)
}
diff --git a/css/types.go b/css/types.go
index 2c084c1..d4e9efa 100644
--- a/css/types.go
+++ b/css/types.go
@@ -114,8 +114,19 @@ type RuleMatch struct {
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/CSS#type-Value
type Value struct {
- Text string `json:"text"` // Value text.
- Range *SourceRange `json:"range,omitempty"` // Value range in the underlying resource (if available).
+ Text string `json:"text"` // Value text.
+ Range *SourceRange `json:"range,omitempty"` // Value range in the underlying resource (if available).
+ Specificity *Specificity `json:"specificity,omitempty"` // Specificity of the selector.
+}
+
+// Specificity specificity:
+// https://drafts.csswg.org/selectors/#specificity-rules.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/CSS#type-Specificity
+type Specificity struct {
+ A int64 `json:"a"` // The a component, which represents the number of ID selectors.
+ B int64 `json:"b"` // The b component, which represents the number of class selectors, attributes selectors, and pseudo-classes.
+ C int64 `json:"c"` // The c component, which represents the number of type selectors and pseudo-elements.
}
// SelectorList selector list data.
@@ -130,23 +141,24 @@ type SelectorList struct {
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/CSS#type-CSSStyleSheetHeader
type StyleSheetHeader struct {
- StyleSheetID StyleSheetID `json:"styleSheetId"` // The stylesheet identifier.
- FrameID cdp.FrameID `json:"frameId"` // Owner frame identifier.
- SourceURL string `json:"sourceURL"` // Stylesheet resource URL. Empty if this is a constructed stylesheet created using new CSSStyleSheet() (but non-empty if this is a constructed sylesheet imported as a CSS module script).
- SourceMapURL string `json:"sourceMapURL,omitempty"` // URL of source map associated with the stylesheet (if any).
- Origin StyleSheetOrigin `json:"origin"` // Stylesheet origin.
- Title string `json:"title"` // Stylesheet title.
- OwnerNode cdp.BackendNodeID `json:"ownerNode,omitempty"` // The backend id for the owner node of the stylesheet.
- Disabled bool `json:"disabled"` // Denotes whether the stylesheet is disabled.
- HasSourceURL bool `json:"hasSourceURL,omitempty"` // Whether the sourceURL field value comes from the sourceURL comment.
- IsInline bool `json:"isInline"` // Whether this stylesheet is created for STYLE tag by parser. This flag is not set for document.written STYLE tags.
- IsMutable bool `json:"isMutable"` // Whether this stylesheet is mutable. Inline stylesheets become mutable after they have been modified via CSSOM API. <link> element's stylesheets become mutable only if DevTools modifies them. Constructed stylesheets (new CSSStyleSheet()) are mutable immediately after creation.
- IsConstructed bool `json:"isConstructed"` // True if this stylesheet is created through new CSSStyleSheet() or imported as a CSS module script.
- StartLine float64 `json:"startLine"` // Line offset of the stylesheet within the resource (zero based).
- StartColumn float64 `json:"startColumn"` // Column offset of the stylesheet within the resource (zero based).
- Length float64 `json:"length"` // Size of the content (in characters).
- EndLine float64 `json:"endLine"` // Line offset of the end of the stylesheet within the resource (zero based).
- EndColumn float64 `json:"endColumn"` // Column offset of the end of the stylesheet within the resource (zero based).
+ StyleSheetID StyleSheetID `json:"styleSheetId"` // The stylesheet identifier.
+ FrameID cdp.FrameID `json:"frameId"` // Owner frame identifier.
+ SourceURL string `json:"sourceURL"` // Stylesheet resource URL. Empty if this is a constructed stylesheet created using new CSSStyleSheet() (but non-empty if this is a constructed sylesheet imported as a CSS module script).
+ SourceMapURL string `json:"sourceMapURL,omitempty"` // URL of source map associated with the stylesheet (if any).
+ Origin StyleSheetOrigin `json:"origin"` // Stylesheet origin.
+ Title string `json:"title"` // Stylesheet title.
+ OwnerNode cdp.BackendNodeID `json:"ownerNode,omitempty"` // The backend id for the owner node of the stylesheet.
+ Disabled bool `json:"disabled"` // Denotes whether the stylesheet is disabled.
+ HasSourceURL bool `json:"hasSourceURL,omitempty"` // Whether the sourceURL field value comes from the sourceURL comment.
+ IsInline bool `json:"isInline"` // Whether this stylesheet is created for STYLE tag by parser. This flag is not set for document.written STYLE tags.
+ IsMutable bool `json:"isMutable"` // Whether this stylesheet is mutable. Inline stylesheets become mutable after they have been modified via CSSOM API. <link> element's stylesheets become mutable only if DevTools modifies them. Constructed stylesheets (new CSSStyleSheet()) are mutable immediately after creation.
+ IsConstructed bool `json:"isConstructed"` // True if this stylesheet is created through new CSSStyleSheet() or imported as a CSS module script.
+ StartLine float64 `json:"startLine"` // Line offset of the stylesheet within the resource (zero based).
+ StartColumn float64 `json:"startColumn"` // Column offset of the stylesheet within the resource (zero based).
+ Length float64 `json:"length"` // Size of the content (in characters).
+ EndLine float64 `json:"endLine"` // Line offset of the end of the stylesheet within the resource (zero based).
+ EndColumn float64 `json:"endColumn"` // Column offset of the end of the stylesheet within the resource (zero based).
+ LoadingFailed bool `json:"loadingFailed,omitempty"` // If the style sheet was loaded from a network resource, this indicates when the resource failed to load
}
// Rule CSS rule representation.
@@ -155,6 +167,7 @@ type StyleSheetHeader struct {
type Rule struct {
StyleSheetID StyleSheetID `json:"styleSheetId,omitempty"` // The css style sheet identifier (absent for user agent stylesheet and user-specified stylesheet rules) this rule came from.
SelectorList *SelectorList `json:"selectorList"` // Rule selector data.
+ NestingSelectors []string `json:"nestingSelectors,omitempty"` // Array of selectors from ancestor style rules, sorted by distance from the current rule.
Origin StyleSheetOrigin `json:"origin"` // Parent stylesheet's origin.
Style *Style `json:"style"` // Associated style declaration.
Media []*Media `json:"media,omitempty"` // Media list array (for rules involving media queries). The array enumerates media queries starting with the innermost one, going outwards.
@@ -162,6 +175,66 @@ type Rule struct {
Supports []*Supports `json:"supports,omitempty"` // @supports CSS at-rule array. The array enumerates @supports at-rules starting with the innermost one, going outwards.
Layers []*Layer `json:"layers,omitempty"` // Cascade layer array. Contains the layer hierarchy that this rule belongs to starting with the innermost layer and going outwards.
Scopes []*Scope `json:"scopes,omitempty"` // @scope CSS at-rule array. The array enumerates @scope at-rules starting with the innermost one, going outwards.
+ RuleTypes []RuleType `json:"ruleTypes,omitempty"` // The array keeps the types of ancestor CSSRules from the innermost going outwards.
+}
+
+// RuleType enum indicating the type of a CSS rule, used to represent the
+// order of a style rule's ancestors. This list only contains rule types that
+// are collected during the ancestor rule collection.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/CSS#type-CSSRuleType
+type RuleType string
+
+// String returns the RuleType as string value.
+func (t RuleType) String() string {
+ return string(t)
+}
+
+// RuleType values.
+const (
+ RuleTypeMediaRule RuleType = "MediaRule"
+ RuleTypeSupportsRule RuleType = "SupportsRule"
+ RuleTypeContainerRule RuleType = "ContainerRule"
+ RuleTypeLayerRule RuleType = "LayerRule"
+ RuleTypeScopeRule RuleType = "ScopeRule"
+ RuleTypeStyleRule RuleType = "StyleRule"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t RuleType) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t RuleType) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *RuleType) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch RuleType(v) {
+ case RuleTypeMediaRule:
+ *t = RuleTypeMediaRule
+ case RuleTypeSupportsRule:
+ *t = RuleTypeSupportsRule
+ case RuleTypeContainerRule:
+ *t = RuleTypeContainerRule
+ case RuleTypeLayerRule:
+ *t = RuleTypeLayerRule
+ case RuleTypeScopeRule:
+ *t = RuleTypeScopeRule
+ case RuleTypeStyleRule:
+ *t = RuleTypeStyleRule
+
+ default:
+ in.AddError(fmt.Errorf("unknown RuleType value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *RuleType) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
}
// RuleUsage CSS coverage information.
@@ -347,6 +420,23 @@ type FontFace struct {
FontVariationAxes []*FontVariationAxis `json:"fontVariationAxes,omitempty"` // Available variation settings (a.k.a. "axes").
}
+// TryRule CSS try rule representation.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/CSS#type-CSSTryRule
+type TryRule struct {
+ StyleSheetID StyleSheetID `json:"styleSheetId,omitempty"` // The css style sheet identifier (absent for user agent stylesheet and user-specified stylesheet rules) this rule came from.
+ Origin StyleSheetOrigin `json:"origin"` // Parent stylesheet's origin.
+ Style *Style `json:"style"` // Associated style declaration.
+}
+
+// PositionFallbackRule CSS position-fallback rule representation.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/CSS#type-CSSPositionFallbackRule
+type PositionFallbackRule struct {
+ Name *Value `json:"name"`
+ TryRules []*TryRule `json:"tryRules"` // List of keyframes.
+}
+
// KeyframesRule CSS keyframes rule representation.
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/CSS#type-CSSKeyframesRule
@@ -355,6 +445,27 @@ type KeyframesRule struct {
Keyframes []*KeyframeRule `json:"keyframes"` // List of keyframes.
}
+// PropertyRegistration representation of a custom property registration
+// through CSS.registerProperty.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/CSS#type-CSSPropertyRegistration
+type PropertyRegistration struct {
+ PropertyName string `json:"propertyName"`
+ InitialValue *Value `json:"initialValue,omitempty"`
+ Inherits bool `json:"inherits"`
+ Syntax string `json:"syntax"`
+}
+
+// PropertyRule CSS property at-rule representation.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/CSS#type-CSSPropertyRule
+type PropertyRule struct {
+ StyleSheetID StyleSheetID `json:"styleSheetId,omitempty"` // The css style sheet identifier (absent for user agent stylesheet and user-specified stylesheet rules) this rule came from.
+ Origin StyleSheetOrigin `json:"origin"` // Parent stylesheet's origin.
+ PropertyName *Value `json:"propertyName"` // Associated property name.
+ Style *Style `json:"style"` // Associated style declaration.
+}
+
// KeyframeRule CSS keyframe rule representation.
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/CSS#type-CSSKeyframeRule
diff --git a/debian/changelog b/debian/changelog
index bdc01a5..0b2f321 100644
--- a/debian/changelog
+++ b/debian/changelog
@@ -1,3 +1,9 @@
+golang-github-chromedp-cdproto (0.0~git20230816.17ee49f-1) UNRELEASED; urgency=low
+
+ * New upstream snapshot.
+
+ -- Debian Janitor <janitor@jelmer.uk> Fri, 25 Aug 2023 13:30:04 -0000
+
golang-github-chromedp-cdproto (0.0~git20230109.6b041c6-1) unstable; urgency=medium
* New upstream version 0.0~git20230109.6b041c6.
diff --git a/debugger/types.go b/debugger/types.go
index 2a6d859..a4466eb 100644
--- a/debugger/types.go
+++ b/debugger/types.go
@@ -353,6 +353,7 @@ const (
PausedReasonOther PausedReason = "other"
PausedReasonPromiseRejection PausedReason = "promiseRejection"
PausedReasonXHR PausedReason = "XHR"
+ PausedReasonStep PausedReason = "step"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
@@ -393,6 +394,8 @@ func (t *PausedReason) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = PausedReasonPromiseRejection
case PausedReasonXHR:
*t = PausedReasonXHR
+ case PausedReasonStep:
+ *t = PausedReasonStep
default:
in.AddError(fmt.Errorf("unknown PausedReason value: %v", v))
@@ -602,10 +605,11 @@ func (t SetScriptSourceStatus) String() string {
// SetScriptSourceStatus values.
const (
- SetScriptSourceStatusOk SetScriptSourceStatus = "Ok"
- SetScriptSourceStatusCompileError SetScriptSourceStatus = "CompileError"
- SetScriptSourceStatusBlockedByActiveGenerator SetScriptSourceStatus = "BlockedByActiveGenerator"
- SetScriptSourceStatusBlockedByActiveFunction SetScriptSourceStatus = "BlockedByActiveFunction"
+ SetScriptSourceStatusOk SetScriptSourceStatus = "Ok"
+ SetScriptSourceStatusCompileError SetScriptSourceStatus = "CompileError"
+ SetScriptSourceStatusBlockedByActiveGenerator SetScriptSourceStatus = "BlockedByActiveGenerator"
+ SetScriptSourceStatusBlockedByActiveFunction SetScriptSourceStatus = "BlockedByActiveFunction"
+ SetScriptSourceStatusBlockedByTopLevelEsModuleChange SetScriptSourceStatus = "BlockedByTopLevelEsModuleChange"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
@@ -630,6 +634,8 @@ func (t *SetScriptSourceStatus) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = SetScriptSourceStatusBlockedByActiveGenerator
case SetScriptSourceStatusBlockedByActiveFunction:
*t = SetScriptSourceStatusBlockedByActiveFunction
+ case SetScriptSourceStatusBlockedByTopLevelEsModuleChange:
+ *t = SetScriptSourceStatusBlockedByTopLevelEsModuleChange
default:
in.AddError(fmt.Errorf("unknown SetScriptSourceStatus value: %v", v))
diff --git a/deviceaccess/deviceaccess.go b/deviceaccess/deviceaccess.go
new file mode 100644
index 0000000..cc1ea6e
--- /dev/null
+++ b/deviceaccess/deviceaccess.go
@@ -0,0 +1,104 @@
+// Package deviceaccess provides the Chrome DevTools Protocol
+// commands, types, and events for the DeviceAccess domain.
+//
+// Generated by the cdproto-gen command.
+package deviceaccess
+
+// Code generated by cdproto-gen. DO NOT EDIT.
+
+import (
+ "context"
+
+ "github.com/chromedp/cdproto/cdp"
+)
+
+// EnableParams enable events in this domain.
+type EnableParams struct{}
+
+// Enable enable events in this domain.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/DeviceAccess#method-enable
+func Enable() *EnableParams {
+ return &EnableParams{}
+}
+
+// Do executes DeviceAccess.enable against the provided context.
+func (p *EnableParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandEnable, nil, nil)
+}
+
+// DisableParams disable events in this domain.
+type DisableParams struct{}
+
+// Disable disable events in this domain.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/DeviceAccess#method-disable
+func Disable() *DisableParams {
+ return &DisableParams{}
+}
+
+// Do executes DeviceAccess.disable against the provided context.
+func (p *DisableParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandDisable, nil, nil)
+}
+
+// SelectPromptParams select a device in response to a
+// DeviceAccess.deviceRequestPrompted event.
+type SelectPromptParams struct {
+ ID RequestID `json:"id"`
+ DeviceID DeviceID `json:"deviceId"`
+}
+
+// SelectPrompt select a device in response to a
+// DeviceAccess.deviceRequestPrompted event.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/DeviceAccess#method-selectPrompt
+//
+// parameters:
+//
+// id
+// deviceID
+func SelectPrompt(id RequestID, deviceID DeviceID) *SelectPromptParams {
+ return &SelectPromptParams{
+ ID: id,
+ DeviceID: deviceID,
+ }
+}
+
+// Do executes DeviceAccess.selectPrompt against the provided context.
+func (p *SelectPromptParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandSelectPrompt, p, nil)
+}
+
+// CancelPromptParams cancel a prompt in response to a
+// DeviceAccess.deviceRequestPrompted event.
+type CancelPromptParams struct {
+ ID RequestID `json:"id"`
+}
+
+// CancelPrompt cancel a prompt in response to a
+// DeviceAccess.deviceRequestPrompted event.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/DeviceAccess#method-cancelPrompt
+//
+// parameters:
+//
+// id
+func CancelPrompt(id RequestID) *CancelPromptParams {
+ return &CancelPromptParams{
+ ID: id,
+ }
+}
+
+// Do executes DeviceAccess.cancelPrompt against the provided context.
+func (p *CancelPromptParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandCancelPrompt, p, nil)
+}
+
+// Command names.
+const (
+ CommandEnable = "DeviceAccess.enable"
+ CommandDisable = "DeviceAccess.disable"
+ CommandSelectPrompt = "DeviceAccess.selectPrompt"
+ CommandCancelPrompt = "DeviceAccess.cancelPrompt"
+)
diff --git a/deviceaccess/easyjson.go b/deviceaccess/easyjson.go
new file mode 100644
index 0000000..05cf9f6
--- /dev/null
+++ b/deviceaccess/easyjson.go
@@ -0,0 +1,466 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package deviceaccess
+
+import (
+ json "encoding/json"
+ easyjson "github.com/mailru/easyjson"
+ jlexer "github.com/mailru/easyjson/jlexer"
+ jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+ _ *json.RawMessage
+ _ *jlexer.Lexer
+ _ *jwriter.Writer
+ _ easyjson.Marshaler
+)
+
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess(in *jlexer.Lexer, out *SelectPromptParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "id":
+ out.ID = RequestID(in.String())
+ case "deviceId":
+ out.DeviceID = DeviceID(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess(out *jwriter.Writer, in SelectPromptParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"id\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.ID))
+ }
+ {
+ const prefix string = ",\"deviceId\":"
+ out.RawString(prefix)
+ out.String(string(in.DeviceID))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v SelectPromptParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v SelectPromptParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *SelectPromptParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *SelectPromptParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess1(in *jlexer.Lexer, out *PromptDevice) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "id":
+ out.ID = DeviceID(in.String())
+ case "name":
+ out.Name = string(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess1(out *jwriter.Writer, in PromptDevice) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"id\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.ID))
+ }
+ {
+ const prefix string = ",\"name\":"
+ out.RawString(prefix)
+ out.String(string(in.Name))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v PromptDevice) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess1(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v PromptDevice) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess1(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *PromptDevice) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess1(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *PromptDevice) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess1(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess2(in *jlexer.Lexer, out *EventDeviceRequestPrompted) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "id":
+ out.ID = RequestID(in.String())
+ case "devices":
+ if in.IsNull() {
+ in.Skip()
+ out.Devices = nil
+ } else {
+ in.Delim('[')
+ if out.Devices == nil {
+ if !in.IsDelim(']') {
+ out.Devices = make([]*PromptDevice, 0, 8)
+ } else {
+ out.Devices = []*PromptDevice{}
+ }
+ } else {
+ out.Devices = (out.Devices)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v1 *PromptDevice
+ if in.IsNull() {
+ in.Skip()
+ v1 = nil
+ } else {
+ if v1 == nil {
+ v1 = new(PromptDevice)
+ }
+ (*v1).UnmarshalEasyJSON(in)
+ }
+ out.Devices = append(out.Devices, v1)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess2(out *jwriter.Writer, in EventDeviceRequestPrompted) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"id\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.ID))
+ }
+ {
+ const prefix string = ",\"devices\":"
+ out.RawString(prefix)
+ if in.Devices == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v2, v3 := range in.Devices {
+ if v2 > 0 {
+ out.RawByte(',')
+ }
+ if v3 == nil {
+ out.RawString("null")
+ } else {
+ (*v3).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v EventDeviceRequestPrompted) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess2(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v EventDeviceRequestPrompted) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess2(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *EventDeviceRequestPrompted) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess2(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *EventDeviceRequestPrompted) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess2(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess3(in *jlexer.Lexer, out *EnableParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess3(out *jwriter.Writer, in EnableParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v EnableParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess3(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v EnableParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess3(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *EnableParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess3(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *EnableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess3(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess4(in *jlexer.Lexer, out *DisableParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess4(out *jwriter.Writer, in DisableParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v DisableParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess4(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v DisableParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess4(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *DisableParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess4(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *DisableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess4(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess5(in *jlexer.Lexer, out *CancelPromptParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "id":
+ out.ID = RequestID(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess5(out *jwriter.Writer, in CancelPromptParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"id\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.ID))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v CancelPromptParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess5(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v CancelPromptParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoDeviceaccess5(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *CancelPromptParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess5(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *CancelPromptParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoDeviceaccess5(l, v)
+}
diff --git a/deviceaccess/events.go b/deviceaccess/events.go
new file mode 100644
index 0000000..53e0a0e
--- /dev/null
+++ b/deviceaccess/events.go
@@ -0,0 +1,12 @@
+package deviceaccess
+
+// Code generated by cdproto-gen. DO NOT EDIT.
+
+// EventDeviceRequestPrompted a device request opened a user prompt to select
+// a device. Respond with the selectPrompt or cancelPrompt command.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/DeviceAccess#event-deviceRequestPrompted
+type EventDeviceRequestPrompted struct {
+ ID RequestID `json:"id"`
+ Devices []*PromptDevice `json:"devices"`
+}
diff --git a/deviceaccess/types.go b/deviceaccess/types.go
new file mode 100644
index 0000000..ea8baa1
--- /dev/null
+++ b/deviceaccess/types.go
@@ -0,0 +1,32 @@
+package deviceaccess
+
+// Code generated by cdproto-gen. DO NOT EDIT.
+
+// RequestID device request id.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/DeviceAccess#type-RequestId
+type RequestID string
+
+// String returns the RequestID as string value.
+func (t RequestID) String() string {
+ return string(t)
+}
+
+// DeviceID a device id.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/DeviceAccess#type-DeviceId
+type DeviceID string
+
+// String returns the DeviceID as string value.
+func (t DeviceID) String() string {
+ return string(t)
+}
+
+// PromptDevice device information displayed in a user prompt to select a
+// device.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/DeviceAccess#type-PromptDevice
+type PromptDevice struct {
+ ID DeviceID `json:"id"`
+ Name string `json:"name"` // Display name as it appears in a device request user prompt.
+}
diff --git a/dom/dom.go b/dom/dom.go
index fc56adf..ede07fa 100644
--- a/dom/dom.go
+++ b/dom/dom.go
@@ -8,9 +8,7 @@
// nodes that are known to the client. Backend keeps track of the nodes that
// were sent to the client and never sends the same node twice. It is client's
// responsibility to collect information about the nodes that were sent to the
-// client.
-//
-// Note that iframe owner elements will return corresponding document
+// client. Note that iframe owner elements will return corresponding document
// elements as their child nodes.
//
// Generated by the cdproto-gen command.
@@ -501,14 +499,15 @@ func (p *GetContentQuadsParams) Do(ctx context.Context) (quads []Quad, err error
}
// GetDocumentParams returns the root DOM node (and optionally the subtree)
-// to the caller.
+// to the caller. Implicitly enables the DOM domain events for the current
+// target.
type GetDocumentParams struct {
Depth int64 `json:"depth,omitempty"` // The maximum depth at which children should be retrieved, defaults to 1. Use -1 for the entire subtree or provide an integer larger than 0.
Pierce bool `json:"pierce,omitempty"` // Whether or not iframes and shadow roots should be traversed when returning the subtree (default is false).
}
// GetDocument returns the root DOM node (and optionally the subtree) to the
-// caller.
+// caller. Implicitly enables the DOM domain events for the current target.
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/DOM#method-getDocument
//
diff --git a/emulation/emulation.go b/emulation/emulation.go
index 35c3a67..352e162 100644
--- a/emulation/emulation.go
+++ b/emulation/emulation.go
@@ -423,7 +423,7 @@ func (p *SetEmulatedMediaParams) Do(ctx context.Context) (err error) {
// SetEmulatedVisionDeficiencyParams emulates the given vision deficiency.
type SetEmulatedVisionDeficiencyParams struct {
- Type SetEmulatedVisionDeficiencyType `json:"type"` // Vision deficiency to emulate.
+ Type SetEmulatedVisionDeficiencyType `json:"type"` // Vision deficiency to emulate. Order: best-effort emulations come first, followed by any physiologically accurate emulations for medically recognized color vision deficiencies.
}
// SetEmulatedVisionDeficiency emulates the given vision deficiency.
@@ -432,7 +432,7 @@ type SetEmulatedVisionDeficiencyParams struct {
//
// parameters:
//
-// type - Vision deficiency to emulate.
+// type - Vision deficiency to emulate. Order: best-effort emulations come first, followed by any physiologically accurate emulations for medically recognized color vision deficiencies.
func SetEmulatedVisionDeficiency(typeVal SetEmulatedVisionDeficiencyType) *SetEmulatedVisionDeficiencyParams {
return &SetEmulatedVisionDeficiencyParams{
Type: typeVal,
diff --git a/emulation/types.go b/emulation/types.go
index ea9e333..d6dc43e 100644
--- a/emulation/types.go
+++ b/emulation/types.go
@@ -102,8 +102,8 @@ type UserAgentBrandVersion struct {
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Emulation#type-UserAgentMetadata
type UserAgentMetadata struct {
- Brands []*UserAgentBrandVersion `json:"brands,omitempty"`
- FullVersionList []*UserAgentBrandVersion `json:"fullVersionList,omitempty"`
+ Brands []*UserAgentBrandVersion `json:"brands,omitempty"` // Brands appearing in Sec-CH-UA.
+ FullVersionList []*UserAgentBrandVersion `json:"fullVersionList,omitempty"` // Brands appearing in Sec-CH-UA-Full-Version-List.
Platform string `json:"platform"`
PlatformVersion string `json:"platformVersion"`
Architecture string `json:"architecture"`
@@ -301,7 +301,9 @@ func (t *SetEmitTouchEventsForMouseConfiguration) UnmarshalJSON(buf []byte) erro
return easyjson.Unmarshal(buf, t)
}
-// SetEmulatedVisionDeficiencyType vision deficiency to emulate.
+// SetEmulatedVisionDeficiencyType vision deficiency to emulate. Order:
+// best-effort emulations come first, followed by any physiologically accurate
+// emulations for medically recognized color vision deficiencies.
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Emulation#method-setEmulatedVisionDeficiency
type SetEmulatedVisionDeficiencyType string
@@ -313,12 +315,13 @@ func (t SetEmulatedVisionDeficiencyType) String() string {
// SetEmulatedVisionDeficiencyType values.
const (
- SetEmulatedVisionDeficiencyTypeNone SetEmulatedVisionDeficiencyType = "none"
- SetEmulatedVisionDeficiencyTypeAchromatopsia SetEmulatedVisionDeficiencyType = "achromatopsia"
- SetEmulatedVisionDeficiencyTypeBlurredVision SetEmulatedVisionDeficiencyType = "blurredVision"
- SetEmulatedVisionDeficiencyTypeDeuteranopia SetEmulatedVisionDeficiencyType = "deuteranopia"
- SetEmulatedVisionDeficiencyTypeProtanopia SetEmulatedVisionDeficiencyType = "protanopia"
- SetEmulatedVisionDeficiencyTypeTritanopia SetEmulatedVisionDeficiencyType = "tritanopia"
+ SetEmulatedVisionDeficiencyTypeNone SetEmulatedVisionDeficiencyType = "none"
+ SetEmulatedVisionDeficiencyTypeBlurredVision SetEmulatedVisionDeficiencyType = "blurredVision"
+ SetEmulatedVisionDeficiencyTypeReducedContrast SetEmulatedVisionDeficiencyType = "reducedContrast"
+ SetEmulatedVisionDeficiencyTypeAchromatopsia SetEmulatedVisionDeficiencyType = "achromatopsia"
+ SetEmulatedVisionDeficiencyTypeDeuteranopia SetEmulatedVisionDeficiencyType = "deuteranopia"
+ SetEmulatedVisionDeficiencyTypeProtanopia SetEmulatedVisionDeficiencyType = "protanopia"
+ SetEmulatedVisionDeficiencyTypeTritanopia SetEmulatedVisionDeficiencyType = "tritanopia"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
@@ -337,10 +340,12 @@ func (t *SetEmulatedVisionDeficiencyType) UnmarshalEasyJSON(in *jlexer.Lexer) {
switch SetEmulatedVisionDeficiencyType(v) {
case SetEmulatedVisionDeficiencyTypeNone:
*t = SetEmulatedVisionDeficiencyTypeNone
- case SetEmulatedVisionDeficiencyTypeAchromatopsia:
- *t = SetEmulatedVisionDeficiencyTypeAchromatopsia
case SetEmulatedVisionDeficiencyTypeBlurredVision:
*t = SetEmulatedVisionDeficiencyTypeBlurredVision
+ case SetEmulatedVisionDeficiencyTypeReducedContrast:
+ *t = SetEmulatedVisionDeficiencyTypeReducedContrast
+ case SetEmulatedVisionDeficiencyTypeAchromatopsia:
+ *t = SetEmulatedVisionDeficiencyTypeAchromatopsia
case SetEmulatedVisionDeficiencyTypeDeuteranopia:
*t = SetEmulatedVisionDeficiencyTypeDeuteranopia
case SetEmulatedVisionDeficiencyTypeProtanopia:
diff --git a/fedcm/easyjson.go b/fedcm/easyjson.go
new file mode 100644
index 0000000..674ed74
--- /dev/null
+++ b/fedcm/easyjson.go
@@ -0,0 +1,617 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package fedcm
+
+import (
+ json "encoding/json"
+ easyjson "github.com/mailru/easyjson"
+ jlexer "github.com/mailru/easyjson/jlexer"
+ jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+ _ *json.RawMessage
+ _ *jlexer.Lexer
+ _ *jwriter.Writer
+ _ easyjson.Marshaler
+)
+
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm(in *jlexer.Lexer, out *SelectAccountParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "dialogId":
+ out.DialogID = string(in.String())
+ case "accountIndex":
+ out.AccountIndex = int64(in.Int64())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm(out *jwriter.Writer, in SelectAccountParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"dialogId\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.DialogID))
+ }
+ {
+ const prefix string = ",\"accountIndex\":"
+ out.RawString(prefix)
+ out.Int64(int64(in.AccountIndex))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v SelectAccountParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v SelectAccountParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *SelectAccountParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *SelectAccountParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm1(in *jlexer.Lexer, out *ResetCooldownParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm1(out *jwriter.Writer, in ResetCooldownParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v ResetCooldownParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm1(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v ResetCooldownParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm1(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *ResetCooldownParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm1(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *ResetCooldownParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm1(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm2(in *jlexer.Lexer, out *EventDialogShown) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "dialogId":
+ out.DialogID = string(in.String())
+ case "dialogType":
+ (out.DialogType).UnmarshalEasyJSON(in)
+ case "accounts":
+ if in.IsNull() {
+ in.Skip()
+ out.Accounts = nil
+ } else {
+ in.Delim('[')
+ if out.Accounts == nil {
+ if !in.IsDelim(']') {
+ out.Accounts = make([]*Account, 0, 8)
+ } else {
+ out.Accounts = []*Account{}
+ }
+ } else {
+ out.Accounts = (out.Accounts)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v1 *Account
+ if in.IsNull() {
+ in.Skip()
+ v1 = nil
+ } else {
+ if v1 == nil {
+ v1 = new(Account)
+ }
+ (*v1).UnmarshalEasyJSON(in)
+ }
+ out.Accounts = append(out.Accounts, v1)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ case "title":
+ out.Title = string(in.String())
+ case "subtitle":
+ out.Subtitle = string(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm2(out *jwriter.Writer, in EventDialogShown) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"dialogId\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.DialogID))
+ }
+ {
+ const prefix string = ",\"dialogType\":"
+ out.RawString(prefix)
+ (in.DialogType).MarshalEasyJSON(out)
+ }
+ {
+ const prefix string = ",\"accounts\":"
+ out.RawString(prefix)
+ if in.Accounts == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v2, v3 := range in.Accounts {
+ if v2 > 0 {
+ out.RawByte(',')
+ }
+ if v3 == nil {
+ out.RawString("null")
+ } else {
+ (*v3).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ {
+ const prefix string = ",\"title\":"
+ out.RawString(prefix)
+ out.String(string(in.Title))
+ }
+ if in.Subtitle != "" {
+ const prefix string = ",\"subtitle\":"
+ out.RawString(prefix)
+ out.String(string(in.Subtitle))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v EventDialogShown) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm2(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v EventDialogShown) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm2(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *EventDialogShown) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm2(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *EventDialogShown) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm2(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm3(in *jlexer.Lexer, out *EnableParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "disableRejectionDelay":
+ out.DisableRejectionDelay = bool(in.Bool())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm3(out *jwriter.Writer, in EnableParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ if in.DisableRejectionDelay {
+ const prefix string = ",\"disableRejectionDelay\":"
+ first = false
+ out.RawString(prefix[1:])
+ out.Bool(bool(in.DisableRejectionDelay))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v EnableParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm3(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v EnableParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm3(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *EnableParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm3(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *EnableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm3(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm4(in *jlexer.Lexer, out *DismissDialogParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "dialogId":
+ out.DialogID = string(in.String())
+ case "triggerCooldown":
+ out.TriggerCooldown = bool(in.Bool())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm4(out *jwriter.Writer, in DismissDialogParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"dialogId\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.DialogID))
+ }
+ if in.TriggerCooldown {
+ const prefix string = ",\"triggerCooldown\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.TriggerCooldown))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v DismissDialogParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm4(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v DismissDialogParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm4(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *DismissDialogParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm4(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *DismissDialogParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm4(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm5(in *jlexer.Lexer, out *DisableParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm5(out *jwriter.Writer, in DisableParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v DisableParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm5(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v DisableParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm5(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *DisableParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm5(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *DisableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm5(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm6(in *jlexer.Lexer, out *Account) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "accountId":
+ out.AccountID = string(in.String())
+ case "email":
+ out.Email = string(in.String())
+ case "name":
+ out.Name = string(in.String())
+ case "givenName":
+ out.GivenName = string(in.String())
+ case "pictureUrl":
+ out.PictureURL = string(in.String())
+ case "idpConfigUrl":
+ out.IdpConfigURL = string(in.String())
+ case "idpSigninUrl":
+ out.IdpSigninURL = string(in.String())
+ case "loginState":
+ (out.LoginState).UnmarshalEasyJSON(in)
+ case "termsOfServiceUrl":
+ out.TermsOfServiceURL = string(in.String())
+ case "privacyPolicyUrl":
+ out.PrivacyPolicyURL = string(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm6(out *jwriter.Writer, in Account) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"accountId\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.AccountID))
+ }
+ {
+ const prefix string = ",\"email\":"
+ out.RawString(prefix)
+ out.String(string(in.Email))
+ }
+ {
+ const prefix string = ",\"name\":"
+ out.RawString(prefix)
+ out.String(string(in.Name))
+ }
+ {
+ const prefix string = ",\"givenName\":"
+ out.RawString(prefix)
+ out.String(string(in.GivenName))
+ }
+ {
+ const prefix string = ",\"pictureUrl\":"
+ out.RawString(prefix)
+ out.String(string(in.PictureURL))
+ }
+ {
+ const prefix string = ",\"idpConfigUrl\":"
+ out.RawString(prefix)
+ out.String(string(in.IdpConfigURL))
+ }
+ {
+ const prefix string = ",\"idpSigninUrl\":"
+ out.RawString(prefix)
+ out.String(string(in.IdpSigninURL))
+ }
+ {
+ const prefix string = ",\"loginState\":"
+ out.RawString(prefix)
+ (in.LoginState).MarshalEasyJSON(out)
+ }
+ if in.TermsOfServiceURL != "" {
+ const prefix string = ",\"termsOfServiceUrl\":"
+ out.RawString(prefix)
+ out.String(string(in.TermsOfServiceURL))
+ }
+ if in.PrivacyPolicyURL != "" {
+ const prefix string = ",\"privacyPolicyUrl\":"
+ out.RawString(prefix)
+ out.String(string(in.PrivacyPolicyURL))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v Account) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm6(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v Account) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoFedcm6(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *Account) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm6(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *Account) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoFedcm6(l, v)
+}
diff --git a/fedcm/events.go b/fedcm/events.go
new file mode 100644
index 0000000..61f94aa
--- /dev/null
+++ b/fedcm/events.go
@@ -0,0 +1,14 @@
+package fedcm
+
+// Code generated by cdproto-gen. DO NOT EDIT.
+
+// EventDialogShown [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/FedCm#event-dialogShown
+type EventDialogShown struct {
+ DialogID string `json:"dialogId"`
+ DialogType DialogType `json:"dialogType"`
+ Accounts []*Account `json:"accounts"`
+ Title string `json:"title"` // These exist primarily so that the caller can verify the RP context was used appropriately.
+ Subtitle string `json:"subtitle,omitempty"`
+}
diff --git a/fedcm/fedcm.go b/fedcm/fedcm.go
new file mode 100644
index 0000000..1a402de
--- /dev/null
+++ b/fedcm/fedcm.go
@@ -0,0 +1,139 @@
+// Package fedcm provides the Chrome DevTools Protocol
+// commands, types, and events for the FedCm domain.
+//
+// This domain allows interacting with the FedCM dialog.
+//
+// Generated by the cdproto-gen command.
+package fedcm
+
+// Code generated by cdproto-gen. DO NOT EDIT.
+
+import (
+ "context"
+
+ "github.com/chromedp/cdproto/cdp"
+)
+
+// EnableParams [no description].
+type EnableParams struct {
+ DisableRejectionDelay bool `json:"disableRejectionDelay,omitempty"` // Allows callers to disable the promise rejection delay that would normally happen, if this is unimportant to what's being tested. (step 4 of https://fedidcg.github.io/FedCM/#browser-api-rp-sign-in)
+}
+
+// Enable [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/FedCm#method-enable
+//
+// parameters:
+func Enable() *EnableParams {
+ return &EnableParams{}
+}
+
+// WithDisableRejectionDelay allows callers to disable the promise rejection
+// delay that would normally happen, if this is unimportant to what's being
+// tested. (step 4 of https://fedidcg.github.io/FedCM/#browser-api-rp-sign-in).
+func (p EnableParams) WithDisableRejectionDelay(disableRejectionDelay bool) *EnableParams {
+ p.DisableRejectionDelay = disableRejectionDelay
+ return &p
+}
+
+// Do executes FedCm.enable against the provided context.
+func (p *EnableParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandEnable, p, nil)
+}
+
+// DisableParams [no description].
+type DisableParams struct{}
+
+// Disable [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/FedCm#method-disable
+func Disable() *DisableParams {
+ return &DisableParams{}
+}
+
+// Do executes FedCm.disable against the provided context.
+func (p *DisableParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandDisable, nil, nil)
+}
+
+// SelectAccountParams [no description].
+type SelectAccountParams struct {
+ DialogID string `json:"dialogId"`
+ AccountIndex int64 `json:"accountIndex"`
+}
+
+// SelectAccount [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/FedCm#method-selectAccount
+//
+// parameters:
+//
+// dialogID
+// accountIndex
+func SelectAccount(dialogID string, accountIndex int64) *SelectAccountParams {
+ return &SelectAccountParams{
+ DialogID: dialogID,
+ AccountIndex: accountIndex,
+ }
+}
+
+// Do executes FedCm.selectAccount against the provided context.
+func (p *SelectAccountParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandSelectAccount, p, nil)
+}
+
+// DismissDialogParams [no description].
+type DismissDialogParams struct {
+ DialogID string `json:"dialogId"`
+ TriggerCooldown bool `json:"triggerCooldown,omitempty"`
+}
+
+// DismissDialog [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/FedCm#method-dismissDialog
+//
+// parameters:
+//
+// dialogID
+func DismissDialog(dialogID string) *DismissDialogParams {
+ return &DismissDialogParams{
+ DialogID: dialogID,
+ }
+}
+
+// WithTriggerCooldown [no description].
+func (p DismissDialogParams) WithTriggerCooldown(triggerCooldown bool) *DismissDialogParams {
+ p.TriggerCooldown = triggerCooldown
+ return &p
+}
+
+// Do executes FedCm.dismissDialog against the provided context.
+func (p *DismissDialogParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandDismissDialog, p, nil)
+}
+
+// ResetCooldownParams resets the cooldown time, if any, to allow the next
+// FedCM call to show a dialog even if one was recently dismissed by the user.
+type ResetCooldownParams struct{}
+
+// ResetCooldown resets the cooldown time, if any, to allow the next FedCM
+// call to show a dialog even if one was recently dismissed by the user.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/FedCm#method-resetCooldown
+func ResetCooldown() *ResetCooldownParams {
+ return &ResetCooldownParams{}
+}
+
+// Do executes FedCm.resetCooldown against the provided context.
+func (p *ResetCooldownParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandResetCooldown, nil, nil)
+}
+
+// Command names.
+const (
+ CommandEnable = "FedCm.enable"
+ CommandDisable = "FedCm.disable"
+ CommandSelectAccount = "FedCm.selectAccount"
+ CommandDismissDialog = "FedCm.dismissDialog"
+ CommandResetCooldown = "FedCm.resetCooldown"
+)
diff --git a/fedcm/types.go b/fedcm/types.go
new file mode 100644
index 0000000..04aaa0a
--- /dev/null
+++ b/fedcm/types.go
@@ -0,0 +1,122 @@
+package fedcm
+
+// Code generated by cdproto-gen. DO NOT EDIT.
+
+import (
+ "fmt"
+
+ "github.com/mailru/easyjson"
+ "github.com/mailru/easyjson/jlexer"
+ "github.com/mailru/easyjson/jwriter"
+)
+
+// LoginState whether this is a sign-up or sign-in action for this account,
+// i.e. whether this account has ever been used to sign in to this RP before.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/FedCm#type-LoginState
+type LoginState string
+
+// String returns the LoginState as string value.
+func (t LoginState) String() string {
+ return string(t)
+}
+
+// LoginState values.
+const (
+ LoginStateSignIn LoginState = "SignIn"
+ LoginStateSignUp LoginState = "SignUp"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t LoginState) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t LoginState) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *LoginState) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch LoginState(v) {
+ case LoginStateSignIn:
+ *t = LoginStateSignIn
+ case LoginStateSignUp:
+ *t = LoginStateSignUp
+
+ default:
+ in.AddError(fmt.Errorf("unknown LoginState value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *LoginState) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
+// DialogType whether the dialog shown is an account chooser or an auto
+// re-authentication dialog.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/FedCm#type-DialogType
+type DialogType string
+
+// String returns the DialogType as string value.
+func (t DialogType) String() string {
+ return string(t)
+}
+
+// DialogType values.
+const (
+ DialogTypeAccountChooser DialogType = "AccountChooser"
+ DialogTypeAutoReauthn DialogType = "AutoReauthn"
+ DialogTypeConfirmIdpSignin DialogType = "ConfirmIdpSignin"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t DialogType) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t DialogType) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *DialogType) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch DialogType(v) {
+ case DialogTypeAccountChooser:
+ *t = DialogTypeAccountChooser
+ case DialogTypeAutoReauthn:
+ *t = DialogTypeAutoReauthn
+ case DialogTypeConfirmIdpSignin:
+ *t = DialogTypeConfirmIdpSignin
+
+ default:
+ in.AddError(fmt.Errorf("unknown DialogType value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *DialogType) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
+// Account corresponds to IdentityRequestAccount.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/FedCm#type-Account
+type Account struct {
+ AccountID string `json:"accountId"`
+ Email string `json:"email"`
+ Name string `json:"name"`
+ GivenName string `json:"givenName"`
+ PictureURL string `json:"pictureUrl"`
+ IdpConfigURL string `json:"idpConfigUrl"`
+ IdpSigninURL string `json:"idpSigninUrl"`
+ LoginState LoginState `json:"loginState"`
+ TermsOfServiceURL string `json:"termsOfServiceUrl,omitempty"` // These two are only set if the loginState is signUp
+ PrivacyPolicyURL string `json:"privacyPolicyUrl,omitempty"`
+}
diff --git a/fetch/events.go b/fetch/events.go
index 1b16fd4..f940b94 100644
--- a/fetch/events.go
+++ b/fetch/events.go
@@ -12,7 +12,12 @@ import (
// with one of continueRequest, failRequest or fulfillRequest. The stage of the
// request can be determined by presence of responseErrorReason and
// responseStatusCode -- the request is at the response stage if either of these
-// fields is present and in the request stage otherwise.
+// fields is present and in the request stage otherwise. Redirect responses and
+// subsequent requests are reported similarly to regular responses and requests.
+// Redirect responses may be distinguished by the value of responseStatusCode
+// (which is one of 301, 302, 303, 307, 308) along with presence of the location
+// header. Requests resulting from a redirect will have redirectedRequestId
+// field set.
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Fetch#event-requestPaused
type EventRequestPaused struct {
diff --git a/fetch/fetch.go b/fetch/fetch.go
index dac13ee..87e4b79 100644
--- a/fetch/fetch.go
+++ b/fetch/fetch.go
@@ -316,7 +316,10 @@ func (p *ContinueResponseParams) Do(ctx context.Context) (err error) {
// that is paused in the Response stage and is mutually exclusive with
// takeResponseBodyForInterceptionAsStream. Calling other methods that affect
// the request or disabling fetch domain before body is received results in an
-// undefined behavior.
+// undefined behavior. Note that the response body is not available for
+// redirects. Requests paused in the _redirect received_ state may be
+// differentiated by responseCode and presence of location response header, see
+// comments to requestPaused for details.
type GetResponseBodyParams struct {
RequestID RequestID `json:"requestId"` // Identifier for the intercepted request to get body for.
}
@@ -326,7 +329,10 @@ type GetResponseBodyParams struct {
// is paused in the Response stage and is mutually exclusive with
// takeResponseBodyForInterceptionAsStream. Calling other methods that affect
// the request or disabling fetch domain before body is received results in an
-// undefined behavior.
+// undefined behavior. Note that the response body is not available for
+// redirects. Requests paused in the _redirect received_ state may be
+// differentiated by responseCode and presence of location response header, see
+// comments to requestPaused for details.
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Fetch#method-getResponseBody
//
diff --git a/headlessexperimental/types.go b/headlessexperimental/types.go
index 3b680d0..85193c4 100644
--- a/headlessexperimental/types.go
+++ b/headlessexperimental/types.go
@@ -15,7 +15,7 @@ import (
// See: https://chromedevtools.github.io/devtools-protocol/tot/HeadlessExperimental#type-ScreenshotParams
type ScreenshotParams struct {
Format ScreenshotParamsFormat `json:"format,omitempty"` // Image compression format (defaults to png).
- Quality int64 `json:"quality,omitempty"` // Compression quality from range [0..100] (jpeg only).
+ Quality int64 `json:"quality,omitempty"` // Compression quality from range [0..100] (jpeg and webp only).
OptimizeForSpeed bool `json:"optimizeForSpeed,omitempty"` // Optimize image encoding for speed, not for resulting size (defaults to false)
}
diff --git a/indexeddb/easyjson.go b/indexeddb/easyjson.go
index 5c2a68c..08ec00a 100644
--- a/indexeddb/easyjson.go
+++ b/indexeddb/easyjson.go
@@ -5,6 +5,7 @@ package indexeddb
import (
json "encoding/json"
runtime "github.com/chromedp/cdproto/runtime"
+ storage "github.com/chromedp/cdproto/storage"
easyjson "github.com/mailru/easyjson"
jlexer "github.com/mailru/easyjson/jlexer"
jwriter "github.com/mailru/easyjson/jwriter"
@@ -116,6 +117,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoIndexeddb1(in *jlexer.Lexer,
out.SecurityOrigin = string(in.String())
case "storageKey":
out.StorageKey = string(in.String())
+ case "storageBucket":
+ if in.IsNull() {
+ in.Skip()
+ out.StorageBucket = nil
+ } else {
+ if out.StorageBucket == nil {
+ out.StorageBucket = new(storage.Bucket)
+ }
+ (*out.StorageBucket).UnmarshalEasyJSON(in)
+ }
case "databaseName":
out.DatabaseName = string(in.String())
default:
@@ -148,6 +159,16 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoIndexeddb1(out *jwriter.Write
}
out.String(string(in.StorageKey))
}
+ if in.StorageBucket != nil {
+ const prefix string = ",\"storageBucket\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (*in.StorageBucket).MarshalEasyJSON(out)
+ }
{
const prefix string = ",\"databaseName\":"
if first {
@@ -304,6 +325,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoIndexeddb3(in *jlexer.Lexer,
out.SecurityOrigin = string(in.String())
case "storageKey":
out.StorageKey = string(in.String())
+ case "storageBucket":
+ if in.IsNull() {
+ in.Skip()
+ out.StorageBucket = nil
+ } else {
+ if out.StorageBucket == nil {
+ out.StorageBucket = new(storage.Bucket)
+ }
+ (*out.StorageBucket).UnmarshalEasyJSON(in)
+ }
default:
in.SkipRecursive()
}
@@ -334,6 +365,16 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoIndexeddb3(out *jwriter.Write
}
out.String(string(in.StorageKey))
}
+ if in.StorageBucket != nil {
+ const prefix string = ",\"storageBucket\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (*in.StorageBucket).MarshalEasyJSON(out)
+ }
out.RawByte('}')
}
@@ -504,6 +545,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoIndexeddb5(in *jlexer.Lexer,
out.SecurityOrigin = string(in.String())
case "storageKey":
out.StorageKey = string(in.String())
+ case "storageBucket":
+ if in.IsNull() {
+ in.Skip()
+ out.StorageBucket = nil
+ } else {
+ if out.StorageBucket == nil {
+ out.StorageBucket = new(storage.Bucket)
+ }
+ (*out.StorageBucket).UnmarshalEasyJSON(in)
+ }
case "databaseName":
out.DatabaseName = string(in.String())
case "objectStoreName":
@@ -554,6 +605,16 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoIndexeddb5(out *jwriter.Write
}
out.String(string(in.StorageKey))
}
+ if in.StorageBucket != nil {
+ const prefix string = ",\"storageBucket\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (*in.StorageBucket).MarshalEasyJSON(out)
+ }
{
const prefix string = ",\"databaseName\":"
if first {
@@ -1319,6 +1380,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoIndexeddb12(in *jlexer.Lexer,
out.SecurityOrigin = string(in.String())
case "storageKey":
out.StorageKey = string(in.String())
+ case "storageBucket":
+ if in.IsNull() {
+ in.Skip()
+ out.StorageBucket = nil
+ } else {
+ if out.StorageBucket == nil {
+ out.StorageBucket = new(storage.Bucket)
+ }
+ (*out.StorageBucket).UnmarshalEasyJSON(in)
+ }
case "databaseName":
out.DatabaseName = string(in.String())
case "objectStoreName":
@@ -1353,6 +1424,16 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoIndexeddb12(out *jwriter.Writ
}
out.String(string(in.StorageKey))
}
+ if in.StorageBucket != nil {
+ const prefix string = ",\"storageBucket\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (*in.StorageBucket).MarshalEasyJSON(out)
+ }
{
const prefix string = ",\"databaseName\":"
if first {
@@ -1535,6 +1616,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoIndexeddb15(in *jlexer.Lexer,
out.SecurityOrigin = string(in.String())
case "storageKey":
out.StorageKey = string(in.String())
+ case "storageBucket":
+ if in.IsNull() {
+ in.Skip()
+ out.StorageBucket = nil
+ } else {
+ if out.StorageBucket == nil {
+ out.StorageBucket = new(storage.Bucket)
+ }
+ (*out.StorageBucket).UnmarshalEasyJSON(in)
+ }
case "databaseName":
out.DatabaseName = string(in.String())
case "objectStoreName":
@@ -1579,6 +1670,16 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoIndexeddb15(out *jwriter.Writ
}
out.String(string(in.StorageKey))
}
+ if in.StorageBucket != nil {
+ const prefix string = ",\"storageBucket\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (*in.StorageBucket).MarshalEasyJSON(out)
+ }
{
const prefix string = ",\"databaseName\":"
if first {
@@ -1652,6 +1753,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoIndexeddb16(in *jlexer.Lexer,
out.SecurityOrigin = string(in.String())
case "storageKey":
out.StorageKey = string(in.String())
+ case "storageBucket":
+ if in.IsNull() {
+ in.Skip()
+ out.StorageBucket = nil
+ } else {
+ if out.StorageBucket == nil {
+ out.StorageBucket = new(storage.Bucket)
+ }
+ (*out.StorageBucket).UnmarshalEasyJSON(in)
+ }
case "databaseName":
out.DatabaseName = string(in.String())
default:
@@ -1684,6 +1795,16 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoIndexeddb16(out *jwriter.Writ
}
out.String(string(in.StorageKey))
}
+ if in.StorageBucket != nil {
+ const prefix string = ",\"storageBucket\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (*in.StorageBucket).MarshalEasyJSON(out)
+ }
{
const prefix string = ",\"databaseName\":"
if first {
@@ -1983,6 +2104,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoIndexeddb19(in *jlexer.Lexer,
out.SecurityOrigin = string(in.String())
case "storageKey":
out.StorageKey = string(in.String())
+ case "storageBucket":
+ if in.IsNull() {
+ in.Skip()
+ out.StorageBucket = nil
+ } else {
+ if out.StorageBucket == nil {
+ out.StorageBucket = new(storage.Bucket)
+ }
+ (*out.StorageBucket).UnmarshalEasyJSON(in)
+ }
case "databaseName":
out.DatabaseName = string(in.String())
case "objectStoreName":
@@ -2017,6 +2148,16 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoIndexeddb19(out *jwriter.Writ
}
out.String(string(in.StorageKey))
}
+ if in.StorageBucket != nil {
+ const prefix string = ",\"storageBucket\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ (*in.StorageBucket).MarshalEasyJSON(out)
+ }
{
const prefix string = ",\"databaseName\":"
if first {
diff --git a/indexeddb/indexeddb.go b/indexeddb/indexeddb.go
index de70f76..0de909f 100644
--- a/indexeddb/indexeddb.go
+++ b/indexeddb/indexeddb.go
@@ -10,14 +10,16 @@ import (
"context"
"github.com/chromedp/cdproto/cdp"
+ "github.com/chromedp/cdproto/storage"
)
// ClearObjectStoreParams clears all entries from an object store.
type ClearObjectStoreParams struct {
- SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey must be specified. Security origin.
- StorageKey string `json:"storageKey,omitempty"` // Storage key.
- DatabaseName string `json:"databaseName"` // Database name.
- ObjectStoreName string `json:"objectStoreName"` // Object store name.
+ SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey, or storageBucket must be specified. Security origin.
+ StorageKey string `json:"storageKey,omitempty"` // Storage key.
+ StorageBucket *storage.Bucket `json:"storageBucket,omitempty"` // Storage bucket. If not specified, it uses the default bucket.
+ DatabaseName string `json:"databaseName"` // Database name.
+ ObjectStoreName string `json:"objectStoreName"` // Object store name.
}
// ClearObjectStore clears all entries from an object store.
@@ -35,8 +37,8 @@ func ClearObjectStore(databaseName string, objectStoreName string) *ClearObjectS
}
}
-// WithSecurityOrigin at least and at most one of securityOrigin, storageKey
-// must be specified. Security origin.
+// WithSecurityOrigin at least and at most one of securityOrigin, storageKey,
+// or storageBucket must be specified. Security origin.
func (p ClearObjectStoreParams) WithSecurityOrigin(securityOrigin string) *ClearObjectStoreParams {
p.SecurityOrigin = securityOrigin
return &p
@@ -48,6 +50,13 @@ func (p ClearObjectStoreParams) WithStorageKey(storageKey string) *ClearObjectSt
return &p
}
+// WithStorageBucket storage bucket. If not specified, it uses the default
+// bucket.
+func (p ClearObjectStoreParams) WithStorageBucket(storageBucket *storage.Bucket) *ClearObjectStoreParams {
+ p.StorageBucket = storageBucket
+ return &p
+}
+
// Do executes IndexedDB.clearObjectStore against the provided context.
func (p *ClearObjectStoreParams) Do(ctx context.Context) (err error) {
return cdp.Execute(ctx, CommandClearObjectStore, p, nil)
@@ -55,9 +64,10 @@ func (p *ClearObjectStoreParams) Do(ctx context.Context) (err error) {
// DeleteDatabaseParams deletes a database.
type DeleteDatabaseParams struct {
- SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey must be specified. Security origin.
- StorageKey string `json:"storageKey,omitempty"` // Storage key.
- DatabaseName string `json:"databaseName"` // Database name.
+ SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey, or storageBucket must be specified. Security origin.
+ StorageKey string `json:"storageKey,omitempty"` // Storage key.
+ StorageBucket *storage.Bucket `json:"storageBucket,omitempty"` // Storage bucket. If not specified, it uses the default bucket.
+ DatabaseName string `json:"databaseName"` // Database name.
}
// DeleteDatabase deletes a database.
@@ -73,8 +83,8 @@ func DeleteDatabase(databaseName string) *DeleteDatabaseParams {
}
}
-// WithSecurityOrigin at least and at most one of securityOrigin, storageKey
-// must be specified. Security origin.
+// WithSecurityOrigin at least and at most one of securityOrigin, storageKey,
+// or storageBucket must be specified. Security origin.
func (p DeleteDatabaseParams) WithSecurityOrigin(securityOrigin string) *DeleteDatabaseParams {
p.SecurityOrigin = securityOrigin
return &p
@@ -86,6 +96,13 @@ func (p DeleteDatabaseParams) WithStorageKey(storageKey string) *DeleteDatabaseP
return &p
}
+// WithStorageBucket storage bucket. If not specified, it uses the default
+// bucket.
+func (p DeleteDatabaseParams) WithStorageBucket(storageBucket *storage.Bucket) *DeleteDatabaseParams {
+ p.StorageBucket = storageBucket
+ return &p
+}
+
// Do executes IndexedDB.deleteDatabase against the provided context.
func (p *DeleteDatabaseParams) Do(ctx context.Context) (err error) {
return cdp.Execute(ctx, CommandDeleteDatabase, p, nil)
@@ -94,11 +111,12 @@ func (p *DeleteDatabaseParams) Do(ctx context.Context) (err error) {
// DeleteObjectStoreEntriesParams delete a range of entries from an object
// store.
type DeleteObjectStoreEntriesParams struct {
- SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey must be specified. Security origin.
- StorageKey string `json:"storageKey,omitempty"` // Storage key.
- DatabaseName string `json:"databaseName"`
- ObjectStoreName string `json:"objectStoreName"`
- KeyRange *KeyRange `json:"keyRange"` // Range of entry keys to delete
+ SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey, or storageBucket must be specified. Security origin.
+ StorageKey string `json:"storageKey,omitempty"` // Storage key.
+ StorageBucket *storage.Bucket `json:"storageBucket,omitempty"` // Storage bucket. If not specified, it uses the default bucket.
+ DatabaseName string `json:"databaseName"`
+ ObjectStoreName string `json:"objectStoreName"`
+ KeyRange *KeyRange `json:"keyRange"` // Range of entry keys to delete
}
// DeleteObjectStoreEntries delete a range of entries from an object store.
@@ -118,8 +136,8 @@ func DeleteObjectStoreEntries(databaseName string, objectStoreName string, keyRa
}
}
-// WithSecurityOrigin at least and at most one of securityOrigin, storageKey
-// must be specified. Security origin.
+// WithSecurityOrigin at least and at most one of securityOrigin, storageKey,
+// or storageBucket must be specified. Security origin.
func (p DeleteObjectStoreEntriesParams) WithSecurityOrigin(securityOrigin string) *DeleteObjectStoreEntriesParams {
p.SecurityOrigin = securityOrigin
return &p
@@ -131,6 +149,13 @@ func (p DeleteObjectStoreEntriesParams) WithStorageKey(storageKey string) *Delet
return &p
}
+// WithStorageBucket storage bucket. If not specified, it uses the default
+// bucket.
+func (p DeleteObjectStoreEntriesParams) WithStorageBucket(storageBucket *storage.Bucket) *DeleteObjectStoreEntriesParams {
+ p.StorageBucket = storageBucket
+ return &p
+}
+
// Do executes IndexedDB.deleteObjectStoreEntries against the provided context.
func (p *DeleteObjectStoreEntriesParams) Do(ctx context.Context) (err error) {
return cdp.Execute(ctx, CommandDeleteObjectStoreEntries, p, nil)
@@ -168,14 +193,15 @@ func (p *EnableParams) Do(ctx context.Context) (err error) {
// RequestDataParams requests data from object store or index.
type RequestDataParams struct {
- SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey must be specified. Security origin.
- StorageKey string `json:"storageKey,omitempty"` // Storage key.
- DatabaseName string `json:"databaseName"` // Database name.
- ObjectStoreName string `json:"objectStoreName"` // Object store name.
- IndexName string `json:"indexName"` // Index name, empty string for object store data requests.
- SkipCount int64 `json:"skipCount"` // Number of records to skip.
- PageSize int64 `json:"pageSize"` // Number of records to fetch.
- KeyRange *KeyRange `json:"keyRange,omitempty"` // Key range.
+ SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey, or storageBucket must be specified. Security origin.
+ StorageKey string `json:"storageKey,omitempty"` // Storage key.
+ StorageBucket *storage.Bucket `json:"storageBucket,omitempty"` // Storage bucket. If not specified, it uses the default bucket.
+ DatabaseName string `json:"databaseName"` // Database name.
+ ObjectStoreName string `json:"objectStoreName"` // Object store name.
+ IndexName string `json:"indexName"` // Index name, empty string for object store data requests.
+ SkipCount int64 `json:"skipCount"` // Number of records to skip.
+ PageSize int64 `json:"pageSize"` // Number of records to fetch.
+ KeyRange *KeyRange `json:"keyRange,omitempty"` // Key range.
}
// RequestData requests data from object store or index.
@@ -199,8 +225,8 @@ func RequestData(databaseName string, objectStoreName string, indexName string,
}
}
-// WithSecurityOrigin at least and at most one of securityOrigin, storageKey
-// must be specified. Security origin.
+// WithSecurityOrigin at least and at most one of securityOrigin, storageKey,
+// or storageBucket must be specified. Security origin.
func (p RequestDataParams) WithSecurityOrigin(securityOrigin string) *RequestDataParams {
p.SecurityOrigin = securityOrigin
return &p
@@ -212,6 +238,13 @@ func (p RequestDataParams) WithStorageKey(storageKey string) *RequestDataParams
return &p
}
+// WithStorageBucket storage bucket. If not specified, it uses the default
+// bucket.
+func (p RequestDataParams) WithStorageBucket(storageBucket *storage.Bucket) *RequestDataParams {
+ p.StorageBucket = storageBucket
+ return &p
+}
+
// WithKeyRange key range.
func (p RequestDataParams) WithKeyRange(keyRange *KeyRange) *RequestDataParams {
p.KeyRange = keyRange
@@ -243,10 +276,11 @@ func (p *RequestDataParams) Do(ctx context.Context) (objectStoreDataEntries []*D
// GetMetadataParams gets metadata of an object store.
type GetMetadataParams struct {
- SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey must be specified. Security origin.
- StorageKey string `json:"storageKey,omitempty"` // Storage key.
- DatabaseName string `json:"databaseName"` // Database name.
- ObjectStoreName string `json:"objectStoreName"` // Object store name.
+ SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey, or storageBucket must be specified. Security origin.
+ StorageKey string `json:"storageKey,omitempty"` // Storage key.
+ StorageBucket *storage.Bucket `json:"storageBucket,omitempty"` // Storage bucket. If not specified, it uses the default bucket.
+ DatabaseName string `json:"databaseName"` // Database name.
+ ObjectStoreName string `json:"objectStoreName"` // Object store name.
}
// GetMetadata gets metadata of an object store.
@@ -264,8 +298,8 @@ func GetMetadata(databaseName string, objectStoreName string) *GetMetadataParams
}
}
-// WithSecurityOrigin at least and at most one of securityOrigin, storageKey
-// must be specified. Security origin.
+// WithSecurityOrigin at least and at most one of securityOrigin, storageKey,
+// or storageBucket must be specified. Security origin.
func (p GetMetadataParams) WithSecurityOrigin(securityOrigin string) *GetMetadataParams {
p.SecurityOrigin = securityOrigin
return &p
@@ -277,6 +311,13 @@ func (p GetMetadataParams) WithStorageKey(storageKey string) *GetMetadataParams
return &p
}
+// WithStorageBucket storage bucket. If not specified, it uses the default
+// bucket.
+func (p GetMetadataParams) WithStorageBucket(storageBucket *storage.Bucket) *GetMetadataParams {
+ p.StorageBucket = storageBucket
+ return &p
+}
+
// GetMetadataReturns return values.
type GetMetadataReturns struct {
EntriesCount float64 `json:"entriesCount,omitempty"` // the entries count
@@ -302,9 +343,10 @@ func (p *GetMetadataParams) Do(ctx context.Context) (entriesCount float64, keyGe
// RequestDatabaseParams requests database with given name in given frame.
type RequestDatabaseParams struct {
- SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey must be specified. Security origin.
- StorageKey string `json:"storageKey,omitempty"` // Storage key.
- DatabaseName string `json:"databaseName"` // Database name.
+ SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey, or storageBucket must be specified. Security origin.
+ StorageKey string `json:"storageKey,omitempty"` // Storage key.
+ StorageBucket *storage.Bucket `json:"storageBucket,omitempty"` // Storage bucket. If not specified, it uses the default bucket.
+ DatabaseName string `json:"databaseName"` // Database name.
}
// RequestDatabase requests database with given name in given frame.
@@ -320,8 +362,8 @@ func RequestDatabase(databaseName string) *RequestDatabaseParams {
}
}
-// WithSecurityOrigin at least and at most one of securityOrigin, storageKey
-// must be specified. Security origin.
+// WithSecurityOrigin at least and at most one of securityOrigin, storageKey,
+// or storageBucket must be specified. Security origin.
func (p RequestDatabaseParams) WithSecurityOrigin(securityOrigin string) *RequestDatabaseParams {
p.SecurityOrigin = securityOrigin
return &p
@@ -333,6 +375,13 @@ func (p RequestDatabaseParams) WithStorageKey(storageKey string) *RequestDatabas
return &p
}
+// WithStorageBucket storage bucket. If not specified, it uses the default
+// bucket.
+func (p RequestDatabaseParams) WithStorageBucket(storageBucket *storage.Bucket) *RequestDatabaseParams {
+ p.StorageBucket = storageBucket
+ return &p
+}
+
// RequestDatabaseReturns return values.
type RequestDatabaseReturns struct {
DatabaseWithObjectStores *DatabaseWithObjectStores `json:"databaseWithObjectStores,omitempty"` // Database with an array of object stores.
@@ -357,8 +406,9 @@ func (p *RequestDatabaseParams) Do(ctx context.Context) (databaseWithObjectStore
// RequestDatabaseNamesParams requests database names for given security
// origin.
type RequestDatabaseNamesParams struct {
- SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey must be specified. Security origin.
- StorageKey string `json:"storageKey,omitempty"` // Storage key.
+ SecurityOrigin string `json:"securityOrigin,omitempty"` // At least and at most one of securityOrigin, storageKey, or storageBucket must be specified. Security origin.
+ StorageKey string `json:"storageKey,omitempty"` // Storage key.
+ StorageBucket *storage.Bucket `json:"storageBucket,omitempty"` // Storage bucket. If not specified, it uses the default bucket.
}
// RequestDatabaseNames requests database names for given security origin.
@@ -370,8 +420,8 @@ func RequestDatabaseNames() *RequestDatabaseNamesParams {
return &RequestDatabaseNamesParams{}
}
-// WithSecurityOrigin at least and at most one of securityOrigin, storageKey
-// must be specified. Security origin.
+// WithSecurityOrigin at least and at most one of securityOrigin, storageKey,
+// or storageBucket must be specified. Security origin.
func (p RequestDatabaseNamesParams) WithSecurityOrigin(securityOrigin string) *RequestDatabaseNamesParams {
p.SecurityOrigin = securityOrigin
return &p
@@ -383,6 +433,13 @@ func (p RequestDatabaseNamesParams) WithStorageKey(storageKey string) *RequestDa
return &p
}
+// WithStorageBucket storage bucket. If not specified, it uses the default
+// bucket.
+func (p RequestDatabaseNamesParams) WithStorageBucket(storageBucket *storage.Bucket) *RequestDatabaseNamesParams {
+ p.StorageBucket = storageBucket
+ return &p
+}
+
// RequestDatabaseNamesReturns return values.
type RequestDatabaseNamesReturns struct {
DatabaseNames []string `json:"databaseNames,omitempty"` // Database names for origin.
diff --git a/input/easyjson.go b/input/easyjson.go
index 163623e..eb18e51 100644
--- a/input/easyjson.go
+++ b/input/easyjson.go
@@ -1851,3 +1851,62 @@ func (v *DispatchDragEventParams) UnmarshalJSON(data []byte) error {
func (v *DispatchDragEventParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoInput15(l, v)
}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoInput16(in *jlexer.Lexer, out *CancelDraggingParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoInput16(out *jwriter.Writer, in CancelDraggingParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v CancelDraggingParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoInput16(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v CancelDraggingParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoInput16(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *CancelDraggingParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoInput16(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *CancelDraggingParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoInput16(l, v)
+}
diff --git a/input/input.go b/input/input.go
index 0281bc4..e0467ab 100644
--- a/input/input.go
+++ b/input/input.go
@@ -431,6 +431,21 @@ func (p *DispatchTouchEventParams) Do(ctx context.Context) (err error) {
return cdp.Execute(ctx, CommandDispatchTouchEvent, p, nil)
}
+// CancelDraggingParams cancels any active dragging in the page.
+type CancelDraggingParams struct{}
+
+// CancelDragging cancels any active dragging in the page.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Input#method-cancelDragging
+func CancelDragging() *CancelDraggingParams {
+ return &CancelDraggingParams{}
+}
+
+// Do executes Input.cancelDragging against the provided context.
+func (p *CancelDraggingParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandCancelDragging, nil, nil)
+}
+
// EmulateTouchFromMouseEventParams emulates touch event from the mouse event
// parameters.
type EmulateTouchFromMouseEventParams struct {
@@ -764,6 +779,7 @@ const (
CommandImeSetComposition = "Input.imeSetComposition"
CommandDispatchMouseEvent = "Input.dispatchMouseEvent"
CommandDispatchTouchEvent = "Input.dispatchTouchEvent"
+ CommandCancelDragging = "Input.cancelDragging"
CommandEmulateTouchFromMouseEvent = "Input.emulateTouchFromMouseEvent"
CommandSetIgnoreInputEvents = "Input.setIgnoreInputEvents"
CommandSetInterceptDrags = "Input.setInterceptDrags"
diff --git a/layertree/easyjson.go b/layertree/easyjson.go
index ce40844..0d1b54a 100644
--- a/layertree/easyjson.go
+++ b/layertree/easyjson.go
@@ -1793,6 +1793,29 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoLayertree19(in *jlexer.Lexer,
continue
}
switch key {
+ case "compositingReasons":
+ if in.IsNull() {
+ in.Skip()
+ out.CompositingReasons = nil
+ } else {
+ in.Delim('[')
+ if out.CompositingReasons == nil {
+ if !in.IsDelim(']') {
+ out.CompositingReasons = make([]string, 0, 4)
+ } else {
+ out.CompositingReasons = []string{}
+ }
+ } else {
+ out.CompositingReasons = (out.CompositingReasons)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v22 string
+ v22 = string(in.String())
+ out.CompositingReasons = append(out.CompositingReasons, v22)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
case "compositingReasonIds":
if in.IsNull() {
in.Skip()
@@ -1809,9 +1832,9 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoLayertree19(in *jlexer.Lexer,
out.CompositingReasonIDs = (out.CompositingReasonIDs)[:0]
}
for !in.IsDelim(']') {
- var v22 string
- v22 = string(in.String())
- out.CompositingReasonIDs = append(out.CompositingReasonIDs, v22)
+ var v23 string
+ v23 = string(in.String())
+ out.CompositingReasonIDs = append(out.CompositingReasonIDs, v23)
in.WantComma()
}
in.Delim(']')
@@ -1830,17 +1853,36 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoLayertree19(out *jwriter.Writ
out.RawByte('{')
first := true
_ = first
- if len(in.CompositingReasonIDs) != 0 {
- const prefix string = ",\"compositingReasonIds\":"
+ if len(in.CompositingReasons) != 0 {
+ const prefix string = ",\"compositingReasons\":"
first = false
out.RawString(prefix[1:])
{
out.RawByte('[')
- for v23, v24 := range in.CompositingReasonIDs {
- if v23 > 0 {
+ for v24, v25 := range in.CompositingReasons {
+ if v24 > 0 {
+ out.RawByte(',')
+ }
+ out.String(string(v25))
+ }
+ out.RawByte(']')
+ }
+ }
+ if len(in.CompositingReasonIDs) != 0 {
+ const prefix string = ",\"compositingReasonIds\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ {
+ out.RawByte('[')
+ for v26, v27 := range in.CompositingReasonIDs {
+ if v26 > 0 {
out.RawByte(',')
}
- out.String(string(v24))
+ out.String(string(v27))
}
out.RawByte(']')
}
diff --git a/layertree/layertree.go b/layertree/layertree.go
index 22949dc..ce8a58d 100644
--- a/layertree/layertree.go
+++ b/layertree/layertree.go
@@ -36,6 +36,7 @@ func CompositingReasons(layerID LayerID) *CompositingReasonsParams {
// CompositingReasonsReturns return values.
type CompositingReasonsReturns struct {
+ CompositingReasons []string `json:"compositingReasons,omitempty"` // A list of strings specifying reasons for the given layer to become composited.
CompositingReasonIDs []string `json:"compositingReasonIds,omitempty"` // A list of strings specifying reason IDs for the given layer to become composited.
}
@@ -43,16 +44,17 @@ type CompositingReasonsReturns struct {
//
// returns:
//
+// compositingReasons - A list of strings specifying reasons for the given layer to become composited.
// compositingReasonIDs - A list of strings specifying reason IDs for the given layer to become composited.
-func (p *CompositingReasonsParams) Do(ctx context.Context) (compositingReasonIDs []string, err error) {
+func (p *CompositingReasonsParams) Do(ctx context.Context) (compositingReasons []string, compositingReasonIDs []string, err error) {
// execute
var res CompositingReasonsReturns
err = cdp.Execute(ctx, CommandCompositingReasons, p, &res)
if err != nil {
- return nil, err
+ return nil, nil, err
}
- return res.CompositingReasonIDs, nil
+ return res.CompositingReasons, res.CompositingReasonIDs, nil
}
// DisableParams disables compositing tree inspection.
diff --git a/network/easyjson.go b/network/easyjson.go
index ba62c05..9f2a5a3 100644
--- a/network/easyjson.go
+++ b/network/easyjson.go
@@ -416,8 +416,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork3(in *jlexer.Lexer, ou
continue
}
switch key {
- case "type":
- (out.Type).UnmarshalEasyJSON(in)
+ case "operation":
+ (out.Operation).UnmarshalEasyJSON(in)
case "refreshPolicy":
(out.RefreshPolicy).UnmarshalEasyJSON(in)
case "issuers":
@@ -458,9 +458,9 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork3(out *jwriter.Writer,
first := true
_ = first
{
- const prefix string = ",\"type\":"
+ const prefix string = ",\"operation\":"
out.RawString(prefix[1:])
- (in.Type).MarshalEasyJSON(out)
+ (in.Operation).MarshalEasyJSON(out)
}
{
const prefix string = ",\"refreshPolicy\":"
@@ -2140,6 +2140,37 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork19(in *jlexer.Lexer, o
}
(*out.Coep).UnmarshalEasyJSON(in)
}
+ case "csp":
+ if in.IsNull() {
+ in.Skip()
+ out.Csp = nil
+ } else {
+ in.Delim('[')
+ if out.Csp == nil {
+ if !in.IsDelim(']') {
+ out.Csp = make([]*ContentSecurityPolicyStatus, 0, 8)
+ } else {
+ out.Csp = []*ContentSecurityPolicyStatus{}
+ }
+ } else {
+ out.Csp = (out.Csp)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v32 *ContentSecurityPolicyStatus
+ if in.IsNull() {
+ in.Skip()
+ v32 = nil
+ } else {
+ if v32 == nil {
+ v32 = new(ContentSecurityPolicyStatus)
+ }
+ (*v32).UnmarshalEasyJSON(in)
+ }
+ out.Csp = append(out.Csp, v32)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
default:
in.SkipRecursive()
}
@@ -2170,6 +2201,29 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork19(out *jwriter.Writer
}
(*in.Coep).MarshalEasyJSON(out)
}
+ if len(in.Csp) != 0 {
+ const prefix string = ",\"csp\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ {
+ out.RawByte('[')
+ for v33, v34 := range in.Csp {
+ if v33 > 0 {
+ out.RawByte(',')
+ }
+ if v34 == nil {
+ out.RawString("null")
+ } else {
+ (*v34).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
out.RawByte('}')
}
@@ -2245,9 +2299,9 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork20(in *jlexer.Lexer, o
out.SanList = (out.SanList)[:0]
}
for !in.IsDelim(']') {
- var v32 string
- v32 = string(in.String())
- out.SanList = append(out.SanList, v32)
+ var v35 string
+ v35 = string(in.String())
+ out.SanList = append(out.SanList, v35)
in.WantComma()
}
in.Delim(']')
@@ -2290,17 +2344,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork20(in *jlexer.Lexer, o
out.SignedCertificateTimestampList = (out.SignedCertificateTimestampList)[:0]
}
for !in.IsDelim(']') {
- var v33 *SignedCertificateTimestamp
+ var v36 *SignedCertificateTimestamp
if in.IsNull() {
in.Skip()
- v33 = nil
+ v36 = nil
} else {
- if v33 == nil {
- v33 = new(SignedCertificateTimestamp)
+ if v36 == nil {
+ v36 = new(SignedCertificateTimestamp)
}
- (*v33).UnmarshalEasyJSON(in)
+ (*v36).UnmarshalEasyJSON(in)
}
- out.SignedCertificateTimestampList = append(out.SignedCertificateTimestampList, v33)
+ out.SignedCertificateTimestampList = append(out.SignedCertificateTimestampList, v36)
in.WantComma()
}
in.Delim(']')
@@ -2367,11 +2421,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork20(out *jwriter.Writer
out.RawString("null")
} else {
out.RawByte('[')
- for v34, v35 := range in.SanList {
- if v34 > 0 {
+ for v37, v38 := range in.SanList {
+ if v37 > 0 {
out.RawByte(',')
}
- out.String(string(v35))
+ out.String(string(v38))
}
out.RawByte(']')
}
@@ -2406,14 +2460,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork20(out *jwriter.Writer
out.RawString("null")
} else {
out.RawByte('[')
- for v36, v37 := range in.SignedCertificateTimestampList {
- if v36 > 0 {
+ for v39, v40 := range in.SignedCertificateTimestampList {
+ if v39 > 0 {
out.RawByte(',')
}
- if v37 == nil {
+ if v40 == nil {
out.RawString("null")
} else {
- (*v37).MarshalEasyJSON(out)
+ (*v40).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -2495,17 +2549,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork21(in *jlexer.Lexer, o
out.Result = (out.Result)[:0]
}
for !in.IsDelim(']') {
- var v38 *debugger.SearchMatch
+ var v41 *debugger.SearchMatch
if in.IsNull() {
in.Skip()
- v38 = nil
+ v41 = nil
} else {
- if v38 == nil {
- v38 = new(debugger.SearchMatch)
+ if v41 == nil {
+ v41 = new(debugger.SearchMatch)
}
- (*v38).UnmarshalEasyJSON(in)
+ (*v41).UnmarshalEasyJSON(in)
}
- out.Result = append(out.Result, v38)
+ out.Result = append(out.Result, v41)
in.WantComma()
}
in.Delim(']')
@@ -2530,14 +2584,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork21(out *jwriter.Writer
out.RawString(prefix[1:])
{
out.RawByte('[')
- for v39, v40 := range in.Result {
- if v39 > 0 {
+ for v42, v43 := range in.Result {
+ if v42 > 0 {
out.RawByte(',')
}
- if v40 == nil {
+ if v43 == nil {
out.RawString("null")
} else {
- (*v40).MarshalEasyJSON(out)
+ (*v43).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -2690,15 +2744,15 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork23(in *jlexer.Lexer, o
for !in.IsDelim('}') {
key := string(in.String())
in.WantColon()
- var v41 interface{}
- if m, ok := v41.(easyjson.Unmarshaler); ok {
+ var v44 interface{}
+ if m, ok := v44.(easyjson.Unmarshaler); ok {
m.UnmarshalEasyJSON(in)
- } else if m, ok := v41.(json.Unmarshaler); ok {
+ } else if m, ok := v44.(json.Unmarshaler); ok {
_ = m.UnmarshalJSON(in.Raw())
} else {
- v41 = in.Interface()
+ v44 = in.Interface()
}
- (out.Headers)[key] = v41
+ (out.Headers)[key] = v44
in.WantComma()
}
in.Delim('}')
@@ -2718,15 +2772,15 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork23(in *jlexer.Lexer, o
for !in.IsDelim('}') {
key := string(in.String())
in.WantColon()
- var v42 interface{}
- if m, ok := v42.(easyjson.Unmarshaler); ok {
+ var v45 interface{}
+ if m, ok := v45.(easyjson.Unmarshaler); ok {
m.UnmarshalEasyJSON(in)
- } else if m, ok := v42.(json.Unmarshaler); ok {
+ } else if m, ok := v45.(json.Unmarshaler); ok {
_ = m.UnmarshalJSON(in.Raw())
} else {
- v42 = in.Interface()
+ v45 = in.Interface()
}
- (out.RequestHeaders)[key] = v42
+ (out.RequestHeaders)[key] = v45
in.WantComma()
}
in.Delim('}')
@@ -2765,7 +2819,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork23(in *jlexer.Lexer, o
out.ResponseTime = nil
} else {
if out.ResponseTime == nil {
- out.ResponseTime = new(cdp.TimeSinceEpoch)
+ out.ResponseTime = new(cdp.TimeSinceEpochMilli)
}
(*out.ResponseTime).UnmarshalEasyJSON(in)
}
@@ -2823,21 +2877,21 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork23(out *jwriter.Writer
out.RawString(`null`)
} else {
out.RawByte('{')
- v43First := true
- for v43Name, v43Value := range in.Headers {
- if v43First {
- v43First = false
+ v46First := true
+ for v46Name, v46Value := range in.Headers {
+ if v46First {
+ v46First = false
} else {
out.RawByte(',')
}
- out.String(string(v43Name))
+ out.String(string(v46Name))
out.RawByte(':')
- if m, ok := v43Value.(easyjson.Marshaler); ok {
+ if m, ok := v46Value.(easyjson.Marshaler); ok {
m.MarshalEasyJSON(out)
- } else if m, ok := v43Value.(json.Marshaler); ok {
+ } else if m, ok := v46Value.(json.Marshaler); ok {
out.Raw(m.MarshalJSON())
} else {
- out.Raw(json.Marshal(v43Value))
+ out.Raw(json.Marshal(v46Value))
}
}
out.RawByte('}')
@@ -2853,21 +2907,21 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork23(out *jwriter.Writer
out.RawString(prefix)
{
out.RawByte('{')
- v44First := true
- for v44Name, v44Value := range in.RequestHeaders {
- if v44First {
- v44First = false
+ v47First := true
+ for v47Name, v47Value := range in.RequestHeaders {
+ if v47First {
+ v47First = false
} else {
out.RawByte(',')
}
- out.String(string(v44Name))
+ out.String(string(v47Name))
out.RawByte(':')
- if m, ok := v44Value.(easyjson.Marshaler); ok {
+ if m, ok := v47Value.(easyjson.Marshaler); ok {
m.MarshalEasyJSON(out)
- } else if m, ok := v44Value.(json.Marshaler); ok {
+ } else if m, ok := v47Value.(json.Marshaler); ok {
out.Raw(m.MarshalJSON())
} else {
- out.Raw(json.Marshal(v44Value))
+ out.Raw(json.Marshal(v47Value))
}
}
out.RawByte('}')
@@ -3032,6 +3086,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork24(in *jlexer.Lexer, o
out.PushStart = float64(in.Float64())
case "pushEnd":
out.PushEnd = float64(in.Float64())
+ case "receiveHeadersStart":
+ out.ReceiveHeadersStart = float64(in.Float64())
case "receiveHeadersEnd":
out.ReceiveHeadersEnd = float64(in.Float64())
default:
@@ -3133,6 +3189,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork24(out *jwriter.Writer
out.RawString(prefix)
out.Float64(float64(in.PushEnd))
}
+ {
+ const prefix string = ",\"receiveHeadersStart\":"
+ out.RawString(prefix)
+ out.Float64(float64(in.ReceiveHeadersStart))
+ }
{
const prefix string = ",\"receiveHeadersEnd\":"
out.RawString(prefix)
@@ -3289,15 +3350,15 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork26(in *jlexer.Lexer, o
for !in.IsDelim('}') {
key := string(in.String())
in.WantColon()
- var v45 interface{}
- if m, ok := v45.(easyjson.Unmarshaler); ok {
+ var v48 interface{}
+ if m, ok := v48.(easyjson.Unmarshaler); ok {
m.UnmarshalEasyJSON(in)
- } else if m, ok := v45.(json.Unmarshaler); ok {
+ } else if m, ok := v48.(json.Unmarshaler); ok {
_ = m.UnmarshalJSON(in.Raw())
} else {
- v45 = in.Interface()
+ v48 = in.Interface()
}
- (out.Headers)[key] = v45
+ (out.Headers)[key] = v48
in.WantComma()
}
in.Delim('}')
@@ -3322,17 +3383,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork26(in *jlexer.Lexer, o
out.PostDataEntries = (out.PostDataEntries)[:0]
}
for !in.IsDelim(']') {
- var v46 *PostDataEntry
+ var v49 *PostDataEntry
if in.IsNull() {
in.Skip()
- v46 = nil
+ v49 = nil
} else {
- if v46 == nil {
- v46 = new(PostDataEntry)
+ if v49 == nil {
+ v49 = new(PostDataEntry)
}
- (*v46).UnmarshalEasyJSON(in)
+ (*v49).UnmarshalEasyJSON(in)
}
- out.PostDataEntries = append(out.PostDataEntries, v46)
+ out.PostDataEntries = append(out.PostDataEntries, v49)
in.WantComma()
}
in.Delim(']')
@@ -3393,21 +3454,21 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork26(out *jwriter.Writer
out.RawString(`null`)
} else {
out.RawByte('{')
- v47First := true
- for v47Name, v47Value := range in.Headers {
- if v47First {
- v47First = false
+ v50First := true
+ for v50Name, v50Value := range in.Headers {
+ if v50First {
+ v50First = false
} else {
out.RawByte(',')
}
- out.String(string(v47Name))
+ out.String(string(v50Name))
out.RawByte(':')
- if m, ok := v47Value.(easyjson.Marshaler); ok {
+ if m, ok := v50Value.(easyjson.Marshaler); ok {
m.MarshalEasyJSON(out)
- } else if m, ok := v47Value.(json.Marshaler); ok {
+ } else if m, ok := v50Value.(json.Marshaler); ok {
out.Raw(m.MarshalJSON())
} else {
- out.Raw(json.Marshal(v47Value))
+ out.Raw(json.Marshal(v50Value))
}
}
out.RawByte('}')
@@ -3428,14 +3489,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork26(out *jwriter.Writer
out.RawString(prefix)
{
out.RawByte('[')
- for v48, v49 := range in.PostDataEntries {
- if v48 > 0 {
+ for v51, v52 := range in.PostDataEntries {
+ if v51 > 0 {
out.RawByte(',')
}
- if v49 == nil {
+ if v52 == nil {
out.RawString("null")
} else {
- (*v49).MarshalEasyJSON(out)
+ (*v52).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -4052,15 +4113,15 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork33(in *jlexer.Lexer, o
for !in.IsDelim('}') {
key := string(in.String())
in.WantColon()
- var v50 interface{}
- if m, ok := v50.(easyjson.Unmarshaler); ok {
+ var v53 interface{}
+ if m, ok := v53.(easyjson.Unmarshaler); ok {
m.UnmarshalEasyJSON(in)
- } else if m, ok := v50.(json.Unmarshaler); ok {
+ } else if m, ok := v53.(json.Unmarshaler); ok {
_ = m.UnmarshalJSON(in.Raw())
} else {
- v50 = in.Interface()
+ v53 = in.Interface()
}
- (out.Headers)[key] = v50
+ (out.Headers)[key] = v53
in.WantComma()
}
in.Delim('}')
@@ -4109,21 +4170,21 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork33(out *jwriter.Writer
out.RawString(prefix)
{
out.RawByte('{')
- v51First := true
- for v51Name, v51Value := range in.Headers {
- if v51First {
- v51First = false
+ v54First := true
+ for v54Name, v54Value := range in.Headers {
+ if v54First {
+ v54First = false
} else {
out.RawByte(',')
}
- out.String(string(v51Name))
+ out.String(string(v54Name))
out.RawByte(':')
- if m, ok := v51Value.(easyjson.Marshaler); ok {
+ if m, ok := v54Value.(easyjson.Marshaler); ok {
m.MarshalEasyJSON(out)
- } else if m, ok := v51Value.(json.Marshaler); ok {
+ } else if m, ok := v54Value.(json.Marshaler); ok {
out.Raw(m.MarshalJSON())
} else {
- out.Raw(json.Marshal(v51Value))
+ out.Raw(json.Marshal(v54Value))
}
}
out.RawByte('}')
@@ -4937,17 +4998,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork44(in *jlexer.Lexer, o
out.Cookies = (out.Cookies)[:0]
}
for !in.IsDelim(']') {
- var v52 *Cookie
+ var v55 *Cookie
if in.IsNull() {
in.Skip()
- v52 = nil
+ v55 = nil
} else {
- if v52 == nil {
- v52 = new(Cookie)
+ if v55 == nil {
+ v55 = new(Cookie)
}
- (*v52).UnmarshalEasyJSON(in)
+ (*v55).UnmarshalEasyJSON(in)
}
- out.Cookies = append(out.Cookies, v52)
+ out.Cookies = append(out.Cookies, v55)
in.WantComma()
}
in.Delim(']')
@@ -4972,14 +5033,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork44(out *jwriter.Writer
out.RawString(prefix[1:])
{
out.RawByte('[')
- for v53, v54 := range in.Cookies {
- if v53 > 0 {
+ for v56, v57 := range in.Cookies {
+ if v56 > 0 {
out.RawByte(',')
}
- if v54 == nil {
+ if v57 == nil {
out.RawString("null")
} else {
- (*v54).MarshalEasyJSON(out)
+ (*v57).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -5046,9 +5107,9 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork45(in *jlexer.Lexer, o
out.Urls = (out.Urls)[:0]
}
for !in.IsDelim(']') {
- var v55 string
- v55 = string(in.String())
- out.Urls = append(out.Urls, v55)
+ var v58 string
+ v58 = string(in.String())
+ out.Urls = append(out.Urls, v58)
in.WantComma()
}
in.Delim(']')
@@ -5073,11 +5134,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork45(out *jwriter.Writer
out.RawString(prefix[1:])
{
out.RawByte('[')
- for v56, v57 := range in.Urls {
- if v56 > 0 {
+ for v59, v60 := range in.Urls {
+ if v59 > 0 {
out.RawByte(',')
}
- out.String(string(v57))
+ out.String(string(v60))
}
out.RawByte(']')
}
@@ -5143,9 +5204,9 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork46(in *jlexer.Lexer, o
out.TableNames = (out.TableNames)[:0]
}
for !in.IsDelim(']') {
- var v58 string
- v58 = string(in.String())
- out.TableNames = append(out.TableNames, v58)
+ var v61 string
+ v61 = string(in.String())
+ out.TableNames = append(out.TableNames, v61)
in.WantComma()
}
in.Delim(']')
@@ -5170,11 +5231,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork46(out *jwriter.Writer
out.RawString(prefix[1:])
{
out.RawByte('[')
- for v59, v60 := range in.TableNames {
- if v59 > 0 {
+ for v62, v63 := range in.TableNames {
+ if v62 > 0 {
out.RawByte(',')
}
- out.String(string(v60))
+ out.String(string(v63))
}
out.RawByte(']')
}
@@ -6386,9 +6447,9 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork59(in *jlexer.Lexer, o
out.Urls = (out.Urls)[:0]
}
for !in.IsDelim(']') {
- var v61 string
- v61 = string(in.String())
- out.Urls = append(out.Urls, v61)
+ var v64 string
+ v64 = string(in.String())
+ out.Urls = append(out.Urls, v64)
in.WantComma()
}
in.Delim(']')
@@ -6419,11 +6480,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork59(out *jwriter.Writer
out.RawString("null")
} else {
out.RawByte('[')
- for v62, v63 := range in.Urls {
- if v62 > 0 {
+ for v65, v66 := range in.Urls {
+ if v65 > 0 {
out.RawByte(',')
}
- out.String(string(v63))
+ out.String(string(v66))
}
out.RawByte(']')
}
@@ -6816,17 +6877,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork64(in *jlexer.Lexer, o
out.BlockedCookies = (out.BlockedCookies)[:0]
}
for !in.IsDelim(']') {
- var v64 *BlockedSetCookieWithReason
+ var v67 *BlockedSetCookieWithReason
if in.IsNull() {
in.Skip()
- v64 = nil
+ v67 = nil
} else {
- if v64 == nil {
- v64 = new(BlockedSetCookieWithReason)
+ if v67 == nil {
+ v67 = new(BlockedSetCookieWithReason)
}
- (*v64).UnmarshalEasyJSON(in)
+ (*v67).UnmarshalEasyJSON(in)
}
- out.BlockedCookies = append(out.BlockedCookies, v64)
+ out.BlockedCookies = append(out.BlockedCookies, v67)
in.WantComma()
}
in.Delim(']')
@@ -6840,15 +6901,15 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork64(in *jlexer.Lexer, o
for !in.IsDelim('}') {
key := string(in.String())
in.WantColon()
- var v65 interface{}
- if m, ok := v65.(easyjson.Unmarshaler); ok {
+ var v68 interface{}
+ if m, ok := v68.(easyjson.Unmarshaler); ok {
m.UnmarshalEasyJSON(in)
- } else if m, ok := v65.(json.Unmarshaler); ok {
+ } else if m, ok := v68.(json.Unmarshaler); ok {
_ = m.UnmarshalJSON(in.Raw())
} else {
- v65 = in.Interface()
+ v68 = in.Interface()
}
- (out.Headers)[key] = v65
+ (out.Headers)[key] = v68
in.WantComma()
}
in.Delim('}')
@@ -6859,6 +6920,10 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork64(in *jlexer.Lexer, o
out.StatusCode = int64(in.Int64())
case "headersText":
out.HeadersText = string(in.String())
+ case "cookiePartitionKey":
+ out.CookiePartitionKey = string(in.String())
+ case "cookiePartitionKeyOpaque":
+ out.CookiePartitionKeyOpaque = bool(in.Bool())
default:
in.SkipRecursive()
}
@@ -6885,14 +6950,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork64(out *jwriter.Writer
out.RawString("null")
} else {
out.RawByte('[')
- for v66, v67 := range in.BlockedCookies {
- if v66 > 0 {
+ for v69, v70 := range in.BlockedCookies {
+ if v69 > 0 {
out.RawByte(',')
}
- if v67 == nil {
+ if v70 == nil {
out.RawString("null")
} else {
- (*v67).MarshalEasyJSON(out)
+ (*v70).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -6905,21 +6970,21 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork64(out *jwriter.Writer
out.RawString(`null`)
} else {
out.RawByte('{')
- v68First := true
- for v68Name, v68Value := range in.Headers {
- if v68First {
- v68First = false
+ v71First := true
+ for v71Name, v71Value := range in.Headers {
+ if v71First {
+ v71First = false
} else {
out.RawByte(',')
}
- out.String(string(v68Name))
+ out.String(string(v71Name))
out.RawByte(':')
- if m, ok := v68Value.(easyjson.Marshaler); ok {
+ if m, ok := v71Value.(easyjson.Marshaler); ok {
m.MarshalEasyJSON(out)
- } else if m, ok := v68Value.(json.Marshaler); ok {
+ } else if m, ok := v71Value.(json.Marshaler); ok {
out.Raw(m.MarshalJSON())
} else {
- out.Raw(json.Marshal(v68Value))
+ out.Raw(json.Marshal(v71Value))
}
}
out.RawByte('}')
@@ -6940,6 +7005,16 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork64(out *jwriter.Writer
out.RawString(prefix)
out.String(string(in.HeadersText))
}
+ if in.CookiePartitionKey != "" {
+ const prefix string = ",\"cookiePartitionKey\":"
+ out.RawString(prefix)
+ out.String(string(in.CookiePartitionKey))
+ }
+ if in.CookiePartitionKeyOpaque {
+ const prefix string = ",\"cookiePartitionKeyOpaque\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.CookiePartitionKeyOpaque))
+ }
out.RawByte('}')
}
@@ -7227,17 +7302,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork67(in *jlexer.Lexer, o
out.AssociatedCookies = (out.AssociatedCookies)[:0]
}
for !in.IsDelim(']') {
- var v69 *BlockedCookieWithReason
+ var v72 *BlockedCookieWithReason
if in.IsNull() {
in.Skip()
- v69 = nil
+ v72 = nil
} else {
- if v69 == nil {
- v69 = new(BlockedCookieWithReason)
+ if v72 == nil {
+ v72 = new(BlockedCookieWithReason)
}
- (*v69).UnmarshalEasyJSON(in)
+ (*v72).UnmarshalEasyJSON(in)
}
- out.AssociatedCookies = append(out.AssociatedCookies, v69)
+ out.AssociatedCookies = append(out.AssociatedCookies, v72)
in.WantComma()
}
in.Delim(']')
@@ -7251,15 +7326,15 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork67(in *jlexer.Lexer, o
for !in.IsDelim('}') {
key := string(in.String())
in.WantColon()
- var v70 interface{}
- if m, ok := v70.(easyjson.Unmarshaler); ok {
+ var v73 interface{}
+ if m, ok := v73.(easyjson.Unmarshaler); ok {
m.UnmarshalEasyJSON(in)
- } else if m, ok := v70.(json.Unmarshaler); ok {
+ } else if m, ok := v73.(json.Unmarshaler); ok {
_ = m.UnmarshalJSON(in.Raw())
} else {
- v70 = in.Interface()
+ v73 = in.Interface()
}
- (out.Headers)[key] = v70
+ (out.Headers)[key] = v73
in.WantComma()
}
in.Delim('}')
@@ -7312,14 +7387,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork67(out *jwriter.Writer
out.RawString("null")
} else {
out.RawByte('[')
- for v71, v72 := range in.AssociatedCookies {
- if v71 > 0 {
+ for v74, v75 := range in.AssociatedCookies {
+ if v74 > 0 {
out.RawByte(',')
}
- if v72 == nil {
+ if v75 == nil {
out.RawString("null")
} else {
- (*v72).MarshalEasyJSON(out)
+ (*v75).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -7332,21 +7407,21 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork67(out *jwriter.Writer
out.RawString(`null`)
} else {
out.RawByte('{')
- v73First := true
- for v73Name, v73Value := range in.Headers {
- if v73First {
- v73First = false
+ v76First := true
+ for v76Name, v76Value := range in.Headers {
+ if v76First {
+ v76First = false
} else {
out.RawByte(',')
}
- out.String(string(v73Name))
+ out.String(string(v76Name))
out.RawByte(':')
- if m, ok := v73Value.(easyjson.Marshaler); ok {
+ if m, ok := v76Value.(easyjson.Marshaler); ok {
m.MarshalEasyJSON(out)
- } else if m, ok := v73Value.(json.Marshaler); ok {
+ } else if m, ok := v76Value.(json.Marshaler); ok {
out.Raw(m.MarshalJSON())
} else {
- out.Raw(json.Marshal(v73Value))
+ out.Raw(json.Marshal(v76Value))
}
}
out.RawByte('}')
@@ -7855,17 +7930,17 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork72(in *jlexer.Lexer, o
out.Endpoints = (out.Endpoints)[:0]
}
for !in.IsDelim(']') {
- var v74 *ReportingAPIEndpoint
+ var v77 *ReportingAPIEndpoint
if in.IsNull() {
in.Skip()
- v74 = nil
+ v77 = nil
} else {
- if v74 == nil {
- v74 = new(ReportingAPIEndpoint)
+ if v77 == nil {
+ v77 = new(ReportingAPIEndpoint)
}
- (*v74).UnmarshalEasyJSON(in)
+ (*v77).UnmarshalEasyJSON(in)
}
- out.Endpoints = append(out.Endpoints, v74)
+ out.Endpoints = append(out.Endpoints, v77)
in.WantComma()
}
in.Delim(']')
@@ -7896,14 +7971,14 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork72(out *jwriter.Writer
out.RawString("null")
} else {
out.RawByte('[')
- for v75, v76 := range in.Endpoints {
- if v75 > 0 {
+ for v78, v79 := range in.Endpoints {
+ if v78 > 0 {
out.RawByte(',')
}
- if v76 == nil {
+ if v79 == nil {
out.RawString("null")
} else {
- (*v76).MarshalEasyJSON(out)
+ (*v79).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -7968,8 +8043,6 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork73(in *jlexer.Lexer, o
}
case "encodedDataLength":
out.EncodedDataLength = float64(in.Float64())
- case "shouldReportCorbBlocking":
- out.ShouldReportCorbBlocking = bool(in.Bool())
default:
in.SkipRecursive()
}
@@ -8003,11 +8076,6 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork73(out *jwriter.Writer
out.RawString(prefix)
out.Float64(float64(in.EncodedDataLength))
}
- if in.ShouldReportCorbBlocking {
- const prefix string = ",\"shouldReportCorbBlocking\":"
- out.RawString(prefix)
- out.Bool(bool(in.ShouldReportCorbBlocking))
- }
out.RawByte('}')
}
@@ -9347,7 +9415,87 @@ func (v *Cookie) UnmarshalJSON(data []byte) error {
func (v *Cookie) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork86(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork87(in *jlexer.Lexer, out *ConnectTiming) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork87(in *jlexer.Lexer, out *ContentSecurityPolicyStatus) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "effectiveDirectives":
+ out.EffectiveDirectives = string(in.String())
+ case "isEnforced":
+ out.IsEnforced = bool(in.Bool())
+ case "source":
+ (out.Source).UnmarshalEasyJSON(in)
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork87(out *jwriter.Writer, in ContentSecurityPolicyStatus) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"effectiveDirectives\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.EffectiveDirectives))
+ }
+ {
+ const prefix string = ",\"isEnforced\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.IsEnforced))
+ }
+ {
+ const prefix string = ",\"source\":"
+ out.RawString(prefix)
+ (in.Source).MarshalEasyJSON(out)
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v ContentSecurityPolicyStatus) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork87(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v ContentSecurityPolicyStatus) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork87(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *ContentSecurityPolicyStatus) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork87(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *ContentSecurityPolicyStatus) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork87(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork88(in *jlexer.Lexer, out *ConnectTiming) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -9378,7 +9526,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork87(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork87(out *jwriter.Writer, in ConnectTiming) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork88(out *jwriter.Writer, in ConnectTiming) {
out.RawByte('{')
first := true
_ = first
@@ -9393,27 +9541,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork87(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v ConnectTiming) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork87(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork88(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ConnectTiming) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork87(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork88(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ConnectTiming) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork87(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork88(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ConnectTiming) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork87(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork88(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork88(in *jlexer.Lexer, out *ClientSecurityState) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork89(in *jlexer.Lexer, out *ClientSecurityState) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -9448,7 +9596,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork88(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork88(out *jwriter.Writer, in ClientSecurityState) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork89(out *jwriter.Writer, in ClientSecurityState) {
out.RawByte('{')
first := true
_ = first
@@ -9473,27 +9621,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork88(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v ClientSecurityState) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork88(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork89(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ClientSecurityState) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork88(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork89(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ClientSecurityState) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork88(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork89(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ClientSecurityState) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork88(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork89(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork89(in *jlexer.Lexer, out *ClearBrowserCookiesParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork90(in *jlexer.Lexer, out *ClearBrowserCookiesParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -9522,7 +9670,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork89(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork89(out *jwriter.Writer, in ClearBrowserCookiesParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork90(out *jwriter.Writer, in ClearBrowserCookiesParams) {
out.RawByte('{')
first := true
_ = first
@@ -9532,27 +9680,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork89(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v ClearBrowserCookiesParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork89(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork90(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ClearBrowserCookiesParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork89(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork90(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ClearBrowserCookiesParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork89(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork90(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ClearBrowserCookiesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork89(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork90(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork90(in *jlexer.Lexer, out *ClearBrowserCacheParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork91(in *jlexer.Lexer, out *ClearBrowserCacheParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -9581,7 +9729,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork90(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork90(out *jwriter.Writer, in ClearBrowserCacheParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork91(out *jwriter.Writer, in ClearBrowserCacheParams) {
out.RawByte('{')
first := true
_ = first
@@ -9591,27 +9739,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork90(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v ClearBrowserCacheParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork90(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork91(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ClearBrowserCacheParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork90(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork91(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ClearBrowserCacheParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork90(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork91(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ClearBrowserCacheParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork90(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork91(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork91(in *jlexer.Lexer, out *ClearAcceptedEncodingsOverrideParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork92(in *jlexer.Lexer, out *ClearAcceptedEncodingsOverrideParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -9640,7 +9788,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork91(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork91(out *jwriter.Writer, in ClearAcceptedEncodingsOverrideParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork92(out *jwriter.Writer, in ClearAcceptedEncodingsOverrideParams) {
out.RawByte('{')
first := true
_ = first
@@ -9650,27 +9798,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork91(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v ClearAcceptedEncodingsOverrideParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork91(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork92(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ClearAcceptedEncodingsOverrideParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork91(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork92(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ClearAcceptedEncodingsOverrideParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork91(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork92(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ClearAcceptedEncodingsOverrideParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork91(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork92(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork92(in *jlexer.Lexer, out *CachedResource) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork93(in *jlexer.Lexer, out *CachedResource) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -9715,7 +9863,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork92(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork92(out *jwriter.Writer, in CachedResource) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork93(out *jwriter.Writer, in CachedResource) {
out.RawByte('{')
first := true
_ = first
@@ -9745,27 +9893,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork92(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v CachedResource) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork92(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork93(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CachedResource) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork92(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork93(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CachedResource) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork92(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork93(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CachedResource) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork92(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork93(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork93(in *jlexer.Lexer, out *BlockedSetCookieWithReason) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork94(in *jlexer.Lexer, out *BlockedSetCookieWithReason) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -9800,9 +9948,9 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork93(in *jlexer.Lexer, o
out.BlockedReasons = (out.BlockedReasons)[:0]
}
for !in.IsDelim(']') {
- var v77 SetCookieBlockedReason
- (v77).UnmarshalEasyJSON(in)
- out.BlockedReasons = append(out.BlockedReasons, v77)
+ var v80 SetCookieBlockedReason
+ (v80).UnmarshalEasyJSON(in)
+ out.BlockedReasons = append(out.BlockedReasons, v80)
in.WantComma()
}
in.Delim(']')
@@ -9829,7 +9977,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork93(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork93(out *jwriter.Writer, in BlockedSetCookieWithReason) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork94(out *jwriter.Writer, in BlockedSetCookieWithReason) {
out.RawByte('{')
first := true
_ = first
@@ -9840,11 +9988,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork93(out *jwriter.Writer
out.RawString("null")
} else {
out.RawByte('[')
- for v78, v79 := range in.BlockedReasons {
- if v78 > 0 {
+ for v81, v82 := range in.BlockedReasons {
+ if v81 > 0 {
out.RawByte(',')
}
- (v79).MarshalEasyJSON(out)
+ (v82).MarshalEasyJSON(out)
}
out.RawByte(']')
}
@@ -9865,27 +10013,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork93(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v BlockedSetCookieWithReason) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork93(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork94(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v BlockedSetCookieWithReason) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork93(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork94(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *BlockedSetCookieWithReason) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork93(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork94(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *BlockedSetCookieWithReason) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork93(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork94(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork94(in *jlexer.Lexer, out *BlockedCookieWithReason) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork95(in *jlexer.Lexer, out *BlockedCookieWithReason) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -9920,9 +10068,9 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork94(in *jlexer.Lexer, o
out.BlockedReasons = (out.BlockedReasons)[:0]
}
for !in.IsDelim(']') {
- var v80 CookieBlockedReason
- (v80).UnmarshalEasyJSON(in)
- out.BlockedReasons = append(out.BlockedReasons, v80)
+ var v83 CookieBlockedReason
+ (v83).UnmarshalEasyJSON(in)
+ out.BlockedReasons = append(out.BlockedReasons, v83)
in.WantComma()
}
in.Delim(']')
@@ -9947,7 +10095,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork94(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork94(out *jwriter.Writer, in BlockedCookieWithReason) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork95(out *jwriter.Writer, in BlockedCookieWithReason) {
out.RawByte('{')
first := true
_ = first
@@ -9958,11 +10106,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork94(out *jwriter.Writer
out.RawString("null")
} else {
out.RawByte('[')
- for v81, v82 := range in.BlockedReasons {
- if v81 > 0 {
+ for v84, v85 := range in.BlockedReasons {
+ if v84 > 0 {
out.RawByte(',')
}
- (v82).MarshalEasyJSON(out)
+ (v85).MarshalEasyJSON(out)
}
out.RawByte(']')
}
@@ -9982,27 +10130,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork94(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v BlockedCookieWithReason) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork94(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork95(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v BlockedCookieWithReason) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork94(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork95(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *BlockedCookieWithReason) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork94(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork95(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *BlockedCookieWithReason) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork94(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork95(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork95(in *jlexer.Lexer, out *AuthChallengeResponse) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork96(in *jlexer.Lexer, out *AuthChallengeResponse) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -10037,7 +10185,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork95(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork95(out *jwriter.Writer, in AuthChallengeResponse) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork96(out *jwriter.Writer, in AuthChallengeResponse) {
out.RawByte('{')
first := true
_ = first
@@ -10062,27 +10210,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork95(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v AuthChallengeResponse) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork95(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork96(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AuthChallengeResponse) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork95(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork96(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AuthChallengeResponse) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork95(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork96(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AuthChallengeResponse) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork95(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork96(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork96(in *jlexer.Lexer, out *AuthChallenge) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork97(in *jlexer.Lexer, out *AuthChallenge) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -10119,7 +10267,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork96(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork96(out *jwriter.Writer, in AuthChallenge) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork97(out *jwriter.Writer, in AuthChallenge) {
out.RawByte('{')
first := true
_ = first
@@ -10155,23 +10303,23 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork96(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v AuthChallenge) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork96(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork97(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AuthChallenge) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork96(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoNetwork97(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AuthChallenge) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork96(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork97(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AuthChallenge) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork96(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoNetwork97(l, v)
}
diff --git a/network/events.go b/network/events.go
index 07b6259..9255992 100644
--- a/network/events.go
+++ b/network/events.go
@@ -45,10 +45,9 @@ type EventLoadingFailed struct {
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Network#event-loadingFinished
type EventLoadingFinished struct {
- RequestID RequestID `json:"requestId"` // Request identifier.
- Timestamp *cdp.MonotonicTime `json:"timestamp"` // Timestamp.
- EncodedDataLength float64 `json:"encodedDataLength"` // Total number of bytes received for this request.
- ShouldReportCorbBlocking bool `json:"shouldReportCorbBlocking,omitempty"` // Set when 1) response was blocked by Cross-Origin Read Blocking and also 2) this needs to be reported to the DevTools console.
+ RequestID RequestID `json:"requestId"` // Request identifier.
+ Timestamp *cdp.MonotonicTime `json:"timestamp"` // Timestamp.
+ EncodedDataLength float64 `json:"encodedDataLength"` // Total number of bytes received for this request.
}
// EventRequestServedFromCache fired if request ended up loading from cache.
@@ -224,12 +223,14 @@ type EventRequestWillBeSentExtraInfo struct {
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Network#event-responseReceivedExtraInfo
type EventResponseReceivedExtraInfo struct {
- RequestID RequestID `json:"requestId"` // Request identifier. Used to match this information to another responseReceived event.
- BlockedCookies []*BlockedSetCookieWithReason `json:"blockedCookies"` // A list of cookies which were not stored from the response along with the corresponding reasons for blocking. The cookies here may not be valid due to syntax errors, which are represented by the invalid cookie line string instead of a proper cookie.
- Headers Headers `json:"headers"` // Raw response headers as they were received over the wire.
- ResourceIPAddressSpace IPAddressSpace `json:"resourceIPAddressSpace"` // The IP address space of the resource. The address space can only be determined once the transport established the connection, so we can't send it in requestWillBeSentExtraInfo.
- StatusCode int64 `json:"statusCode"` // The status code of the response. This is useful in cases the request failed and no responseReceived event is triggered, which is the case for, e.g., CORS errors. This is also the correct status code for cached requests, where the status in responseReceived is a 200 and this will be 304.
- HeadersText string `json:"headersText,omitempty"` // Raw response header text as it was received over the wire. The raw text may not always be available, such as in the case of HTTP/2 or QUIC.
+ RequestID RequestID `json:"requestId"` // Request identifier. Used to match this information to another responseReceived event.
+ BlockedCookies []*BlockedSetCookieWithReason `json:"blockedCookies"` // A list of cookies which were not stored from the response along with the corresponding reasons for blocking. The cookies here may not be valid due to syntax errors, which are represented by the invalid cookie line string instead of a proper cookie.
+ Headers Headers `json:"headers"` // Raw response headers as they were received over the wire.
+ ResourceIPAddressSpace IPAddressSpace `json:"resourceIPAddressSpace"` // The IP address space of the resource. The address space can only be determined once the transport established the connection, so we can't send it in requestWillBeSentExtraInfo.
+ StatusCode int64 `json:"statusCode"` // The status code of the response. This is useful in cases the request failed and no responseReceived event is triggered, which is the case for, e.g., CORS errors. This is also the correct status code for cached requests, where the status in responseReceived is a 200 and this will be 304.
+ HeadersText string `json:"headersText,omitempty"` // Raw response header text as it was received over the wire. The raw text may not always be available, such as in the case of HTTP/2 or QUIC.
+ CookiePartitionKey string `json:"cookiePartitionKey,omitempty"` // The cookie partition key that will be used to store partitioned cookies set in this response. Only sent when partitioned cookies are enabled.
+ CookiePartitionKeyOpaque bool `json:"cookiePartitionKeyOpaque,omitempty"` // True if partitioned cookies are enabled, but the partition key is not serializeable to string.
}
// EventTrustTokenOperationDone fired exactly once for each Trust Token
diff --git a/network/types.go b/network/types.go
index 4a97328..2218c36 100644
--- a/network/types.go
+++ b/network/types.go
@@ -450,6 +450,7 @@ type ResourceTiming struct {
SendEnd float64 `json:"sendEnd"` // Finished sending request.
PushStart float64 `json:"pushStart"` // Time the server started pushing request.
PushEnd float64 `json:"pushEnd"` // Time the server finished pushing request.
+ ReceiveHeadersStart float64 `json:"receiveHeadersStart"` // Started receiving response headers.
ReceiveHeadersEnd float64 `json:"receiveHeadersEnd"` // Finished receiving response headers.
}
@@ -705,36 +706,40 @@ func (t CorsError) String() string {
// CorsError values.
const (
- CorsErrorDisallowedByMode CorsError = "DisallowedByMode"
- CorsErrorInvalidResponse CorsError = "InvalidResponse"
- CorsErrorWildcardOriginNotAllowed CorsError = "WildcardOriginNotAllowed"
- CorsErrorMissingAllowOriginHeader CorsError = "MissingAllowOriginHeader"
- CorsErrorMultipleAllowOriginValues CorsError = "MultipleAllowOriginValues"
- CorsErrorInvalidAllowOriginValue CorsError = "InvalidAllowOriginValue"
- CorsErrorAllowOriginMismatch CorsError = "AllowOriginMismatch"
- CorsErrorInvalidAllowCredentials CorsError = "InvalidAllowCredentials"
- CorsErrorCorsDisabledScheme CorsError = "CorsDisabledScheme"
- CorsErrorPreflightInvalidStatus CorsError = "PreflightInvalidStatus"
- CorsErrorPreflightDisallowedRedirect CorsError = "PreflightDisallowedRedirect"
- CorsErrorPreflightWildcardOriginNotAllowed CorsError = "PreflightWildcardOriginNotAllowed"
- CorsErrorPreflightMissingAllowOriginHeader CorsError = "PreflightMissingAllowOriginHeader"
- CorsErrorPreflightMultipleAllowOriginValues CorsError = "PreflightMultipleAllowOriginValues"
- CorsErrorPreflightInvalidAllowOriginValue CorsError = "PreflightInvalidAllowOriginValue"
- CorsErrorPreflightAllowOriginMismatch CorsError = "PreflightAllowOriginMismatch"
- CorsErrorPreflightInvalidAllowCredentials CorsError = "PreflightInvalidAllowCredentials"
- CorsErrorPreflightMissingAllowExternal CorsError = "PreflightMissingAllowExternal"
- CorsErrorPreflightInvalidAllowExternal CorsError = "PreflightInvalidAllowExternal"
- CorsErrorPreflightMissingAllowPrivateNetwork CorsError = "PreflightMissingAllowPrivateNetwork"
- CorsErrorPreflightInvalidAllowPrivateNetwork CorsError = "PreflightInvalidAllowPrivateNetwork"
- CorsErrorInvalidAllowMethodsPreflightResponse CorsError = "InvalidAllowMethodsPreflightResponse"
- CorsErrorInvalidAllowHeadersPreflightResponse CorsError = "InvalidAllowHeadersPreflightResponse"
- CorsErrorMethodDisallowedByPreflightResponse CorsError = "MethodDisallowedByPreflightResponse"
- CorsErrorHeaderDisallowedByPreflightResponse CorsError = "HeaderDisallowedByPreflightResponse"
- CorsErrorRedirectContainsCredentials CorsError = "RedirectContainsCredentials"
- CorsErrorInsecurePrivateNetwork CorsError = "InsecurePrivateNetwork"
- CorsErrorInvalidPrivateNetworkAccess CorsError = "InvalidPrivateNetworkAccess"
- CorsErrorUnexpectedPrivateNetworkAccess CorsError = "UnexpectedPrivateNetworkAccess"
- CorsErrorNoCorsRedirectModeNotFollow CorsError = "NoCorsRedirectModeNotFollow"
+ CorsErrorDisallowedByMode CorsError = "DisallowedByMode"
+ CorsErrorInvalidResponse CorsError = "InvalidResponse"
+ CorsErrorWildcardOriginNotAllowed CorsError = "WildcardOriginNotAllowed"
+ CorsErrorMissingAllowOriginHeader CorsError = "MissingAllowOriginHeader"
+ CorsErrorMultipleAllowOriginValues CorsError = "MultipleAllowOriginValues"
+ CorsErrorInvalidAllowOriginValue CorsError = "InvalidAllowOriginValue"
+ CorsErrorAllowOriginMismatch CorsError = "AllowOriginMismatch"
+ CorsErrorInvalidAllowCredentials CorsError = "InvalidAllowCredentials"
+ CorsErrorCorsDisabledScheme CorsError = "CorsDisabledScheme"
+ CorsErrorPreflightInvalidStatus CorsError = "PreflightInvalidStatus"
+ CorsErrorPreflightDisallowedRedirect CorsError = "PreflightDisallowedRedirect"
+ CorsErrorPreflightWildcardOriginNotAllowed CorsError = "PreflightWildcardOriginNotAllowed"
+ CorsErrorPreflightMissingAllowOriginHeader CorsError = "PreflightMissingAllowOriginHeader"
+ CorsErrorPreflightMultipleAllowOriginValues CorsError = "PreflightMultipleAllowOriginValues"
+ CorsErrorPreflightInvalidAllowOriginValue CorsError = "PreflightInvalidAllowOriginValue"
+ CorsErrorPreflightAllowOriginMismatch CorsError = "PreflightAllowOriginMismatch"
+ CorsErrorPreflightInvalidAllowCredentials CorsError = "PreflightInvalidAllowCredentials"
+ CorsErrorPreflightMissingAllowExternal CorsError = "PreflightMissingAllowExternal"
+ CorsErrorPreflightInvalidAllowExternal CorsError = "PreflightInvalidAllowExternal"
+ CorsErrorPreflightMissingAllowPrivateNetwork CorsError = "PreflightMissingAllowPrivateNetwork"
+ CorsErrorPreflightInvalidAllowPrivateNetwork CorsError = "PreflightInvalidAllowPrivateNetwork"
+ CorsErrorInvalidAllowMethodsPreflightResponse CorsError = "InvalidAllowMethodsPreflightResponse"
+ CorsErrorInvalidAllowHeadersPreflightResponse CorsError = "InvalidAllowHeadersPreflightResponse"
+ CorsErrorMethodDisallowedByPreflightResponse CorsError = "MethodDisallowedByPreflightResponse"
+ CorsErrorHeaderDisallowedByPreflightResponse CorsError = "HeaderDisallowedByPreflightResponse"
+ CorsErrorRedirectContainsCredentials CorsError = "RedirectContainsCredentials"
+ CorsErrorInsecurePrivateNetwork CorsError = "InsecurePrivateNetwork"
+ CorsErrorInvalidPrivateNetworkAccess CorsError = "InvalidPrivateNetworkAccess"
+ CorsErrorUnexpectedPrivateNetworkAccess CorsError = "UnexpectedPrivateNetworkAccess"
+ CorsErrorNoCorsRedirectModeNotFollow CorsError = "NoCorsRedirectModeNotFollow"
+ CorsErrorPreflightMissingPrivateNetworkAccessID CorsError = "PreflightMissingPrivateNetworkAccessId"
+ CorsErrorPreflightMissingPrivateNetworkAccessName CorsError = "PreflightMissingPrivateNetworkAccessName"
+ CorsErrorPrivateNetworkAccessPermissionUnavailable CorsError = "PrivateNetworkAccessPermissionUnavailable"
+ CorsErrorPrivateNetworkAccessPermissionDenied CorsError = "PrivateNetworkAccessPermissionDenied"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
@@ -811,6 +816,14 @@ func (t *CorsError) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = CorsErrorUnexpectedPrivateNetworkAccess
case CorsErrorNoCorsRedirectModeNotFollow:
*t = CorsErrorNoCorsRedirectModeNotFollow
+ case CorsErrorPreflightMissingPrivateNetworkAccessID:
+ *t = CorsErrorPreflightMissingPrivateNetworkAccessID
+ case CorsErrorPreflightMissingPrivateNetworkAccessName:
+ *t = CorsErrorPreflightMissingPrivateNetworkAccessName
+ case CorsErrorPrivateNetworkAccessPermissionUnavailable:
+ *t = CorsErrorPrivateNetworkAccessPermissionUnavailable
+ case CorsErrorPrivateNetworkAccessPermissionDenied:
+ *t = CorsErrorPrivateNetworkAccessPermissionDenied
default:
in.AddError(fmt.Errorf("unknown CorsError value: %v", v))
@@ -887,8 +900,8 @@ func (t *ServiceWorkerResponseSource) UnmarshalJSON(buf []byte) error {
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Network#type-TrustTokenParams
type TrustTokenParams struct {
- Type TrustTokenOperationType `json:"type"`
- RefreshPolicy TrustTokenParamsRefreshPolicy `json:"refreshPolicy"` // Only set for "token-redemption" type and determine whether to request a fresh SRR or use a still valid cached SRR.
+ Operation TrustTokenOperationType `json:"operation"`
+ RefreshPolicy TrustTokenParamsRefreshPolicy `json:"refreshPolicy"` // Only set for "token-redemption" operation and determine whether to request a fresh SRR or use a still valid cached SRR.
Issuers []string `json:"issuers,omitempty"` // Origins of issuers from whom to request tokens or redemption records.
}
@@ -1024,7 +1037,7 @@ type Response struct {
EncodedDataLength float64 `json:"encodedDataLength"` // Total number of bytes received for this request so far.
Timing *ResourceTiming `json:"timing,omitempty"` // Timing information for the given request.
ServiceWorkerResponseSource ServiceWorkerResponseSource `json:"serviceWorkerResponseSource,omitempty"` // Response source of response from ServiceWorker.
- ResponseTime *cdp.TimeSinceEpoch `json:"responseTime,omitempty"` // The time at which the returned response was generated.
+ ResponseTime *cdp.TimeSinceEpochMilli `json:"responseTime,omitempty"` // The time at which the returned response was generated.
CacheStorageCacheName string `json:"cacheStorageCacheName,omitempty"` // Cache Storage Cache Name.
Protocol string `json:"protocol,omitempty"` // Protocol used to fetch this request.
AlternateProtocolUsage AlternateProtocolUsage `json:"alternateProtocolUsage,omitempty"` // The reason why Chrome uses a specific transport protocol for HTTP semantics.
@@ -1137,6 +1150,7 @@ const (
SetCookieBlockedReasonSamePartyFromCrossPartyContext SetCookieBlockedReason = "SamePartyFromCrossPartyContext"
SetCookieBlockedReasonSamePartyConflictsWithOtherAttributes SetCookieBlockedReason = "SamePartyConflictsWithOtherAttributes"
SetCookieBlockedReasonNameValuePairExceedsMaxSize SetCookieBlockedReason = "NameValuePairExceedsMaxSize"
+ SetCookieBlockedReasonDisallowedCharacter SetCookieBlockedReason = "DisallowedCharacter"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
@@ -1191,6 +1205,8 @@ func (t *SetCookieBlockedReason) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = SetCookieBlockedReasonSamePartyConflictsWithOtherAttributes
case SetCookieBlockedReasonNameValuePairExceedsMaxSize:
*t = SetCookieBlockedReasonNameValuePairExceedsMaxSize
+ case SetCookieBlockedReasonDisallowedCharacter:
+ *t = SetCookieBlockedReasonDisallowedCharacter
default:
in.AddError(fmt.Errorf("unknown SetCookieBlockedReason value: %v", v))
@@ -1426,7 +1442,7 @@ type SignedExchangeHeader struct {
ResponseCode int64 `json:"responseCode"` // Signed exchange response code.
ResponseHeaders Headers `json:"responseHeaders"` // Signed exchange response headers.
Signatures []*SignedExchangeSignature `json:"signatures"` // Signed exchange response signature.
- HeaderIntegrity string `json:"headerIntegrity"` // Signed exchange header integrity hash in the form of "sha256-<base64-hash-value>".
+ HeaderIntegrity string `json:"headerIntegrity"` // Signed exchange header integrity hash in the form of sha256-<base64-hash-value>.
}
// SignedExchangeErrorField field type for a signed exchange related error.
@@ -1520,6 +1536,7 @@ const (
ContentEncodingDeflate ContentEncoding = "deflate"
ContentEncodingGzip ContentEncoding = "gzip"
ContentEncodingBr ContentEncoding = "br"
+ ContentEncodingZstd ContentEncoding = "zstd"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
@@ -1542,6 +1559,8 @@ func (t *ContentEncoding) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = ContentEncodingGzip
case ContentEncodingBr:
*t = ContentEncodingBr
+ case ContentEncodingZstd:
+ *t = ContentEncodingZstd
default:
in.AddError(fmt.Errorf("unknown ContentEncoding value: %v", v))
@@ -1799,12 +1818,67 @@ type CrossOriginEmbedderPolicyStatus struct {
ReportOnlyReportingEndpoint string `json:"reportOnlyReportingEndpoint,omitempty"`
}
+// ContentSecurityPolicySource [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Network#type-ContentSecurityPolicySource
+type ContentSecurityPolicySource string
+
+// String returns the ContentSecurityPolicySource as string value.
+func (t ContentSecurityPolicySource) String() string {
+ return string(t)
+}
+
+// ContentSecurityPolicySource values.
+const (
+ ContentSecurityPolicySourceHTTP ContentSecurityPolicySource = "HTTP"
+ ContentSecurityPolicySourceMeta ContentSecurityPolicySource = "Meta"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t ContentSecurityPolicySource) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t ContentSecurityPolicySource) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *ContentSecurityPolicySource) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch ContentSecurityPolicySource(v) {
+ case ContentSecurityPolicySourceHTTP:
+ *t = ContentSecurityPolicySourceHTTP
+ case ContentSecurityPolicySourceMeta:
+ *t = ContentSecurityPolicySourceMeta
+
+ default:
+ in.AddError(fmt.Errorf("unknown ContentSecurityPolicySource value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *ContentSecurityPolicySource) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
+// ContentSecurityPolicyStatus [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Network#type-ContentSecurityPolicyStatus
+type ContentSecurityPolicyStatus struct {
+ EffectiveDirectives string `json:"effectiveDirectives"`
+ IsEnforced bool `json:"isEnforced"`
+ Source ContentSecurityPolicySource `json:"source"`
+}
+
// SecurityIsolationStatus [no description].
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Network#type-SecurityIsolationStatus
type SecurityIsolationStatus struct {
Coop *CrossOriginOpenerPolicyStatus `json:"coop,omitempty"`
Coep *CrossOriginEmbedderPolicyStatus `json:"coep,omitempty"`
+ Csp []*ContentSecurityPolicyStatus `json:"csp,omitempty"`
}
// ReportStatus the status of a Reporting API report.
@@ -1978,8 +2052,8 @@ func (t *ReferrerPolicy) UnmarshalJSON(buf []byte) error {
return easyjson.Unmarshal(buf, t)
}
-// TrustTokenParamsRefreshPolicy only set for "token-redemption" type and
-// determine whether to request a fresh SRR or use a still valid cached SRR.
+// TrustTokenParamsRefreshPolicy only set for "token-redemption" operation
+// and determine whether to request a fresh SRR or use a still valid cached SRR.
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Network#type-TrustTokenParams
type TrustTokenParamsRefreshPolicy string
@@ -2194,6 +2268,7 @@ func (t TrustTokenOperationDoneStatus) String() string {
const (
TrustTokenOperationDoneStatusOk TrustTokenOperationDoneStatus = "Ok"
TrustTokenOperationDoneStatusInvalidArgument TrustTokenOperationDoneStatus = "InvalidArgument"
+ TrustTokenOperationDoneStatusMissingIssuerKeys TrustTokenOperationDoneStatus = "MissingIssuerKeys"
TrustTokenOperationDoneStatusFailedPrecondition TrustTokenOperationDoneStatus = "FailedPrecondition"
TrustTokenOperationDoneStatusResourceExhausted TrustTokenOperationDoneStatus = "ResourceExhausted"
TrustTokenOperationDoneStatusAlreadyExists TrustTokenOperationDoneStatus = "AlreadyExists"
@@ -2223,6 +2298,8 @@ func (t *TrustTokenOperationDoneStatus) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = TrustTokenOperationDoneStatusOk
case TrustTokenOperationDoneStatusInvalidArgument:
*t = TrustTokenOperationDoneStatusInvalidArgument
+ case TrustTokenOperationDoneStatusMissingIssuerKeys:
+ *t = TrustTokenOperationDoneStatusMissingIssuerKeys
case TrustTokenOperationDoneStatusFailedPrecondition:
*t = TrustTokenOperationDoneStatusFailedPrecondition
case TrustTokenOperationDoneStatusResourceExhausted:
diff --git a/page/easyjson.go b/page/easyjson.go
index cc29cbf..e9c710d 100644
--- a/page/easyjson.go
+++ b/page/easyjson.go
@@ -655,7 +655,139 @@ func (v *SetSPCTransactionModeParams) UnmarshalJSON(data []byte) error {
func (v *SetSPCTransactionModeParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage7(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage8(in *jlexer.Lexer, out *SetLifecycleEventsEnabledParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage8(in *jlexer.Lexer, out *SetRPHRegistrationModeParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "mode":
+ (out.Mode).UnmarshalEasyJSON(in)
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage8(out *jwriter.Writer, in SetRPHRegistrationModeParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"mode\":"
+ out.RawString(prefix[1:])
+ (in.Mode).MarshalEasyJSON(out)
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v SetRPHRegistrationModeParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage8(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v SetRPHRegistrationModeParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage8(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *SetRPHRegistrationModeParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage8(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *SetRPHRegistrationModeParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage8(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage9(in *jlexer.Lexer, out *SetPrerenderingAllowedParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "isAllowed":
+ out.IsAllowed = bool(in.Bool())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage9(out *jwriter.Writer, in SetPrerenderingAllowedParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"isAllowed\":"
+ out.RawString(prefix[1:])
+ out.Bool(bool(in.IsAllowed))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v SetPrerenderingAllowedParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage9(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v SetPrerenderingAllowedParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage9(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *SetPrerenderingAllowedParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage9(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *SetPrerenderingAllowedParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage9(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage10(in *jlexer.Lexer, out *SetLifecycleEventsEnabledParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -686,7 +818,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage8(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage8(out *jwriter.Writer, in SetLifecycleEventsEnabledParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage10(out *jwriter.Writer, in SetLifecycleEventsEnabledParams) {
out.RawByte('{')
first := true
_ = first
@@ -701,27 +833,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage8(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetLifecycleEventsEnabledParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage8(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage10(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetLifecycleEventsEnabledParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage8(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage10(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetLifecycleEventsEnabledParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage8(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage10(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetLifecycleEventsEnabledParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage8(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage10(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage9(in *jlexer.Lexer, out *SetInterceptFileChooserDialogParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage11(in *jlexer.Lexer, out *SetInterceptFileChooserDialogParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -752,7 +884,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage9(in *jlexer.Lexer, out *
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage9(out *jwriter.Writer, in SetInterceptFileChooserDialogParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage11(out *jwriter.Writer, in SetInterceptFileChooserDialogParams) {
out.RawByte('{')
first := true
_ = first
@@ -767,27 +899,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage9(out *jwriter.Writer, in
// MarshalJSON supports json.Marshaler interface
func (v SetInterceptFileChooserDialogParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage9(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage11(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetInterceptFileChooserDialogParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage9(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage11(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetInterceptFileChooserDialogParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage9(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage11(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetInterceptFileChooserDialogParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage9(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage11(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage10(in *jlexer.Lexer, out *SetFontSizesParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage12(in *jlexer.Lexer, out *SetFontSizesParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -826,7 +958,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage10(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage10(out *jwriter.Writer, in SetFontSizesParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage12(out *jwriter.Writer, in SetFontSizesParams) {
out.RawByte('{')
first := true
_ = first
@@ -845,27 +977,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage10(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v SetFontSizesParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage10(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage12(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetFontSizesParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage10(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage12(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetFontSizesParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage10(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage12(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetFontSizesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage10(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage12(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage11(in *jlexer.Lexer, out *SetFontFamiliesParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage13(in *jlexer.Lexer, out *SetFontFamiliesParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -935,7 +1067,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage11(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage11(out *jwriter.Writer, in SetFontFamiliesParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage13(out *jwriter.Writer, in SetFontFamiliesParams) {
out.RawByte('{')
first := true
_ = first
@@ -972,27 +1104,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage11(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v SetFontFamiliesParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage11(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage13(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetFontFamiliesParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage11(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage13(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetFontFamiliesParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage11(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage13(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetFontFamiliesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage11(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage13(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage12(in *jlexer.Lexer, out *SetDocumentContentParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage14(in *jlexer.Lexer, out *SetDocumentContentParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1025,7 +1157,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage12(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage12(out *jwriter.Writer, in SetDocumentContentParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage14(out *jwriter.Writer, in SetDocumentContentParams) {
out.RawByte('{')
first := true
_ = first
@@ -1045,27 +1177,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage12(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v SetDocumentContentParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage12(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage14(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetDocumentContentParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage12(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage14(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetDocumentContentParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage12(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage14(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetDocumentContentParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage12(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage14(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage13(in *jlexer.Lexer, out *SetBypassCSPParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage15(in *jlexer.Lexer, out *SetBypassCSPParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1096,7 +1228,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage13(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage13(out *jwriter.Writer, in SetBypassCSPParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage15(out *jwriter.Writer, in SetBypassCSPParams) {
out.RawByte('{')
first := true
_ = first
@@ -1111,27 +1243,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage13(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v SetBypassCSPParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage13(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage15(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetBypassCSPParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage13(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage15(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetBypassCSPParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage13(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage15(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetBypassCSPParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage13(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage15(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage14(in *jlexer.Lexer, out *SetAdBlockingEnabledParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage16(in *jlexer.Lexer, out *SetAdBlockingEnabledParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1162,7 +1294,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage14(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage14(out *jwriter.Writer, in SetAdBlockingEnabledParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage16(out *jwriter.Writer, in SetAdBlockingEnabledParams) {
out.RawByte('{')
first := true
_ = first
@@ -1177,27 +1309,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage14(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v SetAdBlockingEnabledParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage14(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage16(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetAdBlockingEnabledParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage14(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage16(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetAdBlockingEnabledParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage14(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage16(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetAdBlockingEnabledParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage14(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage16(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage15(in *jlexer.Lexer, out *SearchInResourceReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage17(in *jlexer.Lexer, out *SearchInResourceReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1257,7 +1389,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage15(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage15(out *jwriter.Writer, in SearchInResourceReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage17(out *jwriter.Writer, in SearchInResourceReturns) {
out.RawByte('{')
first := true
_ = first
@@ -1286,27 +1418,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage15(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v SearchInResourceReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage15(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage17(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SearchInResourceReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage15(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage17(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SearchInResourceReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage15(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage17(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SearchInResourceReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage15(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage17(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage16(in *jlexer.Lexer, out *SearchInResourceParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage18(in *jlexer.Lexer, out *SearchInResourceParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1345,7 +1477,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage16(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage16(out *jwriter.Writer, in SearchInResourceParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage18(out *jwriter.Writer, in SearchInResourceParams) {
out.RawByte('{')
first := true
_ = first
@@ -1380,27 +1512,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage16(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v SearchInResourceParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage16(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage18(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SearchInResourceParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage16(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage18(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SearchInResourceParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage16(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage18(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SearchInResourceParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage16(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage18(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage17(in *jlexer.Lexer, out *ScriptFontFamilies) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage19(in *jlexer.Lexer, out *ScriptFontFamilies) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1441,7 +1573,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage17(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage17(out *jwriter.Writer, in ScriptFontFamilies) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage19(out *jwriter.Writer, in ScriptFontFamilies) {
out.RawByte('{')
first := true
_ = first
@@ -1465,27 +1597,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage17(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v ScriptFontFamilies) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage17(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage19(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ScriptFontFamilies) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage17(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage19(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ScriptFontFamilies) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage17(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage19(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ScriptFontFamilies) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage17(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage19(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage18(in *jlexer.Lexer, out *ScreencastFrameMetadata) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage20(in *jlexer.Lexer, out *ScreencastFrameMetadata) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1536,7 +1668,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage18(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage18(out *jwriter.Writer, in ScreencastFrameMetadata) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage20(out *jwriter.Writer, in ScreencastFrameMetadata) {
out.RawByte('{')
first := true
_ = first
@@ -1581,27 +1713,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage18(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v ScreencastFrameMetadata) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage18(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage20(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ScreencastFrameMetadata) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage18(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage20(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ScreencastFrameMetadata) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage18(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage20(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ScreencastFrameMetadata) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage18(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage20(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage19(in *jlexer.Lexer, out *ScreencastFrameAckParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage21(in *jlexer.Lexer, out *ScreencastFrameAckParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1632,7 +1764,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage19(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage19(out *jwriter.Writer, in ScreencastFrameAckParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage21(out *jwriter.Writer, in ScreencastFrameAckParams) {
out.RawByte('{')
first := true
_ = first
@@ -1647,27 +1779,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage19(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v ScreencastFrameAckParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage19(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage21(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ScreencastFrameAckParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage19(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage21(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ScreencastFrameAckParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage19(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage21(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ScreencastFrameAckParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage19(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage21(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage20(in *jlexer.Lexer, out *ResetNavigationHistoryParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage22(in *jlexer.Lexer, out *ResetNavigationHistoryParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1696,7 +1828,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage20(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage20(out *jwriter.Writer, in ResetNavigationHistoryParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage22(out *jwriter.Writer, in ResetNavigationHistoryParams) {
out.RawByte('{')
first := true
_ = first
@@ -1706,27 +1838,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage20(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v ResetNavigationHistoryParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage20(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage22(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ResetNavigationHistoryParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage20(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage22(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ResetNavigationHistoryParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage20(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage22(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ResetNavigationHistoryParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage20(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage22(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage21(in *jlexer.Lexer, out *RemoveScriptToEvaluateOnNewDocumentParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage23(in *jlexer.Lexer, out *RemoveScriptToEvaluateOnNewDocumentParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1757,7 +1889,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage21(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage21(out *jwriter.Writer, in RemoveScriptToEvaluateOnNewDocumentParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage23(out *jwriter.Writer, in RemoveScriptToEvaluateOnNewDocumentParams) {
out.RawByte('{')
first := true
_ = first
@@ -1772,27 +1904,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage21(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v RemoveScriptToEvaluateOnNewDocumentParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage21(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage23(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v RemoveScriptToEvaluateOnNewDocumentParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage21(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage23(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *RemoveScriptToEvaluateOnNewDocumentParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage21(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage23(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *RemoveScriptToEvaluateOnNewDocumentParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage21(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage23(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage22(in *jlexer.Lexer, out *ReloadParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage24(in *jlexer.Lexer, out *ReloadParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1825,7 +1957,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage22(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage22(out *jwriter.Writer, in ReloadParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage24(out *jwriter.Writer, in ReloadParams) {
out.RawByte('{')
first := true
_ = first
@@ -1851,27 +1983,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage22(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v ReloadParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage22(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage24(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ReloadParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage22(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage24(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ReloadParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage22(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage24(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ReloadParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage22(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage24(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage23(in *jlexer.Lexer, out *ProduceCompilationCacheParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage25(in *jlexer.Lexer, out *ProduceCompilationCacheParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1931,7 +2063,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage23(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage23(out *jwriter.Writer, in ProduceCompilationCacheParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage25(out *jwriter.Writer, in ProduceCompilationCacheParams) {
out.RawByte('{')
first := true
_ = first
@@ -1961,27 +2093,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage23(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v ProduceCompilationCacheParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage23(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage25(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ProduceCompilationCacheParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage23(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage25(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ProduceCompilationCacheParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage23(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage25(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ProduceCompilationCacheParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage23(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage25(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage24(in *jlexer.Lexer, out *PrintToPDFReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage26(in *jlexer.Lexer, out *PrintToPDFReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2014,7 +2146,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage24(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage24(out *jwriter.Writer, in PrintToPDFReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage26(out *jwriter.Writer, in PrintToPDFReturns) {
out.RawByte('{')
first := true
_ = first
@@ -2040,27 +2172,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage24(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v PrintToPDFReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage24(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage26(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v PrintToPDFReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage24(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage26(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *PrintToPDFReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage24(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage26(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *PrintToPDFReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage24(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage26(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage25(in *jlexer.Lexer, out *PrintToPDFParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage27(in *jlexer.Lexer, out *PrintToPDFParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2109,6 +2241,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage25(in *jlexer.Lexer, out
out.PreferCSSPageSize = bool(in.Bool())
case "transferMode":
(out.TransferMode).UnmarshalEasyJSON(in)
+ case "generateTaggedPDF":
+ out.GenerateTaggedPDF = bool(in.Bool())
default:
in.SkipRecursive()
}
@@ -2119,7 +2253,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage25(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage25(out *jwriter.Writer, in PrintToPDFParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage27(out *jwriter.Writer, in PrintToPDFParams) {
out.RawByte('{')
first := true
_ = first
@@ -2229,33 +2363,38 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage25(out *jwriter.Writer, i
out.RawString(prefix)
(in.TransferMode).MarshalEasyJSON(out)
}
+ if in.GenerateTaggedPDF {
+ const prefix string = ",\"generateTaggedPDF\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.GenerateTaggedPDF))
+ }
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
func (v PrintToPDFParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage25(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage27(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v PrintToPDFParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage25(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage27(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *PrintToPDFParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage25(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage27(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *PrintToPDFParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage25(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage27(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage26(in *jlexer.Lexer, out *PermissionsPolicyFeatureState) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage28(in *jlexer.Lexer, out *PermissionsPolicyFeatureState) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2298,7 +2437,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage26(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage26(out *jwriter.Writer, in PermissionsPolicyFeatureState) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage28(out *jwriter.Writer, in PermissionsPolicyFeatureState) {
out.RawByte('{')
first := true
_ = first
@@ -2323,27 +2462,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage26(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v PermissionsPolicyFeatureState) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage26(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage28(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v PermissionsPolicyFeatureState) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage26(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage28(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *PermissionsPolicyFeatureState) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage26(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage28(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *PermissionsPolicyFeatureState) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage26(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage28(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage27(in *jlexer.Lexer, out *PermissionsPolicyBlockLocator) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage29(in *jlexer.Lexer, out *PermissionsPolicyBlockLocator) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2376,7 +2515,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage27(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage27(out *jwriter.Writer, in PermissionsPolicyBlockLocator) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage29(out *jwriter.Writer, in PermissionsPolicyBlockLocator) {
out.RawByte('{')
first := true
_ = first
@@ -2396,27 +2535,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage27(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v PermissionsPolicyBlockLocator) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage27(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage29(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v PermissionsPolicyBlockLocator) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage27(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage29(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *PermissionsPolicyBlockLocator) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage27(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage29(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *PermissionsPolicyBlockLocator) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage27(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage29(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage28(in *jlexer.Lexer, out *NavigationEntry) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage30(in *jlexer.Lexer, out *NavigationEntry) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2455,7 +2594,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage28(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage28(out *jwriter.Writer, in NavigationEntry) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage30(out *jwriter.Writer, in NavigationEntry) {
out.RawByte('{')
first := true
_ = first
@@ -2490,27 +2629,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage28(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v NavigationEntry) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage28(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage30(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v NavigationEntry) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage28(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage30(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *NavigationEntry) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage28(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage30(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *NavigationEntry) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage28(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage30(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage29(in *jlexer.Lexer, out *NavigateToHistoryEntryParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage31(in *jlexer.Lexer, out *NavigateToHistoryEntryParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2541,7 +2680,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage29(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage29(out *jwriter.Writer, in NavigateToHistoryEntryParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage31(out *jwriter.Writer, in NavigateToHistoryEntryParams) {
out.RawByte('{')
first := true
_ = first
@@ -2556,27 +2695,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage29(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v NavigateToHistoryEntryParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage29(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage31(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v NavigateToHistoryEntryParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage29(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage31(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *NavigateToHistoryEntryParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage29(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage31(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *NavigateToHistoryEntryParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage29(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage31(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage30(in *jlexer.Lexer, out *NavigateReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage32(in *jlexer.Lexer, out *NavigateReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2611,7 +2750,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage30(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage30(out *jwriter.Writer, in NavigateReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage32(out *jwriter.Writer, in NavigateReturns) {
out.RawByte('{')
first := true
_ = first
@@ -2647,27 +2786,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage30(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v NavigateReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage30(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage32(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v NavigateReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage30(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage32(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *NavigateReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage30(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage32(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *NavigateReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage30(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage32(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage31(in *jlexer.Lexer, out *NavigateParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage33(in *jlexer.Lexer, out *NavigateParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2706,7 +2845,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage31(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage31(out *jwriter.Writer, in NavigateParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage33(out *jwriter.Writer, in NavigateParams) {
out.RawByte('{')
first := true
_ = first
@@ -2741,27 +2880,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage31(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v NavigateParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage31(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage33(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v NavigateParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage31(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage33(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *NavigateParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage31(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage33(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *NavigateParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage31(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage33(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage32(in *jlexer.Lexer, out *LayoutViewport) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage34(in *jlexer.Lexer, out *LayoutViewport) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2798,7 +2937,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage32(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage32(out *jwriter.Writer, in LayoutViewport) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage34(out *jwriter.Writer, in LayoutViewport) {
out.RawByte('{')
first := true
_ = first
@@ -2828,27 +2967,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage32(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v LayoutViewport) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage32(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage34(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v LayoutViewport) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage32(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage34(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *LayoutViewport) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage32(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage34(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *LayoutViewport) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage32(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage34(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage33(in *jlexer.Lexer, out *InstallabilityErrorArgument) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage35(in *jlexer.Lexer, out *InstallabilityErrorArgument) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2881,7 +3020,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage33(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage33(out *jwriter.Writer, in InstallabilityErrorArgument) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage35(out *jwriter.Writer, in InstallabilityErrorArgument) {
out.RawByte('{')
first := true
_ = first
@@ -2901,27 +3040,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage33(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v InstallabilityErrorArgument) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage33(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage35(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v InstallabilityErrorArgument) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage33(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage35(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *InstallabilityErrorArgument) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage33(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage35(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *InstallabilityErrorArgument) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage33(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage35(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage34(in *jlexer.Lexer, out *InstallabilityError) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage36(in *jlexer.Lexer, out *InstallabilityError) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2983,7 +3122,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage34(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage34(out *jwriter.Writer, in InstallabilityError) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage36(out *jwriter.Writer, in InstallabilityError) {
out.RawByte('{')
first := true
_ = first
@@ -3018,27 +3157,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage34(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v InstallabilityError) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage34(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage36(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v InstallabilityError) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage34(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage36(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *InstallabilityError) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage34(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage36(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *InstallabilityError) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage34(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage36(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage35(in *jlexer.Lexer, out *HandleJavaScriptDialogParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage37(in *jlexer.Lexer, out *HandleJavaScriptDialogParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3071,7 +3210,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage35(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage35(out *jwriter.Writer, in HandleJavaScriptDialogParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage37(out *jwriter.Writer, in HandleJavaScriptDialogParams) {
out.RawByte('{')
first := true
_ = first
@@ -3091,27 +3230,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage35(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v HandleJavaScriptDialogParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage35(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage37(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v HandleJavaScriptDialogParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage35(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage37(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *HandleJavaScriptDialogParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage35(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage37(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *HandleJavaScriptDialogParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage35(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage37(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage36(in *jlexer.Lexer, out *GetResourceTreeReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage38(in *jlexer.Lexer, out *GetResourceTreeReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3150,7 +3289,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage36(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage36(out *jwriter.Writer, in GetResourceTreeReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage38(out *jwriter.Writer, in GetResourceTreeReturns) {
out.RawByte('{')
first := true
_ = first
@@ -3166,27 +3305,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage36(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v GetResourceTreeReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage36(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage38(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetResourceTreeReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage36(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage38(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetResourceTreeReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage36(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage38(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetResourceTreeReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage36(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage38(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage37(in *jlexer.Lexer, out *GetResourceTreeParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage39(in *jlexer.Lexer, out *GetResourceTreeParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3215,7 +3354,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage37(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage37(out *jwriter.Writer, in GetResourceTreeParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage39(out *jwriter.Writer, in GetResourceTreeParams) {
out.RawByte('{')
first := true
_ = first
@@ -3225,27 +3364,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage37(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v GetResourceTreeParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage37(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage39(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetResourceTreeParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage37(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage39(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetResourceTreeParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage37(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage39(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetResourceTreeParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage37(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage39(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage38(in *jlexer.Lexer, out *GetResourceContentReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage40(in *jlexer.Lexer, out *GetResourceContentReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3278,7 +3417,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage38(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage38(out *jwriter.Writer, in GetResourceContentReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage40(out *jwriter.Writer, in GetResourceContentReturns) {
out.RawByte('{')
first := true
_ = first
@@ -3304,27 +3443,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage38(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v GetResourceContentReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage38(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage40(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetResourceContentReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage38(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage40(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetResourceContentReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage38(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage40(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetResourceContentReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage38(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage40(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage39(in *jlexer.Lexer, out *GetResourceContentParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage41(in *jlexer.Lexer, out *GetResourceContentParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3357,7 +3496,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage39(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage39(out *jwriter.Writer, in GetResourceContentParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage41(out *jwriter.Writer, in GetResourceContentParams) {
out.RawByte('{')
first := true
_ = first
@@ -3377,27 +3516,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage39(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v GetResourceContentParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage39(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage41(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetResourceContentParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage39(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage41(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetResourceContentParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage39(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage41(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetResourceContentParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage39(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage41(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage40(in *jlexer.Lexer, out *GetPermissionsPolicyStateReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage42(in *jlexer.Lexer, out *GetPermissionsPolicyStateReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3457,7 +3596,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage40(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage40(out *jwriter.Writer, in GetPermissionsPolicyStateReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage42(out *jwriter.Writer, in GetPermissionsPolicyStateReturns) {
out.RawByte('{')
first := true
_ = first
@@ -3486,27 +3625,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage40(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v GetPermissionsPolicyStateReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage40(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage42(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetPermissionsPolicyStateReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage40(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage42(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetPermissionsPolicyStateReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage40(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage42(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetPermissionsPolicyStateReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage40(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage42(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage41(in *jlexer.Lexer, out *GetPermissionsPolicyStateParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage43(in *jlexer.Lexer, out *GetPermissionsPolicyStateParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3537,7 +3676,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage41(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage41(out *jwriter.Writer, in GetPermissionsPolicyStateParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage43(out *jwriter.Writer, in GetPermissionsPolicyStateParams) {
out.RawByte('{')
first := true
_ = first
@@ -3552,27 +3691,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage41(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v GetPermissionsPolicyStateParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage41(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage43(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v GetPermissionsPolicyStateParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage41(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage43(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *GetPermissionsPolicyStateParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage41(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage43(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *GetPermissionsPolicyStateParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage41(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage43(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage42(in *jlexer.Lexer, out *GetOriginTrialsReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage44(in *jlexer.Lexer, out *GetOriginTrialsReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3599,202 +3738,25 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage42(in *jlexer.Lexer, out
in.Delim('[')
if out.OriginTrials == nil {
if !in.IsDelim(']') {
- out.OriginTrials = make([]*cdp.OriginTrial, 0, 8)
- } else {
- out.OriginTrials = []*cdp.OriginTrial{}
- }
- } else {
- out.OriginTrials = (out.OriginTrials)[:0]
- }
- for !in.IsDelim(']') {
- var v16 *cdp.OriginTrial
- if in.IsNull() {
- in.Skip()
- v16 = nil
- } else {
- if v16 == nil {
- v16 = new(cdp.OriginTrial)
- }
- (*v16).UnmarshalEasyJSON(in)
- }
- out.OriginTrials = append(out.OriginTrials, v16)
- in.WantComma()
- }
- in.Delim(']')
- }
- default:
- in.SkipRecursive()
- }
- in.WantComma()
- }
- in.Delim('}')
- if isTopLevel {
- in.Consumed()
- }
-}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage42(out *jwriter.Writer, in GetOriginTrialsReturns) {
- out.RawByte('{')
- first := true
- _ = first
- if len(in.OriginTrials) != 0 {
- const prefix string = ",\"originTrials\":"
- first = false
- out.RawString(prefix[1:])
- {
- out.RawByte('[')
- for v17, v18 := range in.OriginTrials {
- if v17 > 0 {
- out.RawByte(',')
- }
- if v18 == nil {
- out.RawString("null")
- } else {
- (*v18).MarshalEasyJSON(out)
- }
- }
- out.RawByte(']')
- }
- }
- out.RawByte('}')
-}
-
-// MarshalJSON supports json.Marshaler interface
-func (v GetOriginTrialsReturns) MarshalJSON() ([]byte, error) {
- w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage42(&w, v)
- return w.Buffer.BuildBytes(), w.Error
-}
-
-// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetOriginTrialsReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage42(w, v)
-}
-
-// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetOriginTrialsReturns) UnmarshalJSON(data []byte) error {
- r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage42(&r, v)
- return r.Error()
-}
-
-// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetOriginTrialsReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage42(l, v)
-}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage43(in *jlexer.Lexer, out *GetOriginTrialsParams) {
- isTopLevel := in.IsStart()
- if in.IsNull() {
- if isTopLevel {
- in.Consumed()
- }
- in.Skip()
- return
- }
- in.Delim('{')
- for !in.IsDelim('}') {
- key := in.UnsafeFieldName(false)
- in.WantColon()
- if in.IsNull() {
- in.Skip()
- in.WantComma()
- continue
- }
- switch key {
- case "frameId":
- (out.FrameID).UnmarshalEasyJSON(in)
- default:
- in.SkipRecursive()
- }
- in.WantComma()
- }
- in.Delim('}')
- if isTopLevel {
- in.Consumed()
- }
-}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage43(out *jwriter.Writer, in GetOriginTrialsParams) {
- out.RawByte('{')
- first := true
- _ = first
- {
- const prefix string = ",\"frameId\":"
- out.RawString(prefix[1:])
- out.String(string(in.FrameID))
- }
- out.RawByte('}')
-}
-
-// MarshalJSON supports json.Marshaler interface
-func (v GetOriginTrialsParams) MarshalJSON() ([]byte, error) {
- w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage43(&w, v)
- return w.Buffer.BuildBytes(), w.Error
-}
-
-// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetOriginTrialsParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage43(w, v)
-}
-
-// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetOriginTrialsParams) UnmarshalJSON(data []byte) error {
- r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage43(&r, v)
- return r.Error()
-}
-
-// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetOriginTrialsParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage43(l, v)
-}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage44(in *jlexer.Lexer, out *GetNavigationHistoryReturns) {
- isTopLevel := in.IsStart()
- if in.IsNull() {
- if isTopLevel {
- in.Consumed()
- }
- in.Skip()
- return
- }
- in.Delim('{')
- for !in.IsDelim('}') {
- key := in.UnsafeFieldName(false)
- in.WantColon()
- if in.IsNull() {
- in.Skip()
- in.WantComma()
- continue
- }
- switch key {
- case "currentIndex":
- out.CurrentIndex = int64(in.Int64())
- case "entries":
- if in.IsNull() {
- in.Skip()
- out.Entries = nil
- } else {
- in.Delim('[')
- if out.Entries == nil {
- if !in.IsDelim(']') {
- out.Entries = make([]*NavigationEntry, 0, 8)
+ out.OriginTrials = make([]*cdp.OriginTrial, 0, 8)
} else {
- out.Entries = []*NavigationEntry{}
+ out.OriginTrials = []*cdp.OriginTrial{}
}
} else {
- out.Entries = (out.Entries)[:0]
+ out.OriginTrials = (out.OriginTrials)[:0]
}
for !in.IsDelim(']') {
- var v19 *NavigationEntry
+ var v16 *cdp.OriginTrial
if in.IsNull() {
in.Skip()
- v19 = nil
+ v16 = nil
} else {
- if v19 == nil {
- v19 = new(NavigationEntry)
+ if v16 == nil {
+ v16 = new(cdp.OriginTrial)
}
- (*v19).UnmarshalEasyJSON(in)
+ (*v16).UnmarshalEasyJSON(in)
}
- out.Entries = append(out.Entries, v19)
+ out.OriginTrials = append(out.OriginTrials, v16)
in.WantComma()
}
in.Delim(']')
@@ -3809,34 +3771,24 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage44(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage44(out *jwriter.Writer, in GetNavigationHistoryReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage44(out *jwriter.Writer, in GetOriginTrialsReturns) {
out.RawByte('{')
first := true
_ = first
- if in.CurrentIndex != 0 {
- const prefix string = ",\"currentIndex\":"
+ if len(in.OriginTrials) != 0 {
+ const prefix string = ",\"originTrials\":"
first = false
out.RawString(prefix[1:])
- out.Int64(int64(in.CurrentIndex))
- }
- if len(in.Entries) != 0 {
- const prefix string = ",\"entries\":"
- if first {
- first = false
- out.RawString(prefix[1:])
- } else {
- out.RawString(prefix)
- }
{
out.RawByte('[')
- for v20, v21 := range in.Entries {
- if v20 > 0 {
+ for v17, v18 := range in.OriginTrials {
+ if v17 > 0 {
out.RawByte(',')
}
- if v21 == nil {
+ if v18 == nil {
out.RawString("null")
} else {
- (*v21).MarshalEasyJSON(out)
+ (*v18).MarshalEasyJSON(out)
}
}
out.RawByte(']')
@@ -3846,29 +3798,29 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage44(out *jwriter.Writer, i
}
// MarshalJSON supports json.Marshaler interface
-func (v GetNavigationHistoryReturns) MarshalJSON() ([]byte, error) {
+func (v GetOriginTrialsReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage44(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetNavigationHistoryReturns) MarshalEasyJSON(w *jwriter.Writer) {
+func (v GetOriginTrialsReturns) MarshalEasyJSON(w *jwriter.Writer) {
easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage44(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetNavigationHistoryReturns) UnmarshalJSON(data []byte) error {
+func (v *GetOriginTrialsReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage44(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetNavigationHistoryReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
+func (v *GetOriginTrialsReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage44(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage45(in *jlexer.Lexer, out *GetNavigationHistoryParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage45(in *jlexer.Lexer, out *GetOriginTrialsParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3887,6 +3839,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage45(in *jlexer.Lexer, out
continue
}
switch key {
+ case "frameId":
+ (out.FrameID).UnmarshalEasyJSON(in)
default:
in.SkipRecursive()
}
@@ -3897,37 +3851,42 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage45(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage45(out *jwriter.Writer, in GetNavigationHistoryParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage45(out *jwriter.Writer, in GetOriginTrialsParams) {
out.RawByte('{')
first := true
_ = first
+ {
+ const prefix string = ",\"frameId\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.FrameID))
+ }
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetNavigationHistoryParams) MarshalJSON() ([]byte, error) {
+func (v GetOriginTrialsParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage45(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetNavigationHistoryParams) MarshalEasyJSON(w *jwriter.Writer) {
+func (v GetOriginTrialsParams) MarshalEasyJSON(w *jwriter.Writer) {
easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage45(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetNavigationHistoryParams) UnmarshalJSON(data []byte) error {
+func (v *GetOriginTrialsParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage45(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetNavigationHistoryParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+func (v *GetOriginTrialsParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage45(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage46(in *jlexer.Lexer, out *GetManifestIconsReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage46(in *jlexer.Lexer, out *GetNavigationHistoryReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3946,8 +3905,39 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage46(in *jlexer.Lexer, out
continue
}
switch key {
- case "primaryIcon":
- out.PrimaryIcon = string(in.String())
+ case "currentIndex":
+ out.CurrentIndex = int64(in.Int64())
+ case "entries":
+ if in.IsNull() {
+ in.Skip()
+ out.Entries = nil
+ } else {
+ in.Delim('[')
+ if out.Entries == nil {
+ if !in.IsDelim(']') {
+ out.Entries = make([]*NavigationEntry, 0, 8)
+ } else {
+ out.Entries = []*NavigationEntry{}
+ }
+ } else {
+ out.Entries = (out.Entries)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v19 *NavigationEntry
+ if in.IsNull() {
+ in.Skip()
+ v19 = nil
+ } else {
+ if v19 == nil {
+ v19 = new(NavigationEntry)
+ }
+ (*v19).UnmarshalEasyJSON(in)
+ }
+ out.Entries = append(out.Entries, v19)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
default:
in.SkipRecursive()
}
@@ -3958,43 +3948,66 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage46(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage46(out *jwriter.Writer, in GetManifestIconsReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage46(out *jwriter.Writer, in GetNavigationHistoryReturns) {
out.RawByte('{')
first := true
_ = first
- if in.PrimaryIcon != "" {
- const prefix string = ",\"primaryIcon\":"
+ if in.CurrentIndex != 0 {
+ const prefix string = ",\"currentIndex\":"
first = false
out.RawString(prefix[1:])
- out.String(string(in.PrimaryIcon))
+ out.Int64(int64(in.CurrentIndex))
+ }
+ if len(in.Entries) != 0 {
+ const prefix string = ",\"entries\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ {
+ out.RawByte('[')
+ for v20, v21 := range in.Entries {
+ if v20 > 0 {
+ out.RawByte(',')
+ }
+ if v21 == nil {
+ out.RawString("null")
+ } else {
+ (*v21).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetManifestIconsReturns) MarshalJSON() ([]byte, error) {
+func (v GetNavigationHistoryReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage46(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetManifestIconsReturns) MarshalEasyJSON(w *jwriter.Writer) {
+func (v GetNavigationHistoryReturns) MarshalEasyJSON(w *jwriter.Writer) {
easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage46(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetManifestIconsReturns) UnmarshalJSON(data []byte) error {
+func (v *GetNavigationHistoryReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage46(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetManifestIconsReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
+func (v *GetNavigationHistoryReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage46(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage47(in *jlexer.Lexer, out *GetManifestIconsParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage47(in *jlexer.Lexer, out *GetNavigationHistoryParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4023,7 +4036,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage47(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage47(out *jwriter.Writer, in GetManifestIconsParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage47(out *jwriter.Writer, in GetNavigationHistoryParams) {
out.RawByte('{')
first := true
_ = first
@@ -4031,26 +4044,26 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage47(out *jwriter.Writer, i
}
// MarshalJSON supports json.Marshaler interface
-func (v GetManifestIconsParams) MarshalJSON() ([]byte, error) {
+func (v GetNavigationHistoryParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage47(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetManifestIconsParams) MarshalEasyJSON(w *jwriter.Writer) {
+func (v GetNavigationHistoryParams) MarshalEasyJSON(w *jwriter.Writer) {
easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage47(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetManifestIconsParams) UnmarshalJSON(data []byte) error {
+func (v *GetNavigationHistoryParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage47(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetManifestIconsParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+func (v *GetNavigationHistoryParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage47(l, v)
}
func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage48(in *jlexer.Lexer, out *GetLayoutMetricsReturns) {
@@ -6067,94 +6080,7 @@ func (v *EventScreencastFrame) UnmarshalJSON(data []byte) error {
func (v *EventScreencastFrame) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage68(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage69(in *jlexer.Lexer, out *EventPrerenderAttemptCompleted) {
- isTopLevel := in.IsStart()
- if in.IsNull() {
- if isTopLevel {
- in.Consumed()
- }
- in.Skip()
- return
- }
- in.Delim('{')
- for !in.IsDelim('}') {
- key := in.UnsafeFieldName(false)
- in.WantColon()
- if in.IsNull() {
- in.Skip()
- in.WantComma()
- continue
- }
- switch key {
- case "initiatingFrameId":
- (out.InitiatingFrameID).UnmarshalEasyJSON(in)
- case "prerenderingUrl":
- out.PrerenderingURL = string(in.String())
- case "finalStatus":
- (out.FinalStatus).UnmarshalEasyJSON(in)
- case "disallowedApiMethod":
- out.DisallowedAPIMethod = string(in.String())
- default:
- in.SkipRecursive()
- }
- in.WantComma()
- }
- in.Delim('}')
- if isTopLevel {
- in.Consumed()
- }
-}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage69(out *jwriter.Writer, in EventPrerenderAttemptCompleted) {
- out.RawByte('{')
- first := true
- _ = first
- {
- const prefix string = ",\"initiatingFrameId\":"
- out.RawString(prefix[1:])
- out.String(string(in.InitiatingFrameID))
- }
- {
- const prefix string = ",\"prerenderingUrl\":"
- out.RawString(prefix)
- out.String(string(in.PrerenderingURL))
- }
- {
- const prefix string = ",\"finalStatus\":"
- out.RawString(prefix)
- (in.FinalStatus).MarshalEasyJSON(out)
- }
- if in.DisallowedAPIMethod != "" {
- const prefix string = ",\"disallowedApiMethod\":"
- out.RawString(prefix)
- out.String(string(in.DisallowedAPIMethod))
- }
- out.RawByte('}')
-}
-
-// MarshalJSON supports json.Marshaler interface
-func (v EventPrerenderAttemptCompleted) MarshalJSON() ([]byte, error) {
- w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage69(&w, v)
- return w.Buffer.BuildBytes(), w.Error
-}
-
-// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v EventPrerenderAttemptCompleted) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage69(w, v)
-}
-
-// UnmarshalJSON supports json.Unmarshaler interface
-func (v *EventPrerenderAttemptCompleted) UnmarshalJSON(data []byte) error {
- r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage69(&r, v)
- return r.Error()
-}
-
-// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *EventPrerenderAttemptCompleted) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage69(l, v)
-}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage70(in *jlexer.Lexer, out *EventNavigatedWithinDocument) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage69(in *jlexer.Lexer, out *EventNavigatedWithinDocument) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6187,7 +6113,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage70(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage70(out *jwriter.Writer, in EventNavigatedWithinDocument) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage69(out *jwriter.Writer, in EventNavigatedWithinDocument) {
out.RawByte('{')
first := true
_ = first
@@ -6207,27 +6133,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage70(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventNavigatedWithinDocument) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage70(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage69(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventNavigatedWithinDocument) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage70(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage69(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventNavigatedWithinDocument) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage70(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage69(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventNavigatedWithinDocument) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage70(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage69(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage71(in *jlexer.Lexer, out *EventLoadEventFired) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage70(in *jlexer.Lexer, out *EventLoadEventFired) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6266,7 +6192,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage71(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage71(out *jwriter.Writer, in EventLoadEventFired) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage70(out *jwriter.Writer, in EventLoadEventFired) {
out.RawByte('{')
first := true
_ = first
@@ -6285,27 +6211,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage71(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventLoadEventFired) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage71(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage70(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventLoadEventFired) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage71(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage70(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventLoadEventFired) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage71(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage70(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventLoadEventFired) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage71(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage70(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage72(in *jlexer.Lexer, out *EventLifecycleEvent) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage71(in *jlexer.Lexer, out *EventLifecycleEvent) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6350,7 +6276,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage72(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage72(out *jwriter.Writer, in EventLifecycleEvent) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage71(out *jwriter.Writer, in EventLifecycleEvent) {
out.RawByte('{')
first := true
_ = first
@@ -6384,27 +6310,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage72(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventLifecycleEvent) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage72(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage71(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventLifecycleEvent) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage72(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage71(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventLifecycleEvent) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage72(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage71(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventLifecycleEvent) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage72(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage71(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage73(in *jlexer.Lexer, out *EventJavascriptDialogOpening) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage72(in *jlexer.Lexer, out *EventJavascriptDialogOpening) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6443,7 +6369,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage73(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage73(out *jwriter.Writer, in EventJavascriptDialogOpening) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage72(out *jwriter.Writer, in EventJavascriptDialogOpening) {
out.RawByte('{')
first := true
_ = first
@@ -6478,27 +6404,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage73(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventJavascriptDialogOpening) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage73(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage72(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventJavascriptDialogOpening) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage73(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage72(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventJavascriptDialogOpening) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage73(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage72(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventJavascriptDialogOpening) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage73(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage72(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage74(in *jlexer.Lexer, out *EventJavascriptDialogClosed) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage73(in *jlexer.Lexer, out *EventJavascriptDialogClosed) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6531,7 +6457,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage74(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage74(out *jwriter.Writer, in EventJavascriptDialogClosed) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage73(out *jwriter.Writer, in EventJavascriptDialogClosed) {
out.RawByte('{')
first := true
_ = first
@@ -6551,27 +6477,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage74(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventJavascriptDialogClosed) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage74(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage73(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventJavascriptDialogClosed) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage74(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage73(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventJavascriptDialogClosed) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage74(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage73(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventJavascriptDialogClosed) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage74(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage73(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage75(in *jlexer.Lexer, out *EventInterstitialShown) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage74(in *jlexer.Lexer, out *EventInterstitialShown) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6600,7 +6526,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage75(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage75(out *jwriter.Writer, in EventInterstitialShown) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage74(out *jwriter.Writer, in EventInterstitialShown) {
out.RawByte('{')
first := true
_ = first
@@ -6610,27 +6536,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage75(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventInterstitialShown) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage75(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage74(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventInterstitialShown) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage75(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage74(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventInterstitialShown) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage75(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage74(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventInterstitialShown) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage75(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage74(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage76(in *jlexer.Lexer, out *EventInterstitialHidden) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage75(in *jlexer.Lexer, out *EventInterstitialHidden) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6659,7 +6585,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage76(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage76(out *jwriter.Writer, in EventInterstitialHidden) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage75(out *jwriter.Writer, in EventInterstitialHidden) {
out.RawByte('{')
first := true
_ = first
@@ -6669,27 +6595,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage76(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventInterstitialHidden) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage76(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage75(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventInterstitialHidden) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage76(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage75(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventInterstitialHidden) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage76(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage75(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventInterstitialHidden) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage76(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage75(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage77(in *jlexer.Lexer, out *EventFrameStoppedLoading) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage76(in *jlexer.Lexer, out *EventFrameStoppedLoading) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6720,7 +6646,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage77(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage77(out *jwriter.Writer, in EventFrameStoppedLoading) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage76(out *jwriter.Writer, in EventFrameStoppedLoading) {
out.RawByte('{')
first := true
_ = first
@@ -6735,27 +6661,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage77(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventFrameStoppedLoading) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage77(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage76(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventFrameStoppedLoading) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage77(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage76(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventFrameStoppedLoading) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage77(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage76(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventFrameStoppedLoading) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage77(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage76(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage78(in *jlexer.Lexer, out *EventFrameStartedLoading) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage77(in *jlexer.Lexer, out *EventFrameStartedLoading) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6786,7 +6712,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage78(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage78(out *jwriter.Writer, in EventFrameStartedLoading) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage77(out *jwriter.Writer, in EventFrameStartedLoading) {
out.RawByte('{')
first := true
_ = first
@@ -6801,27 +6727,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage78(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventFrameStartedLoading) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage78(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage77(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventFrameStartedLoading) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage78(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage77(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventFrameStartedLoading) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage78(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage77(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventFrameStartedLoading) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage78(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage77(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage79(in *jlexer.Lexer, out *EventFrameResized) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage78(in *jlexer.Lexer, out *EventFrameResized) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6850,7 +6776,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage79(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage79(out *jwriter.Writer, in EventFrameResized) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage78(out *jwriter.Writer, in EventFrameResized) {
out.RawByte('{')
first := true
_ = first
@@ -6860,27 +6786,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage79(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventFrameResized) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage79(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage78(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventFrameResized) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage79(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage78(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventFrameResized) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage79(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage78(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventFrameResized) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage79(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage78(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage80(in *jlexer.Lexer, out *EventFrameRequestedNavigation) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage79(in *jlexer.Lexer, out *EventFrameRequestedNavigation) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -6917,7 +6843,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage80(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage80(out *jwriter.Writer, in EventFrameRequestedNavigation) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage79(out *jwriter.Writer, in EventFrameRequestedNavigation) {
out.RawByte('{')
first := true
_ = first
@@ -6947,27 +6873,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage80(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventFrameRequestedNavigation) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage80(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage79(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventFrameRequestedNavigation) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage80(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage79(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventFrameRequestedNavigation) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage80(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage79(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventFrameRequestedNavigation) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage80(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage79(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage81(in *jlexer.Lexer, out *EventFrameNavigated) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage80(in *jlexer.Lexer, out *EventFrameNavigated) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7008,7 +6934,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage81(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage81(out *jwriter.Writer, in EventFrameNavigated) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage80(out *jwriter.Writer, in EventFrameNavigated) {
out.RawByte('{')
first := true
_ = first
@@ -7032,27 +6958,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage81(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventFrameNavigated) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage81(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage80(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventFrameNavigated) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage81(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage80(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventFrameNavigated) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage81(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage80(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventFrameNavigated) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage81(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage80(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage82(in *jlexer.Lexer, out *EventFrameDetached) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage81(in *jlexer.Lexer, out *EventFrameDetached) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7085,7 +7011,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage82(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage82(out *jwriter.Writer, in EventFrameDetached) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage81(out *jwriter.Writer, in EventFrameDetached) {
out.RawByte('{')
first := true
_ = first
@@ -7105,27 +7031,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage82(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventFrameDetached) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage82(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage81(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventFrameDetached) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage82(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage81(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventFrameDetached) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage82(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage81(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventFrameDetached) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage82(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage81(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage83(in *jlexer.Lexer, out *EventFrameAttached) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage82(in *jlexer.Lexer, out *EventFrameAttached) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7168,7 +7094,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage83(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage83(out *jwriter.Writer, in EventFrameAttached) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage82(out *jwriter.Writer, in EventFrameAttached) {
out.RawByte('{')
first := true
_ = first
@@ -7193,27 +7119,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage83(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventFrameAttached) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage83(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage82(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventFrameAttached) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage83(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage82(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventFrameAttached) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage83(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage82(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventFrameAttached) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage83(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage82(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage84(in *jlexer.Lexer, out *EventFileChooserOpened) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage83(in *jlexer.Lexer, out *EventFileChooserOpened) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7248,7 +7174,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage84(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage84(out *jwriter.Writer, in EventFileChooserOpened) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage83(out *jwriter.Writer, in EventFileChooserOpened) {
out.RawByte('{')
first := true
_ = first
@@ -7273,27 +7199,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage84(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventFileChooserOpened) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage84(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage83(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventFileChooserOpened) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage84(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage83(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventFileChooserOpened) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage84(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage83(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventFileChooserOpened) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage84(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage83(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage85(in *jlexer.Lexer, out *EventDomContentEventFired) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage84(in *jlexer.Lexer, out *EventDomContentEventFired) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7332,7 +7258,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage85(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage85(out *jwriter.Writer, in EventDomContentEventFired) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage84(out *jwriter.Writer, in EventDomContentEventFired) {
out.RawByte('{')
first := true
_ = first
@@ -7351,27 +7277,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage85(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventDomContentEventFired) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage85(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage84(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventDomContentEventFired) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage85(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage84(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventDomContentEventFired) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage85(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage84(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventDomContentEventFired) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage85(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage84(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage86(in *jlexer.Lexer, out *EventDocumentOpened) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage85(in *jlexer.Lexer, out *EventDocumentOpened) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7410,7 +7336,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage86(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage86(out *jwriter.Writer, in EventDocumentOpened) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage85(out *jwriter.Writer, in EventDocumentOpened) {
out.RawByte('{')
first := true
_ = first
@@ -7429,27 +7355,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage86(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventDocumentOpened) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage86(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage85(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventDocumentOpened) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage86(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage85(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventDocumentOpened) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage86(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage85(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventDocumentOpened) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage86(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage85(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage87(in *jlexer.Lexer, out *EventCompilationCacheProduced) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage86(in *jlexer.Lexer, out *EventCompilationCacheProduced) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7482,7 +7408,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage87(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage87(out *jwriter.Writer, in EventCompilationCacheProduced) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage86(out *jwriter.Writer, in EventCompilationCacheProduced) {
out.RawByte('{')
first := true
_ = first
@@ -7502,27 +7428,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage87(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventCompilationCacheProduced) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage87(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage86(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventCompilationCacheProduced) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage87(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage86(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventCompilationCacheProduced) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage87(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage86(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventCompilationCacheProduced) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage87(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage86(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage88(in *jlexer.Lexer, out *EventBackForwardCacheNotUsed) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage87(in *jlexer.Lexer, out *EventBackForwardCacheNotUsed) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7596,7 +7522,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage88(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage88(out *jwriter.Writer, in EventBackForwardCacheNotUsed) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage87(out *jwriter.Writer, in EventBackForwardCacheNotUsed) {
out.RawByte('{')
first := true
_ = first
@@ -7641,27 +7567,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage88(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EventBackForwardCacheNotUsed) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage88(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage87(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EventBackForwardCacheNotUsed) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage88(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage87(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EventBackForwardCacheNotUsed) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage88(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage87(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EventBackForwardCacheNotUsed) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage88(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage87(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage89(in *jlexer.Lexer, out *EnableParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage88(in *jlexer.Lexer, out *EnableParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7690,7 +7616,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage89(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage89(out *jwriter.Writer, in EnableParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage88(out *jwriter.Writer, in EnableParams) {
out.RawByte('{')
first := true
_ = first
@@ -7700,27 +7626,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage89(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v EnableParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage89(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage88(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v EnableParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage89(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage88(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *EnableParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage89(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage88(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *EnableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage89(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage88(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage90(in *jlexer.Lexer, out *DisableParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage89(in *jlexer.Lexer, out *DisableParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7749,7 +7675,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage90(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage90(out *jwriter.Writer, in DisableParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage89(out *jwriter.Writer, in DisableParams) {
out.RawByte('{')
first := true
_ = first
@@ -7759,27 +7685,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage90(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v DisableParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage90(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage89(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v DisableParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage90(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage89(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *DisableParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage90(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage89(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *DisableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage90(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage89(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage91(in *jlexer.Lexer, out *CreateIsolatedWorldReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage90(in *jlexer.Lexer, out *CreateIsolatedWorldReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7810,7 +7736,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage91(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage91(out *jwriter.Writer, in CreateIsolatedWorldReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage90(out *jwriter.Writer, in CreateIsolatedWorldReturns) {
out.RawByte('{')
first := true
_ = first
@@ -7826,27 +7752,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage91(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v CreateIsolatedWorldReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage91(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage90(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CreateIsolatedWorldReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage91(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage90(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CreateIsolatedWorldReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage91(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage90(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CreateIsolatedWorldReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage91(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage90(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage92(in *jlexer.Lexer, out *CreateIsolatedWorldParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage91(in *jlexer.Lexer, out *CreateIsolatedWorldParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7881,7 +7807,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage92(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage92(out *jwriter.Writer, in CreateIsolatedWorldParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage91(out *jwriter.Writer, in CreateIsolatedWorldParams) {
out.RawByte('{')
first := true
_ = first
@@ -7906,27 +7832,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage92(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v CreateIsolatedWorldParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage92(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage91(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CreateIsolatedWorldParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage92(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage91(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CreateIsolatedWorldParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage92(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage91(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CreateIsolatedWorldParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage92(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage91(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage93(in *jlexer.Lexer, out *CrashParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage92(in *jlexer.Lexer, out *CrashParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -7955,7 +7881,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage93(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage93(out *jwriter.Writer, in CrashParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage92(out *jwriter.Writer, in CrashParams) {
out.RawByte('{')
first := true
_ = first
@@ -7965,27 +7891,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage93(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v CrashParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage93(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage92(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CrashParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage93(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage92(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CrashParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage93(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage92(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CrashParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage93(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage92(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage94(in *jlexer.Lexer, out *CompilationCacheParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage93(in *jlexer.Lexer, out *CompilationCacheParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8018,7 +7944,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage94(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage94(out *jwriter.Writer, in CompilationCacheParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage93(out *jwriter.Writer, in CompilationCacheParams) {
out.RawByte('{')
first := true
_ = first
@@ -8038,27 +7964,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage94(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v CompilationCacheParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage94(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage93(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CompilationCacheParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage94(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage93(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CompilationCacheParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage94(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage93(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CompilationCacheParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage94(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage93(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage95(in *jlexer.Lexer, out *CloseParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage94(in *jlexer.Lexer, out *CloseParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8087,7 +8013,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage95(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage95(out *jwriter.Writer, in CloseParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage94(out *jwriter.Writer, in CloseParams) {
out.RawByte('{')
first := true
_ = first
@@ -8097,27 +8023,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage95(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v CloseParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage95(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage94(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CloseParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage95(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage94(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CloseParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage95(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage94(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CloseParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage95(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage94(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage96(in *jlexer.Lexer, out *ClearCompilationCacheParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage95(in *jlexer.Lexer, out *ClearCompilationCacheParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8146,7 +8072,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage96(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage96(out *jwriter.Writer, in ClearCompilationCacheParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage95(out *jwriter.Writer, in ClearCompilationCacheParams) {
out.RawByte('{')
first := true
_ = first
@@ -8156,27 +8082,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage96(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v ClearCompilationCacheParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage96(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage95(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v ClearCompilationCacheParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage96(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage95(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *ClearCompilationCacheParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage96(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage95(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *ClearCompilationCacheParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage96(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage95(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage97(in *jlexer.Lexer, out *CaptureSnapshotReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage96(in *jlexer.Lexer, out *CaptureSnapshotReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8207,7 +8133,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage97(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage97(out *jwriter.Writer, in CaptureSnapshotReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage96(out *jwriter.Writer, in CaptureSnapshotReturns) {
out.RawByte('{')
first := true
_ = first
@@ -8223,27 +8149,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage97(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v CaptureSnapshotReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage97(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage96(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CaptureSnapshotReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage97(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage96(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CaptureSnapshotReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage97(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage96(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CaptureSnapshotReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage97(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage96(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage98(in *jlexer.Lexer, out *CaptureSnapshotParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage97(in *jlexer.Lexer, out *CaptureSnapshotParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8274,7 +8200,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage98(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage98(out *jwriter.Writer, in CaptureSnapshotParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage97(out *jwriter.Writer, in CaptureSnapshotParams) {
out.RawByte('{')
first := true
_ = first
@@ -8290,27 +8216,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage98(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v CaptureSnapshotParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage98(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage97(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CaptureSnapshotParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage98(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage97(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CaptureSnapshotParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage98(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage97(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CaptureSnapshotParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage98(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage97(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage99(in *jlexer.Lexer, out *CaptureScreenshotReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage98(in *jlexer.Lexer, out *CaptureScreenshotReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8341,7 +8267,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage99(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage99(out *jwriter.Writer, in CaptureScreenshotReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage98(out *jwriter.Writer, in CaptureScreenshotReturns) {
out.RawByte('{')
first := true
_ = first
@@ -8357,27 +8283,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage99(out *jwriter.Writer, i
// MarshalJSON supports json.Marshaler interface
func (v CaptureScreenshotReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage99(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage98(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CaptureScreenshotReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage99(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage98(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CaptureScreenshotReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage99(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage98(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CaptureScreenshotReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage99(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage98(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage100(in *jlexer.Lexer, out *CaptureScreenshotParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage99(in *jlexer.Lexer, out *CaptureScreenshotParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8426,7 +8352,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage100(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage100(out *jwriter.Writer, in CaptureScreenshotParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage99(out *jwriter.Writer, in CaptureScreenshotParams) {
out.RawByte('{')
first := true
_ = first
@@ -8492,27 +8418,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage100(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v CaptureScreenshotParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage100(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage99(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CaptureScreenshotParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage100(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage99(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CaptureScreenshotParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage100(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage99(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CaptureScreenshotParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage100(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage99(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage101(in *jlexer.Lexer, out *BringToFrontParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage100(in *jlexer.Lexer, out *BringToFrontParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8541,7 +8467,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage101(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage101(out *jwriter.Writer, in BringToFrontParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage100(out *jwriter.Writer, in BringToFrontParams) {
out.RawByte('{')
first := true
_ = first
@@ -8551,27 +8477,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage101(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v BringToFrontParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage101(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage100(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v BringToFrontParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage101(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage100(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *BringToFrontParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage101(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage100(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *BringToFrontParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage101(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage100(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage102(in *jlexer.Lexer, out *BackForwardCacheNotRestoredExplanationTree) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage101(in *jlexer.Lexer, out *BackForwardCacheNotRestoredExplanationTree) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8664,7 +8590,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage102(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage102(out *jwriter.Writer, in BackForwardCacheNotRestoredExplanationTree) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage101(out *jwriter.Writer, in BackForwardCacheNotRestoredExplanationTree) {
out.RawByte('{')
first := true
_ = first
@@ -8719,27 +8645,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage102(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v BackForwardCacheNotRestoredExplanationTree) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage102(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage101(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v BackForwardCacheNotRestoredExplanationTree) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage102(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage101(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *BackForwardCacheNotRestoredExplanationTree) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage102(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage101(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *BackForwardCacheNotRestoredExplanationTree) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage102(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage101(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage103(in *jlexer.Lexer, out *BackForwardCacheNotRestoredExplanation) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage102(in *jlexer.Lexer, out *BackForwardCacheNotRestoredExplanation) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8774,7 +8700,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage103(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage103(out *jwriter.Writer, in BackForwardCacheNotRestoredExplanation) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage102(out *jwriter.Writer, in BackForwardCacheNotRestoredExplanation) {
out.RawByte('{')
first := true
_ = first
@@ -8799,27 +8725,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage103(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v BackForwardCacheNotRestoredExplanation) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage103(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage102(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v BackForwardCacheNotRestoredExplanation) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage103(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage102(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *BackForwardCacheNotRestoredExplanation) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage103(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage102(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *BackForwardCacheNotRestoredExplanation) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage103(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage102(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage104(in *jlexer.Lexer, out *AppManifestParsedProperties) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage103(in *jlexer.Lexer, out *AppManifestParsedProperties) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8850,7 +8776,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage104(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage104(out *jwriter.Writer, in AppManifestParsedProperties) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage103(out *jwriter.Writer, in AppManifestParsedProperties) {
out.RawByte('{')
first := true
_ = first
@@ -8865,27 +8791,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage104(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v AppManifestParsedProperties) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage104(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage103(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AppManifestParsedProperties) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage104(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage103(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AppManifestParsedProperties) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage104(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage103(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AppManifestParsedProperties) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage104(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage103(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage105(in *jlexer.Lexer, out *AppManifestError) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage104(in *jlexer.Lexer, out *AppManifestError) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -8922,7 +8848,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage105(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage105(out *jwriter.Writer, in AppManifestError) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage104(out *jwriter.Writer, in AppManifestError) {
out.RawByte('{')
first := true
_ = first
@@ -8952,27 +8878,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage105(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v AppManifestError) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage105(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage104(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AppManifestError) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage105(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage104(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AppManifestError) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage105(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage104(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AppManifestError) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage105(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage104(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage106(in *jlexer.Lexer, out *AddScriptToEvaluateOnNewDocumentReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage105(in *jlexer.Lexer, out *AddScriptToEvaluateOnNewDocumentReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -9003,7 +8929,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage106(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage106(out *jwriter.Writer, in AddScriptToEvaluateOnNewDocumentReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage105(out *jwriter.Writer, in AddScriptToEvaluateOnNewDocumentReturns) {
out.RawByte('{')
first := true
_ = first
@@ -9019,27 +8945,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage106(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v AddScriptToEvaluateOnNewDocumentReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage106(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage105(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AddScriptToEvaluateOnNewDocumentReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage106(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage105(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AddScriptToEvaluateOnNewDocumentReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage106(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage105(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AddScriptToEvaluateOnNewDocumentReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage106(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage105(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage107(in *jlexer.Lexer, out *AddScriptToEvaluateOnNewDocumentParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage106(in *jlexer.Lexer, out *AddScriptToEvaluateOnNewDocumentParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -9064,6 +8990,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage107(in *jlexer.Lexer, out
out.WorldName = string(in.String())
case "includeCommandLineAPI":
out.IncludeCommandLineAPI = bool(in.Bool())
+ case "runImmediately":
+ out.RunImmediately = bool(in.Bool())
default:
in.SkipRecursive()
}
@@ -9074,7 +9002,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage107(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage107(out *jwriter.Writer, in AddScriptToEvaluateOnNewDocumentParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage106(out *jwriter.Writer, in AddScriptToEvaluateOnNewDocumentParams) {
out.RawByte('{')
first := true
_ = first
@@ -9093,33 +9021,38 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage107(out *jwriter.Writer,
out.RawString(prefix)
out.Bool(bool(in.IncludeCommandLineAPI))
}
+ if in.RunImmediately {
+ const prefix string = ",\"runImmediately\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.RunImmediately))
+ }
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
func (v AddScriptToEvaluateOnNewDocumentParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage107(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage106(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AddScriptToEvaluateOnNewDocumentParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage107(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage106(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AddScriptToEvaluateOnNewDocumentParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage107(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage106(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AddScriptToEvaluateOnNewDocumentParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage107(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage106(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage108(in *jlexer.Lexer, out *AddCompilationCacheParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage107(in *jlexer.Lexer, out *AddCompilationCacheParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -9152,7 +9085,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage108(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage108(out *jwriter.Writer, in AddCompilationCacheParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage107(out *jwriter.Writer, in AddCompilationCacheParams) {
out.RawByte('{')
first := true
_ = first
@@ -9172,27 +9105,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage108(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v AddCompilationCacheParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage108(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage107(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AddCompilationCacheParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage108(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage107(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AddCompilationCacheParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage108(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage107(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AddCompilationCacheParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage108(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage107(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage109(in *jlexer.Lexer, out *AdScriptID) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage108(in *jlexer.Lexer, out *AdScriptID) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -9225,7 +9158,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage109(in *jlexer.Lexer, out
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage109(out *jwriter.Writer, in AdScriptID) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage108(out *jwriter.Writer, in AdScriptID) {
out.RawByte('{')
first := true
_ = first
@@ -9245,23 +9178,23 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage109(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v AdScriptID) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage109(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage108(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AdScriptID) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage109(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPage108(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AdScriptID) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage109(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage108(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AdScriptID) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage109(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPage108(l, v)
}
diff --git a/page/events.go b/page/events.go
index 6339972..e37e12f 100644
--- a/page/events.go
+++ b/page/events.go
@@ -143,17 +143,6 @@ type EventBackForwardCacheNotUsed struct {
NotRestoredExplanationsTree *BackForwardCacheNotRestoredExplanationTree `json:"notRestoredExplanationsTree,omitempty"` // Tree structure of reasons why the page could not be cached for each frame.
}
-// EventPrerenderAttemptCompleted fired when a prerender attempt is
-// completed.
-//
-// See: https://chromedevtools.github.io/devtools-protocol/tot/Page#event-prerenderAttemptCompleted
-type EventPrerenderAttemptCompleted struct {
- InitiatingFrameID cdp.FrameID `json:"initiatingFrameId"` // The frame id of the frame initiating prerendering.
- PrerenderingURL string `json:"prerenderingUrl"`
- FinalStatus PrerenderFinalStatus `json:"finalStatus"`
- DisallowedAPIMethod string `json:"disallowedApiMethod,omitempty"` // This is used to give users more information about the name of the API call that is incompatible with prerender and has caused the cancellation of the attempt
-}
-
// EventLoadEventFired [no description].
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Page#event-loadEventFired
diff --git a/page/page.go b/page/page.go
index cea3a96..02936d1 100644
--- a/page/page.go
+++ b/page/page.go
@@ -26,6 +26,7 @@ type AddScriptToEvaluateOnNewDocumentParams struct {
Source string `json:"source"`
WorldName string `json:"worldName,omitempty"` // If specified, creates an isolated world with the given name and evaluates given script in it. This world name will be used as the ExecutionContextDescription::name when the corresponding event is emitted.
IncludeCommandLineAPI bool `json:"includeCommandLineAPI,omitempty"` // Specifies whether command line API should be available to the script, defaults to false.
+ RunImmediately bool `json:"runImmediately,omitempty"` // If true, runs the script immediately on existing execution contexts or worlds. Default: false.
}
// AddScriptToEvaluateOnNewDocument evaluates given script in every frame
@@ -57,6 +58,13 @@ func (p AddScriptToEvaluateOnNewDocumentParams) WithIncludeCommandLineAPI(includ
return &p
}
+// WithRunImmediately if true, runs the script immediately on existing
+// execution contexts or worlds. Default: false.
+func (p AddScriptToEvaluateOnNewDocumentParams) WithRunImmediately(runImmediately bool) *AddScriptToEvaluateOnNewDocumentParams {
+ p.RunImmediately = runImmediately
+ return &p
+}
+
// AddScriptToEvaluateOnNewDocumentReturns return values.
type AddScriptToEvaluateOnNewDocumentReturns struct {
Identifier ScriptIdentifier `json:"identifier,omitempty"` // Identifier of the added script.
@@ -375,43 +383,6 @@ func (p *GetInstallabilityErrorsParams) Do(ctx context.Context) (installabilityE
return res.InstallabilityErrors, nil
}
-// GetManifestIconsParams [no description].
-type GetManifestIconsParams struct{}
-
-// GetManifestIcons [no description].
-//
-// See: https://chromedevtools.github.io/devtools-protocol/tot/Page#method-getManifestIcons
-func GetManifestIcons() *GetManifestIconsParams {
- return &GetManifestIconsParams{}
-}
-
-// GetManifestIconsReturns return values.
-type GetManifestIconsReturns struct {
- PrimaryIcon string `json:"primaryIcon,omitempty"`
-}
-
-// Do executes Page.getManifestIcons against the provided context.
-//
-// returns:
-//
-// primaryIcon
-func (p *GetManifestIconsParams) Do(ctx context.Context) (primaryIcon []byte, err error) {
- // execute
- var res GetManifestIconsReturns
- err = cdp.Execute(ctx, CommandGetManifestIcons, nil, &res)
- if err != nil {
- return nil, err
- }
-
- // decode
- var dec []byte
- dec, err = base64.StdEncoding.DecodeString(res.PrimaryIcon)
- if err != nil {
- return nil, err
- }
- return dec, nil
-}
-
// GetAppIDParams returns the unique (PWA) app id. Only returns values if the
// feature flag 'WebAppEnableManifestId' is enabled.
type GetAppIDParams struct{}
@@ -840,6 +811,7 @@ type PrintToPDFParams struct {
FooterTemplate string `json:"footerTemplate,omitempty"` // HTML template for the print footer. Should use the same format as the headerTemplate.
PreferCSSPageSize bool `json:"preferCSSPageSize,omitempty"` // Whether or not to prefer page size as defined by css. Defaults to false, in which case the content will be scaled to fit the paper size.
TransferMode PrintToPDFTransferMode `json:"transferMode,omitempty"` // return as stream
+ GenerateTaggedPDF bool `json:"generateTaggedPDF,omitempty"` // Whether or not to generate tagged (accessible) PDF. Defaults to embedder choice.
}
// PrintToPDF print page as PDF.
@@ -955,6 +927,13 @@ func (p PrintToPDFParams) WithTransferMode(transferMode PrintToPDFTransferMode)
return &p
}
+// WithGenerateTaggedPDF whether or not to generate tagged (accessible) PDF.
+// Defaults to embedder choice.
+func (p PrintToPDFParams) WithGenerateTaggedPDF(generateTaggedPDF bool) *PrintToPDFParams {
+ p.GenerateTaggedPDF = generateTaggedPDF
+ return &p
+}
+
// PrintToPDFReturns return values.
type PrintToPDFReturns struct {
Data string `json:"data,omitempty"` // Base64-encoded pdf data. Empty if |returnAsStream| is specified.
@@ -1580,7 +1559,7 @@ func (p *ClearCompilationCacheParams) Do(ctx context.Context) (err error) {
// transaction mode.
// https://w3c.github.io/secure-payment-confirmation/#sctn-automation-set-spc-transaction-mode.
type SetSPCTransactionModeParams struct {
- Mode SetSPCTransactionModeMode `json:"mode"`
+ Mode AutoResponseMode `json:"mode"`
}
// SetSPCTransactionMode sets the Secure Payment Confirmation transaction
@@ -1592,7 +1571,7 @@ type SetSPCTransactionModeParams struct {
// parameters:
//
// mode
-func SetSPCTransactionMode(mode SetSPCTransactionModeMode) *SetSPCTransactionModeParams {
+func SetSPCTransactionMode(mode AutoResponseMode) *SetSPCTransactionModeParams {
return &SetSPCTransactionModeParams{
Mode: mode,
}
@@ -1603,6 +1582,31 @@ func (p *SetSPCTransactionModeParams) Do(ctx context.Context) (err error) {
return cdp.Execute(ctx, CommandSetSPCTransactionMode, p, nil)
}
+// SetRPHRegistrationModeParams extensions for Custom Handlers API:
+// https://html.spec.whatwg.org/multipage/system-state.html#rph-automation.
+type SetRPHRegistrationModeParams struct {
+ Mode AutoResponseMode `json:"mode"`
+}
+
+// SetRPHRegistrationMode extensions for Custom Handlers API:
+// https://html.spec.whatwg.org/multipage/system-state.html#rph-automation.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Page#method-setRPHRegistrationMode
+//
+// parameters:
+//
+// mode
+func SetRPHRegistrationMode(mode AutoResponseMode) *SetRPHRegistrationModeParams {
+ return &SetRPHRegistrationModeParams{
+ Mode: mode,
+ }
+}
+
+// Do executes Page.setRPHRegistrationMode against the provided context.
+func (p *SetRPHRegistrationModeParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandSetRPHRegistrationMode, p, nil)
+}
+
// GenerateTestReportParams generates a report for testing.
type GenerateTestReportParams struct {
Message string `json:"message"` // Message to be displayed in the report.
@@ -1679,6 +1683,37 @@ func (p *SetInterceptFileChooserDialogParams) Do(ctx context.Context) (err error
return cdp.Execute(ctx, CommandSetInterceptFileChooserDialog, p, nil)
}
+// SetPrerenderingAllowedParams enable/disable prerendering manually. This
+// command is a short-term solution for https://crbug.com/1440085. See
+// https://docs.google.com/document/d/12HVmFxYj5Jc-eJr5OmWsa2bqTJsbgGLKI6ZIyx0_wpA
+// for more details. TODO(https://crbug.com/1440085): Remove this once Puppeteer
+// supports tab targets.
+type SetPrerenderingAllowedParams struct {
+ IsAllowed bool `json:"isAllowed"`
+}
+
+// SetPrerenderingAllowed enable/disable prerendering manually. This command
+// is a short-term solution for https://crbug.com/1440085. See
+// https://docs.google.com/document/d/12HVmFxYj5Jc-eJr5OmWsa2bqTJsbgGLKI6ZIyx0_wpA
+// for more details. TODO(https://crbug.com/1440085): Remove this once Puppeteer
+// supports tab targets.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Page#method-setPrerenderingAllowed
+//
+// parameters:
+//
+// isAllowed
+func SetPrerenderingAllowed(isAllowed bool) *SetPrerenderingAllowedParams {
+ return &SetPrerenderingAllowedParams{
+ IsAllowed: isAllowed,
+ }
+}
+
+// Do executes Page.setPrerenderingAllowed against the provided context.
+func (p *SetPrerenderingAllowedParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandSetPrerenderingAllowed, p, nil)
+}
+
// Command names.
const (
CommandAddScriptToEvaluateOnNewDocument = "Page.addScriptToEvaluateOnNewDocument"
@@ -1690,7 +1725,6 @@ const (
CommandEnable = "Page.enable"
CommandGetAppManifest = "Page.getAppManifest"
CommandGetInstallabilityErrors = "Page.getInstallabilityErrors"
- CommandGetManifestIcons = "Page.getManifestIcons"
CommandGetAppID = "Page.getAppId"
CommandGetAdScriptID = "Page.getAdScriptId"
CommandGetFrameTree = "Page.getFrameTree"
@@ -1725,7 +1759,9 @@ const (
CommandAddCompilationCache = "Page.addCompilationCache"
CommandClearCompilationCache = "Page.clearCompilationCache"
CommandSetSPCTransactionMode = "Page.setSPCTransactionMode"
+ CommandSetRPHRegistrationMode = "Page.setRPHRegistrationMode"
CommandGenerateTestReport = "Page.generateTestReport"
CommandWaitForDebugger = "Page.waitForDebugger"
CommandSetInterceptFileChooserDialog = "Page.setInterceptFileChooserDialog"
+ CommandSetPrerenderingAllowed = "Page.setPrerenderingAllowed"
)
diff --git a/page/types.go b/page/types.go
index 8f3ef16..15eff0f 100644
--- a/page/types.go
+++ b/page/types.go
@@ -57,11 +57,10 @@ const (
PermissionsPolicyFeatureChUaPlatform PermissionsPolicyFeature = "ch-ua-platform"
PermissionsPolicyFeatureChUaModel PermissionsPolicyFeature = "ch-ua-model"
PermissionsPolicyFeatureChUaMobile PermissionsPolicyFeature = "ch-ua-mobile"
- PermissionsPolicyFeatureChUaFull PermissionsPolicyFeature = "ch-ua-full"
+ PermissionsPolicyFeatureChUaFormFactor PermissionsPolicyFeature = "ch-ua-form-factor"
PermissionsPolicyFeatureChUaFullVersion PermissionsPolicyFeature = "ch-ua-full-version"
PermissionsPolicyFeatureChUaFullVersionList PermissionsPolicyFeature = "ch-ua-full-version-list"
PermissionsPolicyFeatureChUaPlatformVersion PermissionsPolicyFeature = "ch-ua-platform-version"
- PermissionsPolicyFeatureChUaReduced PermissionsPolicyFeature = "ch-ua-reduced"
PermissionsPolicyFeatureChUaWow64 PermissionsPolicyFeature = "ch-ua-wow64"
PermissionsPolicyFeatureChViewportHeight PermissionsPolicyFeature = "ch-viewport-height"
PermissionsPolicyFeatureChViewportWidth PermissionsPolicyFeature = "ch-viewport-width"
@@ -96,6 +95,8 @@ const (
PermissionsPolicyFeaturePayment PermissionsPolicyFeature = "payment"
PermissionsPolicyFeaturePictureInPicture PermissionsPolicyFeature = "picture-in-picture"
PermissionsPolicyFeaturePrivateAggregation PermissionsPolicyFeature = "private-aggregation"
+ PermissionsPolicyFeaturePrivateStateTokenIssuance PermissionsPolicyFeature = "private-state-token-issuance"
+ PermissionsPolicyFeaturePrivateStateTokenRedemption PermissionsPolicyFeature = "private-state-token-redemption"
PermissionsPolicyFeaturePublickeyCredentialsGet PermissionsPolicyFeature = "publickey-credentials-get"
PermissionsPolicyFeatureRunAdAuction PermissionsPolicyFeature = "run-ad-auction"
PermissionsPolicyFeatureScreenWakeLock PermissionsPolicyFeature = "screen-wake-lock"
@@ -106,11 +107,11 @@ const (
PermissionsPolicyFeatureSmartCard PermissionsPolicyFeature = "smart-card"
PermissionsPolicyFeatureStorageAccess PermissionsPolicyFeature = "storage-access"
PermissionsPolicyFeatureSyncXhr PermissionsPolicyFeature = "sync-xhr"
- PermissionsPolicyFeatureTrustTokenRedemption PermissionsPolicyFeature = "trust-token-redemption"
PermissionsPolicyFeatureUnload PermissionsPolicyFeature = "unload"
PermissionsPolicyFeatureUsb PermissionsPolicyFeature = "usb"
PermissionsPolicyFeatureVerticalScroll PermissionsPolicyFeature = "vertical-scroll"
PermissionsPolicyFeatureWebShare PermissionsPolicyFeature = "web-share"
+ PermissionsPolicyFeatureWindowManagement PermissionsPolicyFeature = "window-management"
PermissionsPolicyFeatureWindowPlacement PermissionsPolicyFeature = "window-placement"
PermissionsPolicyFeatureXrSpatialTracking PermissionsPolicyFeature = "xr-spatial-tracking"
)
@@ -171,16 +172,14 @@ func (t *PermissionsPolicyFeature) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = PermissionsPolicyFeatureChUaModel
case PermissionsPolicyFeatureChUaMobile:
*t = PermissionsPolicyFeatureChUaMobile
- case PermissionsPolicyFeatureChUaFull:
- *t = PermissionsPolicyFeatureChUaFull
+ case PermissionsPolicyFeatureChUaFormFactor:
+ *t = PermissionsPolicyFeatureChUaFormFactor
case PermissionsPolicyFeatureChUaFullVersion:
*t = PermissionsPolicyFeatureChUaFullVersion
case PermissionsPolicyFeatureChUaFullVersionList:
*t = PermissionsPolicyFeatureChUaFullVersionList
case PermissionsPolicyFeatureChUaPlatformVersion:
*t = PermissionsPolicyFeatureChUaPlatformVersion
- case PermissionsPolicyFeatureChUaReduced:
- *t = PermissionsPolicyFeatureChUaReduced
case PermissionsPolicyFeatureChUaWow64:
*t = PermissionsPolicyFeatureChUaWow64
case PermissionsPolicyFeatureChViewportHeight:
@@ -249,6 +248,10 @@ func (t *PermissionsPolicyFeature) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = PermissionsPolicyFeaturePictureInPicture
case PermissionsPolicyFeaturePrivateAggregation:
*t = PermissionsPolicyFeaturePrivateAggregation
+ case PermissionsPolicyFeaturePrivateStateTokenIssuance:
+ *t = PermissionsPolicyFeaturePrivateStateTokenIssuance
+ case PermissionsPolicyFeaturePrivateStateTokenRedemption:
+ *t = PermissionsPolicyFeaturePrivateStateTokenRedemption
case PermissionsPolicyFeaturePublickeyCredentialsGet:
*t = PermissionsPolicyFeaturePublickeyCredentialsGet
case PermissionsPolicyFeatureRunAdAuction:
@@ -269,8 +272,6 @@ func (t *PermissionsPolicyFeature) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = PermissionsPolicyFeatureStorageAccess
case PermissionsPolicyFeatureSyncXhr:
*t = PermissionsPolicyFeatureSyncXhr
- case PermissionsPolicyFeatureTrustTokenRedemption:
- *t = PermissionsPolicyFeatureTrustTokenRedemption
case PermissionsPolicyFeatureUnload:
*t = PermissionsPolicyFeatureUnload
case PermissionsPolicyFeatureUsb:
@@ -279,6 +280,8 @@ func (t *PermissionsPolicyFeature) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = PermissionsPolicyFeatureVerticalScroll
case PermissionsPolicyFeatureWebShare:
*t = PermissionsPolicyFeatureWebShare
+ case PermissionsPolicyFeatureWindowManagement:
+ *t = PermissionsPolicyFeatureWindowManagement
case PermissionsPolicyFeatureWindowPlacement:
*t = PermissionsPolicyFeatureWindowPlacement
case PermissionsPolicyFeatureXrSpatialTracking:
@@ -840,6 +843,58 @@ type CompilationCacheParams struct {
Eager bool `json:"eager,omitempty"` // A hint to the backend whether eager compilation is recommended. (the actual compilation mode used is upon backend discretion).
}
+// AutoResponseMode enum of possible auto-response for permissions / prompt
+// dialogs.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Page#type-AutoResponseMode
+type AutoResponseMode string
+
+// String returns the AutoResponseMode as string value.
+func (t AutoResponseMode) String() string {
+ return string(t)
+}
+
+// AutoResponseMode values.
+const (
+ AutoResponseModeNone AutoResponseMode = "none"
+ AutoResponseModeAutoAccept AutoResponseMode = "autoAccept"
+ AutoResponseModeAutoReject AutoResponseMode = "autoReject"
+ AutoResponseModeAutoOptOut AutoResponseMode = "autoOptOut"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t AutoResponseMode) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t AutoResponseMode) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *AutoResponseMode) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch AutoResponseMode(v) {
+ case AutoResponseModeNone:
+ *t = AutoResponseModeNone
+ case AutoResponseModeAutoAccept:
+ *t = AutoResponseModeAutoAccept
+ case AutoResponseModeAutoReject:
+ *t = AutoResponseModeAutoReject
+ case AutoResponseModeAutoOptOut:
+ *t = AutoResponseModeAutoOptOut
+
+ default:
+ in.AddError(fmt.Errorf("unknown AutoResponseMode value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *AutoResponseMode) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
// NavigationType the type of a frameNavigated event.
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Page#type-NavigationType
@@ -951,6 +1006,9 @@ const (
BackForwardCacheNotRestoredReasonActivationNavigationsDisallowedForBug1234857 BackForwardCacheNotRestoredReason = "ActivationNavigationsDisallowedForBug1234857"
BackForwardCacheNotRestoredReasonErrorDocument BackForwardCacheNotRestoredReason = "ErrorDocument"
BackForwardCacheNotRestoredReasonFencedFramesEmbedder BackForwardCacheNotRestoredReason = "FencedFramesEmbedder"
+ BackForwardCacheNotRestoredReasonCookieDisabled BackForwardCacheNotRestoredReason = "CookieDisabled"
+ BackForwardCacheNotRestoredReasonHTTPAuthRequired BackForwardCacheNotRestoredReason = "HTTPAuthRequired"
+ BackForwardCacheNotRestoredReasonCookieFlushed BackForwardCacheNotRestoredReason = "CookieFlushed"
BackForwardCacheNotRestoredReasonWebSocket BackForwardCacheNotRestoredReason = "WebSocket"
BackForwardCacheNotRestoredReasonWebTransport BackForwardCacheNotRestoredReason = "WebTransport"
BackForwardCacheNotRestoredReasonWebRTC BackForwardCacheNotRestoredReason = "WebRTC"
@@ -962,14 +1020,12 @@ const (
BackForwardCacheNotRestoredReasonDocumentLoaded BackForwardCacheNotRestoredReason = "DocumentLoaded"
BackForwardCacheNotRestoredReasonDedicatedWorkerOrWorklet BackForwardCacheNotRestoredReason = "DedicatedWorkerOrWorklet"
BackForwardCacheNotRestoredReasonOutstandingNetworkRequestOthers BackForwardCacheNotRestoredReason = "OutstandingNetworkRequestOthers"
- BackForwardCacheNotRestoredReasonOutstandingIndexedDBTransaction BackForwardCacheNotRestoredReason = "OutstandingIndexedDBTransaction"
BackForwardCacheNotRestoredReasonRequestedMIDIPermission BackForwardCacheNotRestoredReason = "RequestedMIDIPermission"
BackForwardCacheNotRestoredReasonRequestedAudioCapturePermission BackForwardCacheNotRestoredReason = "RequestedAudioCapturePermission"
BackForwardCacheNotRestoredReasonRequestedVideoCapturePermission BackForwardCacheNotRestoredReason = "RequestedVideoCapturePermission"
BackForwardCacheNotRestoredReasonRequestedBackForwardCacheBlockedSensors BackForwardCacheNotRestoredReason = "RequestedBackForwardCacheBlockedSensors"
BackForwardCacheNotRestoredReasonRequestedBackgroundWorkPermission BackForwardCacheNotRestoredReason = "RequestedBackgroundWorkPermission"
BackForwardCacheNotRestoredReasonBroadcastChannel BackForwardCacheNotRestoredReason = "BroadcastChannel"
- BackForwardCacheNotRestoredReasonIndexedDBConnection BackForwardCacheNotRestoredReason = "IndexedDBConnection"
BackForwardCacheNotRestoredReasonWebXR BackForwardCacheNotRestoredReason = "WebXR"
BackForwardCacheNotRestoredReasonSharedWorker BackForwardCacheNotRestoredReason = "SharedWorker"
BackForwardCacheNotRestoredReasonWebLocks BackForwardCacheNotRestoredReason = "WebLocks"
@@ -996,7 +1052,10 @@ const (
BackForwardCacheNotRestoredReasonKeepaliveRequest BackForwardCacheNotRestoredReason = "KeepaliveRequest"
BackForwardCacheNotRestoredReasonIndexedDBEvent BackForwardCacheNotRestoredReason = "IndexedDBEvent"
BackForwardCacheNotRestoredReasonDummy BackForwardCacheNotRestoredReason = "Dummy"
- BackForwardCacheNotRestoredReasonAuthorizationHeader BackForwardCacheNotRestoredReason = "AuthorizationHeader"
+ BackForwardCacheNotRestoredReasonJsNetworkRequestReceivedCacheControlNoStoreResource BackForwardCacheNotRestoredReason = "JsNetworkRequestReceivedCacheControlNoStoreResource"
+ BackForwardCacheNotRestoredReasonWebRTCSticky BackForwardCacheNotRestoredReason = "WebRTCSticky"
+ BackForwardCacheNotRestoredReasonWebTransportSticky BackForwardCacheNotRestoredReason = "WebTransportSticky"
+ BackForwardCacheNotRestoredReasonWebSocketSticky BackForwardCacheNotRestoredReason = "WebSocketSticky"
BackForwardCacheNotRestoredReasonContentSecurityHandler BackForwardCacheNotRestoredReason = "ContentSecurityHandler"
BackForwardCacheNotRestoredReasonContentWebAuthenticationAPI BackForwardCacheNotRestoredReason = "ContentWebAuthenticationAPI"
BackForwardCacheNotRestoredReasonContentFileChooser BackForwardCacheNotRestoredReason = "ContentFileChooser"
@@ -1144,6 +1203,12 @@ func (t *BackForwardCacheNotRestoredReason) UnmarshalEasyJSON(in *jlexer.Lexer)
*t = BackForwardCacheNotRestoredReasonErrorDocument
case BackForwardCacheNotRestoredReasonFencedFramesEmbedder:
*t = BackForwardCacheNotRestoredReasonFencedFramesEmbedder
+ case BackForwardCacheNotRestoredReasonCookieDisabled:
+ *t = BackForwardCacheNotRestoredReasonCookieDisabled
+ case BackForwardCacheNotRestoredReasonHTTPAuthRequired:
+ *t = BackForwardCacheNotRestoredReasonHTTPAuthRequired
+ case BackForwardCacheNotRestoredReasonCookieFlushed:
+ *t = BackForwardCacheNotRestoredReasonCookieFlushed
case BackForwardCacheNotRestoredReasonWebSocket:
*t = BackForwardCacheNotRestoredReasonWebSocket
case BackForwardCacheNotRestoredReasonWebTransport:
@@ -1166,8 +1231,6 @@ func (t *BackForwardCacheNotRestoredReason) UnmarshalEasyJSON(in *jlexer.Lexer)
*t = BackForwardCacheNotRestoredReasonDedicatedWorkerOrWorklet
case BackForwardCacheNotRestoredReasonOutstandingNetworkRequestOthers:
*t = BackForwardCacheNotRestoredReasonOutstandingNetworkRequestOthers
- case BackForwardCacheNotRestoredReasonOutstandingIndexedDBTransaction:
- *t = BackForwardCacheNotRestoredReasonOutstandingIndexedDBTransaction
case BackForwardCacheNotRestoredReasonRequestedMIDIPermission:
*t = BackForwardCacheNotRestoredReasonRequestedMIDIPermission
case BackForwardCacheNotRestoredReasonRequestedAudioCapturePermission:
@@ -1180,8 +1243,6 @@ func (t *BackForwardCacheNotRestoredReason) UnmarshalEasyJSON(in *jlexer.Lexer)
*t = BackForwardCacheNotRestoredReasonRequestedBackgroundWorkPermission
case BackForwardCacheNotRestoredReasonBroadcastChannel:
*t = BackForwardCacheNotRestoredReasonBroadcastChannel
- case BackForwardCacheNotRestoredReasonIndexedDBConnection:
- *t = BackForwardCacheNotRestoredReasonIndexedDBConnection
case BackForwardCacheNotRestoredReasonWebXR:
*t = BackForwardCacheNotRestoredReasonWebXR
case BackForwardCacheNotRestoredReasonSharedWorker:
@@ -1234,8 +1295,14 @@ func (t *BackForwardCacheNotRestoredReason) UnmarshalEasyJSON(in *jlexer.Lexer)
*t = BackForwardCacheNotRestoredReasonIndexedDBEvent
case BackForwardCacheNotRestoredReasonDummy:
*t = BackForwardCacheNotRestoredReasonDummy
- case BackForwardCacheNotRestoredReasonAuthorizationHeader:
- *t = BackForwardCacheNotRestoredReasonAuthorizationHeader
+ case BackForwardCacheNotRestoredReasonJsNetworkRequestReceivedCacheControlNoStoreResource:
+ *t = BackForwardCacheNotRestoredReasonJsNetworkRequestReceivedCacheControlNoStoreResource
+ case BackForwardCacheNotRestoredReasonWebRTCSticky:
+ *t = BackForwardCacheNotRestoredReasonWebRTCSticky
+ case BackForwardCacheNotRestoredReasonWebTransportSticky:
+ *t = BackForwardCacheNotRestoredReasonWebTransportSticky
+ case BackForwardCacheNotRestoredReasonWebSocketSticky:
+ *t = BackForwardCacheNotRestoredReasonWebSocketSticky
case BackForwardCacheNotRestoredReasonContentSecurityHandler:
*t = BackForwardCacheNotRestoredReasonContentSecurityHandler
case BackForwardCacheNotRestoredReasonContentWebAuthenticationAPI:
@@ -1364,192 +1431,6 @@ type BackForwardCacheNotRestoredExplanationTree struct {
Children []*BackForwardCacheNotRestoredExplanationTree `json:"children"` // Array of children frame
}
-// PrerenderFinalStatus list of FinalStatus reasons for Prerender2.
-//
-// See: https://chromedevtools.github.io/devtools-protocol/tot/Page#type-PrerenderFinalStatus
-type PrerenderFinalStatus string
-
-// String returns the PrerenderFinalStatus as string value.
-func (t PrerenderFinalStatus) String() string {
- return string(t)
-}
-
-// PrerenderFinalStatus values.
-const (
- PrerenderFinalStatusActivated PrerenderFinalStatus = "Activated"
- PrerenderFinalStatusDestroyed PrerenderFinalStatus = "Destroyed"
- PrerenderFinalStatusLowEndDevice PrerenderFinalStatus = "LowEndDevice"
- PrerenderFinalStatusInvalidSchemeRedirect PrerenderFinalStatus = "InvalidSchemeRedirect"
- PrerenderFinalStatusInvalidSchemeNavigation PrerenderFinalStatus = "InvalidSchemeNavigation"
- PrerenderFinalStatusInProgressNavigation PrerenderFinalStatus = "InProgressNavigation"
- PrerenderFinalStatusNavigationRequestBlockedByCsp PrerenderFinalStatus = "NavigationRequestBlockedByCsp"
- PrerenderFinalStatusMainFrameNavigation PrerenderFinalStatus = "MainFrameNavigation"
- PrerenderFinalStatusMojoBinderPolicy PrerenderFinalStatus = "MojoBinderPolicy"
- PrerenderFinalStatusRendererProcessCrashed PrerenderFinalStatus = "RendererProcessCrashed"
- PrerenderFinalStatusRendererProcessKilled PrerenderFinalStatus = "RendererProcessKilled"
- PrerenderFinalStatusDownload PrerenderFinalStatus = "Download"
- PrerenderFinalStatusTriggerDestroyed PrerenderFinalStatus = "TriggerDestroyed"
- PrerenderFinalStatusNavigationNotCommitted PrerenderFinalStatus = "NavigationNotCommitted"
- PrerenderFinalStatusNavigationBadHTTPStatus PrerenderFinalStatus = "NavigationBadHttpStatus"
- PrerenderFinalStatusClientCertRequested PrerenderFinalStatus = "ClientCertRequested"
- PrerenderFinalStatusNavigationRequestNetworkError PrerenderFinalStatus = "NavigationRequestNetworkError"
- PrerenderFinalStatusMaxNumOfRunningPrerendersExceeded PrerenderFinalStatus = "MaxNumOfRunningPrerendersExceeded"
- PrerenderFinalStatusCancelAllHostsForTesting PrerenderFinalStatus = "CancelAllHostsForTesting"
- PrerenderFinalStatusDidFailLoad PrerenderFinalStatus = "DidFailLoad"
- PrerenderFinalStatusStop PrerenderFinalStatus = "Stop"
- PrerenderFinalStatusSslCertificateError PrerenderFinalStatus = "SslCertificateError"
- PrerenderFinalStatusLoginAuthRequested PrerenderFinalStatus = "LoginAuthRequested"
- PrerenderFinalStatusUaChangeRequiresReload PrerenderFinalStatus = "UaChangeRequiresReload"
- PrerenderFinalStatusBlockedByClient PrerenderFinalStatus = "BlockedByClient"
- PrerenderFinalStatusAudioOutputDeviceRequested PrerenderFinalStatus = "AudioOutputDeviceRequested"
- PrerenderFinalStatusMixedContent PrerenderFinalStatus = "MixedContent"
- PrerenderFinalStatusTriggerBackgrounded PrerenderFinalStatus = "TriggerBackgrounded"
- PrerenderFinalStatusEmbedderTriggeredAndCrossOriginRedirected PrerenderFinalStatus = "EmbedderTriggeredAndCrossOriginRedirected"
- PrerenderFinalStatusMemoryLimitExceeded PrerenderFinalStatus = "MemoryLimitExceeded"
- PrerenderFinalStatusFailToGetMemoryUsage PrerenderFinalStatus = "FailToGetMemoryUsage"
- PrerenderFinalStatusDataSaverEnabled PrerenderFinalStatus = "DataSaverEnabled"
- PrerenderFinalStatusHasEffectiveURL PrerenderFinalStatus = "HasEffectiveUrl"
- PrerenderFinalStatusActivatedBeforeStarted PrerenderFinalStatus = "ActivatedBeforeStarted"
- PrerenderFinalStatusInactivePageRestriction PrerenderFinalStatus = "InactivePageRestriction"
- PrerenderFinalStatusStartFailed PrerenderFinalStatus = "StartFailed"
- PrerenderFinalStatusTimeoutBackgrounded PrerenderFinalStatus = "TimeoutBackgrounded"
- PrerenderFinalStatusCrossSiteRedirect PrerenderFinalStatus = "CrossSiteRedirect"
- PrerenderFinalStatusCrossSiteNavigation PrerenderFinalStatus = "CrossSiteNavigation"
- PrerenderFinalStatusSameSiteCrossOriginRedirect PrerenderFinalStatus = "SameSiteCrossOriginRedirect"
- PrerenderFinalStatusSameSiteCrossOriginNavigation PrerenderFinalStatus = "SameSiteCrossOriginNavigation"
- PrerenderFinalStatusSameSiteCrossOriginRedirectNotOptIn PrerenderFinalStatus = "SameSiteCrossOriginRedirectNotOptIn"
- PrerenderFinalStatusSameSiteCrossOriginNavigationNotOptIn PrerenderFinalStatus = "SameSiteCrossOriginNavigationNotOptIn"
- PrerenderFinalStatusActivationNavigationParameterMismatch PrerenderFinalStatus = "ActivationNavigationParameterMismatch"
- PrerenderFinalStatusActivatedInBackground PrerenderFinalStatus = "ActivatedInBackground"
- PrerenderFinalStatusEmbedderHostDisallowed PrerenderFinalStatus = "EmbedderHostDisallowed"
- PrerenderFinalStatusActivationNavigationDestroyedBeforeSuccess PrerenderFinalStatus = "ActivationNavigationDestroyedBeforeSuccess"
- PrerenderFinalStatusTabClosedByUserGesture PrerenderFinalStatus = "TabClosedByUserGesture"
- PrerenderFinalStatusTabClosedWithoutUserGesture PrerenderFinalStatus = "TabClosedWithoutUserGesture"
-)
-
-// MarshalEasyJSON satisfies easyjson.Marshaler.
-func (t PrerenderFinalStatus) MarshalEasyJSON(out *jwriter.Writer) {
- out.String(string(t))
-}
-
-// MarshalJSON satisfies json.Marshaler.
-func (t PrerenderFinalStatus) MarshalJSON() ([]byte, error) {
- return easyjson.Marshal(t)
-}
-
-// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
-func (t *PrerenderFinalStatus) UnmarshalEasyJSON(in *jlexer.Lexer) {
- v := in.String()
- switch PrerenderFinalStatus(v) {
- case PrerenderFinalStatusActivated:
- *t = PrerenderFinalStatusActivated
- case PrerenderFinalStatusDestroyed:
- *t = PrerenderFinalStatusDestroyed
- case PrerenderFinalStatusLowEndDevice:
- *t = PrerenderFinalStatusLowEndDevice
- case PrerenderFinalStatusInvalidSchemeRedirect:
- *t = PrerenderFinalStatusInvalidSchemeRedirect
- case PrerenderFinalStatusInvalidSchemeNavigation:
- *t = PrerenderFinalStatusInvalidSchemeNavigation
- case PrerenderFinalStatusInProgressNavigation:
- *t = PrerenderFinalStatusInProgressNavigation
- case PrerenderFinalStatusNavigationRequestBlockedByCsp:
- *t = PrerenderFinalStatusNavigationRequestBlockedByCsp
- case PrerenderFinalStatusMainFrameNavigation:
- *t = PrerenderFinalStatusMainFrameNavigation
- case PrerenderFinalStatusMojoBinderPolicy:
- *t = PrerenderFinalStatusMojoBinderPolicy
- case PrerenderFinalStatusRendererProcessCrashed:
- *t = PrerenderFinalStatusRendererProcessCrashed
- case PrerenderFinalStatusRendererProcessKilled:
- *t = PrerenderFinalStatusRendererProcessKilled
- case PrerenderFinalStatusDownload:
- *t = PrerenderFinalStatusDownload
- case PrerenderFinalStatusTriggerDestroyed:
- *t = PrerenderFinalStatusTriggerDestroyed
- case PrerenderFinalStatusNavigationNotCommitted:
- *t = PrerenderFinalStatusNavigationNotCommitted
- case PrerenderFinalStatusNavigationBadHTTPStatus:
- *t = PrerenderFinalStatusNavigationBadHTTPStatus
- case PrerenderFinalStatusClientCertRequested:
- *t = PrerenderFinalStatusClientCertRequested
- case PrerenderFinalStatusNavigationRequestNetworkError:
- *t = PrerenderFinalStatusNavigationRequestNetworkError
- case PrerenderFinalStatusMaxNumOfRunningPrerendersExceeded:
- *t = PrerenderFinalStatusMaxNumOfRunningPrerendersExceeded
- case PrerenderFinalStatusCancelAllHostsForTesting:
- *t = PrerenderFinalStatusCancelAllHostsForTesting
- case PrerenderFinalStatusDidFailLoad:
- *t = PrerenderFinalStatusDidFailLoad
- case PrerenderFinalStatusStop:
- *t = PrerenderFinalStatusStop
- case PrerenderFinalStatusSslCertificateError:
- *t = PrerenderFinalStatusSslCertificateError
- case PrerenderFinalStatusLoginAuthRequested:
- *t = PrerenderFinalStatusLoginAuthRequested
- case PrerenderFinalStatusUaChangeRequiresReload:
- *t = PrerenderFinalStatusUaChangeRequiresReload
- case PrerenderFinalStatusBlockedByClient:
- *t = PrerenderFinalStatusBlockedByClient
- case PrerenderFinalStatusAudioOutputDeviceRequested:
- *t = PrerenderFinalStatusAudioOutputDeviceRequested
- case PrerenderFinalStatusMixedContent:
- *t = PrerenderFinalStatusMixedContent
- case PrerenderFinalStatusTriggerBackgrounded:
- *t = PrerenderFinalStatusTriggerBackgrounded
- case PrerenderFinalStatusEmbedderTriggeredAndCrossOriginRedirected:
- *t = PrerenderFinalStatusEmbedderTriggeredAndCrossOriginRedirected
- case PrerenderFinalStatusMemoryLimitExceeded:
- *t = PrerenderFinalStatusMemoryLimitExceeded
- case PrerenderFinalStatusFailToGetMemoryUsage:
- *t = PrerenderFinalStatusFailToGetMemoryUsage
- case PrerenderFinalStatusDataSaverEnabled:
- *t = PrerenderFinalStatusDataSaverEnabled
- case PrerenderFinalStatusHasEffectiveURL:
- *t = PrerenderFinalStatusHasEffectiveURL
- case PrerenderFinalStatusActivatedBeforeStarted:
- *t = PrerenderFinalStatusActivatedBeforeStarted
- case PrerenderFinalStatusInactivePageRestriction:
- *t = PrerenderFinalStatusInactivePageRestriction
- case PrerenderFinalStatusStartFailed:
- *t = PrerenderFinalStatusStartFailed
- case PrerenderFinalStatusTimeoutBackgrounded:
- *t = PrerenderFinalStatusTimeoutBackgrounded
- case PrerenderFinalStatusCrossSiteRedirect:
- *t = PrerenderFinalStatusCrossSiteRedirect
- case PrerenderFinalStatusCrossSiteNavigation:
- *t = PrerenderFinalStatusCrossSiteNavigation
- case PrerenderFinalStatusSameSiteCrossOriginRedirect:
- *t = PrerenderFinalStatusSameSiteCrossOriginRedirect
- case PrerenderFinalStatusSameSiteCrossOriginNavigation:
- *t = PrerenderFinalStatusSameSiteCrossOriginNavigation
- case PrerenderFinalStatusSameSiteCrossOriginRedirectNotOptIn:
- *t = PrerenderFinalStatusSameSiteCrossOriginRedirectNotOptIn
- case PrerenderFinalStatusSameSiteCrossOriginNavigationNotOptIn:
- *t = PrerenderFinalStatusSameSiteCrossOriginNavigationNotOptIn
- case PrerenderFinalStatusActivationNavigationParameterMismatch:
- *t = PrerenderFinalStatusActivationNavigationParameterMismatch
- case PrerenderFinalStatusActivatedInBackground:
- *t = PrerenderFinalStatusActivatedInBackground
- case PrerenderFinalStatusEmbedderHostDisallowed:
- *t = PrerenderFinalStatusEmbedderHostDisallowed
- case PrerenderFinalStatusActivationNavigationDestroyedBeforeSuccess:
- *t = PrerenderFinalStatusActivationNavigationDestroyedBeforeSuccess
- case PrerenderFinalStatusTabClosedByUserGesture:
- *t = PrerenderFinalStatusTabClosedByUserGesture
- case PrerenderFinalStatusTabClosedWithoutUserGesture:
- *t = PrerenderFinalStatusTabClosedWithoutUserGesture
-
- default:
- in.AddError(fmt.Errorf("unknown PrerenderFinalStatus value: %v", v))
- }
-}
-
-// UnmarshalJSON satisfies json.Unmarshaler.
-func (t *PrerenderFinalStatus) UnmarshalJSON(buf []byte) error {
- return easyjson.Unmarshal(buf, t)
-}
-
// FileChooserOpenedMode input mode.
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Page#event-fileChooserOpened
@@ -1864,54 +1745,3 @@ func (t *SetWebLifecycleStateState) UnmarshalEasyJSON(in *jlexer.Lexer) {
func (t *SetWebLifecycleStateState) UnmarshalJSON(buf []byte) error {
return easyjson.Unmarshal(buf, t)
}
-
-// SetSPCTransactionModeMode [no description].
-//
-// See: https://chromedevtools.github.io/devtools-protocol/tot/Page#method-setSPCTransactionMode
-type SetSPCTransactionModeMode string
-
-// String returns the SetSPCTransactionModeMode as string value.
-func (t SetSPCTransactionModeMode) String() string {
- return string(t)
-}
-
-// SetSPCTransactionModeMode values.
-const (
- SetSPCTransactionModeModeNone SetSPCTransactionModeMode = "none"
- SetSPCTransactionModeModeAutoAccept SetSPCTransactionModeMode = "autoAccept"
- SetSPCTransactionModeModeAutoReject SetSPCTransactionModeMode = "autoReject"
- SetSPCTransactionModeModeAutoOptOut SetSPCTransactionModeMode = "autoOptOut"
-)
-
-// MarshalEasyJSON satisfies easyjson.Marshaler.
-func (t SetSPCTransactionModeMode) MarshalEasyJSON(out *jwriter.Writer) {
- out.String(string(t))
-}
-
-// MarshalJSON satisfies json.Marshaler.
-func (t SetSPCTransactionModeMode) MarshalJSON() ([]byte, error) {
- return easyjson.Marshal(t)
-}
-
-// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
-func (t *SetSPCTransactionModeMode) UnmarshalEasyJSON(in *jlexer.Lexer) {
- v := in.String()
- switch SetSPCTransactionModeMode(v) {
- case SetSPCTransactionModeModeNone:
- *t = SetSPCTransactionModeModeNone
- case SetSPCTransactionModeModeAutoAccept:
- *t = SetSPCTransactionModeModeAutoAccept
- case SetSPCTransactionModeModeAutoReject:
- *t = SetSPCTransactionModeModeAutoReject
- case SetSPCTransactionModeModeAutoOptOut:
- *t = SetSPCTransactionModeModeAutoOptOut
-
- default:
- in.AddError(fmt.Errorf("unknown SetSPCTransactionModeMode value: %v", v))
- }
-}
-
-// UnmarshalJSON satisfies json.Unmarshaler.
-func (t *SetSPCTransactionModeMode) UnmarshalJSON(buf []byte) error {
- return easyjson.Unmarshal(buf, t)
-}
diff --git a/preload/easyjson.go b/preload/easyjson.go
new file mode 100644
index 0000000..ed5509e
--- /dev/null
+++ b/preload/easyjson.go
@@ -0,0 +1,1163 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package preload
+
+import (
+ json "encoding/json"
+ cdp "github.com/chromedp/cdproto/cdp"
+ network "github.com/chromedp/cdproto/network"
+ easyjson "github.com/mailru/easyjson"
+ jlexer "github.com/mailru/easyjson/jlexer"
+ jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+ _ *json.RawMessage
+ _ *jlexer.Lexer
+ _ *jwriter.Writer
+ _ easyjson.Marshaler
+)
+
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload(in *jlexer.Lexer, out *RuleSet) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "id":
+ out.ID = RuleSetID(in.String())
+ case "loaderId":
+ out.LoaderID = cdp.LoaderID(in.String())
+ case "sourceText":
+ out.SourceText = string(in.String())
+ case "backendNodeId":
+ (out.BackendNodeID).UnmarshalEasyJSON(in)
+ case "url":
+ out.URL = string(in.String())
+ case "requestId":
+ out.RequestID = network.RequestID(in.String())
+ case "errorType":
+ (out.ErrorType).UnmarshalEasyJSON(in)
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload(out *jwriter.Writer, in RuleSet) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"id\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.ID))
+ }
+ {
+ const prefix string = ",\"loaderId\":"
+ out.RawString(prefix)
+ out.String(string(in.LoaderID))
+ }
+ {
+ const prefix string = ",\"sourceText\":"
+ out.RawString(prefix)
+ out.String(string(in.SourceText))
+ }
+ if in.BackendNodeID != 0 {
+ const prefix string = ",\"backendNodeId\":"
+ out.RawString(prefix)
+ out.Int64(int64(in.BackendNodeID))
+ }
+ if in.URL != "" {
+ const prefix string = ",\"url\":"
+ out.RawString(prefix)
+ out.String(string(in.URL))
+ }
+ if in.RequestID != "" {
+ const prefix string = ",\"requestId\":"
+ out.RawString(prefix)
+ out.String(string(in.RequestID))
+ }
+ if in.ErrorType != "" {
+ const prefix string = ",\"errorType\":"
+ out.RawString(prefix)
+ (in.ErrorType).MarshalEasyJSON(out)
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v RuleSet) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v RuleSet) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *RuleSet) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *RuleSet) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload1(in *jlexer.Lexer, out *IngAttemptSource) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "key":
+ if in.IsNull() {
+ in.Skip()
+ out.Key = nil
+ } else {
+ if out.Key == nil {
+ out.Key = new(IngAttemptKey)
+ }
+ (*out.Key).UnmarshalEasyJSON(in)
+ }
+ case "ruleSetIds":
+ if in.IsNull() {
+ in.Skip()
+ out.RuleSetIDs = nil
+ } else {
+ in.Delim('[')
+ if out.RuleSetIDs == nil {
+ if !in.IsDelim(']') {
+ out.RuleSetIDs = make([]RuleSetID, 0, 4)
+ } else {
+ out.RuleSetIDs = []RuleSetID{}
+ }
+ } else {
+ out.RuleSetIDs = (out.RuleSetIDs)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v1 RuleSetID
+ v1 = RuleSetID(in.String())
+ out.RuleSetIDs = append(out.RuleSetIDs, v1)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ case "nodeIds":
+ if in.IsNull() {
+ in.Skip()
+ out.NodeIDs = nil
+ } else {
+ in.Delim('[')
+ if out.NodeIDs == nil {
+ if !in.IsDelim(']') {
+ out.NodeIDs = make([]cdp.BackendNodeID, 0, 8)
+ } else {
+ out.NodeIDs = []cdp.BackendNodeID{}
+ }
+ } else {
+ out.NodeIDs = (out.NodeIDs)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v2 cdp.BackendNodeID
+ (v2).UnmarshalEasyJSON(in)
+ out.NodeIDs = append(out.NodeIDs, v2)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload1(out *jwriter.Writer, in IngAttemptSource) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"key\":"
+ out.RawString(prefix[1:])
+ if in.Key == nil {
+ out.RawString("null")
+ } else {
+ (*in.Key).MarshalEasyJSON(out)
+ }
+ }
+ {
+ const prefix string = ",\"ruleSetIds\":"
+ out.RawString(prefix)
+ if in.RuleSetIDs == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v3, v4 := range in.RuleSetIDs {
+ if v3 > 0 {
+ out.RawByte(',')
+ }
+ out.String(string(v4))
+ }
+ out.RawByte(']')
+ }
+ }
+ {
+ const prefix string = ",\"nodeIds\":"
+ out.RawString(prefix)
+ if in.NodeIDs == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v5, v6 := range in.NodeIDs {
+ if v5 > 0 {
+ out.RawByte(',')
+ }
+ out.Int64(int64(v6))
+ }
+ out.RawByte(']')
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v IngAttemptSource) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload1(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v IngAttemptSource) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload1(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *IngAttemptSource) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload1(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *IngAttemptSource) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload1(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload2(in *jlexer.Lexer, out *IngAttemptKey) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "loaderId":
+ out.LoaderID = cdp.LoaderID(in.String())
+ case "action":
+ (out.Action).UnmarshalEasyJSON(in)
+ case "url":
+ out.URL = string(in.String())
+ case "targetHint":
+ (out.TargetHint).UnmarshalEasyJSON(in)
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload2(out *jwriter.Writer, in IngAttemptKey) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"loaderId\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.LoaderID))
+ }
+ {
+ const prefix string = ",\"action\":"
+ out.RawString(prefix)
+ (in.Action).MarshalEasyJSON(out)
+ }
+ {
+ const prefix string = ",\"url\":"
+ out.RawString(prefix)
+ out.String(string(in.URL))
+ }
+ if in.TargetHint != "" {
+ const prefix string = ",\"targetHint\":"
+ out.RawString(prefix)
+ (in.TargetHint).MarshalEasyJSON(out)
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v IngAttemptKey) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload2(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v IngAttemptKey) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload2(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *IngAttemptKey) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload2(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *IngAttemptKey) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload2(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload3(in *jlexer.Lexer, out *EventRuleSetUpdated) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "ruleSet":
+ if in.IsNull() {
+ in.Skip()
+ out.RuleSet = nil
+ } else {
+ if out.RuleSet == nil {
+ out.RuleSet = new(RuleSet)
+ }
+ (*out.RuleSet).UnmarshalEasyJSON(in)
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload3(out *jwriter.Writer, in EventRuleSetUpdated) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"ruleSet\":"
+ out.RawString(prefix[1:])
+ if in.RuleSet == nil {
+ out.RawString("null")
+ } else {
+ (*in.RuleSet).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v EventRuleSetUpdated) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload3(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v EventRuleSetUpdated) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload3(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *EventRuleSetUpdated) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload3(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *EventRuleSetUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload3(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload4(in *jlexer.Lexer, out *EventRuleSetRemoved) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "id":
+ out.ID = RuleSetID(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload4(out *jwriter.Writer, in EventRuleSetRemoved) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"id\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.ID))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v EventRuleSetRemoved) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload4(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v EventRuleSetRemoved) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload4(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *EventRuleSetRemoved) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload4(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *EventRuleSetRemoved) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload4(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload5(in *jlexer.Lexer, out *EventPrerenderStatusUpdated) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "key":
+ if in.IsNull() {
+ in.Skip()
+ out.Key = nil
+ } else {
+ if out.Key == nil {
+ out.Key = new(IngAttemptKey)
+ }
+ (*out.Key).UnmarshalEasyJSON(in)
+ }
+ case "status":
+ (out.Status).UnmarshalEasyJSON(in)
+ case "prerenderStatus":
+ (out.PrerenderStatus).UnmarshalEasyJSON(in)
+ case "disallowedMojoInterface":
+ out.DisallowedMojoInterface = string(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload5(out *jwriter.Writer, in EventPrerenderStatusUpdated) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"key\":"
+ out.RawString(prefix[1:])
+ if in.Key == nil {
+ out.RawString("null")
+ } else {
+ (*in.Key).MarshalEasyJSON(out)
+ }
+ }
+ {
+ const prefix string = ",\"status\":"
+ out.RawString(prefix)
+ (in.Status).MarshalEasyJSON(out)
+ }
+ if in.PrerenderStatus != "" {
+ const prefix string = ",\"prerenderStatus\":"
+ out.RawString(prefix)
+ (in.PrerenderStatus).MarshalEasyJSON(out)
+ }
+ if in.DisallowedMojoInterface != "" {
+ const prefix string = ",\"disallowedMojoInterface\":"
+ out.RawString(prefix)
+ out.String(string(in.DisallowedMojoInterface))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v EventPrerenderStatusUpdated) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload5(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v EventPrerenderStatusUpdated) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload5(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *EventPrerenderStatusUpdated) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload5(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *EventPrerenderStatusUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload5(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload6(in *jlexer.Lexer, out *EventPrerenderAttemptCompleted) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "key":
+ if in.IsNull() {
+ in.Skip()
+ out.Key = nil
+ } else {
+ if out.Key == nil {
+ out.Key = new(IngAttemptKey)
+ }
+ (*out.Key).UnmarshalEasyJSON(in)
+ }
+ case "initiatingFrameId":
+ (out.InitiatingFrameID).UnmarshalEasyJSON(in)
+ case "prerenderingUrl":
+ out.PrerenderingURL = string(in.String())
+ case "finalStatus":
+ (out.FinalStatus).UnmarshalEasyJSON(in)
+ case "disallowedApiMethod":
+ out.DisallowedAPIMethod = string(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload6(out *jwriter.Writer, in EventPrerenderAttemptCompleted) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"key\":"
+ out.RawString(prefix[1:])
+ if in.Key == nil {
+ out.RawString("null")
+ } else {
+ (*in.Key).MarshalEasyJSON(out)
+ }
+ }
+ {
+ const prefix string = ",\"initiatingFrameId\":"
+ out.RawString(prefix)
+ out.String(string(in.InitiatingFrameID))
+ }
+ {
+ const prefix string = ",\"prerenderingUrl\":"
+ out.RawString(prefix)
+ out.String(string(in.PrerenderingURL))
+ }
+ {
+ const prefix string = ",\"finalStatus\":"
+ out.RawString(prefix)
+ (in.FinalStatus).MarshalEasyJSON(out)
+ }
+ if in.DisallowedAPIMethod != "" {
+ const prefix string = ",\"disallowedApiMethod\":"
+ out.RawString(prefix)
+ out.String(string(in.DisallowedAPIMethod))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v EventPrerenderAttemptCompleted) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload6(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v EventPrerenderAttemptCompleted) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload6(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *EventPrerenderAttemptCompleted) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload6(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *EventPrerenderAttemptCompleted) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload6(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload7(in *jlexer.Lexer, out *EventPreloadingAttemptSourcesUpdated) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "loaderId":
+ out.LoaderID = cdp.LoaderID(in.String())
+ case "preloadingAttemptSources":
+ if in.IsNull() {
+ in.Skip()
+ out.PreloadingAttemptSources = nil
+ } else {
+ in.Delim('[')
+ if out.PreloadingAttemptSources == nil {
+ if !in.IsDelim(']') {
+ out.PreloadingAttemptSources = make([]*IngAttemptSource, 0, 8)
+ } else {
+ out.PreloadingAttemptSources = []*IngAttemptSource{}
+ }
+ } else {
+ out.PreloadingAttemptSources = (out.PreloadingAttemptSources)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v7 *IngAttemptSource
+ if in.IsNull() {
+ in.Skip()
+ v7 = nil
+ } else {
+ if v7 == nil {
+ v7 = new(IngAttemptSource)
+ }
+ (*v7).UnmarshalEasyJSON(in)
+ }
+ out.PreloadingAttemptSources = append(out.PreloadingAttemptSources, v7)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload7(out *jwriter.Writer, in EventPreloadingAttemptSourcesUpdated) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"loaderId\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.LoaderID))
+ }
+ {
+ const prefix string = ",\"preloadingAttemptSources\":"
+ out.RawString(prefix)
+ if in.PreloadingAttemptSources == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v8, v9 := range in.PreloadingAttemptSources {
+ if v8 > 0 {
+ out.RawByte(',')
+ }
+ if v9 == nil {
+ out.RawString("null")
+ } else {
+ (*v9).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v EventPreloadingAttemptSourcesUpdated) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload7(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v EventPreloadingAttemptSourcesUpdated) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload7(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *EventPreloadingAttemptSourcesUpdated) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload7(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *EventPreloadingAttemptSourcesUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload7(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload8(in *jlexer.Lexer, out *EventPreloadEnabledStateUpdated) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "disabledByPreference":
+ out.DisabledByPreference = bool(in.Bool())
+ case "disabledByDataSaver":
+ out.DisabledByDataSaver = bool(in.Bool())
+ case "disabledByBatterySaver":
+ out.DisabledByBatterySaver = bool(in.Bool())
+ case "disabledByHoldbackPrefetchSpeculationRules":
+ out.DisabledByHoldbackPrefetchSpeculationRules = bool(in.Bool())
+ case "disabledByHoldbackPrerenderSpeculationRules":
+ out.DisabledByHoldbackPrerenderSpeculationRules = bool(in.Bool())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload8(out *jwriter.Writer, in EventPreloadEnabledStateUpdated) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"disabledByPreference\":"
+ out.RawString(prefix[1:])
+ out.Bool(bool(in.DisabledByPreference))
+ }
+ {
+ const prefix string = ",\"disabledByDataSaver\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.DisabledByDataSaver))
+ }
+ {
+ const prefix string = ",\"disabledByBatterySaver\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.DisabledByBatterySaver))
+ }
+ {
+ const prefix string = ",\"disabledByHoldbackPrefetchSpeculationRules\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.DisabledByHoldbackPrefetchSpeculationRules))
+ }
+ {
+ const prefix string = ",\"disabledByHoldbackPrerenderSpeculationRules\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.DisabledByHoldbackPrerenderSpeculationRules))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v EventPreloadEnabledStateUpdated) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload8(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v EventPreloadEnabledStateUpdated) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload8(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *EventPreloadEnabledStateUpdated) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload8(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *EventPreloadEnabledStateUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload8(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload9(in *jlexer.Lexer, out *EventPrefetchStatusUpdated) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "key":
+ if in.IsNull() {
+ in.Skip()
+ out.Key = nil
+ } else {
+ if out.Key == nil {
+ out.Key = new(IngAttemptKey)
+ }
+ (*out.Key).UnmarshalEasyJSON(in)
+ }
+ case "initiatingFrameId":
+ (out.InitiatingFrameID).UnmarshalEasyJSON(in)
+ case "prefetchUrl":
+ out.PrefetchURL = string(in.String())
+ case "status":
+ (out.Status).UnmarshalEasyJSON(in)
+ case "prefetchStatus":
+ (out.PrefetchStatus).UnmarshalEasyJSON(in)
+ case "requestId":
+ out.RequestID = network.RequestID(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload9(out *jwriter.Writer, in EventPrefetchStatusUpdated) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"key\":"
+ out.RawString(prefix[1:])
+ if in.Key == nil {
+ out.RawString("null")
+ } else {
+ (*in.Key).MarshalEasyJSON(out)
+ }
+ }
+ {
+ const prefix string = ",\"initiatingFrameId\":"
+ out.RawString(prefix)
+ out.String(string(in.InitiatingFrameID))
+ }
+ {
+ const prefix string = ",\"prefetchUrl\":"
+ out.RawString(prefix)
+ out.String(string(in.PrefetchURL))
+ }
+ {
+ const prefix string = ",\"status\":"
+ out.RawString(prefix)
+ (in.Status).MarshalEasyJSON(out)
+ }
+ {
+ const prefix string = ",\"prefetchStatus\":"
+ out.RawString(prefix)
+ (in.PrefetchStatus).MarshalEasyJSON(out)
+ }
+ {
+ const prefix string = ",\"requestId\":"
+ out.RawString(prefix)
+ out.String(string(in.RequestID))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v EventPrefetchStatusUpdated) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload9(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v EventPrefetchStatusUpdated) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload9(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *EventPrefetchStatusUpdated) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload9(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *EventPrefetchStatusUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload9(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload10(in *jlexer.Lexer, out *EnableParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload10(out *jwriter.Writer, in EnableParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v EnableParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload10(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v EnableParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload10(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *EnableParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload10(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *EnableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload10(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload11(in *jlexer.Lexer, out *DisableParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload11(out *jwriter.Writer, in DisableParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v DisableParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload11(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v DisableParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoPreload11(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *DisableParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload11(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *DisableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoPreload11(l, v)
+}
diff --git a/preload/events.go b/preload/events.go
new file mode 100644
index 0000000..6e5762e
--- /dev/null
+++ b/preload/events.go
@@ -0,0 +1,78 @@
+package preload
+
+// Code generated by cdproto-gen. DO NOT EDIT.
+
+import (
+ "github.com/chromedp/cdproto/cdp"
+ "github.com/chromedp/cdproto/network"
+)
+
+// EventRuleSetUpdated upsert. Currently, it is only emitted when a rule set
+// added.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#event-ruleSetUpdated
+type EventRuleSetUpdated struct {
+ RuleSet *RuleSet `json:"ruleSet"`
+}
+
+// EventRuleSetRemoved [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#event-ruleSetRemoved
+type EventRuleSetRemoved struct {
+ ID RuleSetID `json:"id"`
+}
+
+// EventPrerenderAttemptCompleted fired when a prerender attempt is
+// completed.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#event-prerenderAttemptCompleted
+type EventPrerenderAttemptCompleted struct {
+ Key *IngAttemptKey `json:"key"`
+ InitiatingFrameID cdp.FrameID `json:"initiatingFrameId"` // The frame id of the frame initiating prerendering.
+ PrerenderingURL string `json:"prerenderingUrl"`
+ FinalStatus PrerenderFinalStatus `json:"finalStatus"`
+ DisallowedAPIMethod string `json:"disallowedApiMethod,omitempty"` // This is used to give users more information about the name of the API call that is incompatible with prerender and has caused the cancellation of the attempt
+}
+
+// EventPreloadEnabledStateUpdated fired when a preload enabled state is
+// updated.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#event-preloadEnabledStateUpdated
+type EventPreloadEnabledStateUpdated struct {
+ DisabledByPreference bool `json:"disabledByPreference"`
+ DisabledByDataSaver bool `json:"disabledByDataSaver"`
+ DisabledByBatterySaver bool `json:"disabledByBatterySaver"`
+ DisabledByHoldbackPrefetchSpeculationRules bool `json:"disabledByHoldbackPrefetchSpeculationRules"`
+ DisabledByHoldbackPrerenderSpeculationRules bool `json:"disabledByHoldbackPrerenderSpeculationRules"`
+}
+
+// EventPrefetchStatusUpdated fired when a prefetch attempt is updated.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#event-prefetchStatusUpdated
+type EventPrefetchStatusUpdated struct {
+ Key *IngAttemptKey `json:"key"`
+ InitiatingFrameID cdp.FrameID `json:"initiatingFrameId"` // The frame id of the frame initiating prefetch.
+ PrefetchURL string `json:"prefetchUrl"`
+ Status IngStatus `json:"status"`
+ PrefetchStatus PrefetchStatus `json:"prefetchStatus"`
+ RequestID network.RequestID `json:"requestId"`
+}
+
+// EventPrerenderStatusUpdated fired when a prerender attempt is updated.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#event-prerenderStatusUpdated
+type EventPrerenderStatusUpdated struct {
+ Key *IngAttemptKey `json:"key"`
+ Status IngStatus `json:"status"`
+ PrerenderStatus PrerenderFinalStatus `json:"prerenderStatus,omitempty"`
+ DisallowedMojoInterface string `json:"disallowedMojoInterface,omitempty"` // This is used to give users more information about the name of Mojo interface that is incompatible with prerender and has caused the cancellation of the attempt.
+}
+
+// EventPreloadingAttemptSourcesUpdated send a list of sources for all
+// preloading attempts in a document.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#event-preloadingAttemptSourcesUpdated
+type EventPreloadingAttemptSourcesUpdated struct {
+ LoaderID cdp.LoaderID `json:"loaderId"`
+ PreloadingAttemptSources []*IngAttemptSource `json:"preloadingAttemptSources"`
+}
diff --git a/preload/preload.go b/preload/preload.go
new file mode 100644
index 0000000..27eef58
--- /dev/null
+++ b/preload/preload.go
@@ -0,0 +1,49 @@
+// Package preload provides the Chrome DevTools Protocol
+// commands, types, and events for the Preload domain.
+//
+// Generated by the cdproto-gen command.
+package preload
+
+// Code generated by cdproto-gen. DO NOT EDIT.
+
+import (
+ "context"
+
+ "github.com/chromedp/cdproto/cdp"
+)
+
+// EnableParams [no description].
+type EnableParams struct{}
+
+// Enable [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#method-enable
+func Enable() *EnableParams {
+ return &EnableParams{}
+}
+
+// Do executes Preload.enable against the provided context.
+func (p *EnableParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandEnable, nil, nil)
+}
+
+// DisableParams [no description].
+type DisableParams struct{}
+
+// Disable [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#method-disable
+func Disable() *DisableParams {
+ return &DisableParams{}
+}
+
+// Do executes Preload.disable against the provided context.
+func (p *DisableParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandDisable, nil, nil)
+}
+
+// Command names.
+const (
+ CommandEnable = "Preload.enable"
+ CommandDisable = "Preload.disable"
+)
diff --git a/preload/types.go b/preload/types.go
new file mode 100644
index 0000000..670f7ed
--- /dev/null
+++ b/preload/types.go
@@ -0,0 +1,618 @@
+package preload
+
+// Code generated by cdproto-gen. DO NOT EDIT.
+
+import (
+ "fmt"
+
+ "github.com/chromedp/cdproto/cdp"
+ "github.com/chromedp/cdproto/network"
+ "github.com/mailru/easyjson"
+ "github.com/mailru/easyjson/jlexer"
+ "github.com/mailru/easyjson/jwriter"
+)
+
+// RuleSetID unique id.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#type-RuleSetId
+type RuleSetID string
+
+// String returns the RuleSetID as string value.
+func (t RuleSetID) String() string {
+ return string(t)
+}
+
+// RuleSet corresponds to SpeculationRuleSet.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#type-RuleSet
+type RuleSet struct {
+ ID RuleSetID `json:"id"`
+ LoaderID cdp.LoaderID `json:"loaderId"` // Identifies a document which the rule set is associated with.
+ SourceText string `json:"sourceText"` // Source text of JSON representing the rule set. If it comes from <script> tag, it is the textContent of the node. Note that it is a JSON for valid case. See also: - https://wicg.github.io/nav-speculation/speculation-rules.html - https://github.com/WICG/nav-speculation/blob/main/triggers.md
+ BackendNodeID cdp.BackendNodeID `json:"backendNodeId,omitempty"` // A speculation rule set is either added through an inline <script> tag or through an external resource via the 'Speculation-Rules' HTTP header. For the first case, we include the BackendNodeId of the relevant <script> tag. For the second case, we include the external URL where the rule set was loaded from, and also RequestId if Network domain is enabled. See also: - https://wicg.github.io/nav-speculation/speculation-rules.html#speculation-rules-script - https://wicg.github.io/nav-speculation/speculation-rules.html#speculation-rules-header
+ URL string `json:"url,omitempty"`
+ RequestID network.RequestID `json:"requestId,omitempty"`
+ ErrorType RuleSetErrorType `json:"errorType,omitempty"` // Error information errorMessage is null iff errorType is null.
+}
+
+// RuleSetErrorType [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#type-RuleSetErrorType
+type RuleSetErrorType string
+
+// String returns the RuleSetErrorType as string value.
+func (t RuleSetErrorType) String() string {
+ return string(t)
+}
+
+// RuleSetErrorType values.
+const (
+ RuleSetErrorTypeSourceIsNotJSONObject RuleSetErrorType = "SourceIsNotJsonObject"
+ RuleSetErrorTypeInvalidRulesSkipped RuleSetErrorType = "InvalidRulesSkipped"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t RuleSetErrorType) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t RuleSetErrorType) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *RuleSetErrorType) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch RuleSetErrorType(v) {
+ case RuleSetErrorTypeSourceIsNotJSONObject:
+ *t = RuleSetErrorTypeSourceIsNotJSONObject
+ case RuleSetErrorTypeInvalidRulesSkipped:
+ *t = RuleSetErrorTypeInvalidRulesSkipped
+
+ default:
+ in.AddError(fmt.Errorf("unknown RuleSetErrorType value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *RuleSetErrorType) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
+// SpeculationAction the type of preloading attempted. It corresponds to
+// mojom::SpeculationAction (although PrefetchWithSubresources is omitted as it
+// isn't being used by clients).
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#type-SpeculationAction
+type SpeculationAction string
+
+// String returns the SpeculationAction as string value.
+func (t SpeculationAction) String() string {
+ return string(t)
+}
+
+// SpeculationAction values.
+const (
+ SpeculationActionPrefetch SpeculationAction = "Prefetch"
+ SpeculationActionPrerender SpeculationAction = "Prerender"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t SpeculationAction) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t SpeculationAction) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *SpeculationAction) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch SpeculationAction(v) {
+ case SpeculationActionPrefetch:
+ *t = SpeculationActionPrefetch
+ case SpeculationActionPrerender:
+ *t = SpeculationActionPrerender
+
+ default:
+ in.AddError(fmt.Errorf("unknown SpeculationAction value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *SpeculationAction) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
+// SpeculationTargetHint corresponds to mojom::SpeculationTargetHint. See
+// https://github.com/WICG/nav-speculation/blob/main/triggers.md#window-name-targeting-hints.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#type-SpeculationTargetHint
+type SpeculationTargetHint string
+
+// String returns the SpeculationTargetHint as string value.
+func (t SpeculationTargetHint) String() string {
+ return string(t)
+}
+
+// SpeculationTargetHint values.
+const (
+ SpeculationTargetHintBlank SpeculationTargetHint = "Blank"
+ SpeculationTargetHintSelf SpeculationTargetHint = "Self"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t SpeculationTargetHint) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t SpeculationTargetHint) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *SpeculationTargetHint) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch SpeculationTargetHint(v) {
+ case SpeculationTargetHintBlank:
+ *t = SpeculationTargetHintBlank
+ case SpeculationTargetHintSelf:
+ *t = SpeculationTargetHintSelf
+
+ default:
+ in.AddError(fmt.Errorf("unknown SpeculationTargetHint value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *SpeculationTargetHint) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
+// IngAttemptKey a key that identifies a preloading attempt. The url used is
+// the url specified by the trigger (i.e. the initial URL), and not the final
+// url that is navigated to. For example, prerendering allows same-origin main
+// frame navigations during the attempt, but the attempt is still keyed with the
+// initial URL.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#type-PreloadingAttemptKey
+type IngAttemptKey struct {
+ LoaderID cdp.LoaderID `json:"loaderId"`
+ Action SpeculationAction `json:"action"`
+ URL string `json:"url"`
+ TargetHint SpeculationTargetHint `json:"targetHint,omitempty"`
+}
+
+// IngAttemptSource lists sources for a preloading attempt, specifically the
+// ids of rule sets that had a speculation rule that triggered the attempt, and
+// the BackendNodeIds of <a href> or <area href> elements that triggered the
+// attempt (in the case of attempts triggered by a document rule). It is
+// possible for multiple rule sets and links to trigger a single attempt.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#type-PreloadingAttemptSource
+type IngAttemptSource struct {
+ Key *IngAttemptKey `json:"key"`
+ RuleSetIDs []RuleSetID `json:"ruleSetIds"`
+ NodeIDs []cdp.BackendNodeID `json:"nodeIds"`
+}
+
+// PrerenderFinalStatus list of FinalStatus reasons for Prerender2.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#type-PrerenderFinalStatus
+type PrerenderFinalStatus string
+
+// String returns the PrerenderFinalStatus as string value.
+func (t PrerenderFinalStatus) String() string {
+ return string(t)
+}
+
+// PrerenderFinalStatus values.
+const (
+ PrerenderFinalStatusActivated PrerenderFinalStatus = "Activated"
+ PrerenderFinalStatusDestroyed PrerenderFinalStatus = "Destroyed"
+ PrerenderFinalStatusLowEndDevice PrerenderFinalStatus = "LowEndDevice"
+ PrerenderFinalStatusInvalidSchemeRedirect PrerenderFinalStatus = "InvalidSchemeRedirect"
+ PrerenderFinalStatusInvalidSchemeNavigation PrerenderFinalStatus = "InvalidSchemeNavigation"
+ PrerenderFinalStatusInProgressNavigation PrerenderFinalStatus = "InProgressNavigation"
+ PrerenderFinalStatusNavigationRequestBlockedByCsp PrerenderFinalStatus = "NavigationRequestBlockedByCsp"
+ PrerenderFinalStatusMainFrameNavigation PrerenderFinalStatus = "MainFrameNavigation"
+ PrerenderFinalStatusMojoBinderPolicy PrerenderFinalStatus = "MojoBinderPolicy"
+ PrerenderFinalStatusRendererProcessCrashed PrerenderFinalStatus = "RendererProcessCrashed"
+ PrerenderFinalStatusRendererProcessKilled PrerenderFinalStatus = "RendererProcessKilled"
+ PrerenderFinalStatusDownload PrerenderFinalStatus = "Download"
+ PrerenderFinalStatusTriggerDestroyed PrerenderFinalStatus = "TriggerDestroyed"
+ PrerenderFinalStatusNavigationNotCommitted PrerenderFinalStatus = "NavigationNotCommitted"
+ PrerenderFinalStatusNavigationBadHTTPStatus PrerenderFinalStatus = "NavigationBadHttpStatus"
+ PrerenderFinalStatusClientCertRequested PrerenderFinalStatus = "ClientCertRequested"
+ PrerenderFinalStatusNavigationRequestNetworkError PrerenderFinalStatus = "NavigationRequestNetworkError"
+ PrerenderFinalStatusMaxNumOfRunningPrerendersExceeded PrerenderFinalStatus = "MaxNumOfRunningPrerendersExceeded"
+ PrerenderFinalStatusCancelAllHostsForTesting PrerenderFinalStatus = "CancelAllHostsForTesting"
+ PrerenderFinalStatusDidFailLoad PrerenderFinalStatus = "DidFailLoad"
+ PrerenderFinalStatusStop PrerenderFinalStatus = "Stop"
+ PrerenderFinalStatusSslCertificateError PrerenderFinalStatus = "SslCertificateError"
+ PrerenderFinalStatusLoginAuthRequested PrerenderFinalStatus = "LoginAuthRequested"
+ PrerenderFinalStatusUaChangeRequiresReload PrerenderFinalStatus = "UaChangeRequiresReload"
+ PrerenderFinalStatusBlockedByClient PrerenderFinalStatus = "BlockedByClient"
+ PrerenderFinalStatusAudioOutputDeviceRequested PrerenderFinalStatus = "AudioOutputDeviceRequested"
+ PrerenderFinalStatusMixedContent PrerenderFinalStatus = "MixedContent"
+ PrerenderFinalStatusTriggerBackgrounded PrerenderFinalStatus = "TriggerBackgrounded"
+ PrerenderFinalStatusMemoryLimitExceeded PrerenderFinalStatus = "MemoryLimitExceeded"
+ PrerenderFinalStatusFailToGetMemoryUsage PrerenderFinalStatus = "FailToGetMemoryUsage"
+ PrerenderFinalStatusDataSaverEnabled PrerenderFinalStatus = "DataSaverEnabled"
+ PrerenderFinalStatusHasEffectiveURL PrerenderFinalStatus = "HasEffectiveUrl"
+ PrerenderFinalStatusActivatedBeforeStarted PrerenderFinalStatus = "ActivatedBeforeStarted"
+ PrerenderFinalStatusInactivePageRestriction PrerenderFinalStatus = "InactivePageRestriction"
+ PrerenderFinalStatusStartFailed PrerenderFinalStatus = "StartFailed"
+ PrerenderFinalStatusTimeoutBackgrounded PrerenderFinalStatus = "TimeoutBackgrounded"
+ PrerenderFinalStatusCrossSiteRedirectInInitialNavigation PrerenderFinalStatus = "CrossSiteRedirectInInitialNavigation"
+ PrerenderFinalStatusCrossSiteNavigationInInitialNavigation PrerenderFinalStatus = "CrossSiteNavigationInInitialNavigation"
+ PrerenderFinalStatusSameSiteCrossOriginRedirectNotOptInInInitialNavigation PrerenderFinalStatus = "SameSiteCrossOriginRedirectNotOptInInInitialNavigation"
+ PrerenderFinalStatusSameSiteCrossOriginNavigationNotOptInInInitialNavigation PrerenderFinalStatus = "SameSiteCrossOriginNavigationNotOptInInInitialNavigation"
+ PrerenderFinalStatusActivationNavigationParameterMismatch PrerenderFinalStatus = "ActivationNavigationParameterMismatch"
+ PrerenderFinalStatusActivatedInBackground PrerenderFinalStatus = "ActivatedInBackground"
+ PrerenderFinalStatusEmbedderHostDisallowed PrerenderFinalStatus = "EmbedderHostDisallowed"
+ PrerenderFinalStatusActivationNavigationDestroyedBeforeSuccess PrerenderFinalStatus = "ActivationNavigationDestroyedBeforeSuccess"
+ PrerenderFinalStatusTabClosedByUserGesture PrerenderFinalStatus = "TabClosedByUserGesture"
+ PrerenderFinalStatusTabClosedWithoutUserGesture PrerenderFinalStatus = "TabClosedWithoutUserGesture"
+ PrerenderFinalStatusPrimaryMainFrameRendererProcessCrashed PrerenderFinalStatus = "PrimaryMainFrameRendererProcessCrashed"
+ PrerenderFinalStatusPrimaryMainFrameRendererProcessKilled PrerenderFinalStatus = "PrimaryMainFrameRendererProcessKilled"
+ PrerenderFinalStatusActivationFramePolicyNotCompatible PrerenderFinalStatus = "ActivationFramePolicyNotCompatible"
+ PrerenderFinalStatusPreloadingDisabled PrerenderFinalStatus = "PreloadingDisabled"
+ PrerenderFinalStatusBatterySaverEnabled PrerenderFinalStatus = "BatterySaverEnabled"
+ PrerenderFinalStatusActivatedDuringMainFrameNavigation PrerenderFinalStatus = "ActivatedDuringMainFrameNavigation"
+ PrerenderFinalStatusPreloadingUnsupportedByWebContents PrerenderFinalStatus = "PreloadingUnsupportedByWebContents"
+ PrerenderFinalStatusCrossSiteRedirectInMainFrameNavigation PrerenderFinalStatus = "CrossSiteRedirectInMainFrameNavigation"
+ PrerenderFinalStatusCrossSiteNavigationInMainFrameNavigation PrerenderFinalStatus = "CrossSiteNavigationInMainFrameNavigation"
+ PrerenderFinalStatusSameSiteCrossOriginRedirectNotOptInInMainFrameNavigation PrerenderFinalStatus = "SameSiteCrossOriginRedirectNotOptInInMainFrameNavigation"
+ PrerenderFinalStatusSameSiteCrossOriginNavigationNotOptInInMainFrameNavigation PrerenderFinalStatus = "SameSiteCrossOriginNavigationNotOptInInMainFrameNavigation"
+ PrerenderFinalStatusMemoryPressureOnTrigger PrerenderFinalStatus = "MemoryPressureOnTrigger"
+ PrerenderFinalStatusMemoryPressureAfterTriggered PrerenderFinalStatus = "MemoryPressureAfterTriggered"
+ PrerenderFinalStatusPrerenderingDisabledByDevTools PrerenderFinalStatus = "PrerenderingDisabledByDevTools"
+ PrerenderFinalStatusResourceLoadBlockedByClient PrerenderFinalStatus = "ResourceLoadBlockedByClient"
+ PrerenderFinalStatusSpeculationRuleRemoved PrerenderFinalStatus = "SpeculationRuleRemoved"
+ PrerenderFinalStatusActivatedWithAuxiliaryBrowsingContexts PrerenderFinalStatus = "ActivatedWithAuxiliaryBrowsingContexts"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t PrerenderFinalStatus) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t PrerenderFinalStatus) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *PrerenderFinalStatus) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch PrerenderFinalStatus(v) {
+ case PrerenderFinalStatusActivated:
+ *t = PrerenderFinalStatusActivated
+ case PrerenderFinalStatusDestroyed:
+ *t = PrerenderFinalStatusDestroyed
+ case PrerenderFinalStatusLowEndDevice:
+ *t = PrerenderFinalStatusLowEndDevice
+ case PrerenderFinalStatusInvalidSchemeRedirect:
+ *t = PrerenderFinalStatusInvalidSchemeRedirect
+ case PrerenderFinalStatusInvalidSchemeNavigation:
+ *t = PrerenderFinalStatusInvalidSchemeNavigation
+ case PrerenderFinalStatusInProgressNavigation:
+ *t = PrerenderFinalStatusInProgressNavigation
+ case PrerenderFinalStatusNavigationRequestBlockedByCsp:
+ *t = PrerenderFinalStatusNavigationRequestBlockedByCsp
+ case PrerenderFinalStatusMainFrameNavigation:
+ *t = PrerenderFinalStatusMainFrameNavigation
+ case PrerenderFinalStatusMojoBinderPolicy:
+ *t = PrerenderFinalStatusMojoBinderPolicy
+ case PrerenderFinalStatusRendererProcessCrashed:
+ *t = PrerenderFinalStatusRendererProcessCrashed
+ case PrerenderFinalStatusRendererProcessKilled:
+ *t = PrerenderFinalStatusRendererProcessKilled
+ case PrerenderFinalStatusDownload:
+ *t = PrerenderFinalStatusDownload
+ case PrerenderFinalStatusTriggerDestroyed:
+ *t = PrerenderFinalStatusTriggerDestroyed
+ case PrerenderFinalStatusNavigationNotCommitted:
+ *t = PrerenderFinalStatusNavigationNotCommitted
+ case PrerenderFinalStatusNavigationBadHTTPStatus:
+ *t = PrerenderFinalStatusNavigationBadHTTPStatus
+ case PrerenderFinalStatusClientCertRequested:
+ *t = PrerenderFinalStatusClientCertRequested
+ case PrerenderFinalStatusNavigationRequestNetworkError:
+ *t = PrerenderFinalStatusNavigationRequestNetworkError
+ case PrerenderFinalStatusMaxNumOfRunningPrerendersExceeded:
+ *t = PrerenderFinalStatusMaxNumOfRunningPrerendersExceeded
+ case PrerenderFinalStatusCancelAllHostsForTesting:
+ *t = PrerenderFinalStatusCancelAllHostsForTesting
+ case PrerenderFinalStatusDidFailLoad:
+ *t = PrerenderFinalStatusDidFailLoad
+ case PrerenderFinalStatusStop:
+ *t = PrerenderFinalStatusStop
+ case PrerenderFinalStatusSslCertificateError:
+ *t = PrerenderFinalStatusSslCertificateError
+ case PrerenderFinalStatusLoginAuthRequested:
+ *t = PrerenderFinalStatusLoginAuthRequested
+ case PrerenderFinalStatusUaChangeRequiresReload:
+ *t = PrerenderFinalStatusUaChangeRequiresReload
+ case PrerenderFinalStatusBlockedByClient:
+ *t = PrerenderFinalStatusBlockedByClient
+ case PrerenderFinalStatusAudioOutputDeviceRequested:
+ *t = PrerenderFinalStatusAudioOutputDeviceRequested
+ case PrerenderFinalStatusMixedContent:
+ *t = PrerenderFinalStatusMixedContent
+ case PrerenderFinalStatusTriggerBackgrounded:
+ *t = PrerenderFinalStatusTriggerBackgrounded
+ case PrerenderFinalStatusMemoryLimitExceeded:
+ *t = PrerenderFinalStatusMemoryLimitExceeded
+ case PrerenderFinalStatusFailToGetMemoryUsage:
+ *t = PrerenderFinalStatusFailToGetMemoryUsage
+ case PrerenderFinalStatusDataSaverEnabled:
+ *t = PrerenderFinalStatusDataSaverEnabled
+ case PrerenderFinalStatusHasEffectiveURL:
+ *t = PrerenderFinalStatusHasEffectiveURL
+ case PrerenderFinalStatusActivatedBeforeStarted:
+ *t = PrerenderFinalStatusActivatedBeforeStarted
+ case PrerenderFinalStatusInactivePageRestriction:
+ *t = PrerenderFinalStatusInactivePageRestriction
+ case PrerenderFinalStatusStartFailed:
+ *t = PrerenderFinalStatusStartFailed
+ case PrerenderFinalStatusTimeoutBackgrounded:
+ *t = PrerenderFinalStatusTimeoutBackgrounded
+ case PrerenderFinalStatusCrossSiteRedirectInInitialNavigation:
+ *t = PrerenderFinalStatusCrossSiteRedirectInInitialNavigation
+ case PrerenderFinalStatusCrossSiteNavigationInInitialNavigation:
+ *t = PrerenderFinalStatusCrossSiteNavigationInInitialNavigation
+ case PrerenderFinalStatusSameSiteCrossOriginRedirectNotOptInInInitialNavigation:
+ *t = PrerenderFinalStatusSameSiteCrossOriginRedirectNotOptInInInitialNavigation
+ case PrerenderFinalStatusSameSiteCrossOriginNavigationNotOptInInInitialNavigation:
+ *t = PrerenderFinalStatusSameSiteCrossOriginNavigationNotOptInInInitialNavigation
+ case PrerenderFinalStatusActivationNavigationParameterMismatch:
+ *t = PrerenderFinalStatusActivationNavigationParameterMismatch
+ case PrerenderFinalStatusActivatedInBackground:
+ *t = PrerenderFinalStatusActivatedInBackground
+ case PrerenderFinalStatusEmbedderHostDisallowed:
+ *t = PrerenderFinalStatusEmbedderHostDisallowed
+ case PrerenderFinalStatusActivationNavigationDestroyedBeforeSuccess:
+ *t = PrerenderFinalStatusActivationNavigationDestroyedBeforeSuccess
+ case PrerenderFinalStatusTabClosedByUserGesture:
+ *t = PrerenderFinalStatusTabClosedByUserGesture
+ case PrerenderFinalStatusTabClosedWithoutUserGesture:
+ *t = PrerenderFinalStatusTabClosedWithoutUserGesture
+ case PrerenderFinalStatusPrimaryMainFrameRendererProcessCrashed:
+ *t = PrerenderFinalStatusPrimaryMainFrameRendererProcessCrashed
+ case PrerenderFinalStatusPrimaryMainFrameRendererProcessKilled:
+ *t = PrerenderFinalStatusPrimaryMainFrameRendererProcessKilled
+ case PrerenderFinalStatusActivationFramePolicyNotCompatible:
+ *t = PrerenderFinalStatusActivationFramePolicyNotCompatible
+ case PrerenderFinalStatusPreloadingDisabled:
+ *t = PrerenderFinalStatusPreloadingDisabled
+ case PrerenderFinalStatusBatterySaverEnabled:
+ *t = PrerenderFinalStatusBatterySaverEnabled
+ case PrerenderFinalStatusActivatedDuringMainFrameNavigation:
+ *t = PrerenderFinalStatusActivatedDuringMainFrameNavigation
+ case PrerenderFinalStatusPreloadingUnsupportedByWebContents:
+ *t = PrerenderFinalStatusPreloadingUnsupportedByWebContents
+ case PrerenderFinalStatusCrossSiteRedirectInMainFrameNavigation:
+ *t = PrerenderFinalStatusCrossSiteRedirectInMainFrameNavigation
+ case PrerenderFinalStatusCrossSiteNavigationInMainFrameNavigation:
+ *t = PrerenderFinalStatusCrossSiteNavigationInMainFrameNavigation
+ case PrerenderFinalStatusSameSiteCrossOriginRedirectNotOptInInMainFrameNavigation:
+ *t = PrerenderFinalStatusSameSiteCrossOriginRedirectNotOptInInMainFrameNavigation
+ case PrerenderFinalStatusSameSiteCrossOriginNavigationNotOptInInMainFrameNavigation:
+ *t = PrerenderFinalStatusSameSiteCrossOriginNavigationNotOptInInMainFrameNavigation
+ case PrerenderFinalStatusMemoryPressureOnTrigger:
+ *t = PrerenderFinalStatusMemoryPressureOnTrigger
+ case PrerenderFinalStatusMemoryPressureAfterTriggered:
+ *t = PrerenderFinalStatusMemoryPressureAfterTriggered
+ case PrerenderFinalStatusPrerenderingDisabledByDevTools:
+ *t = PrerenderFinalStatusPrerenderingDisabledByDevTools
+ case PrerenderFinalStatusResourceLoadBlockedByClient:
+ *t = PrerenderFinalStatusResourceLoadBlockedByClient
+ case PrerenderFinalStatusSpeculationRuleRemoved:
+ *t = PrerenderFinalStatusSpeculationRuleRemoved
+ case PrerenderFinalStatusActivatedWithAuxiliaryBrowsingContexts:
+ *t = PrerenderFinalStatusActivatedWithAuxiliaryBrowsingContexts
+
+ default:
+ in.AddError(fmt.Errorf("unknown PrerenderFinalStatus value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *PrerenderFinalStatus) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
+// IngStatus preloading status values, see also PreloadingTriggeringOutcome.
+// This status is shared by prefetchStatusUpdated and prerenderStatusUpdated.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#type-PreloadingStatus
+type IngStatus string
+
+// String returns the IngStatus as string value.
+func (t IngStatus) String() string {
+ return string(t)
+}
+
+// IngStatus values.
+const (
+ IngStatusPending IngStatus = "Pending"
+ IngStatusRunning IngStatus = "Running"
+ IngStatusReady IngStatus = "Ready"
+ IngStatusSuccess IngStatus = "Success"
+ IngStatusFailure IngStatus = "Failure"
+ IngStatusNotSupported IngStatus = "NotSupported"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t IngStatus) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t IngStatus) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *IngStatus) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch IngStatus(v) {
+ case IngStatusPending:
+ *t = IngStatusPending
+ case IngStatusRunning:
+ *t = IngStatusRunning
+ case IngStatusReady:
+ *t = IngStatusReady
+ case IngStatusSuccess:
+ *t = IngStatusSuccess
+ case IngStatusFailure:
+ *t = IngStatusFailure
+ case IngStatusNotSupported:
+ *t = IngStatusNotSupported
+
+ default:
+ in.AddError(fmt.Errorf("unknown IngStatus value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *IngStatus) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
+// PrefetchStatus tODO(https://crbug.com/1384419): revisit the list of
+// PrefetchStatus and filter out the ones that aren't necessary to the
+// developers.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Preload#type-PrefetchStatus
+type PrefetchStatus string
+
+// String returns the PrefetchStatus as string value.
+func (t PrefetchStatus) String() string {
+ return string(t)
+}
+
+// PrefetchStatus values.
+const (
+ PrefetchStatusPrefetchAllowed PrefetchStatus = "PrefetchAllowed"
+ PrefetchStatusPrefetchFailedIneligibleRedirect PrefetchStatus = "PrefetchFailedIneligibleRedirect"
+ PrefetchStatusPrefetchFailedInvalidRedirect PrefetchStatus = "PrefetchFailedInvalidRedirect"
+ PrefetchStatusPrefetchFailedMIMENotSupported PrefetchStatus = "PrefetchFailedMIMENotSupported"
+ PrefetchStatusPrefetchFailedNetError PrefetchStatus = "PrefetchFailedNetError"
+ PrefetchStatusPrefetchFailedNon2xX PrefetchStatus = "PrefetchFailedNon2XX"
+ PrefetchStatusPrefetchFailedPerPageLimitExceeded PrefetchStatus = "PrefetchFailedPerPageLimitExceeded"
+ PrefetchStatusPrefetchEvicted PrefetchStatus = "PrefetchEvicted"
+ PrefetchStatusPrefetchHeldback PrefetchStatus = "PrefetchHeldback"
+ PrefetchStatusPrefetchIneligibleRetryAfter PrefetchStatus = "PrefetchIneligibleRetryAfter"
+ PrefetchStatusPrefetchIsPrivacyDecoy PrefetchStatus = "PrefetchIsPrivacyDecoy"
+ PrefetchStatusPrefetchIsStale PrefetchStatus = "PrefetchIsStale"
+ PrefetchStatusPrefetchNotEligibleBrowserContextOffTheRecord PrefetchStatus = "PrefetchNotEligibleBrowserContextOffTheRecord"
+ PrefetchStatusPrefetchNotEligibleDataSaverEnabled PrefetchStatus = "PrefetchNotEligibleDataSaverEnabled"
+ PrefetchStatusPrefetchNotEligibleExistingProxy PrefetchStatus = "PrefetchNotEligibleExistingProxy"
+ PrefetchStatusPrefetchNotEligibleHostIsNonUnique PrefetchStatus = "PrefetchNotEligibleHostIsNonUnique"
+ PrefetchStatusPrefetchNotEligibleNonDefaultStoragePartition PrefetchStatus = "PrefetchNotEligibleNonDefaultStoragePartition"
+ PrefetchStatusPrefetchNotEligibleSameSiteCrossOriginPrefetchRequiredProxy PrefetchStatus = "PrefetchNotEligibleSameSiteCrossOriginPrefetchRequiredProxy"
+ PrefetchStatusPrefetchNotEligibleSchemeIsNotHTTPS PrefetchStatus = "PrefetchNotEligibleSchemeIsNotHttps"
+ PrefetchStatusPrefetchNotEligibleUserHasCookies PrefetchStatus = "PrefetchNotEligibleUserHasCookies"
+ PrefetchStatusPrefetchNotEligibleUserHasServiceWorker PrefetchStatus = "PrefetchNotEligibleUserHasServiceWorker"
+ PrefetchStatusPrefetchNotEligibleBatterySaverEnabled PrefetchStatus = "PrefetchNotEligibleBatterySaverEnabled"
+ PrefetchStatusPrefetchNotEligiblePreloadingDisabled PrefetchStatus = "PrefetchNotEligiblePreloadingDisabled"
+ PrefetchStatusPrefetchNotFinishedInTime PrefetchStatus = "PrefetchNotFinishedInTime"
+ PrefetchStatusPrefetchNotStarted PrefetchStatus = "PrefetchNotStarted"
+ PrefetchStatusPrefetchNotUsedCookiesChanged PrefetchStatus = "PrefetchNotUsedCookiesChanged"
+ PrefetchStatusPrefetchProxyNotAvailable PrefetchStatus = "PrefetchProxyNotAvailable"
+ PrefetchStatusPrefetchResponseUsed PrefetchStatus = "PrefetchResponseUsed"
+ PrefetchStatusPrefetchSuccessfulButNotUsed PrefetchStatus = "PrefetchSuccessfulButNotUsed"
+ PrefetchStatusPrefetchNotUsedProbeFailed PrefetchStatus = "PrefetchNotUsedProbeFailed"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t PrefetchStatus) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t PrefetchStatus) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *PrefetchStatus) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch PrefetchStatus(v) {
+ case PrefetchStatusPrefetchAllowed:
+ *t = PrefetchStatusPrefetchAllowed
+ case PrefetchStatusPrefetchFailedIneligibleRedirect:
+ *t = PrefetchStatusPrefetchFailedIneligibleRedirect
+ case PrefetchStatusPrefetchFailedInvalidRedirect:
+ *t = PrefetchStatusPrefetchFailedInvalidRedirect
+ case PrefetchStatusPrefetchFailedMIMENotSupported:
+ *t = PrefetchStatusPrefetchFailedMIMENotSupported
+ case PrefetchStatusPrefetchFailedNetError:
+ *t = PrefetchStatusPrefetchFailedNetError
+ case PrefetchStatusPrefetchFailedNon2xX:
+ *t = PrefetchStatusPrefetchFailedNon2xX
+ case PrefetchStatusPrefetchFailedPerPageLimitExceeded:
+ *t = PrefetchStatusPrefetchFailedPerPageLimitExceeded
+ case PrefetchStatusPrefetchEvicted:
+ *t = PrefetchStatusPrefetchEvicted
+ case PrefetchStatusPrefetchHeldback:
+ *t = PrefetchStatusPrefetchHeldback
+ case PrefetchStatusPrefetchIneligibleRetryAfter:
+ *t = PrefetchStatusPrefetchIneligibleRetryAfter
+ case PrefetchStatusPrefetchIsPrivacyDecoy:
+ *t = PrefetchStatusPrefetchIsPrivacyDecoy
+ case PrefetchStatusPrefetchIsStale:
+ *t = PrefetchStatusPrefetchIsStale
+ case PrefetchStatusPrefetchNotEligibleBrowserContextOffTheRecord:
+ *t = PrefetchStatusPrefetchNotEligibleBrowserContextOffTheRecord
+ case PrefetchStatusPrefetchNotEligibleDataSaverEnabled:
+ *t = PrefetchStatusPrefetchNotEligibleDataSaverEnabled
+ case PrefetchStatusPrefetchNotEligibleExistingProxy:
+ *t = PrefetchStatusPrefetchNotEligibleExistingProxy
+ case PrefetchStatusPrefetchNotEligibleHostIsNonUnique:
+ *t = PrefetchStatusPrefetchNotEligibleHostIsNonUnique
+ case PrefetchStatusPrefetchNotEligibleNonDefaultStoragePartition:
+ *t = PrefetchStatusPrefetchNotEligibleNonDefaultStoragePartition
+ case PrefetchStatusPrefetchNotEligibleSameSiteCrossOriginPrefetchRequiredProxy:
+ *t = PrefetchStatusPrefetchNotEligibleSameSiteCrossOriginPrefetchRequiredProxy
+ case PrefetchStatusPrefetchNotEligibleSchemeIsNotHTTPS:
+ *t = PrefetchStatusPrefetchNotEligibleSchemeIsNotHTTPS
+ case PrefetchStatusPrefetchNotEligibleUserHasCookies:
+ *t = PrefetchStatusPrefetchNotEligibleUserHasCookies
+ case PrefetchStatusPrefetchNotEligibleUserHasServiceWorker:
+ *t = PrefetchStatusPrefetchNotEligibleUserHasServiceWorker
+ case PrefetchStatusPrefetchNotEligibleBatterySaverEnabled:
+ *t = PrefetchStatusPrefetchNotEligibleBatterySaverEnabled
+ case PrefetchStatusPrefetchNotEligiblePreloadingDisabled:
+ *t = PrefetchStatusPrefetchNotEligiblePreloadingDisabled
+ case PrefetchStatusPrefetchNotFinishedInTime:
+ *t = PrefetchStatusPrefetchNotFinishedInTime
+ case PrefetchStatusPrefetchNotStarted:
+ *t = PrefetchStatusPrefetchNotStarted
+ case PrefetchStatusPrefetchNotUsedCookiesChanged:
+ *t = PrefetchStatusPrefetchNotUsedCookiesChanged
+ case PrefetchStatusPrefetchProxyNotAvailable:
+ *t = PrefetchStatusPrefetchProxyNotAvailable
+ case PrefetchStatusPrefetchResponseUsed:
+ *t = PrefetchStatusPrefetchResponseUsed
+ case PrefetchStatusPrefetchSuccessfulButNotUsed:
+ *t = PrefetchStatusPrefetchSuccessfulButNotUsed
+ case PrefetchStatusPrefetchNotUsedProbeFailed:
+ *t = PrefetchStatusPrefetchNotUsedProbeFailed
+
+ default:
+ in.AddError(fmt.Errorf("unknown PrefetchStatus value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *PrefetchStatus) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
diff --git a/runtime/easyjson.go b/runtime/easyjson.go
index e3f888c..9b58820 100644
--- a/runtime/easyjson.go
+++ b/runtime/easyjson.go
@@ -17,87 +17,7 @@ var (
_ easyjson.Marshaler
)
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime(in *jlexer.Lexer, out *WebDriverValue) {
- isTopLevel := in.IsStart()
- if in.IsNull() {
- if isTopLevel {
- in.Consumed()
- }
- in.Skip()
- return
- }
- in.Delim('{')
- for !in.IsDelim('}') {
- key := in.UnsafeFieldName(false)
- in.WantColon()
- if in.IsNull() {
- in.Skip()
- in.WantComma()
- continue
- }
- switch key {
- case "type":
- (out.Type).UnmarshalEasyJSON(in)
- case "value":
- (out.Value).UnmarshalEasyJSON(in)
- case "objectId":
- out.ObjectID = string(in.String())
- default:
- in.SkipRecursive()
- }
- in.WantComma()
- }
- in.Delim('}')
- if isTopLevel {
- in.Consumed()
- }
-}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime(out *jwriter.Writer, in WebDriverValue) {
- out.RawByte('{')
- first := true
- _ = first
- {
- const prefix string = ",\"type\":"
- out.RawString(prefix[1:])
- (in.Type).MarshalEasyJSON(out)
- }
- if (in.Value).IsDefined() {
- const prefix string = ",\"value\":"
- out.RawString(prefix)
- (in.Value).MarshalEasyJSON(out)
- }
- if in.ObjectID != "" {
- const prefix string = ",\"objectId\":"
- out.RawString(prefix)
- out.String(string(in.ObjectID))
- }
- out.RawByte('}')
-}
-
-// MarshalJSON supports json.Marshaler interface
-func (v WebDriverValue) MarshalJSON() ([]byte, error) {
- w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime(&w, v)
- return w.Buffer.BuildBytes(), w.Error
-}
-
-// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v WebDriverValue) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime(w, v)
-}
-
-// UnmarshalJSON supports json.Unmarshaler interface
-func (v *WebDriverValue) UnmarshalJSON(data []byte) error {
- r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime(&r, v)
- return r.Error()
-}
-
-// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *WebDriverValue) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime(l, v)
-}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime1(in *jlexer.Lexer, out *TerminateExecutionParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime(in *jlexer.Lexer, out *TerminateExecutionParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -126,7 +46,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime1(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime1(out *jwriter.Writer, in TerminateExecutionParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime(out *jwriter.Writer, in TerminateExecutionParams) {
out.RawByte('{')
first := true
_ = first
@@ -136,27 +56,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime1(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v TerminateExecutionParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime1(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v TerminateExecutionParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime1(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *TerminateExecutionParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime1(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *TerminateExecutionParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime1(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime2(in *jlexer.Lexer, out *StackTraceID) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime1(in *jlexer.Lexer, out *StackTraceID) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -189,7 +109,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime2(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime2(out *jwriter.Writer, in StackTraceID) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime1(out *jwriter.Writer, in StackTraceID) {
out.RawByte('{')
first := true
_ = first
@@ -209,27 +129,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime2(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v StackTraceID) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime2(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime1(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v StackTraceID) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime2(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime1(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *StackTraceID) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime2(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime1(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *StackTraceID) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime2(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime1(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime3(in *jlexer.Lexer, out *StackTrace) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime2(in *jlexer.Lexer, out *StackTrace) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -311,7 +231,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime3(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime3(out *jwriter.Writer, in StackTrace) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime2(out *jwriter.Writer, in StackTrace) {
out.RawByte('{')
first := true
_ = first
@@ -362,27 +282,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime3(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v StackTrace) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime3(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime2(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v StackTrace) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime3(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime2(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *StackTrace) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime3(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime2(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *StackTrace) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime3(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime2(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime4(in *jlexer.Lexer, out *SetMaxCallStackSizeToCaptureParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime3(in *jlexer.Lexer, out *SetMaxCallStackSizeToCaptureParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -413,7 +333,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime4(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime4(out *jwriter.Writer, in SetMaxCallStackSizeToCaptureParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime3(out *jwriter.Writer, in SetMaxCallStackSizeToCaptureParams) {
out.RawByte('{')
first := true
_ = first
@@ -428,27 +348,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime4(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v SetMaxCallStackSizeToCaptureParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime4(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime3(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetMaxCallStackSizeToCaptureParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime4(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime3(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetMaxCallStackSizeToCaptureParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime4(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime3(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetMaxCallStackSizeToCaptureParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime4(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime3(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime5(in *jlexer.Lexer, out *SetCustomObjectFormatterEnabledParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime4(in *jlexer.Lexer, out *SetCustomObjectFormatterEnabledParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -479,7 +399,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime5(in *jlexer.Lexer, ou
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime5(out *jwriter.Writer, in SetCustomObjectFormatterEnabledParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime4(out *jwriter.Writer, in SetCustomObjectFormatterEnabledParams) {
out.RawByte('{')
first := true
_ = first
@@ -494,24 +414,104 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime5(out *jwriter.Writer,
// MarshalJSON supports json.Marshaler interface
func (v SetCustomObjectFormatterEnabledParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime5(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime4(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetCustomObjectFormatterEnabledParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime5(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime4(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetCustomObjectFormatterEnabledParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime5(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime4(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetCustomObjectFormatterEnabledParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime4(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime5(in *jlexer.Lexer, out *SerializationOptions) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "serialization":
+ (out.Serialization).UnmarshalEasyJSON(in)
+ case "maxDepth":
+ out.MaxDepth = int64(in.Int64())
+ case "additionalParameters":
+ (out.AdditionalParameters).UnmarshalEasyJSON(in)
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime5(out *jwriter.Writer, in SerializationOptions) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"serialization\":"
+ out.RawString(prefix[1:])
+ (in.Serialization).MarshalEasyJSON(out)
+ }
+ if in.MaxDepth != 0 {
+ const prefix string = ",\"maxDepth\":"
+ out.RawString(prefix)
+ out.Int64(int64(in.MaxDepth))
+ }
+ if (in.AdditionalParameters).IsDefined() {
+ const prefix string = ",\"additionalParameters\":"
+ out.RawString(prefix)
+ (in.AdditionalParameters).MarshalEasyJSON(out)
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v SerializationOptions) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime5(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v SerializationOptions) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime5(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *SerializationOptions) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime5(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *SerializationOptions) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime5(l, v)
}
func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime6(in *jlexer.Lexer, out *RunScriptReturns) {
@@ -880,15 +880,15 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime10(in *jlexer.Lexer, o
out.UnserializableValue = UnserializableValue(in.String())
case "description":
out.Description = string(in.String())
- case "webDriverValue":
+ case "deepSerializedValue":
if in.IsNull() {
in.Skip()
- out.WebDriverValue = nil
+ out.DeepSerializedValue = nil
} else {
- if out.WebDriverValue == nil {
- out.WebDriverValue = new(WebDriverValue)
+ if out.DeepSerializedValue == nil {
+ out.DeepSerializedValue = new(DeepSerializedValue)
}
- (*out.WebDriverValue).UnmarshalEasyJSON(in)
+ (*out.DeepSerializedValue).UnmarshalEasyJSON(in)
}
case "objectId":
out.ObjectID = RemoteObjectID(in.String())
@@ -956,10 +956,10 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime10(out *jwriter.Writer
out.RawString(prefix)
out.String(string(in.Description))
}
- if in.WebDriverValue != nil {
- const prefix string = ",\"webDriverValue\":"
+ if in.DeepSerializedValue != nil {
+ const prefix string = ",\"deepSerializedValue\":"
out.RawString(prefix)
- (*in.WebDriverValue).MarshalEasyJSON(out)
+ (*in.DeepSerializedValue).MarshalEasyJSON(out)
}
if in.ObjectID != "" {
const prefix string = ",\"objectId\":"
@@ -3924,8 +3924,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime41(in *jlexer.Lexer, o
out.AllowUnsafeEvalBlockedByCSP = bool(in.Bool())
case "uniqueContextId":
out.UniqueContextID = string(in.String())
- case "generateWebDriverValue":
- out.GenerateWebDriverValue = bool(in.Bool())
+ case "serializationOptions":
+ if in.IsNull() {
+ in.Skip()
+ out.SerializationOptions = nil
+ } else {
+ if out.SerializationOptions == nil {
+ out.SerializationOptions = new(SerializationOptions)
+ }
+ (*out.SerializationOptions).UnmarshalEasyJSON(in)
+ }
default:
in.SkipRecursive()
}
@@ -4015,10 +4023,10 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime41(out *jwriter.Writer
out.RawString(prefix)
out.String(string(in.UniqueContextID))
}
- if in.GenerateWebDriverValue {
- const prefix string = ",\"generateWebDriverValue\":"
+ if in.SerializationOptions != nil {
+ const prefix string = ",\"serializationOptions\":"
out.RawString(prefix)
- out.Bool(bool(in.GenerateWebDriverValue))
+ (*in.SerializationOptions).MarshalEasyJSON(out)
}
out.RawByte('}')
}
@@ -4322,7 +4330,94 @@ func (v *DisableParams) UnmarshalJSON(data []byte) error {
func (v *DisableParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime45(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime46(in *jlexer.Lexer, out *CustomPreview) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime46(in *jlexer.Lexer, out *DeepSerializedValue) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "type":
+ (out.Type).UnmarshalEasyJSON(in)
+ case "value":
+ (out.Value).UnmarshalEasyJSON(in)
+ case "objectId":
+ out.ObjectID = string(in.String())
+ case "weakLocalObjectReference":
+ out.WeakLocalObjectReference = int64(in.Int64())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime46(out *jwriter.Writer, in DeepSerializedValue) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"type\":"
+ out.RawString(prefix[1:])
+ (in.Type).MarshalEasyJSON(out)
+ }
+ if (in.Value).IsDefined() {
+ const prefix string = ",\"value\":"
+ out.RawString(prefix)
+ (in.Value).MarshalEasyJSON(out)
+ }
+ if in.ObjectID != "" {
+ const prefix string = ",\"objectId\":"
+ out.RawString(prefix)
+ out.String(string(in.ObjectID))
+ }
+ if in.WeakLocalObjectReference != 0 {
+ const prefix string = ",\"weakLocalObjectReference\":"
+ out.RawString(prefix)
+ out.Int64(int64(in.WeakLocalObjectReference))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v DeepSerializedValue) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime46(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v DeepSerializedValue) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime46(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *DeepSerializedValue) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime46(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *DeepSerializedValue) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime46(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime47(in *jlexer.Lexer, out *CustomPreview) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4355,7 +4450,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime46(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime46(out *jwriter.Writer, in CustomPreview) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime47(out *jwriter.Writer, in CustomPreview) {
out.RawByte('{')
first := true
_ = first
@@ -4375,27 +4470,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime46(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v CustomPreview) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime46(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime47(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CustomPreview) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime46(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime47(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CustomPreview) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime46(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime47(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CustomPreview) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime46(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime47(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime47(in *jlexer.Lexer, out *CompileScriptReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime48(in *jlexer.Lexer, out *CompileScriptReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4436,7 +4531,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime47(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime47(out *jwriter.Writer, in CompileScriptReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime48(out *jwriter.Writer, in CompileScriptReturns) {
out.RawByte('{')
first := true
_ = first
@@ -4462,27 +4557,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime47(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v CompileScriptReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime47(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime48(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CompileScriptReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime47(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime48(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CompileScriptReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime47(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime48(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CompileScriptReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime47(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime48(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime48(in *jlexer.Lexer, out *CompileScriptParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime49(in *jlexer.Lexer, out *CompileScriptParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4519,7 +4614,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime48(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime48(out *jwriter.Writer, in CompileScriptParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime49(out *jwriter.Writer, in CompileScriptParams) {
out.RawByte('{')
first := true
_ = first
@@ -4549,27 +4644,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime48(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v CompileScriptParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime48(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime49(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CompileScriptParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime48(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime49(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CompileScriptParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime48(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime49(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CompileScriptParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime48(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime49(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime49(in *jlexer.Lexer, out *CallFunctionOnReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime50(in *jlexer.Lexer, out *CallFunctionOnReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4618,7 +4713,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime49(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime49(out *jwriter.Writer, in CallFunctionOnReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime50(out *jwriter.Writer, in CallFunctionOnReturns) {
out.RawByte('{')
first := true
_ = first
@@ -4644,27 +4739,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime49(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v CallFunctionOnReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime49(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime50(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CallFunctionOnReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime49(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime50(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CallFunctionOnReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime49(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime50(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CallFunctionOnReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime49(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime50(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime50(in *jlexer.Lexer, out *CallFunctionOnParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime51(in *jlexer.Lexer, out *CallFunctionOnParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4736,8 +4831,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime50(in *jlexer.Lexer, o
out.ThrowOnSideEffect = bool(in.Bool())
case "uniqueContextId":
out.UniqueContextID = string(in.String())
- case "generateWebDriverValue":
- out.GenerateWebDriverValue = bool(in.Bool())
+ case "serializationOptions":
+ if in.IsNull() {
+ in.Skip()
+ out.SerializationOptions = nil
+ } else {
+ if out.SerializationOptions == nil {
+ out.SerializationOptions = new(SerializationOptions)
+ }
+ (*out.SerializationOptions).UnmarshalEasyJSON(in)
+ }
default:
in.SkipRecursive()
}
@@ -4748,7 +4851,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime50(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime50(out *jwriter.Writer, in CallFunctionOnParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime51(out *jwriter.Writer, in CallFunctionOnParams) {
out.RawByte('{')
first := true
_ = first
@@ -4825,10 +4928,10 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime50(out *jwriter.Writer
out.RawString(prefix)
out.String(string(in.UniqueContextID))
}
- if in.GenerateWebDriverValue {
- const prefix string = ",\"generateWebDriverValue\":"
+ if in.SerializationOptions != nil {
+ const prefix string = ",\"serializationOptions\":"
out.RawString(prefix)
- out.Bool(bool(in.GenerateWebDriverValue))
+ (*in.SerializationOptions).MarshalEasyJSON(out)
}
out.RawByte('}')
}
@@ -4836,27 +4939,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime50(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v CallFunctionOnParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime50(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime51(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CallFunctionOnParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime50(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime51(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CallFunctionOnParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime50(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime51(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CallFunctionOnParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime50(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime51(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime51(in *jlexer.Lexer, out *CallFrame) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime52(in *jlexer.Lexer, out *CallFrame) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4895,7 +4998,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime51(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime51(out *jwriter.Writer, in CallFrame) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime52(out *jwriter.Writer, in CallFrame) {
out.RawByte('{')
first := true
_ = first
@@ -4930,27 +5033,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime51(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v CallFrame) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime51(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime52(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CallFrame) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime51(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime52(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CallFrame) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime51(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime52(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CallFrame) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime51(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime52(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime52(in *jlexer.Lexer, out *CallArgument) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime53(in *jlexer.Lexer, out *CallArgument) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4985,7 +5088,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime52(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime52(out *jwriter.Writer, in CallArgument) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime53(out *jwriter.Writer, in CallArgument) {
out.RawByte('{')
first := true
_ = first
@@ -5021,27 +5124,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime52(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v CallArgument) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime52(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime53(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v CallArgument) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime52(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime53(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *CallArgument) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime52(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime53(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *CallArgument) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime52(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime53(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime53(in *jlexer.Lexer, out *AwaitPromiseReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime54(in *jlexer.Lexer, out *AwaitPromiseReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -5090,7 +5193,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime53(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime53(out *jwriter.Writer, in AwaitPromiseReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime54(out *jwriter.Writer, in AwaitPromiseReturns) {
out.RawByte('{')
first := true
_ = first
@@ -5116,27 +5219,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime53(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v AwaitPromiseReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime53(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime54(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AwaitPromiseReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime53(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime54(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AwaitPromiseReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime53(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime54(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AwaitPromiseReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime53(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime54(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime54(in *jlexer.Lexer, out *AwaitPromiseParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime55(in *jlexer.Lexer, out *AwaitPromiseParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -5171,7 +5274,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime54(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime54(out *jwriter.Writer, in AwaitPromiseParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime55(out *jwriter.Writer, in AwaitPromiseParams) {
out.RawByte('{')
first := true
_ = first
@@ -5196,27 +5299,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime54(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v AwaitPromiseParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime54(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime55(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AwaitPromiseParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime54(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime55(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AwaitPromiseParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime54(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime55(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AwaitPromiseParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime54(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime55(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime55(in *jlexer.Lexer, out *AddBindingParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime56(in *jlexer.Lexer, out *AddBindingParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -5249,7 +5352,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime55(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime55(out *jwriter.Writer, in AddBindingParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime56(out *jwriter.Writer, in AddBindingParams) {
out.RawByte('{')
first := true
_ = first
@@ -5269,23 +5372,23 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime55(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v AddBindingParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime55(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime56(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v AddBindingParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime55(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoRuntime56(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *AddBindingParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime55(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime56(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *AddBindingParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime55(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoRuntime56(l, v)
}
diff --git a/runtime/runtime.go b/runtime/runtime.go
index 87f2ba0..5e738f9 100644
--- a/runtime/runtime.go
+++ b/runtime/runtime.go
@@ -78,19 +78,19 @@ func (p *AwaitPromiseParams) Do(ctx context.Context) (result *RemoteObject, exce
// CallFunctionOnParams calls function with given declaration on the given
// object. Object group of the result is inherited from the target object.
type CallFunctionOnParams struct {
- FunctionDeclaration string `json:"functionDeclaration"` // Declaration of the function to call.
- ObjectID RemoteObjectID `json:"objectId,omitempty"` // Identifier of the object to call function on. Either objectId or executionContextId should be specified.
- Arguments []*CallArgument `json:"arguments,omitempty"` // Call arguments. All call arguments must belong to the same JavaScript world as the target object.
- Silent bool `json:"silent,omitempty"` // In silent mode exceptions thrown during evaluation are not reported and do not pause execution. Overrides setPauseOnException state.
- ReturnByValue bool `json:"returnByValue,omitempty"` // Whether the result is expected to be a JSON object which should be sent by value.
- GeneratePreview bool `json:"generatePreview,omitempty"` // Whether preview should be generated for the result.
- UserGesture bool `json:"userGesture,omitempty"` // Whether execution should be treated as initiated by user in the UI.
- AwaitPromise bool `json:"awaitPromise,omitempty"` // Whether execution should await for resulting value and return once awaited promise is resolved.
- ExecutionContextID ExecutionContextID `json:"executionContextId,omitempty"` // Specifies execution context which global object will be used to call function on. Either executionContextId or objectId should be specified.
- ObjectGroup string `json:"objectGroup,omitempty"` // Symbolic group name that can be used to release multiple objects. If objectGroup is not specified and objectId is, objectGroup will be inherited from object.
- ThrowOnSideEffect bool `json:"throwOnSideEffect,omitempty"` // Whether to throw an exception if side effect cannot be ruled out during evaluation.
- UniqueContextID string `json:"uniqueContextId,omitempty"` // An alternative way to specify the execution context to call function on. Compared to contextId that may be reused across processes, this is guaranteed to be system-unique, so it can be used to prevent accidental function call in context different than intended (e.g. as a result of navigation across process boundaries). This is mutually exclusive with executionContextId.
- GenerateWebDriverValue bool `json:"generateWebDriverValue,omitempty"` // Whether the result should contain webDriverValue, serialized according to https://w3c.github.io/webdriver-bidi. This is mutually exclusive with returnByValue, but resulting objectId is still provided.
+ FunctionDeclaration string `json:"functionDeclaration"` // Declaration of the function to call.
+ ObjectID RemoteObjectID `json:"objectId,omitempty"` // Identifier of the object to call function on. Either objectId or executionContextId should be specified.
+ Arguments []*CallArgument `json:"arguments,omitempty"` // Call arguments. All call arguments must belong to the same JavaScript world as the target object.
+ Silent bool `json:"silent,omitempty"` // In silent mode exceptions thrown during evaluation are not reported and do not pause execution. Overrides setPauseOnException state.
+ ReturnByValue bool `json:"returnByValue,omitempty"` // Whether the result is expected to be a JSON object which should be sent by value. Can be overridden by serializationOptions.
+ GeneratePreview bool `json:"generatePreview,omitempty"` // Whether preview should be generated for the result.
+ UserGesture bool `json:"userGesture,omitempty"` // Whether execution should be treated as initiated by user in the UI.
+ AwaitPromise bool `json:"awaitPromise,omitempty"` // Whether execution should await for resulting value and return once awaited promise is resolved.
+ ExecutionContextID ExecutionContextID `json:"executionContextId,omitempty"` // Specifies execution context which global object will be used to call function on. Either executionContextId or objectId should be specified.
+ ObjectGroup string `json:"objectGroup,omitempty"` // Symbolic group name that can be used to release multiple objects. If objectGroup is not specified and objectId is, objectGroup will be inherited from object.
+ ThrowOnSideEffect bool `json:"throwOnSideEffect,omitempty"` // Whether to throw an exception if side effect cannot be ruled out during evaluation.
+ UniqueContextID string `json:"uniqueContextId,omitempty"` // An alternative way to specify the execution context to call function on. Compared to contextId that may be reused across processes, this is guaranteed to be system-unique, so it can be used to prevent accidental function call in context different than intended (e.g. as a result of navigation across process boundaries). This is mutually exclusive with executionContextId.
+ SerializationOptions *SerializationOptions `json:"serializationOptions,omitempty"` // Specifies the result serialization. If provided, overrides generatePreview, returnByValue and generateWebDriverValue.
}
// CallFunctionOn calls function with given declaration on the given object.
@@ -129,7 +129,7 @@ func (p CallFunctionOnParams) WithSilent(silent bool) *CallFunctionOnParams {
}
// WithReturnByValue whether the result is expected to be a JSON object which
-// should be sent by value.
+// should be sent by value. Can be overridden by serializationOptions.
func (p CallFunctionOnParams) WithReturnByValue(returnByValue bool) *CallFunctionOnParams {
p.ReturnByValue = returnByValue
return &p
@@ -189,12 +189,10 @@ func (p CallFunctionOnParams) WithUniqueContextID(uniqueContextID string) *CallF
return &p
}
-// WithGenerateWebDriverValue whether the result should contain
-// webDriverValue, serialized according to https://w3c.github.io/webdriver-bidi.
-// This is mutually exclusive with returnByValue, but resulting objectId is
-// still provided.
-func (p CallFunctionOnParams) WithGenerateWebDriverValue(generateWebDriverValue bool) *CallFunctionOnParams {
- p.GenerateWebDriverValue = generateWebDriverValue
+// WithSerializationOptions specifies the result serialization. If provided,
+// overrides generatePreview, returnByValue and generateWebDriverValue.
+func (p CallFunctionOnParams) WithSerializationOptions(serializationOptions *SerializationOptions) *CallFunctionOnParams {
+ p.SerializationOptions = serializationOptions
return &p
}
@@ -329,22 +327,22 @@ func (p *EnableParams) Do(ctx context.Context) (err error) {
// EvaluateParams evaluates expression on global object.
type EvaluateParams struct {
- Expression string `json:"expression"` // Expression to evaluate.
- ObjectGroup string `json:"objectGroup,omitempty"` // Symbolic group name that can be used to release multiple objects.
- IncludeCommandLineAPI bool `json:"includeCommandLineAPI,omitempty"` // Determines whether Command Line API should be available during the evaluation.
- Silent bool `json:"silent,omitempty"` // In silent mode exceptions thrown during evaluation are not reported and do not pause execution. Overrides setPauseOnException state.
- ContextID ExecutionContextID `json:"contextId,omitempty"` // Specifies in which execution context to perform evaluation. If the parameter is omitted the evaluation will be performed in the context of the inspected page. This is mutually exclusive with uniqueContextId, which offers an alternative way to identify the execution context that is more reliable in a multi-process environment.
- ReturnByValue bool `json:"returnByValue,omitempty"` // Whether the result is expected to be a JSON object that should be sent by value.
- GeneratePreview bool `json:"generatePreview,omitempty"` // Whether preview should be generated for the result.
- UserGesture bool `json:"userGesture,omitempty"` // Whether execution should be treated as initiated by user in the UI.
- AwaitPromise bool `json:"awaitPromise,omitempty"` // Whether execution should await for resulting value and return once awaited promise is resolved.
- ThrowOnSideEffect bool `json:"throwOnSideEffect,omitempty"` // Whether to throw an exception if side effect cannot be ruled out during evaluation. This implies disableBreaks below.
- Timeout TimeDelta `json:"timeout,omitempty"` // Terminate execution after timing out (number of milliseconds).
- DisableBreaks bool `json:"disableBreaks,omitempty"` // Disable breakpoints during execution.
- ReplMode bool `json:"replMode,omitempty"` // Setting this flag to true enables let re-declaration and top-level await. Note that let variables can only be re-declared if they originate from replMode themselves.
- AllowUnsafeEvalBlockedByCSP bool `json:"allowUnsafeEvalBlockedByCSP,omitempty"` // The Content Security Policy (CSP) for the target might block 'unsafe-eval' which includes eval(), Function(), setTimeout() and setInterval() when called with non-callable arguments. This flag bypasses CSP for this evaluation and allows unsafe-eval. Defaults to true.
- UniqueContextID string `json:"uniqueContextId,omitempty"` // An alternative way to specify the execution context to evaluate in. Compared to contextId that may be reused across processes, this is guaranteed to be system-unique, so it can be used to prevent accidental evaluation of the expression in context different than intended (e.g. as a result of navigation across process boundaries). This is mutually exclusive with contextId.
- GenerateWebDriverValue bool `json:"generateWebDriverValue,omitempty"` // Whether the result should be serialized according to https://w3c.github.io/webdriver-bidi.
+ Expression string `json:"expression"` // Expression to evaluate.
+ ObjectGroup string `json:"objectGroup,omitempty"` // Symbolic group name that can be used to release multiple objects.
+ IncludeCommandLineAPI bool `json:"includeCommandLineAPI,omitempty"` // Determines whether Command Line API should be available during the evaluation.
+ Silent bool `json:"silent,omitempty"` // In silent mode exceptions thrown during evaluation are not reported and do not pause execution. Overrides setPauseOnException state.
+ ContextID ExecutionContextID `json:"contextId,omitempty"` // Specifies in which execution context to perform evaluation. If the parameter is omitted the evaluation will be performed in the context of the inspected page. This is mutually exclusive with uniqueContextId, which offers an alternative way to identify the execution context that is more reliable in a multi-process environment.
+ ReturnByValue bool `json:"returnByValue,omitempty"` // Whether the result is expected to be a JSON object that should be sent by value.
+ GeneratePreview bool `json:"generatePreview,omitempty"` // Whether preview should be generated for the result.
+ UserGesture bool `json:"userGesture,omitempty"` // Whether execution should be treated as initiated by user in the UI.
+ AwaitPromise bool `json:"awaitPromise,omitempty"` // Whether execution should await for resulting value and return once awaited promise is resolved.
+ ThrowOnSideEffect bool `json:"throwOnSideEffect,omitempty"` // Whether to throw an exception if side effect cannot be ruled out during evaluation. This implies disableBreaks below.
+ Timeout TimeDelta `json:"timeout,omitempty"` // Terminate execution after timing out (number of milliseconds).
+ DisableBreaks bool `json:"disableBreaks,omitempty"` // Disable breakpoints during execution.
+ ReplMode bool `json:"replMode,omitempty"` // Setting this flag to true enables let re-declaration and top-level await. Note that let variables can only be re-declared if they originate from replMode themselves.
+ AllowUnsafeEvalBlockedByCSP bool `json:"allowUnsafeEvalBlockedByCSP,omitempty"` // The Content Security Policy (CSP) for the target might block 'unsafe-eval' which includes eval(), Function(), setTimeout() and setInterval() when called with non-callable arguments. This flag bypasses CSP for this evaluation and allows unsafe-eval. Defaults to true.
+ UniqueContextID string `json:"uniqueContextId,omitempty"` // An alternative way to specify the execution context to evaluate in. Compared to contextId that may be reused across processes, this is guaranteed to be system-unique, so it can be used to prevent accidental evaluation of the expression in context different than intended (e.g. as a result of navigation across process boundaries). This is mutually exclusive with contextId.
+ SerializationOptions *SerializationOptions `json:"serializationOptions,omitempty"` // Specifies the result serialization. If provided, overrides generatePreview, returnByValue and generateWebDriverValue.
}
// Evaluate evaluates expression on global object.
@@ -466,10 +464,10 @@ func (p EvaluateParams) WithUniqueContextID(uniqueContextID string) *EvaluatePar
return &p
}
-// WithGenerateWebDriverValue whether the result should be serialized
-// according to https://w3c.github.io/webdriver-bidi.
-func (p EvaluateParams) WithGenerateWebDriverValue(generateWebDriverValue bool) *EvaluateParams {
- p.GenerateWebDriverValue = generateWebDriverValue
+// WithSerializationOptions specifies the result serialization. If provided,
+// overrides generatePreview, returnByValue and generateWebDriverValue.
+func (p EvaluateParams) WithSerializationOptions(serializationOptions *SerializationOptions) *EvaluateParams {
+ p.SerializationOptions = serializationOptions
return &p
}
diff --git a/runtime/types.go b/runtime/types.go
index c9e1032..2e462fe 100644
--- a/runtime/types.go
+++ b/runtime/types.go
@@ -23,14 +23,24 @@ func (t ScriptID) String() string {
return string(t)
}
-// WebDriverValue represents the value serialiazed by the WebDriver BiDi
-// specification https://w3c.github.io/webdriver-bidi.
+// SerializationOptions represents options for serialization. Overrides
+// generatePreview, returnByValue and generateWebDriverValue.
//
-// See: https://chromedevtools.github.io/devtools-protocol/tot/Runtime#type-WebDriverValue
-type WebDriverValue struct {
- Type WebDriverValueType `json:"type"`
- Value easyjson.RawMessage `json:"value,omitempty"`
- ObjectID string `json:"objectId,omitempty"`
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Runtime#type-SerializationOptions
+type SerializationOptions struct {
+ Serialization SerializationOptionsSerialization `json:"serialization"`
+ MaxDepth int64 `json:"maxDepth,omitempty"` // Deep serialization depth. Default is full depth. Respected only in deep serialization mode.
+ AdditionalParameters easyjson.RawMessage `json:"additionalParameters,omitempty"`
+}
+
+// DeepSerializedValue represents deep serialized value.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Runtime#type-DeepSerializedValue
+type DeepSerializedValue struct {
+ Type DeepSerializedValueType `json:"type"`
+ Value easyjson.RawMessage `json:"value,omitempty"`
+ ObjectID string `json:"objectId,omitempty"`
+ WeakLocalObjectReference int64 `json:"weakLocalObjectReference,omitempty"` // Set if value reference met more then once during serialization. In such case, value is provided only to one of the serialized values. Unique per value in the scope of one CDP call.
}
// RemoteObjectID unique object identifier.
@@ -58,16 +68,16 @@ func (t UnserializableValue) String() string {
//
// See: https://chromedevtools.github.io/devtools-protocol/tot/Runtime#type-RemoteObject
type RemoteObject struct {
- Type Type `json:"type"` // Object type.
- Subtype Subtype `json:"subtype,omitempty"` // Object subtype hint. Specified for object type values only. NOTE: If you change anything here, make sure to also update subtype in ObjectPreview and PropertyPreview below.
- ClassName string `json:"className,omitempty"` // Object class (constructor) name. Specified for object type values only.
- Value easyjson.RawMessage `json:"value,omitempty"` // Remote object value in case of primitive values or JSON values (if it was requested).
- UnserializableValue UnserializableValue `json:"unserializableValue,omitempty"` // Primitive value which can not be JSON-stringified does not have value, but gets this property.
- Description string `json:"description,omitempty"` // String representation of the object.
- WebDriverValue *WebDriverValue `json:"webDriverValue,omitempty"` // WebDriver BiDi representation of the value.
- ObjectID RemoteObjectID `json:"objectId,omitempty"` // Unique object identifier (for non-primitive values).
- Preview *ObjectPreview `json:"preview,omitempty"` // Preview containing abbreviated property values. Specified for object type values only.
- CustomPreview *CustomPreview `json:"customPreview,omitempty"`
+ Type Type `json:"type"` // Object type.
+ Subtype Subtype `json:"subtype,omitempty"` // Object subtype hint. Specified for object type values only. NOTE: If you change anything here, make sure to also update subtype in ObjectPreview and PropertyPreview below.
+ ClassName string `json:"className,omitempty"` // Object class (constructor) name. Specified for object type values only.
+ Value easyjson.RawMessage `json:"value,omitempty"` // Remote object value in case of primitive values or JSON values (if it was requested).
+ UnserializableValue UnserializableValue `json:"unserializableValue,omitempty"` // Primitive value which can not be JSON-stringified does not have value, but gets this property.
+ Description string `json:"description,omitempty"` // String representation of the object.
+ DeepSerializedValue *DeepSerializedValue `json:"deepSerializedValue,omitempty"` // Deep serialized value.
+ ObjectID RemoteObjectID `json:"objectId,omitempty"` // Unique object identifier (for non-primitive values).
+ Preview *ObjectPreview `json:"preview,omitempty"` // Preview containing abbreviated property values. Specified for object type values only.
+ CustomPreview *CustomPreview `json:"customPreview,omitempty"`
}
// CustomPreview [no description].
@@ -289,111 +299,159 @@ type StackTraceID struct {
DebuggerID UniqueDebuggerID `json:"debuggerId,omitempty"`
}
-// WebDriverValueType [no description].
+// SerializationOptionsSerialization [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Runtime#type-SerializationOptions
+type SerializationOptionsSerialization string
+
+// String returns the SerializationOptionsSerialization as string value.
+func (t SerializationOptionsSerialization) String() string {
+ return string(t)
+}
+
+// SerializationOptionsSerialization values.
+const (
+ SerializationOptionsSerializationDeep SerializationOptionsSerialization = "deep"
+ SerializationOptionsSerializationJSON SerializationOptionsSerialization = "json"
+ SerializationOptionsSerializationIDOnly SerializationOptionsSerialization = "idOnly"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t SerializationOptionsSerialization) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t SerializationOptionsSerialization) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *SerializationOptionsSerialization) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch SerializationOptionsSerialization(v) {
+ case SerializationOptionsSerializationDeep:
+ *t = SerializationOptionsSerializationDeep
+ case SerializationOptionsSerializationJSON:
+ *t = SerializationOptionsSerializationJSON
+ case SerializationOptionsSerializationIDOnly:
+ *t = SerializationOptionsSerializationIDOnly
+
+ default:
+ in.AddError(fmt.Errorf("unknown SerializationOptionsSerialization value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *SerializationOptionsSerialization) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
+// DeepSerializedValueType [no description].
//
-// See: https://chromedevtools.github.io/devtools-protocol/tot/Runtime#type-WebDriverValue
-type WebDriverValueType string
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Runtime#type-DeepSerializedValue
+type DeepSerializedValueType string
-// String returns the WebDriverValueType as string value.
-func (t WebDriverValueType) String() string {
+// String returns the DeepSerializedValueType as string value.
+func (t DeepSerializedValueType) String() string {
return string(t)
}
-// WebDriverValueType values.
+// DeepSerializedValueType values.
const (
- WebDriverValueTypeUndefined WebDriverValueType = "undefined"
- WebDriverValueTypeNull WebDriverValueType = "null"
- WebDriverValueTypeString WebDriverValueType = "string"
- WebDriverValueTypeNumber WebDriverValueType = "number"
- WebDriverValueTypeBoolean WebDriverValueType = "boolean"
- WebDriverValueTypeBigint WebDriverValueType = "bigint"
- WebDriverValueTypeRegexp WebDriverValueType = "regexp"
- WebDriverValueTypeDate WebDriverValueType = "date"
- WebDriverValueTypeSymbol WebDriverValueType = "symbol"
- WebDriverValueTypeArray WebDriverValueType = "array"
- WebDriverValueTypeObject WebDriverValueType = "object"
- WebDriverValueTypeFunction WebDriverValueType = "function"
- WebDriverValueTypeMap WebDriverValueType = "map"
- WebDriverValueTypeSet WebDriverValueType = "set"
- WebDriverValueTypeWeakmap WebDriverValueType = "weakmap"
- WebDriverValueTypeWeakset WebDriverValueType = "weakset"
- WebDriverValueTypeError WebDriverValueType = "error"
- WebDriverValueTypeProxy WebDriverValueType = "proxy"
- WebDriverValueTypePromise WebDriverValueType = "promise"
- WebDriverValueTypeTypedarray WebDriverValueType = "typedarray"
- WebDriverValueTypeArraybuffer WebDriverValueType = "arraybuffer"
- WebDriverValueTypeNode WebDriverValueType = "node"
- WebDriverValueTypeWindow WebDriverValueType = "window"
+ DeepSerializedValueTypeUndefined DeepSerializedValueType = "undefined"
+ DeepSerializedValueTypeNull DeepSerializedValueType = "null"
+ DeepSerializedValueTypeString DeepSerializedValueType = "string"
+ DeepSerializedValueTypeNumber DeepSerializedValueType = "number"
+ DeepSerializedValueTypeBoolean DeepSerializedValueType = "boolean"
+ DeepSerializedValueTypeBigint DeepSerializedValueType = "bigint"
+ DeepSerializedValueTypeRegexp DeepSerializedValueType = "regexp"
+ DeepSerializedValueTypeDate DeepSerializedValueType = "date"
+ DeepSerializedValueTypeSymbol DeepSerializedValueType = "symbol"
+ DeepSerializedValueTypeArray DeepSerializedValueType = "array"
+ DeepSerializedValueTypeObject DeepSerializedValueType = "object"
+ DeepSerializedValueTypeFunction DeepSerializedValueType = "function"
+ DeepSerializedValueTypeMap DeepSerializedValueType = "map"
+ DeepSerializedValueTypeSet DeepSerializedValueType = "set"
+ DeepSerializedValueTypeWeakmap DeepSerializedValueType = "weakmap"
+ DeepSerializedValueTypeWeakset DeepSerializedValueType = "weakset"
+ DeepSerializedValueTypeError DeepSerializedValueType = "error"
+ DeepSerializedValueTypeProxy DeepSerializedValueType = "proxy"
+ DeepSerializedValueTypePromise DeepSerializedValueType = "promise"
+ DeepSerializedValueTypeTypedarray DeepSerializedValueType = "typedarray"
+ DeepSerializedValueTypeArraybuffer DeepSerializedValueType = "arraybuffer"
+ DeepSerializedValueTypeNode DeepSerializedValueType = "node"
+ DeepSerializedValueTypeWindow DeepSerializedValueType = "window"
)
// MarshalEasyJSON satisfies easyjson.Marshaler.
-func (t WebDriverValueType) MarshalEasyJSON(out *jwriter.Writer) {
+func (t DeepSerializedValueType) MarshalEasyJSON(out *jwriter.Writer) {
out.String(string(t))
}
// MarshalJSON satisfies json.Marshaler.
-func (t WebDriverValueType) MarshalJSON() ([]byte, error) {
+func (t DeepSerializedValueType) MarshalJSON() ([]byte, error) {
return easyjson.Marshal(t)
}
// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
-func (t *WebDriverValueType) UnmarshalEasyJSON(in *jlexer.Lexer) {
+func (t *DeepSerializedValueType) UnmarshalEasyJSON(in *jlexer.Lexer) {
v := in.String()
- switch WebDriverValueType(v) {
- case WebDriverValueTypeUndefined:
- *t = WebDriverValueTypeUndefined
- case WebDriverValueTypeNull:
- *t = WebDriverValueTypeNull
- case WebDriverValueTypeString:
- *t = WebDriverValueTypeString
- case WebDriverValueTypeNumber:
- *t = WebDriverValueTypeNumber
- case WebDriverValueTypeBoolean:
- *t = WebDriverValueTypeBoolean
- case WebDriverValueTypeBigint:
- *t = WebDriverValueTypeBigint
- case WebDriverValueTypeRegexp:
- *t = WebDriverValueTypeRegexp
- case WebDriverValueTypeDate:
- *t = WebDriverValueTypeDate
- case WebDriverValueTypeSymbol:
- *t = WebDriverValueTypeSymbol
- case WebDriverValueTypeArray:
- *t = WebDriverValueTypeArray
- case WebDriverValueTypeObject:
- *t = WebDriverValueTypeObject
- case WebDriverValueTypeFunction:
- *t = WebDriverValueTypeFunction
- case WebDriverValueTypeMap:
- *t = WebDriverValueTypeMap
- case WebDriverValueTypeSet:
- *t = WebDriverValueTypeSet
- case WebDriverValueTypeWeakmap:
- *t = WebDriverValueTypeWeakmap
- case WebDriverValueTypeWeakset:
- *t = WebDriverValueTypeWeakset
- case WebDriverValueTypeError:
- *t = WebDriverValueTypeError
- case WebDriverValueTypeProxy:
- *t = WebDriverValueTypeProxy
- case WebDriverValueTypePromise:
- *t = WebDriverValueTypePromise
- case WebDriverValueTypeTypedarray:
- *t = WebDriverValueTypeTypedarray
- case WebDriverValueTypeArraybuffer:
- *t = WebDriverValueTypeArraybuffer
- case WebDriverValueTypeNode:
- *t = WebDriverValueTypeNode
- case WebDriverValueTypeWindow:
- *t = WebDriverValueTypeWindow
+ switch DeepSerializedValueType(v) {
+ case DeepSerializedValueTypeUndefined:
+ *t = DeepSerializedValueTypeUndefined
+ case DeepSerializedValueTypeNull:
+ *t = DeepSerializedValueTypeNull
+ case DeepSerializedValueTypeString:
+ *t = DeepSerializedValueTypeString
+ case DeepSerializedValueTypeNumber:
+ *t = DeepSerializedValueTypeNumber
+ case DeepSerializedValueTypeBoolean:
+ *t = DeepSerializedValueTypeBoolean
+ case DeepSerializedValueTypeBigint:
+ *t = DeepSerializedValueTypeBigint
+ case DeepSerializedValueTypeRegexp:
+ *t = DeepSerializedValueTypeRegexp
+ case DeepSerializedValueTypeDate:
+ *t = DeepSerializedValueTypeDate
+ case DeepSerializedValueTypeSymbol:
+ *t = DeepSerializedValueTypeSymbol
+ case DeepSerializedValueTypeArray:
+ *t = DeepSerializedValueTypeArray
+ case DeepSerializedValueTypeObject:
+ *t = DeepSerializedValueTypeObject
+ case DeepSerializedValueTypeFunction:
+ *t = DeepSerializedValueTypeFunction
+ case DeepSerializedValueTypeMap:
+ *t = DeepSerializedValueTypeMap
+ case DeepSerializedValueTypeSet:
+ *t = DeepSerializedValueTypeSet
+ case DeepSerializedValueTypeWeakmap:
+ *t = DeepSerializedValueTypeWeakmap
+ case DeepSerializedValueTypeWeakset:
+ *t = DeepSerializedValueTypeWeakset
+ case DeepSerializedValueTypeError:
+ *t = DeepSerializedValueTypeError
+ case DeepSerializedValueTypeProxy:
+ *t = DeepSerializedValueTypeProxy
+ case DeepSerializedValueTypePromise:
+ *t = DeepSerializedValueTypePromise
+ case DeepSerializedValueTypeTypedarray:
+ *t = DeepSerializedValueTypeTypedarray
+ case DeepSerializedValueTypeArraybuffer:
+ *t = DeepSerializedValueTypeArraybuffer
+ case DeepSerializedValueTypeNode:
+ *t = DeepSerializedValueTypeNode
+ case DeepSerializedValueTypeWindow:
+ *t = DeepSerializedValueTypeWindow
default:
- in.AddError(fmt.Errorf("unknown WebDriverValueType value: %v", v))
+ in.AddError(fmt.Errorf("unknown DeepSerializedValueType value: %v", v))
}
}
// UnmarshalJSON satisfies json.Unmarshaler.
-func (t *WebDriverValueType) UnmarshalJSON(buf []byte) error {
+func (t *DeepSerializedValueType) UnmarshalJSON(buf []byte) error {
return easyjson.Unmarshal(buf, t)
}
diff --git a/storage/easyjson.go b/storage/easyjson.go
index 9b5ee87..97a219a 100644
--- a/storage/easyjson.go
+++ b/storage/easyjson.go
@@ -1229,7 +1229,80 @@ func (v *SharedStorageAccessParams) UnmarshalJSON(data []byte) error {
func (v *SharedStorageAccessParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage14(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage15(in *jlexer.Lexer, out *SetSharedStorageTrackingParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage15(in *jlexer.Lexer, out *SetStorageBucketTrackingParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "storageKey":
+ out.StorageKey = string(in.String())
+ case "enable":
+ out.Enable = bool(in.Bool())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage15(out *jwriter.Writer, in SetStorageBucketTrackingParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"storageKey\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.StorageKey))
+ }
+ {
+ const prefix string = ",\"enable\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.Enable))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v SetStorageBucketTrackingParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage15(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v SetStorageBucketTrackingParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage15(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *SetStorageBucketTrackingParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage15(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *SetStorageBucketTrackingParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage15(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage16(in *jlexer.Lexer, out *SetSharedStorageTrackingParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1260,7 +1333,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage15(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage15(out *jwriter.Writer, in SetSharedStorageTrackingParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage16(out *jwriter.Writer, in SetSharedStorageTrackingParams) {
out.RawByte('{')
first := true
_ = first
@@ -1275,27 +1348,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage15(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v SetSharedStorageTrackingParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage15(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage16(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetSharedStorageTrackingParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage15(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage16(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetSharedStorageTrackingParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage15(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage16(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetSharedStorageTrackingParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage15(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage16(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage16(in *jlexer.Lexer, out *SetSharedStorageEntryParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage17(in *jlexer.Lexer, out *SetSharedStorageEntryParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1332,7 +1405,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage16(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage16(out *jwriter.Writer, in SetSharedStorageEntryParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage17(out *jwriter.Writer, in SetSharedStorageEntryParams) {
out.RawByte('{')
first := true
_ = first
@@ -1362,27 +1435,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage16(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v SetSharedStorageEntryParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage16(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage17(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetSharedStorageEntryParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage16(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage17(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetSharedStorageEntryParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage16(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage17(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetSharedStorageEntryParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage16(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage17(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage17(in *jlexer.Lexer, out *SetInterestGroupTrackingParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage18(in *jlexer.Lexer, out *SetInterestGroupTrackingParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1413,7 +1486,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage17(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage17(out *jwriter.Writer, in SetInterestGroupTrackingParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage18(out *jwriter.Writer, in SetInterestGroupTrackingParams) {
out.RawByte('{')
first := true
_ = first
@@ -1428,27 +1501,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage17(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v SetInterestGroupTrackingParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage17(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage18(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetInterestGroupTrackingParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage17(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage18(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetInterestGroupTrackingParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage17(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage18(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetInterestGroupTrackingParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage17(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage18(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage18(in *jlexer.Lexer, out *SetCookiesParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage19(in *jlexer.Lexer, out *SetCookiesParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1510,7 +1583,7 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage18(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage18(out *jwriter.Writer, in SetCookiesParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage19(out *jwriter.Writer, in SetCookiesParams) {
out.RawByte('{')
first := true
_ = first
@@ -1545,27 +1618,27 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage18(out *jwriter.Writer
// MarshalJSON supports json.Marshaler interface
func (v SetCookiesParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage18(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage19(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
func (v SetCookiesParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage18(w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage19(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
func (v *SetCookiesParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage18(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage19(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
func (v *SetCookiesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage18(l, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage19(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage19(in *jlexer.Lexer, out *ResetSharedStorageBudgetParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage20(in *jlexer.Lexer, out *SetAttributionReportingTrackingParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1584,8 +1657,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage19(in *jlexer.Lexer, o
continue
}
switch key {
- case "ownerOrigin":
- out.OwnerOrigin = string(in.String())
+ case "enable":
+ out.Enable = bool(in.Bool())
default:
in.SkipRecursive()
}
@@ -1596,42 +1669,42 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage19(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage19(out *jwriter.Writer, in ResetSharedStorageBudgetParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage20(out *jwriter.Writer, in SetAttributionReportingTrackingParams) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"ownerOrigin\":"
+ const prefix string = ",\"enable\":"
out.RawString(prefix[1:])
- out.String(string(in.OwnerOrigin))
+ out.Bool(bool(in.Enable))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v ResetSharedStorageBudgetParams) MarshalJSON() ([]byte, error) {
+func (v SetAttributionReportingTrackingParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage19(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage20(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v ResetSharedStorageBudgetParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage19(w, v)
+func (v SetAttributionReportingTrackingParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage20(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *ResetSharedStorageBudgetParams) UnmarshalJSON(data []byte) error {
+func (v *SetAttributionReportingTrackingParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage19(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage20(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *ResetSharedStorageBudgetParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage19(l, v)
+func (v *SetAttributionReportingTrackingParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage20(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage20(in *jlexer.Lexer, out *OverrideQuotaForOriginParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage21(in *jlexer.Lexer, out *SetAttributionReportingLocalTestingModeParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1650,10 +1723,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage20(in *jlexer.Lexer, o
continue
}
switch key {
- case "origin":
- out.Origin = string(in.String())
- case "quotaSize":
- out.QuotaSize = float64(in.Float64())
+ case "enabled":
+ out.Enabled = bool(in.Bool())
default:
in.SkipRecursive()
}
@@ -1664,47 +1735,42 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage20(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage20(out *jwriter.Writer, in OverrideQuotaForOriginParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage21(out *jwriter.Writer, in SetAttributionReportingLocalTestingModeParams) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"origin\":"
+ const prefix string = ",\"enabled\":"
out.RawString(prefix[1:])
- out.String(string(in.Origin))
- }
- if in.QuotaSize != 0 {
- const prefix string = ",\"quotaSize\":"
- out.RawString(prefix)
- out.Float64(float64(in.QuotaSize))
+ out.Bool(bool(in.Enabled))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v OverrideQuotaForOriginParams) MarshalJSON() ([]byte, error) {
+func (v SetAttributionReportingLocalTestingModeParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage20(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage21(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v OverrideQuotaForOriginParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage20(w, v)
+func (v SetAttributionReportingLocalTestingModeParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage21(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *OverrideQuotaForOriginParams) UnmarshalJSON(data []byte) error {
+func (v *SetAttributionReportingLocalTestingModeParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage20(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage21(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *OverrideQuotaForOriginParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage20(l, v)
+func (v *SetAttributionReportingLocalTestingModeParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage21(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage21(in *jlexer.Lexer, out *InterestGroupDetails) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage22(in *jlexer.Lexer, out *RunBounceTrackingMitigationsReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1723,113 +1789,25 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage21(in *jlexer.Lexer, o
continue
}
switch key {
- case "ownerOrigin":
- out.OwnerOrigin = string(in.String())
- case "name":
- out.Name = string(in.String())
- case "expirationTime":
- if in.IsNull() {
- in.Skip()
- out.ExpirationTime = nil
- } else {
- if out.ExpirationTime == nil {
- out.ExpirationTime = new(cdp.TimeSinceEpoch)
- }
- (*out.ExpirationTime).UnmarshalEasyJSON(in)
- }
- case "joiningOrigin":
- out.JoiningOrigin = string(in.String())
- case "biddingUrl":
- out.BiddingURL = string(in.String())
- case "biddingWasmHelperUrl":
- out.BiddingWasmHelperURL = string(in.String())
- case "updateUrl":
- out.UpdateURL = string(in.String())
- case "trustedBiddingSignalsUrl":
- out.TrustedBiddingSignalsURL = string(in.String())
- case "trustedBiddingSignalsKeys":
+ case "deletedSites":
if in.IsNull() {
in.Skip()
- out.TrustedBiddingSignalsKeys = nil
+ out.DeletedSites = nil
} else {
in.Delim('[')
- if out.TrustedBiddingSignalsKeys == nil {
+ if out.DeletedSites == nil {
if !in.IsDelim(']') {
- out.TrustedBiddingSignalsKeys = make([]string, 0, 4)
+ out.DeletedSites = make([]string, 0, 4)
} else {
- out.TrustedBiddingSignalsKeys = []string{}
+ out.DeletedSites = []string{}
}
} else {
- out.TrustedBiddingSignalsKeys = (out.TrustedBiddingSignalsKeys)[:0]
+ out.DeletedSites = (out.DeletedSites)[:0]
}
for !in.IsDelim(']') {
var v10 string
v10 = string(in.String())
- out.TrustedBiddingSignalsKeys = append(out.TrustedBiddingSignalsKeys, v10)
- in.WantComma()
- }
- in.Delim(']')
- }
- case "userBiddingSignals":
- out.UserBiddingSignals = string(in.String())
- case "ads":
- if in.IsNull() {
- in.Skip()
- out.Ads = nil
- } else {
- in.Delim('[')
- if out.Ads == nil {
- if !in.IsDelim(']') {
- out.Ads = make([]*InterestGroupAd, 0, 8)
- } else {
- out.Ads = []*InterestGroupAd{}
- }
- } else {
- out.Ads = (out.Ads)[:0]
- }
- for !in.IsDelim(']') {
- var v11 *InterestGroupAd
- if in.IsNull() {
- in.Skip()
- v11 = nil
- } else {
- if v11 == nil {
- v11 = new(InterestGroupAd)
- }
- (*v11).UnmarshalEasyJSON(in)
- }
- out.Ads = append(out.Ads, v11)
- in.WantComma()
- }
- in.Delim(']')
- }
- case "adComponents":
- if in.IsNull() {
- in.Skip()
- out.AdComponents = nil
- } else {
- in.Delim('[')
- if out.AdComponents == nil {
- if !in.IsDelim(']') {
- out.AdComponents = make([]*InterestGroupAd, 0, 8)
- } else {
- out.AdComponents = []*InterestGroupAd{}
- }
- } else {
- out.AdComponents = (out.AdComponents)[:0]
- }
- for !in.IsDelim(']') {
- var v12 *InterestGroupAd
- if in.IsNull() {
- in.Skip()
- v12 = nil
- } else {
- if v12 == nil {
- v12 = new(InterestGroupAd)
- }
- (*v12).UnmarshalEasyJSON(in)
- }
- out.AdComponents = append(out.AdComponents, v12)
+ out.DeletedSites = append(out.DeletedSites, v10)
in.WantComma()
}
in.Delim(']')
@@ -1844,142 +1822,1185 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage21(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage21(out *jwriter.Writer, in InterestGroupDetails) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage22(out *jwriter.Writer, in RunBounceTrackingMitigationsReturns) {
out.RawByte('{')
first := true
_ = first
- {
- const prefix string = ",\"ownerOrigin\":"
+ if len(in.DeletedSites) != 0 {
+ const prefix string = ",\"deletedSites\":"
+ first = false
out.RawString(prefix[1:])
- out.String(string(in.OwnerOrigin))
- }
- {
- const prefix string = ",\"name\":"
- out.RawString(prefix)
- out.String(string(in.Name))
- }
- {
- const prefix string = ",\"expirationTime\":"
- out.RawString(prefix)
- if in.ExpirationTime == nil {
- out.RawString("null")
- } else {
- (*in.ExpirationTime).MarshalEasyJSON(out)
+ {
+ out.RawByte('[')
+ for v11, v12 := range in.DeletedSites {
+ if v11 > 0 {
+ out.RawByte(',')
+ }
+ out.String(string(v12))
+ }
+ out.RawByte(']')
}
}
- {
- const prefix string = ",\"joiningOrigin\":"
- out.RawString(prefix)
- out.String(string(in.JoiningOrigin))
- }
- if in.BiddingURL != "" {
- const prefix string = ",\"biddingUrl\":"
- out.RawString(prefix)
- out.String(string(in.BiddingURL))
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v RunBounceTrackingMitigationsReturns) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage22(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v RunBounceTrackingMitigationsReturns) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage22(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *RunBounceTrackingMitigationsReturns) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage22(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *RunBounceTrackingMitigationsReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage22(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage23(in *jlexer.Lexer, out *RunBounceTrackingMitigationsParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage23(out *jwriter.Writer, in RunBounceTrackingMitigationsParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v RunBounceTrackingMitigationsParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage23(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v RunBounceTrackingMitigationsParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage23(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *RunBounceTrackingMitigationsParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage23(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *RunBounceTrackingMitigationsParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage23(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage24(in *jlexer.Lexer, out *ResetSharedStorageBudgetParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "ownerOrigin":
+ out.OwnerOrigin = string(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage24(out *jwriter.Writer, in ResetSharedStorageBudgetParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"ownerOrigin\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.OwnerOrigin))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v ResetSharedStorageBudgetParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage24(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v ResetSharedStorageBudgetParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage24(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *ResetSharedStorageBudgetParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage24(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *ResetSharedStorageBudgetParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage24(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage25(in *jlexer.Lexer, out *OverrideQuotaForOriginParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "origin":
+ out.Origin = string(in.String())
+ case "quotaSize":
+ out.QuotaSize = float64(in.Float64())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage25(out *jwriter.Writer, in OverrideQuotaForOriginParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"origin\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.Origin))
+ }
+ if in.QuotaSize != 0 {
+ const prefix string = ",\"quotaSize\":"
+ out.RawString(prefix)
+ out.Float64(float64(in.QuotaSize))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v OverrideQuotaForOriginParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage25(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v OverrideQuotaForOriginParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage25(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *OverrideQuotaForOriginParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage25(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *OverrideQuotaForOriginParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage25(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage26(in *jlexer.Lexer, out *InterestGroupDetails) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "ownerOrigin":
+ out.OwnerOrigin = string(in.String())
+ case "name":
+ out.Name = string(in.String())
+ case "expirationTime":
+ if in.IsNull() {
+ in.Skip()
+ out.ExpirationTime = nil
+ } else {
+ if out.ExpirationTime == nil {
+ out.ExpirationTime = new(cdp.TimeSinceEpoch)
+ }
+ (*out.ExpirationTime).UnmarshalEasyJSON(in)
+ }
+ case "joiningOrigin":
+ out.JoiningOrigin = string(in.String())
+ case "biddingUrl":
+ out.BiddingURL = string(in.String())
+ case "biddingWasmHelperUrl":
+ out.BiddingWasmHelperURL = string(in.String())
+ case "updateUrl":
+ out.UpdateURL = string(in.String())
+ case "trustedBiddingSignalsUrl":
+ out.TrustedBiddingSignalsURL = string(in.String())
+ case "trustedBiddingSignalsKeys":
+ if in.IsNull() {
+ in.Skip()
+ out.TrustedBiddingSignalsKeys = nil
+ } else {
+ in.Delim('[')
+ if out.TrustedBiddingSignalsKeys == nil {
+ if !in.IsDelim(']') {
+ out.TrustedBiddingSignalsKeys = make([]string, 0, 4)
+ } else {
+ out.TrustedBiddingSignalsKeys = []string{}
+ }
+ } else {
+ out.TrustedBiddingSignalsKeys = (out.TrustedBiddingSignalsKeys)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v13 string
+ v13 = string(in.String())
+ out.TrustedBiddingSignalsKeys = append(out.TrustedBiddingSignalsKeys, v13)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ case "userBiddingSignals":
+ out.UserBiddingSignals = string(in.String())
+ case "ads":
+ if in.IsNull() {
+ in.Skip()
+ out.Ads = nil
+ } else {
+ in.Delim('[')
+ if out.Ads == nil {
+ if !in.IsDelim(']') {
+ out.Ads = make([]*InterestGroupAd, 0, 8)
+ } else {
+ out.Ads = []*InterestGroupAd{}
+ }
+ } else {
+ out.Ads = (out.Ads)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v14 *InterestGroupAd
+ if in.IsNull() {
+ in.Skip()
+ v14 = nil
+ } else {
+ if v14 == nil {
+ v14 = new(InterestGroupAd)
+ }
+ (*v14).UnmarshalEasyJSON(in)
+ }
+ out.Ads = append(out.Ads, v14)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ case "adComponents":
+ if in.IsNull() {
+ in.Skip()
+ out.AdComponents = nil
+ } else {
+ in.Delim('[')
+ if out.AdComponents == nil {
+ if !in.IsDelim(']') {
+ out.AdComponents = make([]*InterestGroupAd, 0, 8)
+ } else {
+ out.AdComponents = []*InterestGroupAd{}
+ }
+ } else {
+ out.AdComponents = (out.AdComponents)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v15 *InterestGroupAd
+ if in.IsNull() {
+ in.Skip()
+ v15 = nil
+ } else {
+ if v15 == nil {
+ v15 = new(InterestGroupAd)
+ }
+ (*v15).UnmarshalEasyJSON(in)
+ }
+ out.AdComponents = append(out.AdComponents, v15)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage26(out *jwriter.Writer, in InterestGroupDetails) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"ownerOrigin\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.OwnerOrigin))
+ }
+ {
+ const prefix string = ",\"name\":"
+ out.RawString(prefix)
+ out.String(string(in.Name))
+ }
+ {
+ const prefix string = ",\"expirationTime\":"
+ out.RawString(prefix)
+ if in.ExpirationTime == nil {
+ out.RawString("null")
+ } else {
+ (*in.ExpirationTime).MarshalEasyJSON(out)
+ }
+ }
+ {
+ const prefix string = ",\"joiningOrigin\":"
+ out.RawString(prefix)
+ out.String(string(in.JoiningOrigin))
+ }
+ if in.BiddingURL != "" {
+ const prefix string = ",\"biddingUrl\":"
+ out.RawString(prefix)
+ out.String(string(in.BiddingURL))
+ }
+ if in.BiddingWasmHelperURL != "" {
+ const prefix string = ",\"biddingWasmHelperUrl\":"
+ out.RawString(prefix)
+ out.String(string(in.BiddingWasmHelperURL))
+ }
+ if in.UpdateURL != "" {
+ const prefix string = ",\"updateUrl\":"
+ out.RawString(prefix)
+ out.String(string(in.UpdateURL))
+ }
+ if in.TrustedBiddingSignalsURL != "" {
+ const prefix string = ",\"trustedBiddingSignalsUrl\":"
+ out.RawString(prefix)
+ out.String(string(in.TrustedBiddingSignalsURL))
+ }
+ {
+ const prefix string = ",\"trustedBiddingSignalsKeys\":"
+ out.RawString(prefix)
+ if in.TrustedBiddingSignalsKeys == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v16, v17 := range in.TrustedBiddingSignalsKeys {
+ if v16 > 0 {
+ out.RawByte(',')
+ }
+ out.String(string(v17))
+ }
+ out.RawByte(']')
+ }
+ }
+ if in.UserBiddingSignals != "" {
+ const prefix string = ",\"userBiddingSignals\":"
+ out.RawString(prefix)
+ out.String(string(in.UserBiddingSignals))
+ }
+ {
+ const prefix string = ",\"ads\":"
+ out.RawString(prefix)
+ if in.Ads == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v18, v19 := range in.Ads {
+ if v18 > 0 {
+ out.RawByte(',')
+ }
+ if v19 == nil {
+ out.RawString("null")
+ } else {
+ (*v19).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ {
+ const prefix string = ",\"adComponents\":"
+ out.RawString(prefix)
+ if in.AdComponents == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v20, v21 := range in.AdComponents {
+ if v20 > 0 {
+ out.RawByte(',')
+ }
+ if v21 == nil {
+ out.RawString("null")
+ } else {
+ (*v21).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v InterestGroupDetails) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage26(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v InterestGroupDetails) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage26(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *InterestGroupDetails) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage26(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *InterestGroupDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage26(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage27(in *jlexer.Lexer, out *InterestGroupAd) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "renderUrl":
+ out.RenderURL = string(in.String())
+ case "metadata":
+ out.Metadata = string(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
}
- if in.BiddingWasmHelperURL != "" {
- const prefix string = ",\"biddingWasmHelperUrl\":"
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage27(out *jwriter.Writer, in InterestGroupAd) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"renderUrl\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.RenderURL))
+ }
+ if in.Metadata != "" {
+ const prefix string = ",\"metadata\":"
out.RawString(prefix)
- out.String(string(in.BiddingWasmHelperURL))
+ out.String(string(in.Metadata))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v InterestGroupAd) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage27(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v InterestGroupAd) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage27(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *InterestGroupAd) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage27(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *InterestGroupAd) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage27(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage28(in *jlexer.Lexer, out *GetUsageAndQuotaReturns) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "usage":
+ out.Usage = float64(in.Float64())
+ case "quota":
+ out.Quota = float64(in.Float64())
+ case "overrideActive":
+ out.OverrideActive = bool(in.Bool())
+ case "usageBreakdown":
+ if in.IsNull() {
+ in.Skip()
+ out.UsageBreakdown = nil
+ } else {
+ in.Delim('[')
+ if out.UsageBreakdown == nil {
+ if !in.IsDelim(']') {
+ out.UsageBreakdown = make([]*UsageForType, 0, 8)
+ } else {
+ out.UsageBreakdown = []*UsageForType{}
+ }
+ } else {
+ out.UsageBreakdown = (out.UsageBreakdown)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v22 *UsageForType
+ if in.IsNull() {
+ in.Skip()
+ v22 = nil
+ } else {
+ if v22 == nil {
+ v22 = new(UsageForType)
+ }
+ (*v22).UnmarshalEasyJSON(in)
+ }
+ out.UsageBreakdown = append(out.UsageBreakdown, v22)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage28(out *jwriter.Writer, in GetUsageAndQuotaReturns) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ if in.Usage != 0 {
+ const prefix string = ",\"usage\":"
+ first = false
+ out.RawString(prefix[1:])
+ out.Float64(float64(in.Usage))
+ }
+ if in.Quota != 0 {
+ const prefix string = ",\"quota\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ out.Float64(float64(in.Quota))
+ }
+ if in.OverrideActive {
+ const prefix string = ",\"overrideActive\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ out.Bool(bool(in.OverrideActive))
+ }
+ if len(in.UsageBreakdown) != 0 {
+ const prefix string = ",\"usageBreakdown\":"
+ if first {
+ first = false
+ out.RawString(prefix[1:])
+ } else {
+ out.RawString(prefix)
+ }
+ {
+ out.RawByte('[')
+ for v23, v24 := range in.UsageBreakdown {
+ if v23 > 0 {
+ out.RawByte(',')
+ }
+ if v24 == nil {
+ out.RawString("null")
+ } else {
+ (*v24).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v GetUsageAndQuotaReturns) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage28(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v GetUsageAndQuotaReturns) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage28(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *GetUsageAndQuotaReturns) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage28(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *GetUsageAndQuotaReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage28(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage29(in *jlexer.Lexer, out *GetUsageAndQuotaParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "origin":
+ out.Origin = string(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage29(out *jwriter.Writer, in GetUsageAndQuotaParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"origin\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.Origin))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v GetUsageAndQuotaParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage29(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v GetUsageAndQuotaParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage29(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *GetUsageAndQuotaParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage29(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *GetUsageAndQuotaParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage29(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage30(in *jlexer.Lexer, out *GetTrustTokensReturns) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
}
- if in.UpdateURL != "" {
- const prefix string = ",\"updateUrl\":"
- out.RawString(prefix)
- out.String(string(in.UpdateURL))
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "tokens":
+ if in.IsNull() {
+ in.Skip()
+ out.Tokens = nil
+ } else {
+ in.Delim('[')
+ if out.Tokens == nil {
+ if !in.IsDelim(']') {
+ out.Tokens = make([]*TrustTokens, 0, 8)
+ } else {
+ out.Tokens = []*TrustTokens{}
+ }
+ } else {
+ out.Tokens = (out.Tokens)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v25 *TrustTokens
+ if in.IsNull() {
+ in.Skip()
+ v25 = nil
+ } else {
+ if v25 == nil {
+ v25 = new(TrustTokens)
+ }
+ (*v25).UnmarshalEasyJSON(in)
+ }
+ out.Tokens = append(out.Tokens, v25)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
}
- if in.TrustedBiddingSignalsURL != "" {
- const prefix string = ",\"trustedBiddingSignalsUrl\":"
- out.RawString(prefix)
- out.String(string(in.TrustedBiddingSignalsURL))
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
}
- {
- const prefix string = ",\"trustedBiddingSignalsKeys\":"
- out.RawString(prefix)
- if in.TrustedBiddingSignalsKeys == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
- out.RawString("null")
- } else {
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage30(out *jwriter.Writer, in GetTrustTokensReturns) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ if len(in.Tokens) != 0 {
+ const prefix string = ",\"tokens\":"
+ first = false
+ out.RawString(prefix[1:])
+ {
out.RawByte('[')
- for v13, v14 := range in.TrustedBiddingSignalsKeys {
- if v13 > 0 {
+ for v26, v27 := range in.Tokens {
+ if v26 > 0 {
out.RawByte(',')
}
- out.String(string(v14))
+ if v27 == nil {
+ out.RawString("null")
+ } else {
+ (*v27).MarshalEasyJSON(out)
+ }
}
out.RawByte(']')
}
}
- if in.UserBiddingSignals != "" {
- const prefix string = ",\"userBiddingSignals\":"
- out.RawString(prefix)
- out.String(string(in.UserBiddingSignals))
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v GetTrustTokensReturns) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage30(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v GetTrustTokensReturns) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage30(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *GetTrustTokensReturns) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage30(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *GetTrustTokensReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage30(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage31(in *jlexer.Lexer, out *GetTrustTokensParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage31(out *jwriter.Writer, in GetTrustTokensParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v GetTrustTokensParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage31(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v GetTrustTokensParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage31(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *GetTrustTokensParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage31(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *GetTrustTokensParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage31(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage32(in *jlexer.Lexer, out *GetStorageKeyForFrameReturns) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "storageKey":
+ out.StorageKey = SerializedStorageKey(in.String())
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage32(out *jwriter.Writer, in GetStorageKeyForFrameReturns) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ if in.StorageKey != "" {
+ const prefix string = ",\"storageKey\":"
+ first = false
+ out.RawString(prefix[1:])
+ out.String(string(in.StorageKey))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v GetStorageKeyForFrameReturns) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage32(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v GetStorageKeyForFrameReturns) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage32(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *GetStorageKeyForFrameReturns) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage32(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *GetStorageKeyForFrameReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage32(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage33(in *jlexer.Lexer, out *GetStorageKeyForFrameParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
+ }
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "frameId":
+ (out.FrameID).UnmarshalEasyJSON(in)
+ default:
+ in.SkipRecursive()
+ }
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
}
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage33(out *jwriter.Writer, in GetStorageKeyForFrameParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
{
- const prefix string = ",\"ads\":"
- out.RawString(prefix)
- if in.Ads == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
- out.RawString("null")
- } else {
- out.RawByte('[')
- for v15, v16 := range in.Ads {
- if v15 > 0 {
- out.RawByte(',')
- }
- if v16 == nil {
- out.RawString("null")
- } else {
- (*v16).MarshalEasyJSON(out)
- }
- }
- out.RawByte(']')
+ const prefix string = ",\"frameId\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.FrameID))
+ }
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v GetStorageKeyForFrameParams) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage33(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v GetStorageKeyForFrameParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage33(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *GetStorageKeyForFrameParams) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage33(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *GetStorageKeyForFrameParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage33(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage34(in *jlexer.Lexer, out *GetSharedStorageMetadataReturns) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
}
+ in.Skip()
+ return
}
- {
- const prefix string = ",\"adComponents\":"
- out.RawString(prefix)
- if in.AdComponents == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
- out.RawString("null")
- } else {
- out.RawByte('[')
- for v17, v18 := range in.AdComponents {
- if v17 > 0 {
- out.RawByte(',')
- }
- if v18 == nil {
- out.RawString("null")
- } else {
- (*v18).MarshalEasyJSON(out)
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
+ case "metadata":
+ if in.IsNull() {
+ in.Skip()
+ out.Metadata = nil
+ } else {
+ if out.Metadata == nil {
+ out.Metadata = new(SharedStorageMetadata)
}
+ (*out.Metadata).UnmarshalEasyJSON(in)
}
- out.RawByte(']')
+ default:
+ in.SkipRecursive()
}
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage34(out *jwriter.Writer, in GetSharedStorageMetadataReturns) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ if in.Metadata != nil {
+ const prefix string = ",\"metadata\":"
+ first = false
+ out.RawString(prefix[1:])
+ (*in.Metadata).MarshalEasyJSON(out)
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v InterestGroupDetails) MarshalJSON() ([]byte, error) {
+func (v GetSharedStorageMetadataReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage21(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage34(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v InterestGroupDetails) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage21(w, v)
+func (v GetSharedStorageMetadataReturns) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage34(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *InterestGroupDetails) UnmarshalJSON(data []byte) error {
+func (v *GetSharedStorageMetadataReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage21(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage34(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *InterestGroupDetails) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage21(l, v)
+func (v *GetSharedStorageMetadataReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage34(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage22(in *jlexer.Lexer, out *InterestGroupAd) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage35(in *jlexer.Lexer, out *GetSharedStorageMetadataParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -1998,10 +3019,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage22(in *jlexer.Lexer, o
continue
}
switch key {
- case "renderUrl":
- out.RenderURL = string(in.String())
- case "metadata":
- out.Metadata = string(in.String())
+ case "ownerOrigin":
+ out.OwnerOrigin = string(in.String())
default:
in.SkipRecursive()
}
@@ -2012,47 +3031,42 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage22(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage22(out *jwriter.Writer, in InterestGroupAd) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage35(out *jwriter.Writer, in GetSharedStorageMetadataParams) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"renderUrl\":"
+ const prefix string = ",\"ownerOrigin\":"
out.RawString(prefix[1:])
- out.String(string(in.RenderURL))
- }
- if in.Metadata != "" {
- const prefix string = ",\"metadata\":"
- out.RawString(prefix)
- out.String(string(in.Metadata))
+ out.String(string(in.OwnerOrigin))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v InterestGroupAd) MarshalJSON() ([]byte, error) {
+func (v GetSharedStorageMetadataParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage22(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage35(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v InterestGroupAd) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage22(w, v)
+func (v GetSharedStorageMetadataParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage35(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *InterestGroupAd) UnmarshalJSON(data []byte) error {
+func (v *GetSharedStorageMetadataParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage22(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage35(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *InterestGroupAd) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage22(l, v)
+func (v *GetSharedStorageMetadataParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage35(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage23(in *jlexer.Lexer, out *GetUsageAndQuotaReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage36(in *jlexer.Lexer, out *GetSharedStorageEntriesReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2071,39 +3085,33 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage23(in *jlexer.Lexer, o
continue
}
switch key {
- case "usage":
- out.Usage = float64(in.Float64())
- case "quota":
- out.Quota = float64(in.Float64())
- case "overrideActive":
- out.OverrideActive = bool(in.Bool())
- case "usageBreakdown":
+ case "entries":
if in.IsNull() {
in.Skip()
- out.UsageBreakdown = nil
+ out.Entries = nil
} else {
in.Delim('[')
- if out.UsageBreakdown == nil {
+ if out.Entries == nil {
if !in.IsDelim(']') {
- out.UsageBreakdown = make([]*UsageForType, 0, 8)
+ out.Entries = make([]*SharedStorageEntry, 0, 8)
} else {
- out.UsageBreakdown = []*UsageForType{}
+ out.Entries = []*SharedStorageEntry{}
}
} else {
- out.UsageBreakdown = (out.UsageBreakdown)[:0]
+ out.Entries = (out.Entries)[:0]
}
for !in.IsDelim(']') {
- var v19 *UsageForType
+ var v28 *SharedStorageEntry
if in.IsNull() {
in.Skip()
- v19 = nil
+ v28 = nil
} else {
- if v19 == nil {
- v19 = new(UsageForType)
+ if v28 == nil {
+ v28 = new(SharedStorageEntry)
}
- (*v19).UnmarshalEasyJSON(in)
+ (*v28).UnmarshalEasyJSON(in)
}
- out.UsageBreakdown = append(out.UsageBreakdown, v19)
+ out.Entries = append(out.Entries, v28)
in.WantComma()
}
in.Delim(']')
@@ -2118,86 +3126,122 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage23(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage23(out *jwriter.Writer, in GetUsageAndQuotaReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage36(out *jwriter.Writer, in GetSharedStorageEntriesReturns) {
out.RawByte('{')
first := true
_ = first
- if in.Usage != 0 {
- const prefix string = ",\"usage\":"
+ if len(in.Entries) != 0 {
+ const prefix string = ",\"entries\":"
first = false
out.RawString(prefix[1:])
- out.Float64(float64(in.Usage))
- }
- if in.Quota != 0 {
- const prefix string = ",\"quota\":"
- if first {
- first = false
- out.RawString(prefix[1:])
- } else {
- out.RawString(prefix)
+ {
+ out.RawByte('[')
+ for v29, v30 := range in.Entries {
+ if v29 > 0 {
+ out.RawByte(',')
+ }
+ if v30 == nil {
+ out.RawString("null")
+ } else {
+ (*v30).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
}
- out.Float64(float64(in.Quota))
}
- if in.OverrideActive {
- const prefix string = ",\"overrideActive\":"
- if first {
- first = false
- out.RawString(prefix[1:])
- } else {
- out.RawString(prefix)
+ out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v GetSharedStorageEntriesReturns) MarshalJSON() ([]byte, error) {
+ w := jwriter.Writer{}
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage36(&w, v)
+ return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v GetSharedStorageEntriesReturns) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage36(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *GetSharedStorageEntriesReturns) UnmarshalJSON(data []byte) error {
+ r := jlexer.Lexer{Data: data}
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage36(&r, v)
+ return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *GetSharedStorageEntriesReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage36(l, v)
+}
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage37(in *jlexer.Lexer, out *GetSharedStorageEntriesParams) {
+ isTopLevel := in.IsStart()
+ if in.IsNull() {
+ if isTopLevel {
+ in.Consumed()
}
- out.Bool(bool(in.OverrideActive))
- }
- if len(in.UsageBreakdown) != 0 {
- const prefix string = ",\"usageBreakdown\":"
- if first {
- first = false
- out.RawString(prefix[1:])
- } else {
- out.RawString(prefix)
+ in.Skip()
+ return
+ }
+ in.Delim('{')
+ for !in.IsDelim('}') {
+ key := in.UnsafeFieldName(false)
+ in.WantColon()
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
}
- {
- out.RawByte('[')
- for v20, v21 := range in.UsageBreakdown {
- if v20 > 0 {
- out.RawByte(',')
- }
- if v21 == nil {
- out.RawString("null")
- } else {
- (*v21).MarshalEasyJSON(out)
- }
- }
- out.RawByte(']')
+ switch key {
+ case "ownerOrigin":
+ out.OwnerOrigin = string(in.String())
+ default:
+ in.SkipRecursive()
}
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage37(out *jwriter.Writer, in GetSharedStorageEntriesParams) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"ownerOrigin\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.OwnerOrigin))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetUsageAndQuotaReturns) MarshalJSON() ([]byte, error) {
+func (v GetSharedStorageEntriesParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage23(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage37(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetUsageAndQuotaReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage23(w, v)
+func (v GetSharedStorageEntriesParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage37(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetUsageAndQuotaReturns) UnmarshalJSON(data []byte) error {
+func (v *GetSharedStorageEntriesParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage23(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage37(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetUsageAndQuotaReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage23(l, v)
+func (v *GetSharedStorageEntriesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage37(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage24(in *jlexer.Lexer, out *GetUsageAndQuotaParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage38(in *jlexer.Lexer, out *GetInterestGroupDetailsReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2216,8 +3260,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage24(in *jlexer.Lexer, o
continue
}
switch key {
- case "origin":
- out.Origin = string(in.String())
+ case "details":
+ if in.IsNull() {
+ in.Skip()
+ out.Details = nil
+ } else {
+ if out.Details == nil {
+ out.Details = new(InterestGroupDetails)
+ }
+ (*out.Details).UnmarshalEasyJSON(in)
+ }
default:
in.SkipRecursive()
}
@@ -2228,42 +3280,43 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage24(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage24(out *jwriter.Writer, in GetUsageAndQuotaParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage38(out *jwriter.Writer, in GetInterestGroupDetailsReturns) {
out.RawByte('{')
first := true
_ = first
- {
- const prefix string = ",\"origin\":"
+ if in.Details != nil {
+ const prefix string = ",\"details\":"
+ first = false
out.RawString(prefix[1:])
- out.String(string(in.Origin))
+ (*in.Details).MarshalEasyJSON(out)
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetUsageAndQuotaParams) MarshalJSON() ([]byte, error) {
+func (v GetInterestGroupDetailsReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage24(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage38(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetUsageAndQuotaParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage24(w, v)
+func (v GetInterestGroupDetailsReturns) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage38(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetUsageAndQuotaParams) UnmarshalJSON(data []byte) error {
+func (v *GetInterestGroupDetailsReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage24(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage38(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetUsageAndQuotaParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage24(l, v)
+func (v *GetInterestGroupDetailsReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage38(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage25(in *jlexer.Lexer, out *GetTrustTokensReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage39(in *jlexer.Lexer, out *GetInterestGroupDetailsParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2282,37 +3335,10 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage25(in *jlexer.Lexer, o
continue
}
switch key {
- case "tokens":
- if in.IsNull() {
- in.Skip()
- out.Tokens = nil
- } else {
- in.Delim('[')
- if out.Tokens == nil {
- if !in.IsDelim(']') {
- out.Tokens = make([]*TrustTokens, 0, 8)
- } else {
- out.Tokens = []*TrustTokens{}
- }
- } else {
- out.Tokens = (out.Tokens)[:0]
- }
- for !in.IsDelim(']') {
- var v22 *TrustTokens
- if in.IsNull() {
- in.Skip()
- v22 = nil
- } else {
- if v22 == nil {
- v22 = new(TrustTokens)
- }
- (*v22).UnmarshalEasyJSON(in)
- }
- out.Tokens = append(out.Tokens, v22)
- in.WantComma()
- }
- in.Delim(']')
- }
+ case "ownerOrigin":
+ out.OwnerOrigin = string(in.String())
+ case "name":
+ out.Name = string(in.String())
default:
in.SkipRecursive()
}
@@ -2323,56 +3349,47 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage25(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage25(out *jwriter.Writer, in GetTrustTokensReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage39(out *jwriter.Writer, in GetInterestGroupDetailsParams) {
out.RawByte('{')
first := true
_ = first
- if len(in.Tokens) != 0 {
- const prefix string = ",\"tokens\":"
- first = false
+ {
+ const prefix string = ",\"ownerOrigin\":"
out.RawString(prefix[1:])
- {
- out.RawByte('[')
- for v23, v24 := range in.Tokens {
- if v23 > 0 {
- out.RawByte(',')
- }
- if v24 == nil {
- out.RawString("null")
- } else {
- (*v24).MarshalEasyJSON(out)
- }
- }
- out.RawByte(']')
- }
+ out.String(string(in.OwnerOrigin))
+ }
+ {
+ const prefix string = ",\"name\":"
+ out.RawString(prefix)
+ out.String(string(in.Name))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetTrustTokensReturns) MarshalJSON() ([]byte, error) {
+func (v GetInterestGroupDetailsParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage25(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage39(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetTrustTokensReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage25(w, v)
+func (v GetInterestGroupDetailsParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage39(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetTrustTokensReturns) UnmarshalJSON(data []byte) error {
+func (v *GetInterestGroupDetailsParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage25(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage39(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetTrustTokensReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage25(l, v)
+func (v *GetInterestGroupDetailsParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage39(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage26(in *jlexer.Lexer, out *GetTrustTokensParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage40(in *jlexer.Lexer, out *GetCookiesReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2391,6 +3408,37 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage26(in *jlexer.Lexer, o
continue
}
switch key {
+ case "cookies":
+ if in.IsNull() {
+ in.Skip()
+ out.Cookies = nil
+ } else {
+ in.Delim('[')
+ if out.Cookies == nil {
+ if !in.IsDelim(']') {
+ out.Cookies = make([]*network.Cookie, 0, 8)
+ } else {
+ out.Cookies = []*network.Cookie{}
+ }
+ } else {
+ out.Cookies = (out.Cookies)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v31 *network.Cookie
+ if in.IsNull() {
+ in.Skip()
+ v31 = nil
+ } else {
+ if v31 == nil {
+ v31 = new(network.Cookie)
+ }
+ (*v31).UnmarshalEasyJSON(in)
+ }
+ out.Cookies = append(out.Cookies, v31)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
default:
in.SkipRecursive()
}
@@ -2401,37 +3449,56 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage26(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage26(out *jwriter.Writer, in GetTrustTokensParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage40(out *jwriter.Writer, in GetCookiesReturns) {
out.RawByte('{')
first := true
_ = first
+ if len(in.Cookies) != 0 {
+ const prefix string = ",\"cookies\":"
+ first = false
+ out.RawString(prefix[1:])
+ {
+ out.RawByte('[')
+ for v32, v33 := range in.Cookies {
+ if v32 > 0 {
+ out.RawByte(',')
+ }
+ if v33 == nil {
+ out.RawString("null")
+ } else {
+ (*v33).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetTrustTokensParams) MarshalJSON() ([]byte, error) {
+func (v GetCookiesReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage26(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage40(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetTrustTokensParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage26(w, v)
+func (v GetCookiesReturns) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage40(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetTrustTokensParams) UnmarshalJSON(data []byte) error {
+func (v *GetCookiesReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage26(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage40(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetTrustTokensParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage26(l, v)
+func (v *GetCookiesReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage40(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage27(in *jlexer.Lexer, out *GetStorageKeyForFrameReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage41(in *jlexer.Lexer, out *GetCookiesParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2450,8 +3517,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage27(in *jlexer.Lexer, o
continue
}
switch key {
- case "storageKey":
- out.StorageKey = SerializedStorageKey(in.String())
+ case "browserContextId":
+ out.BrowserContextID = cdp.BrowserContextID(in.String())
default:
in.SkipRecursive()
}
@@ -2462,43 +3529,43 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage27(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage27(out *jwriter.Writer, in GetStorageKeyForFrameReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage41(out *jwriter.Writer, in GetCookiesParams) {
out.RawByte('{')
first := true
_ = first
- if in.StorageKey != "" {
- const prefix string = ",\"storageKey\":"
+ if in.BrowserContextID != "" {
+ const prefix string = ",\"browserContextId\":"
first = false
out.RawString(prefix[1:])
- out.String(string(in.StorageKey))
+ out.String(string(in.BrowserContextID))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetStorageKeyForFrameReturns) MarshalJSON() ([]byte, error) {
+func (v GetCookiesParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage27(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage41(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetStorageKeyForFrameReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage27(w, v)
+func (v GetCookiesParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage41(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetStorageKeyForFrameReturns) UnmarshalJSON(data []byte) error {
+func (v *GetCookiesParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage27(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage41(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetStorageKeyForFrameReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage27(l, v)
+func (v *GetCookiesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage41(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage28(in *jlexer.Lexer, out *GetStorageKeyForFrameParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage42(in *jlexer.Lexer, out *EventStorageBucketDeleted) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2517,8 +3584,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage28(in *jlexer.Lexer, o
continue
}
switch key {
- case "frameId":
- (out.FrameID).UnmarshalEasyJSON(in)
+ case "bucketId":
+ out.BucketID = string(in.String())
default:
in.SkipRecursive()
}
@@ -2529,42 +3596,42 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage28(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage28(out *jwriter.Writer, in GetStorageKeyForFrameParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage42(out *jwriter.Writer, in EventStorageBucketDeleted) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"frameId\":"
+ const prefix string = ",\"bucketId\":"
out.RawString(prefix[1:])
- out.String(string(in.FrameID))
+ out.String(string(in.BucketID))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetStorageKeyForFrameParams) MarshalJSON() ([]byte, error) {
+func (v EventStorageBucketDeleted) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage28(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage42(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetStorageKeyForFrameParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage28(w, v)
+func (v EventStorageBucketDeleted) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage42(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetStorageKeyForFrameParams) UnmarshalJSON(data []byte) error {
+func (v *EventStorageBucketDeleted) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage28(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage42(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetStorageKeyForFrameParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage28(l, v)
+func (v *EventStorageBucketDeleted) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage42(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage29(in *jlexer.Lexer, out *GetSharedStorageMetadataReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage43(in *jlexer.Lexer, out *EventStorageBucketCreatedOrUpdated) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2583,15 +3650,15 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage29(in *jlexer.Lexer, o
continue
}
switch key {
- case "metadata":
+ case "bucketInfo":
if in.IsNull() {
in.Skip()
- out.Metadata = nil
+ out.BucketInfo = nil
} else {
- if out.Metadata == nil {
- out.Metadata = new(SharedStorageMetadata)
+ if out.BucketInfo == nil {
+ out.BucketInfo = new(BucketInfo)
}
- (*out.Metadata).UnmarshalEasyJSON(in)
+ (*out.BucketInfo).UnmarshalEasyJSON(in)
}
default:
in.SkipRecursive()
@@ -2603,43 +3670,46 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage29(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage29(out *jwriter.Writer, in GetSharedStorageMetadataReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage43(out *jwriter.Writer, in EventStorageBucketCreatedOrUpdated) {
out.RawByte('{')
first := true
_ = first
- if in.Metadata != nil {
- const prefix string = ",\"metadata\":"
- first = false
+ {
+ const prefix string = ",\"bucketInfo\":"
out.RawString(prefix[1:])
- (*in.Metadata).MarshalEasyJSON(out)
+ if in.BucketInfo == nil {
+ out.RawString("null")
+ } else {
+ (*in.BucketInfo).MarshalEasyJSON(out)
+ }
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetSharedStorageMetadataReturns) MarshalJSON() ([]byte, error) {
+func (v EventStorageBucketCreatedOrUpdated) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage29(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage43(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetSharedStorageMetadataReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage29(w, v)
+func (v EventStorageBucketCreatedOrUpdated) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage43(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetSharedStorageMetadataReturns) UnmarshalJSON(data []byte) error {
+func (v *EventStorageBucketCreatedOrUpdated) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage29(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage43(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetSharedStorageMetadataReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage29(l, v)
+func (v *EventStorageBucketCreatedOrUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage43(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage30(in *jlexer.Lexer, out *GetSharedStorageMetadataParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage44(in *jlexer.Lexer, out *EventSharedStorageAccessed) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2658,8 +3728,32 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage30(in *jlexer.Lexer, o
continue
}
switch key {
+ case "accessTime":
+ if in.IsNull() {
+ in.Skip()
+ out.AccessTime = nil
+ } else {
+ if out.AccessTime == nil {
+ out.AccessTime = new(cdp.TimeSinceEpoch)
+ }
+ (*out.AccessTime).UnmarshalEasyJSON(in)
+ }
+ case "type":
+ (out.Type).UnmarshalEasyJSON(in)
+ case "mainFrameId":
+ (out.MainFrameID).UnmarshalEasyJSON(in)
case "ownerOrigin":
out.OwnerOrigin = string(in.String())
+ case "params":
+ if in.IsNull() {
+ in.Skip()
+ out.Params = nil
+ } else {
+ if out.Params == nil {
+ out.Params = new(SharedStorageAccessParams)
+ }
+ (*out.Params).UnmarshalEasyJSON(in)
+ }
default:
in.SkipRecursive()
}
@@ -2670,42 +3764,70 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage30(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage30(out *jwriter.Writer, in GetSharedStorageMetadataParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage44(out *jwriter.Writer, in EventSharedStorageAccessed) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"ownerOrigin\":"
+ const prefix string = ",\"accessTime\":"
out.RawString(prefix[1:])
+ if in.AccessTime == nil {
+ out.RawString("null")
+ } else {
+ (*in.AccessTime).MarshalEasyJSON(out)
+ }
+ }
+ {
+ const prefix string = ",\"type\":"
+ out.RawString(prefix)
+ (in.Type).MarshalEasyJSON(out)
+ }
+ {
+ const prefix string = ",\"mainFrameId\":"
+ out.RawString(prefix)
+ out.String(string(in.MainFrameID))
+ }
+ {
+ const prefix string = ",\"ownerOrigin\":"
+ out.RawString(prefix)
out.String(string(in.OwnerOrigin))
}
+ {
+ const prefix string = ",\"params\":"
+ out.RawString(prefix)
+ if in.Params == nil {
+ out.RawString("null")
+ } else {
+ (*in.Params).MarshalEasyJSON(out)
+ }
+ }
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetSharedStorageMetadataParams) MarshalJSON() ([]byte, error) {
+func (v EventSharedStorageAccessed) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage30(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage44(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetSharedStorageMetadataParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage30(w, v)
+func (v EventSharedStorageAccessed) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage44(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetSharedStorageMetadataParams) UnmarshalJSON(data []byte) error {
+func (v *EventSharedStorageAccessed) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage30(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage44(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetSharedStorageMetadataParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage30(l, v)
+func (v *EventSharedStorageAccessed) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage44(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage31(in *jlexer.Lexer, out *GetSharedStorageEntriesReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage45(in *jlexer.Lexer, out *EventInterestGroupAccessed) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2724,37 +3846,22 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage31(in *jlexer.Lexer, o
continue
}
switch key {
- case "entries":
+ case "accessTime":
if in.IsNull() {
in.Skip()
- out.Entries = nil
+ out.AccessTime = nil
} else {
- in.Delim('[')
- if out.Entries == nil {
- if !in.IsDelim(']') {
- out.Entries = make([]*SharedStorageEntry, 0, 8)
- } else {
- out.Entries = []*SharedStorageEntry{}
- }
- } else {
- out.Entries = (out.Entries)[:0]
- }
- for !in.IsDelim(']') {
- var v25 *SharedStorageEntry
- if in.IsNull() {
- in.Skip()
- v25 = nil
- } else {
- if v25 == nil {
- v25 = new(SharedStorageEntry)
- }
- (*v25).UnmarshalEasyJSON(in)
- }
- out.Entries = append(out.Entries, v25)
- in.WantComma()
+ if out.AccessTime == nil {
+ out.AccessTime = new(cdp.TimeSinceEpoch)
}
- in.Delim(']')
+ (*out.AccessTime).UnmarshalEasyJSON(in)
}
+ case "type":
+ (out.Type).UnmarshalEasyJSON(in)
+ case "ownerOrigin":
+ out.OwnerOrigin = string(in.String())
+ case "name":
+ out.Name = string(in.String())
default:
in.SkipRecursive()
}
@@ -2765,56 +3872,61 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage31(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage31(out *jwriter.Writer, in GetSharedStorageEntriesReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage45(out *jwriter.Writer, in EventInterestGroupAccessed) {
out.RawByte('{')
first := true
_ = first
- if len(in.Entries) != 0 {
- const prefix string = ",\"entries\":"
- first = false
+ {
+ const prefix string = ",\"accessTime\":"
out.RawString(prefix[1:])
- {
- out.RawByte('[')
- for v26, v27 := range in.Entries {
- if v26 > 0 {
- out.RawByte(',')
- }
- if v27 == nil {
- out.RawString("null")
- } else {
- (*v27).MarshalEasyJSON(out)
- }
- }
- out.RawByte(']')
+ if in.AccessTime == nil {
+ out.RawString("null")
+ } else {
+ (*in.AccessTime).MarshalEasyJSON(out)
}
}
+ {
+ const prefix string = ",\"type\":"
+ out.RawString(prefix)
+ (in.Type).MarshalEasyJSON(out)
+ }
+ {
+ const prefix string = ",\"ownerOrigin\":"
+ out.RawString(prefix)
+ out.String(string(in.OwnerOrigin))
+ }
+ {
+ const prefix string = ",\"name\":"
+ out.RawString(prefix)
+ out.String(string(in.Name))
+ }
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetSharedStorageEntriesReturns) MarshalJSON() ([]byte, error) {
+func (v EventInterestGroupAccessed) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage31(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage45(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetSharedStorageEntriesReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage31(w, v)
+func (v EventInterestGroupAccessed) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage45(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetSharedStorageEntriesReturns) UnmarshalJSON(data []byte) error {
+func (v *EventInterestGroupAccessed) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage31(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage45(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetSharedStorageEntriesReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage31(l, v)
+func (v *EventInterestGroupAccessed) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage45(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage32(in *jlexer.Lexer, out *GetSharedStorageEntriesParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage46(in *jlexer.Lexer, out *EventIndexedDBListUpdated) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2833,8 +3945,12 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage32(in *jlexer.Lexer, o
continue
}
switch key {
- case "ownerOrigin":
- out.OwnerOrigin = string(in.String())
+ case "origin":
+ out.Origin = string(in.String())
+ case "storageKey":
+ out.StorageKey = string(in.String())
+ case "bucketId":
+ out.BucketID = string(in.String())
default:
in.SkipRecursive()
}
@@ -2845,42 +3961,52 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage32(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage32(out *jwriter.Writer, in GetSharedStorageEntriesParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage46(out *jwriter.Writer, in EventIndexedDBListUpdated) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"ownerOrigin\":"
+ const prefix string = ",\"origin\":"
out.RawString(prefix[1:])
- out.String(string(in.OwnerOrigin))
+ out.String(string(in.Origin))
+ }
+ {
+ const prefix string = ",\"storageKey\":"
+ out.RawString(prefix)
+ out.String(string(in.StorageKey))
+ }
+ {
+ const prefix string = ",\"bucketId\":"
+ out.RawString(prefix)
+ out.String(string(in.BucketID))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetSharedStorageEntriesParams) MarshalJSON() ([]byte, error) {
+func (v EventIndexedDBListUpdated) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage32(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage46(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetSharedStorageEntriesParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage32(w, v)
+func (v EventIndexedDBListUpdated) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage46(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetSharedStorageEntriesParams) UnmarshalJSON(data []byte) error {
+func (v *EventIndexedDBListUpdated) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage32(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage46(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetSharedStorageEntriesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage32(l, v)
+func (v *EventIndexedDBListUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage46(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage33(in *jlexer.Lexer, out *GetInterestGroupDetailsReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage47(in *jlexer.Lexer, out *EventIndexedDBContentUpdated) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2899,63 +4025,82 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage33(in *jlexer.Lexer, o
continue
}
switch key {
- case "details":
- if in.IsNull() {
- in.Skip()
- out.Details = nil
- } else {
- if out.Details == nil {
- out.Details = new(InterestGroupDetails)
- }
- (*out.Details).UnmarshalEasyJSON(in)
- }
+ case "origin":
+ out.Origin = string(in.String())
+ case "storageKey":
+ out.StorageKey = string(in.String())
+ case "bucketId":
+ out.BucketID = string(in.String())
+ case "databaseName":
+ out.DatabaseName = string(in.String())
+ case "objectStoreName":
+ out.ObjectStoreName = string(in.String())
default:
in.SkipRecursive()
}
in.WantComma()
}
- in.Delim('}')
- if isTopLevel {
- in.Consumed()
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage47(out *jwriter.Writer, in EventIndexedDBContentUpdated) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"origin\":"
+ out.RawString(prefix[1:])
+ out.String(string(in.Origin))
+ }
+ {
+ const prefix string = ",\"storageKey\":"
+ out.RawString(prefix)
+ out.String(string(in.StorageKey))
+ }
+ {
+ const prefix string = ",\"bucketId\":"
+ out.RawString(prefix)
+ out.String(string(in.BucketID))
}
-}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage33(out *jwriter.Writer, in GetInterestGroupDetailsReturns) {
- out.RawByte('{')
- first := true
- _ = first
- if in.Details != nil {
- const prefix string = ",\"details\":"
- first = false
- out.RawString(prefix[1:])
- (*in.Details).MarshalEasyJSON(out)
+ {
+ const prefix string = ",\"databaseName\":"
+ out.RawString(prefix)
+ out.String(string(in.DatabaseName))
+ }
+ {
+ const prefix string = ",\"objectStoreName\":"
+ out.RawString(prefix)
+ out.String(string(in.ObjectStoreName))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetInterestGroupDetailsReturns) MarshalJSON() ([]byte, error) {
+func (v EventIndexedDBContentUpdated) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage33(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage47(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetInterestGroupDetailsReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage33(w, v)
+func (v EventIndexedDBContentUpdated) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage47(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetInterestGroupDetailsReturns) UnmarshalJSON(data []byte) error {
+func (v *EventIndexedDBContentUpdated) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage33(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage47(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetInterestGroupDetailsReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage33(l, v)
+func (v *EventIndexedDBContentUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage47(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage34(in *jlexer.Lexer, out *GetInterestGroupDetailsParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage48(in *jlexer.Lexer, out *EventCacheStorageListUpdated) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -2974,10 +4119,12 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage34(in *jlexer.Lexer, o
continue
}
switch key {
- case "ownerOrigin":
- out.OwnerOrigin = string(in.String())
- case "name":
- out.Name = string(in.String())
+ case "origin":
+ out.Origin = string(in.String())
+ case "storageKey":
+ out.StorageKey = string(in.String())
+ case "bucketId":
+ out.BucketID = string(in.String())
default:
in.SkipRecursive()
}
@@ -2988,47 +4135,52 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage34(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage34(out *jwriter.Writer, in GetInterestGroupDetailsParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage48(out *jwriter.Writer, in EventCacheStorageListUpdated) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"ownerOrigin\":"
+ const prefix string = ",\"origin\":"
out.RawString(prefix[1:])
- out.String(string(in.OwnerOrigin))
+ out.String(string(in.Origin))
}
{
- const prefix string = ",\"name\":"
+ const prefix string = ",\"storageKey\":"
out.RawString(prefix)
- out.String(string(in.Name))
+ out.String(string(in.StorageKey))
+ }
+ {
+ const prefix string = ",\"bucketId\":"
+ out.RawString(prefix)
+ out.String(string(in.BucketID))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetInterestGroupDetailsParams) MarshalJSON() ([]byte, error) {
+func (v EventCacheStorageListUpdated) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage34(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage48(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetInterestGroupDetailsParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage34(w, v)
+func (v EventCacheStorageListUpdated) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage48(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetInterestGroupDetailsParams) UnmarshalJSON(data []byte) error {
+func (v *EventCacheStorageListUpdated) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage34(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage48(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetInterestGroupDetailsParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage34(l, v)
+func (v *EventCacheStorageListUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage48(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage35(in *jlexer.Lexer, out *GetCookiesReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage49(in *jlexer.Lexer, out *EventCacheStorageContentUpdated) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3047,37 +4199,14 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage35(in *jlexer.Lexer, o
continue
}
switch key {
- case "cookies":
- if in.IsNull() {
- in.Skip()
- out.Cookies = nil
- } else {
- in.Delim('[')
- if out.Cookies == nil {
- if !in.IsDelim(']') {
- out.Cookies = make([]*network.Cookie, 0, 8)
- } else {
- out.Cookies = []*network.Cookie{}
- }
- } else {
- out.Cookies = (out.Cookies)[:0]
- }
- for !in.IsDelim(']') {
- var v28 *network.Cookie
- if in.IsNull() {
- in.Skip()
- v28 = nil
- } else {
- if v28 == nil {
- v28 = new(network.Cookie)
- }
- (*v28).UnmarshalEasyJSON(in)
- }
- out.Cookies = append(out.Cookies, v28)
- in.WantComma()
- }
- in.Delim(']')
- }
+ case "origin":
+ out.Origin = string(in.String())
+ case "storageKey":
+ out.StorageKey = string(in.String())
+ case "bucketId":
+ out.BucketID = string(in.String())
+ case "cacheName":
+ out.CacheName = string(in.String())
default:
in.SkipRecursive()
}
@@ -3088,56 +4217,57 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage35(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage35(out *jwriter.Writer, in GetCookiesReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage49(out *jwriter.Writer, in EventCacheStorageContentUpdated) {
out.RawByte('{')
first := true
_ = first
- if len(in.Cookies) != 0 {
- const prefix string = ",\"cookies\":"
- first = false
+ {
+ const prefix string = ",\"origin\":"
out.RawString(prefix[1:])
- {
- out.RawByte('[')
- for v29, v30 := range in.Cookies {
- if v29 > 0 {
- out.RawByte(',')
- }
- if v30 == nil {
- out.RawString("null")
- } else {
- (*v30).MarshalEasyJSON(out)
- }
- }
- out.RawByte(']')
- }
+ out.String(string(in.Origin))
+ }
+ {
+ const prefix string = ",\"storageKey\":"
+ out.RawString(prefix)
+ out.String(string(in.StorageKey))
+ }
+ {
+ const prefix string = ",\"bucketId\":"
+ out.RawString(prefix)
+ out.String(string(in.BucketID))
+ }
+ {
+ const prefix string = ",\"cacheName\":"
+ out.RawString(prefix)
+ out.String(string(in.CacheName))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetCookiesReturns) MarshalJSON() ([]byte, error) {
+func (v EventCacheStorageContentUpdated) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage35(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage49(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetCookiesReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage35(w, v)
+func (v EventCacheStorageContentUpdated) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage49(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetCookiesReturns) UnmarshalJSON(data []byte) error {
+func (v *EventCacheStorageContentUpdated) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage35(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage49(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetCookiesReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage35(l, v)
+func (v *EventCacheStorageContentUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage49(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage36(in *jlexer.Lexer, out *GetCookiesParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage50(in *jlexer.Lexer, out *EventAttributionReportingSourceRegistered) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3156,8 +4286,18 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage36(in *jlexer.Lexer, o
continue
}
switch key {
- case "browserContextId":
- out.BrowserContextID = cdp.BrowserContextID(in.String())
+ case "registration":
+ if in.IsNull() {
+ in.Skip()
+ out.Registration = nil
+ } else {
+ if out.Registration == nil {
+ out.Registration = new(AttributionReportingSourceRegistration)
+ }
+ (*out.Registration).UnmarshalEasyJSON(in)
+ }
+ case "result":
+ (out.Result).UnmarshalEasyJSON(in)
default:
in.SkipRecursive()
}
@@ -3168,43 +4308,51 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage36(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage36(out *jwriter.Writer, in GetCookiesParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage50(out *jwriter.Writer, in EventAttributionReportingSourceRegistered) {
out.RawByte('{')
first := true
_ = first
- if in.BrowserContextID != "" {
- const prefix string = ",\"browserContextId\":"
- first = false
+ {
+ const prefix string = ",\"registration\":"
out.RawString(prefix[1:])
- out.String(string(in.BrowserContextID))
+ if in.Registration == nil {
+ out.RawString("null")
+ } else {
+ (*in.Registration).MarshalEasyJSON(out)
+ }
+ }
+ {
+ const prefix string = ",\"result\":"
+ out.RawString(prefix)
+ (in.Result).MarshalEasyJSON(out)
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v GetCookiesParams) MarshalJSON() ([]byte, error) {
+func (v EventAttributionReportingSourceRegistered) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage36(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage50(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v GetCookiesParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage36(w, v)
+func (v EventAttributionReportingSourceRegistered) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage50(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *GetCookiesParams) UnmarshalJSON(data []byte) error {
+func (v *EventAttributionReportingSourceRegistered) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage36(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage50(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *GetCookiesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage36(l, v)
+func (v *EventAttributionReportingSourceRegistered) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage50(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage37(in *jlexer.Lexer, out *EventSharedStorageAccessed) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage51(in *jlexer.Lexer, out *DeleteStorageBucketParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3223,31 +4371,15 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage37(in *jlexer.Lexer, o
continue
}
switch key {
- case "accessTime":
- if in.IsNull() {
- in.Skip()
- out.AccessTime = nil
- } else {
- if out.AccessTime == nil {
- out.AccessTime = new(cdp.TimeSinceEpoch)
- }
- (*out.AccessTime).UnmarshalEasyJSON(in)
- }
- case "type":
- (out.Type).UnmarshalEasyJSON(in)
- case "mainFrameId":
- (out.MainFrameID).UnmarshalEasyJSON(in)
- case "ownerOrigin":
- out.OwnerOrigin = string(in.String())
- case "params":
+ case "bucket":
if in.IsNull() {
in.Skip()
- out.Params = nil
+ out.Bucket = nil
} else {
- if out.Params == nil {
- out.Params = new(SharedStorageAccessParams)
+ if out.Bucket == nil {
+ out.Bucket = new(Bucket)
}
- (*out.Params).UnmarshalEasyJSON(in)
+ (*out.Bucket).UnmarshalEasyJSON(in)
}
default:
in.SkipRecursive()
@@ -3259,70 +4391,46 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage37(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage37(out *jwriter.Writer, in EventSharedStorageAccessed) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage51(out *jwriter.Writer, in DeleteStorageBucketParams) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"accessTime\":"
+ const prefix string = ",\"bucket\":"
out.RawString(prefix[1:])
- if in.AccessTime == nil {
- out.RawString("null")
- } else {
- (*in.AccessTime).MarshalEasyJSON(out)
- }
- }
- {
- const prefix string = ",\"type\":"
- out.RawString(prefix)
- (in.Type).MarshalEasyJSON(out)
- }
- {
- const prefix string = ",\"mainFrameId\":"
- out.RawString(prefix)
- out.String(string(in.MainFrameID))
- }
- {
- const prefix string = ",\"ownerOrigin\":"
- out.RawString(prefix)
- out.String(string(in.OwnerOrigin))
- }
- {
- const prefix string = ",\"params\":"
- out.RawString(prefix)
- if in.Params == nil {
+ if in.Bucket == nil {
out.RawString("null")
} else {
- (*in.Params).MarshalEasyJSON(out)
+ (*in.Bucket).MarshalEasyJSON(out)
}
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v EventSharedStorageAccessed) MarshalJSON() ([]byte, error) {
+func (v DeleteStorageBucketParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage37(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage51(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v EventSharedStorageAccessed) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage37(w, v)
+func (v DeleteStorageBucketParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage51(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *EventSharedStorageAccessed) UnmarshalJSON(data []byte) error {
+func (v *DeleteStorageBucketParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage37(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage51(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *EventSharedStorageAccessed) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage37(l, v)
+func (v *DeleteStorageBucketParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage51(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage38(in *jlexer.Lexer, out *EventInterestGroupAccessed) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage52(in *jlexer.Lexer, out *DeleteSharedStorageEntryParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3335,28 +4443,16 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage38(in *jlexer.Lexer, o
for !in.IsDelim('}') {
key := in.UnsafeFieldName(false)
in.WantColon()
- if in.IsNull() {
- in.Skip()
- in.WantComma()
- continue
- }
- switch key {
- case "accessTime":
- if in.IsNull() {
- in.Skip()
- out.AccessTime = nil
- } else {
- if out.AccessTime == nil {
- out.AccessTime = new(cdp.TimeSinceEpoch)
- }
- (*out.AccessTime).UnmarshalEasyJSON(in)
- }
- case "type":
- (out.Type).UnmarshalEasyJSON(in)
+ if in.IsNull() {
+ in.Skip()
+ in.WantComma()
+ continue
+ }
+ switch key {
case "ownerOrigin":
out.OwnerOrigin = string(in.String())
- case "name":
- out.Name = string(in.String())
+ case "key":
+ out.Key = string(in.String())
default:
in.SkipRecursive()
}
@@ -3367,61 +4463,47 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage38(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage38(out *jwriter.Writer, in EventInterestGroupAccessed) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage52(out *jwriter.Writer, in DeleteSharedStorageEntryParams) {
out.RawByte('{')
first := true
_ = first
- {
- const prefix string = ",\"accessTime\":"
- out.RawString(prefix[1:])
- if in.AccessTime == nil {
- out.RawString("null")
- } else {
- (*in.AccessTime).MarshalEasyJSON(out)
- }
- }
- {
- const prefix string = ",\"type\":"
- out.RawString(prefix)
- (in.Type).MarshalEasyJSON(out)
- }
{
const prefix string = ",\"ownerOrigin\":"
- out.RawString(prefix)
+ out.RawString(prefix[1:])
out.String(string(in.OwnerOrigin))
}
{
- const prefix string = ",\"name\":"
+ const prefix string = ",\"key\":"
out.RawString(prefix)
- out.String(string(in.Name))
+ out.String(string(in.Key))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v EventInterestGroupAccessed) MarshalJSON() ([]byte, error) {
+func (v DeleteSharedStorageEntryParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage38(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage52(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v EventInterestGroupAccessed) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage38(w, v)
+func (v DeleteSharedStorageEntryParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage52(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *EventInterestGroupAccessed) UnmarshalJSON(data []byte) error {
+func (v *DeleteSharedStorageEntryParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage38(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage52(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *EventInterestGroupAccessed) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage38(l, v)
+func (v *DeleteSharedStorageEntryParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage52(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage39(in *jlexer.Lexer, out *EventIndexedDBListUpdated) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage53(in *jlexer.Lexer, out *ClearTrustTokensReturns) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3440,10 +4522,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage39(in *jlexer.Lexer, o
continue
}
switch key {
- case "origin":
- out.Origin = string(in.String())
- case "storageKey":
- out.StorageKey = string(in.String())
+ case "didDeleteTokens":
+ out.DidDeleteTokens = bool(in.Bool())
default:
in.SkipRecursive()
}
@@ -3454,47 +4534,43 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage39(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage39(out *jwriter.Writer, in EventIndexedDBListUpdated) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage53(out *jwriter.Writer, in ClearTrustTokensReturns) {
out.RawByte('{')
first := true
_ = first
- {
- const prefix string = ",\"origin\":"
+ if in.DidDeleteTokens {
+ const prefix string = ",\"didDeleteTokens\":"
+ first = false
out.RawString(prefix[1:])
- out.String(string(in.Origin))
- }
- {
- const prefix string = ",\"storageKey\":"
- out.RawString(prefix)
- out.String(string(in.StorageKey))
+ out.Bool(bool(in.DidDeleteTokens))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v EventIndexedDBListUpdated) MarshalJSON() ([]byte, error) {
+func (v ClearTrustTokensReturns) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage39(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage53(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v EventIndexedDBListUpdated) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage39(w, v)
+func (v ClearTrustTokensReturns) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage53(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *EventIndexedDBListUpdated) UnmarshalJSON(data []byte) error {
+func (v *ClearTrustTokensReturns) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage39(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage53(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *EventIndexedDBListUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage39(l, v)
+func (v *ClearTrustTokensReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage53(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage40(in *jlexer.Lexer, out *EventIndexedDBContentUpdated) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage54(in *jlexer.Lexer, out *ClearTrustTokensParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3513,14 +4589,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage40(in *jlexer.Lexer, o
continue
}
switch key {
- case "origin":
- out.Origin = string(in.String())
- case "storageKey":
- out.StorageKey = string(in.String())
- case "databaseName":
- out.DatabaseName = string(in.String())
- case "objectStoreName":
- out.ObjectStoreName = string(in.String())
+ case "issuerOrigin":
+ out.IssuerOrigin = string(in.String())
default:
in.SkipRecursive()
}
@@ -3531,57 +4601,42 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage40(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage40(out *jwriter.Writer, in EventIndexedDBContentUpdated) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage54(out *jwriter.Writer, in ClearTrustTokensParams) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"origin\":"
+ const prefix string = ",\"issuerOrigin\":"
out.RawString(prefix[1:])
- out.String(string(in.Origin))
- }
- {
- const prefix string = ",\"storageKey\":"
- out.RawString(prefix)
- out.String(string(in.StorageKey))
- }
- {
- const prefix string = ",\"databaseName\":"
- out.RawString(prefix)
- out.String(string(in.DatabaseName))
- }
- {
- const prefix string = ",\"objectStoreName\":"
- out.RawString(prefix)
- out.String(string(in.ObjectStoreName))
+ out.String(string(in.IssuerOrigin))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v EventIndexedDBContentUpdated) MarshalJSON() ([]byte, error) {
+func (v ClearTrustTokensParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage40(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage54(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v EventIndexedDBContentUpdated) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage40(w, v)
+func (v ClearTrustTokensParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage54(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *EventIndexedDBContentUpdated) UnmarshalJSON(data []byte) error {
+func (v *ClearTrustTokensParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage40(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage54(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *EventIndexedDBContentUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage40(l, v)
+func (v *ClearTrustTokensParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage54(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage41(in *jlexer.Lexer, out *EventCacheStorageListUpdated) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage55(in *jlexer.Lexer, out *ClearSharedStorageEntriesParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3600,10 +4655,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage41(in *jlexer.Lexer, o
continue
}
switch key {
- case "origin":
- out.Origin = string(in.String())
- case "storageKey":
- out.StorageKey = string(in.String())
+ case "ownerOrigin":
+ out.OwnerOrigin = string(in.String())
default:
in.SkipRecursive()
}
@@ -3614,47 +4667,42 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage41(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage41(out *jwriter.Writer, in EventCacheStorageListUpdated) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage55(out *jwriter.Writer, in ClearSharedStorageEntriesParams) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"origin\":"
+ const prefix string = ",\"ownerOrigin\":"
out.RawString(prefix[1:])
- out.String(string(in.Origin))
- }
- {
- const prefix string = ",\"storageKey\":"
- out.RawString(prefix)
- out.String(string(in.StorageKey))
+ out.String(string(in.OwnerOrigin))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v EventCacheStorageListUpdated) MarshalJSON() ([]byte, error) {
+func (v ClearSharedStorageEntriesParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage41(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage55(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v EventCacheStorageListUpdated) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage41(w, v)
+func (v ClearSharedStorageEntriesParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage55(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *EventCacheStorageListUpdated) UnmarshalJSON(data []byte) error {
+func (v *ClearSharedStorageEntriesParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage41(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage55(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *EventCacheStorageListUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage41(l, v)
+func (v *ClearSharedStorageEntriesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage55(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage42(in *jlexer.Lexer, out *EventCacheStorageContentUpdated) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage56(in *jlexer.Lexer, out *ClearDataForStorageKeyParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3673,12 +4721,10 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage42(in *jlexer.Lexer, o
continue
}
switch key {
- case "origin":
- out.Origin = string(in.String())
case "storageKey":
out.StorageKey = string(in.String())
- case "cacheName":
- out.CacheName = string(in.String())
+ case "storageTypes":
+ out.StorageTypes = string(in.String())
default:
in.SkipRecursive()
}
@@ -3689,52 +4735,47 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage42(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage42(out *jwriter.Writer, in EventCacheStorageContentUpdated) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage56(out *jwriter.Writer, in ClearDataForStorageKeyParams) {
out.RawByte('{')
first := true
_ = first
- {
- const prefix string = ",\"origin\":"
- out.RawString(prefix[1:])
- out.String(string(in.Origin))
- }
{
const prefix string = ",\"storageKey\":"
- out.RawString(prefix)
+ out.RawString(prefix[1:])
out.String(string(in.StorageKey))
}
{
- const prefix string = ",\"cacheName\":"
+ const prefix string = ",\"storageTypes\":"
out.RawString(prefix)
- out.String(string(in.CacheName))
+ out.String(string(in.StorageTypes))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v EventCacheStorageContentUpdated) MarshalJSON() ([]byte, error) {
+func (v ClearDataForStorageKeyParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage42(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage56(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v EventCacheStorageContentUpdated) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage42(w, v)
+func (v ClearDataForStorageKeyParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage56(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *EventCacheStorageContentUpdated) UnmarshalJSON(data []byte) error {
+func (v *ClearDataForStorageKeyParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage42(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage56(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *EventCacheStorageContentUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage42(l, v)
+func (v *ClearDataForStorageKeyParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage56(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage43(in *jlexer.Lexer, out *DeleteSharedStorageEntryParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage57(in *jlexer.Lexer, out *ClearDataForOriginParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3753,10 +4794,10 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage43(in *jlexer.Lexer, o
continue
}
switch key {
- case "ownerOrigin":
- out.OwnerOrigin = string(in.String())
- case "key":
- out.Key = string(in.String())
+ case "origin":
+ out.Origin = string(in.String())
+ case "storageTypes":
+ out.StorageTypes = string(in.String())
default:
in.SkipRecursive()
}
@@ -3767,47 +4808,47 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage43(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage43(out *jwriter.Writer, in DeleteSharedStorageEntryParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage57(out *jwriter.Writer, in ClearDataForOriginParams) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"ownerOrigin\":"
+ const prefix string = ",\"origin\":"
out.RawString(prefix[1:])
- out.String(string(in.OwnerOrigin))
+ out.String(string(in.Origin))
}
{
- const prefix string = ",\"key\":"
+ const prefix string = ",\"storageTypes\":"
out.RawString(prefix)
- out.String(string(in.Key))
+ out.String(string(in.StorageTypes))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v DeleteSharedStorageEntryParams) MarshalJSON() ([]byte, error) {
+func (v ClearDataForOriginParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage43(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage57(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v DeleteSharedStorageEntryParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage43(w, v)
+func (v ClearDataForOriginParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage57(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *DeleteSharedStorageEntryParams) UnmarshalJSON(data []byte) error {
+func (v *ClearDataForOriginParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage43(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage57(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *DeleteSharedStorageEntryParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage43(l, v)
+func (v *ClearDataForOriginParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage57(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage44(in *jlexer.Lexer, out *ClearTrustTokensReturns) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage58(in *jlexer.Lexer, out *ClearCookiesParams) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3826,8 +4867,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage44(in *jlexer.Lexer, o
continue
}
switch key {
- case "didDeleteTokens":
- out.DidDeleteTokens = bool(in.Bool())
+ case "browserContextId":
+ out.BrowserContextID = cdp.BrowserContextID(in.String())
default:
in.SkipRecursive()
}
@@ -3838,43 +4879,43 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage44(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage44(out *jwriter.Writer, in ClearTrustTokensReturns) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage58(out *jwriter.Writer, in ClearCookiesParams) {
out.RawByte('{')
first := true
_ = first
- if in.DidDeleteTokens {
- const prefix string = ",\"didDeleteTokens\":"
+ if in.BrowserContextID != "" {
+ const prefix string = ",\"browserContextId\":"
first = false
out.RawString(prefix[1:])
- out.Bool(bool(in.DidDeleteTokens))
+ out.String(string(in.BrowserContextID))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v ClearTrustTokensReturns) MarshalJSON() ([]byte, error) {
+func (v ClearCookiesParams) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage44(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage58(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v ClearTrustTokensReturns) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage44(w, v)
+func (v ClearCookiesParams) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage58(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *ClearTrustTokensReturns) UnmarshalJSON(data []byte) error {
+func (v *ClearCookiesParams) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage44(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage58(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *ClearTrustTokensReturns) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage44(l, v)
+func (v *ClearCookiesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage58(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage45(in *jlexer.Lexer, out *ClearTrustTokensParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage59(in *jlexer.Lexer, out *BucketInfo) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3893,54 +4934,113 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage45(in *jlexer.Lexer, o
continue
}
switch key {
- case "issuerOrigin":
- out.IssuerOrigin = string(in.String())
+ case "bucket":
+ if in.IsNull() {
+ in.Skip()
+ out.Bucket = nil
+ } else {
+ if out.Bucket == nil {
+ out.Bucket = new(Bucket)
+ }
+ (*out.Bucket).UnmarshalEasyJSON(in)
+ }
+ case "id":
+ out.ID = string(in.String())
+ case "expiration":
+ if in.IsNull() {
+ in.Skip()
+ out.Expiration = nil
+ } else {
+ if out.Expiration == nil {
+ out.Expiration = new(cdp.TimeSinceEpoch)
+ }
+ (*out.Expiration).UnmarshalEasyJSON(in)
+ }
+ case "quota":
+ out.Quota = float64(in.Float64())
+ case "persistent":
+ out.Persistent = bool(in.Bool())
+ case "durability":
+ (out.Durability).UnmarshalEasyJSON(in)
default:
in.SkipRecursive()
}
- in.WantComma()
+ in.WantComma()
+ }
+ in.Delim('}')
+ if isTopLevel {
+ in.Consumed()
+ }
+}
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage59(out *jwriter.Writer, in BucketInfo) {
+ out.RawByte('{')
+ first := true
+ _ = first
+ {
+ const prefix string = ",\"bucket\":"
+ out.RawString(prefix[1:])
+ if in.Bucket == nil {
+ out.RawString("null")
+ } else {
+ (*in.Bucket).MarshalEasyJSON(out)
+ }
+ }
+ {
+ const prefix string = ",\"id\":"
+ out.RawString(prefix)
+ out.String(string(in.ID))
+ }
+ {
+ const prefix string = ",\"expiration\":"
+ out.RawString(prefix)
+ if in.Expiration == nil {
+ out.RawString("null")
+ } else {
+ (*in.Expiration).MarshalEasyJSON(out)
+ }
}
- in.Delim('}')
- if isTopLevel {
- in.Consumed()
+ {
+ const prefix string = ",\"quota\":"
+ out.RawString(prefix)
+ out.Float64(float64(in.Quota))
}
-}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage45(out *jwriter.Writer, in ClearTrustTokensParams) {
- out.RawByte('{')
- first := true
- _ = first
{
- const prefix string = ",\"issuerOrigin\":"
- out.RawString(prefix[1:])
- out.String(string(in.IssuerOrigin))
+ const prefix string = ",\"persistent\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.Persistent))
+ }
+ {
+ const prefix string = ",\"durability\":"
+ out.RawString(prefix)
+ (in.Durability).MarshalEasyJSON(out)
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v ClearTrustTokensParams) MarshalJSON() ([]byte, error) {
+func (v BucketInfo) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage45(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage59(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v ClearTrustTokensParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage45(w, v)
+func (v BucketInfo) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage59(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *ClearTrustTokensParams) UnmarshalJSON(data []byte) error {
+func (v *BucketInfo) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage45(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage59(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *ClearTrustTokensParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage45(l, v)
+func (v *BucketInfo) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage59(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage46(in *jlexer.Lexer, out *ClearSharedStorageEntriesParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage60(in *jlexer.Lexer, out *Bucket) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -3959,8 +5059,10 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage46(in *jlexer.Lexer, o
continue
}
switch key {
- case "ownerOrigin":
- out.OwnerOrigin = string(in.String())
+ case "storageKey":
+ out.StorageKey = SerializedStorageKey(in.String())
+ case "name":
+ out.Name = string(in.String())
default:
in.SkipRecursive()
}
@@ -3971,42 +5073,47 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage46(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage46(out *jwriter.Writer, in ClearSharedStorageEntriesParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage60(out *jwriter.Writer, in Bucket) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"ownerOrigin\":"
+ const prefix string = ",\"storageKey\":"
out.RawString(prefix[1:])
- out.String(string(in.OwnerOrigin))
+ out.String(string(in.StorageKey))
+ }
+ if in.Name != "" {
+ const prefix string = ",\"name\":"
+ out.RawString(prefix)
+ out.String(string(in.Name))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v ClearSharedStorageEntriesParams) MarshalJSON() ([]byte, error) {
+func (v Bucket) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage46(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage60(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v ClearSharedStorageEntriesParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage46(w, v)
+func (v Bucket) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage60(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *ClearSharedStorageEntriesParams) UnmarshalJSON(data []byte) error {
+func (v *Bucket) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage46(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage60(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *ClearSharedStorageEntriesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage46(l, v)
+func (v *Bucket) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage60(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage47(in *jlexer.Lexer, out *ClearDataForStorageKeyParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage61(in *jlexer.Lexer, out *AttributionReportingSourceRegistration) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4025,10 +5132,119 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage47(in *jlexer.Lexer, o
continue
}
switch key {
- case "storageKey":
- out.StorageKey = string(in.String())
- case "storageTypes":
- out.StorageTypes = string(in.String())
+ case "time":
+ if in.IsNull() {
+ in.Skip()
+ out.Time = nil
+ } else {
+ if out.Time == nil {
+ out.Time = new(cdp.TimeSinceEpoch)
+ }
+ (*out.Time).UnmarshalEasyJSON(in)
+ }
+ case "expiry":
+ out.Expiry = int64(in.Int64())
+ case "eventReportWindow":
+ out.EventReportWindow = int64(in.Int64())
+ case "aggregatableReportWindow":
+ out.AggregatableReportWindow = int64(in.Int64())
+ case "type":
+ (out.Type).UnmarshalEasyJSON(in)
+ case "sourceOrigin":
+ out.SourceOrigin = string(in.String())
+ case "reportingOrigin":
+ out.ReportingOrigin = string(in.String())
+ case "destinationSites":
+ if in.IsNull() {
+ in.Skip()
+ out.DestinationSites = nil
+ } else {
+ in.Delim('[')
+ if out.DestinationSites == nil {
+ if !in.IsDelim(']') {
+ out.DestinationSites = make([]string, 0, 4)
+ } else {
+ out.DestinationSites = []string{}
+ }
+ } else {
+ out.DestinationSites = (out.DestinationSites)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v34 string
+ v34 = string(in.String())
+ out.DestinationSites = append(out.DestinationSites, v34)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ case "eventId":
+ out.EventID = UnsignedInt64asBase10(in.String())
+ case "priority":
+ out.Priority = SignedInt64asBase10(in.String())
+ case "filterData":
+ if in.IsNull() {
+ in.Skip()
+ out.FilterData = nil
+ } else {
+ in.Delim('[')
+ if out.FilterData == nil {
+ if !in.IsDelim(']') {
+ out.FilterData = make([]*AttributionReportingFilterDataEntry, 0, 8)
+ } else {
+ out.FilterData = []*AttributionReportingFilterDataEntry{}
+ }
+ } else {
+ out.FilterData = (out.FilterData)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v35 *AttributionReportingFilterDataEntry
+ if in.IsNull() {
+ in.Skip()
+ v35 = nil
+ } else {
+ if v35 == nil {
+ v35 = new(AttributionReportingFilterDataEntry)
+ }
+ (*v35).UnmarshalEasyJSON(in)
+ }
+ out.FilterData = append(out.FilterData, v35)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ case "aggregationKeys":
+ if in.IsNull() {
+ in.Skip()
+ out.AggregationKeys = nil
+ } else {
+ in.Delim('[')
+ if out.AggregationKeys == nil {
+ if !in.IsDelim(']') {
+ out.AggregationKeys = make([]*AttributionReportingAggregationKeysEntry, 0, 8)
+ } else {
+ out.AggregationKeys = []*AttributionReportingAggregationKeysEntry{}
+ }
+ } else {
+ out.AggregationKeys = (out.AggregationKeys)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v36 *AttributionReportingAggregationKeysEntry
+ if in.IsNull() {
+ in.Skip()
+ v36 = nil
+ } else {
+ if v36 == nil {
+ v36 = new(AttributionReportingAggregationKeysEntry)
+ }
+ (*v36).UnmarshalEasyJSON(in)
+ }
+ out.AggregationKeys = append(out.AggregationKeys, v36)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
+ case "debugKey":
+ out.DebugKey = UnsignedInt64asBase10(in.String())
default:
in.SkipRecursive()
}
@@ -4039,47 +5255,147 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage47(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage47(out *jwriter.Writer, in ClearDataForStorageKeyParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage61(out *jwriter.Writer, in AttributionReportingSourceRegistration) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"storageKey\":"
+ const prefix string = ",\"time\":"
out.RawString(prefix[1:])
- out.String(string(in.StorageKey))
+ if in.Time == nil {
+ out.RawString("null")
+ } else {
+ (*in.Time).MarshalEasyJSON(out)
+ }
+ }
+ if in.Expiry != 0 {
+ const prefix string = ",\"expiry\":"
+ out.RawString(prefix)
+ out.Int64(int64(in.Expiry))
+ }
+ if in.EventReportWindow != 0 {
+ const prefix string = ",\"eventReportWindow\":"
+ out.RawString(prefix)
+ out.Int64(int64(in.EventReportWindow))
+ }
+ if in.AggregatableReportWindow != 0 {
+ const prefix string = ",\"aggregatableReportWindow\":"
+ out.RawString(prefix)
+ out.Int64(int64(in.AggregatableReportWindow))
}
{
- const prefix string = ",\"storageTypes\":"
+ const prefix string = ",\"type\":"
out.RawString(prefix)
- out.String(string(in.StorageTypes))
+ (in.Type).MarshalEasyJSON(out)
+ }
+ {
+ const prefix string = ",\"sourceOrigin\":"
+ out.RawString(prefix)
+ out.String(string(in.SourceOrigin))
+ }
+ {
+ const prefix string = ",\"reportingOrigin\":"
+ out.RawString(prefix)
+ out.String(string(in.ReportingOrigin))
+ }
+ {
+ const prefix string = ",\"destinationSites\":"
+ out.RawString(prefix)
+ if in.DestinationSites == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v37, v38 := range in.DestinationSites {
+ if v37 > 0 {
+ out.RawByte(',')
+ }
+ out.String(string(v38))
+ }
+ out.RawByte(']')
+ }
+ }
+ {
+ const prefix string = ",\"eventId\":"
+ out.RawString(prefix)
+ out.String(string(in.EventID))
+ }
+ {
+ const prefix string = ",\"priority\":"
+ out.RawString(prefix)
+ out.String(string(in.Priority))
+ }
+ {
+ const prefix string = ",\"filterData\":"
+ out.RawString(prefix)
+ if in.FilterData == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v39, v40 := range in.FilterData {
+ if v39 > 0 {
+ out.RawByte(',')
+ }
+ if v40 == nil {
+ out.RawString("null")
+ } else {
+ (*v40).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ {
+ const prefix string = ",\"aggregationKeys\":"
+ out.RawString(prefix)
+ if in.AggregationKeys == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v41, v42 := range in.AggregationKeys {
+ if v41 > 0 {
+ out.RawByte(',')
+ }
+ if v42 == nil {
+ out.RawString("null")
+ } else {
+ (*v42).MarshalEasyJSON(out)
+ }
+ }
+ out.RawByte(']')
+ }
+ }
+ if in.DebugKey != "" {
+ const prefix string = ",\"debugKey\":"
+ out.RawString(prefix)
+ out.String(string(in.DebugKey))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v ClearDataForStorageKeyParams) MarshalJSON() ([]byte, error) {
+func (v AttributionReportingSourceRegistration) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage47(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage61(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v ClearDataForStorageKeyParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage47(w, v)
+func (v AttributionReportingSourceRegistration) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage61(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *ClearDataForStorageKeyParams) UnmarshalJSON(data []byte) error {
+func (v *AttributionReportingSourceRegistration) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage47(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage61(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *ClearDataForStorageKeyParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage47(l, v)
+func (v *AttributionReportingSourceRegistration) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage61(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage48(in *jlexer.Lexer, out *ClearDataForOriginParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage62(in *jlexer.Lexer, out *AttributionReportingFilterDataEntry) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4098,10 +5414,31 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage48(in *jlexer.Lexer, o
continue
}
switch key {
- case "origin":
- out.Origin = string(in.String())
- case "storageTypes":
- out.StorageTypes = string(in.String())
+ case "key":
+ out.Key = string(in.String())
+ case "values":
+ if in.IsNull() {
+ in.Skip()
+ out.Values = nil
+ } else {
+ in.Delim('[')
+ if out.Values == nil {
+ if !in.IsDelim(']') {
+ out.Values = make([]string, 0, 4)
+ } else {
+ out.Values = []string{}
+ }
+ } else {
+ out.Values = (out.Values)[:0]
+ }
+ for !in.IsDelim(']') {
+ var v43 string
+ v43 = string(in.String())
+ out.Values = append(out.Values, v43)
+ in.WantComma()
+ }
+ in.Delim(']')
+ }
default:
in.SkipRecursive()
}
@@ -4112,47 +5449,58 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage48(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage48(out *jwriter.Writer, in ClearDataForOriginParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage62(out *jwriter.Writer, in AttributionReportingFilterDataEntry) {
out.RawByte('{')
first := true
_ = first
{
- const prefix string = ",\"origin\":"
+ const prefix string = ",\"key\":"
out.RawString(prefix[1:])
- out.String(string(in.Origin))
+ out.String(string(in.Key))
}
{
- const prefix string = ",\"storageTypes\":"
+ const prefix string = ",\"values\":"
out.RawString(prefix)
- out.String(string(in.StorageTypes))
+ if in.Values == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+ out.RawString("null")
+ } else {
+ out.RawByte('[')
+ for v44, v45 := range in.Values {
+ if v44 > 0 {
+ out.RawByte(',')
+ }
+ out.String(string(v45))
+ }
+ out.RawByte(']')
+ }
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v ClearDataForOriginParams) MarshalJSON() ([]byte, error) {
+func (v AttributionReportingFilterDataEntry) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage48(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage62(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v ClearDataForOriginParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage48(w, v)
+func (v AttributionReportingFilterDataEntry) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage62(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *ClearDataForOriginParams) UnmarshalJSON(data []byte) error {
+func (v *AttributionReportingFilterDataEntry) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage48(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage62(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *ClearDataForOriginParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage48(l, v)
+func (v *AttributionReportingFilterDataEntry) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage62(l, v)
}
-func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage49(in *jlexer.Lexer, out *ClearCookiesParams) {
+func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage63(in *jlexer.Lexer, out *AttributionReportingAggregationKeysEntry) {
isTopLevel := in.IsStart()
if in.IsNull() {
if isTopLevel {
@@ -4171,8 +5519,10 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage49(in *jlexer.Lexer, o
continue
}
switch key {
- case "browserContextId":
- out.BrowserContextID = cdp.BrowserContextID(in.String())
+ case "key":
+ out.Key = string(in.String())
+ case "value":
+ out.Value = UnsignedInt128asBase16(in.String())
default:
in.SkipRecursive()
}
@@ -4183,39 +5533,43 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage49(in *jlexer.Lexer, o
in.Consumed()
}
}
-func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage49(out *jwriter.Writer, in ClearCookiesParams) {
+func easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage63(out *jwriter.Writer, in AttributionReportingAggregationKeysEntry) {
out.RawByte('{')
first := true
_ = first
- if in.BrowserContextID != "" {
- const prefix string = ",\"browserContextId\":"
- first = false
+ {
+ const prefix string = ",\"key\":"
out.RawString(prefix[1:])
- out.String(string(in.BrowserContextID))
+ out.String(string(in.Key))
+ }
+ {
+ const prefix string = ",\"value\":"
+ out.RawString(prefix)
+ out.String(string(in.Value))
}
out.RawByte('}')
}
// MarshalJSON supports json.Marshaler interface
-func (v ClearCookiesParams) MarshalJSON() ([]byte, error) {
+func (v AttributionReportingAggregationKeysEntry) MarshalJSON() ([]byte, error) {
w := jwriter.Writer{}
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage49(&w, v)
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage63(&w, v)
return w.Buffer.BuildBytes(), w.Error
}
// MarshalEasyJSON supports easyjson.Marshaler interface
-func (v ClearCookiesParams) MarshalEasyJSON(w *jwriter.Writer) {
- easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage49(w, v)
+func (v AttributionReportingAggregationKeysEntry) MarshalEasyJSON(w *jwriter.Writer) {
+ easyjsonC5a4559bEncodeGithubComChromedpCdprotoStorage63(w, v)
}
// UnmarshalJSON supports json.Unmarshaler interface
-func (v *ClearCookiesParams) UnmarshalJSON(data []byte) error {
+func (v *AttributionReportingAggregationKeysEntry) UnmarshalJSON(data []byte) error {
r := jlexer.Lexer{Data: data}
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage49(&r, v)
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage63(&r, v)
return r.Error()
}
// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
-func (v *ClearCookiesParams) UnmarshalEasyJSON(l *jlexer.Lexer) {
- easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage49(l, v)
+func (v *AttributionReportingAggregationKeysEntry) UnmarshalEasyJSON(l *jlexer.Lexer) {
+ easyjsonC5a4559bDecodeGithubComChromedpCdprotoStorage63(l, v)
}
diff --git a/storage/events.go b/storage/events.go
index 1eaeaf8..9cfe411 100644
--- a/storage/events.go
+++ b/storage/events.go
@@ -12,6 +12,7 @@ import (
type EventCacheStorageContentUpdated struct {
Origin string `json:"origin"` // Origin to update.
StorageKey string `json:"storageKey"` // Storage key to update.
+ BucketID string `json:"bucketId"` // Storage bucket to update.
CacheName string `json:"cacheName"` // Name of cache in origin.
}
@@ -21,6 +22,7 @@ type EventCacheStorageContentUpdated struct {
type EventCacheStorageListUpdated struct {
Origin string `json:"origin"` // Origin to update.
StorageKey string `json:"storageKey"` // Storage key to update.
+ BucketID string `json:"bucketId"` // Storage bucket to update.
}
// EventIndexedDBContentUpdated the origin's IndexedDB object store has been
@@ -30,6 +32,7 @@ type EventCacheStorageListUpdated struct {
type EventIndexedDBContentUpdated struct {
Origin string `json:"origin"` // Origin to update.
StorageKey string `json:"storageKey"` // Storage key to update.
+ BucketID string `json:"bucketId"` // Storage bucket to update.
DatabaseName string `json:"databaseName"` // Database to update.
ObjectStoreName string `json:"objectStoreName"` // ObjectStore to update.
}
@@ -41,6 +44,7 @@ type EventIndexedDBContentUpdated struct {
type EventIndexedDBListUpdated struct {
Origin string `json:"origin"` // Origin to update.
StorageKey string `json:"storageKey"` // Storage key to update.
+ BucketID string `json:"bucketId"` // Storage bucket to update.
}
// EventInterestGroupAccessed one of the interest groups was accessed by the
@@ -65,3 +69,26 @@ type EventSharedStorageAccessed struct {
OwnerOrigin string `json:"ownerOrigin"` // Serialized origin for the context that invoked the Shared Storage API.
Params *SharedStorageAccessParams `json:"params"` // The sub-parameters warapped by params are all optional and their presence/absence depends on type.
}
+
+// EventStorageBucketCreatedOrUpdated [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#event-storageBucketCreatedOrUpdated
+type EventStorageBucketCreatedOrUpdated struct {
+ BucketInfo *BucketInfo `json:"bucketInfo"`
+}
+
+// EventStorageBucketDeleted [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#event-storageBucketDeleted
+type EventStorageBucketDeleted struct {
+ BucketID string `json:"bucketId"`
+}
+
+// EventAttributionReportingSourceRegistered tODO(crbug.com/1458532): Add
+// other Attribution Reporting events, e.g. trigger registration.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#event-attributionReportingSourceRegistered
+type EventAttributionReportingSourceRegistered struct {
+ Registration *AttributionReportingSourceRegistration `json:"registration"`
+ Result AttributionReportingSourceRegistrationResult `json:"result"`
+}
diff --git a/storage/storage.go b/storage/storage.go
index 3281ce2..51e9047 100644
--- a/storage/storage.go
+++ b/storage/storage.go
@@ -850,33 +850,172 @@ func (p *SetSharedStorageTrackingParams) Do(ctx context.Context) (err error) {
return cdp.Execute(ctx, CommandSetSharedStorageTracking, p, nil)
}
+// SetStorageBucketTrackingParams set tracking for a storage key's buckets.
+type SetStorageBucketTrackingParams struct {
+ StorageKey string `json:"storageKey"`
+ Enable bool `json:"enable"`
+}
+
+// SetStorageBucketTracking set tracking for a storage key's buckets.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#method-setStorageBucketTracking
+//
+// parameters:
+//
+// storageKey
+// enable
+func SetStorageBucketTracking(storageKey string, enable bool) *SetStorageBucketTrackingParams {
+ return &SetStorageBucketTrackingParams{
+ StorageKey: storageKey,
+ Enable: enable,
+ }
+}
+
+// Do executes Storage.setStorageBucketTracking against the provided context.
+func (p *SetStorageBucketTrackingParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandSetStorageBucketTracking, p, nil)
+}
+
+// DeleteStorageBucketParams deletes the Storage Bucket with the given
+// storage key and bucket name.
+type DeleteStorageBucketParams struct {
+ Bucket *Bucket `json:"bucket"`
+}
+
+// DeleteStorageBucket deletes the Storage Bucket with the given storage key
+// and bucket name.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#method-deleteStorageBucket
+//
+// parameters:
+//
+// bucket
+func DeleteStorageBucket(bucket *Bucket) *DeleteStorageBucketParams {
+ return &DeleteStorageBucketParams{
+ Bucket: bucket,
+ }
+}
+
+// Do executes Storage.deleteStorageBucket against the provided context.
+func (p *DeleteStorageBucketParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandDeleteStorageBucket, p, nil)
+}
+
+// RunBounceTrackingMitigationsParams deletes state for sites identified as
+// potential bounce trackers, immediately.
+type RunBounceTrackingMitigationsParams struct{}
+
+// RunBounceTrackingMitigations deletes state for sites identified as
+// potential bounce trackers, immediately.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#method-runBounceTrackingMitigations
+func RunBounceTrackingMitigations() *RunBounceTrackingMitigationsParams {
+ return &RunBounceTrackingMitigationsParams{}
+}
+
+// RunBounceTrackingMitigationsReturns return values.
+type RunBounceTrackingMitigationsReturns struct {
+ DeletedSites []string `json:"deletedSites,omitempty"`
+}
+
+// Do executes Storage.runBounceTrackingMitigations against the provided context.
+//
+// returns:
+//
+// deletedSites
+func (p *RunBounceTrackingMitigationsParams) Do(ctx context.Context) (deletedSites []string, err error) {
+ // execute
+ var res RunBounceTrackingMitigationsReturns
+ err = cdp.Execute(ctx, CommandRunBounceTrackingMitigations, nil, &res)
+ if err != nil {
+ return nil, err
+ }
+
+ return res.DeletedSites, nil
+}
+
+// SetAttributionReportingLocalTestingModeParams
+// https://wicg.github.io/attribution-reporting-api/.
+type SetAttributionReportingLocalTestingModeParams struct {
+ Enabled bool `json:"enabled"` // If enabled, noise is suppressed and reports are sent immediately.
+}
+
+// SetAttributionReportingLocalTestingMode
+// https://wicg.github.io/attribution-reporting-api/.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#method-setAttributionReportingLocalTestingMode
+//
+// parameters:
+//
+// enabled - If enabled, noise is suppressed and reports are sent immediately.
+func SetAttributionReportingLocalTestingMode(enabled bool) *SetAttributionReportingLocalTestingModeParams {
+ return &SetAttributionReportingLocalTestingModeParams{
+ Enabled: enabled,
+ }
+}
+
+// Do executes Storage.setAttributionReportingLocalTestingMode against the provided context.
+func (p *SetAttributionReportingLocalTestingModeParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandSetAttributionReportingLocalTestingMode, p, nil)
+}
+
+// SetAttributionReportingTrackingParams enables/disables issuing of
+// Attribution Reporting events.
+type SetAttributionReportingTrackingParams struct {
+ Enable bool `json:"enable"`
+}
+
+// SetAttributionReportingTracking enables/disables issuing of Attribution
+// Reporting events.
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#method-setAttributionReportingTracking
+//
+// parameters:
+//
+// enable
+func SetAttributionReportingTracking(enable bool) *SetAttributionReportingTrackingParams {
+ return &SetAttributionReportingTrackingParams{
+ Enable: enable,
+ }
+}
+
+// Do executes Storage.setAttributionReportingTracking against the provided context.
+func (p *SetAttributionReportingTrackingParams) Do(ctx context.Context) (err error) {
+ return cdp.Execute(ctx, CommandSetAttributionReportingTracking, p, nil)
+}
+
// Command names.
const (
- CommandGetStorageKeyForFrame = "Storage.getStorageKeyForFrame"
- CommandClearDataForOrigin = "Storage.clearDataForOrigin"
- CommandClearDataForStorageKey = "Storage.clearDataForStorageKey"
- CommandGetCookies = "Storage.getCookies"
- CommandSetCookies = "Storage.setCookies"
- CommandClearCookies = "Storage.clearCookies"
- CommandGetUsageAndQuota = "Storage.getUsageAndQuota"
- CommandOverrideQuotaForOrigin = "Storage.overrideQuotaForOrigin"
- CommandTrackCacheStorageForOrigin = "Storage.trackCacheStorageForOrigin"
- CommandTrackCacheStorageForStorageKey = "Storage.trackCacheStorageForStorageKey"
- CommandTrackIndexedDBForOrigin = "Storage.trackIndexedDBForOrigin"
- CommandTrackIndexedDBForStorageKey = "Storage.trackIndexedDBForStorageKey"
- CommandUntrackCacheStorageForOrigin = "Storage.untrackCacheStorageForOrigin"
- CommandUntrackCacheStorageForStorageKey = "Storage.untrackCacheStorageForStorageKey"
- CommandUntrackIndexedDBForOrigin = "Storage.untrackIndexedDBForOrigin"
- CommandUntrackIndexedDBForStorageKey = "Storage.untrackIndexedDBForStorageKey"
- CommandGetTrustTokens = "Storage.getTrustTokens"
- CommandClearTrustTokens = "Storage.clearTrustTokens"
- CommandGetInterestGroupDetails = "Storage.getInterestGroupDetails"
- CommandSetInterestGroupTracking = "Storage.setInterestGroupTracking"
- CommandGetSharedStorageMetadata = "Storage.getSharedStorageMetadata"
- CommandGetSharedStorageEntries = "Storage.getSharedStorageEntries"
- CommandSetSharedStorageEntry = "Storage.setSharedStorageEntry"
- CommandDeleteSharedStorageEntry = "Storage.deleteSharedStorageEntry"
- CommandClearSharedStorageEntries = "Storage.clearSharedStorageEntries"
- CommandResetSharedStorageBudget = "Storage.resetSharedStorageBudget"
- CommandSetSharedStorageTracking = "Storage.setSharedStorageTracking"
+ CommandGetStorageKeyForFrame = "Storage.getStorageKeyForFrame"
+ CommandClearDataForOrigin = "Storage.clearDataForOrigin"
+ CommandClearDataForStorageKey = "Storage.clearDataForStorageKey"
+ CommandGetCookies = "Storage.getCookies"
+ CommandSetCookies = "Storage.setCookies"
+ CommandClearCookies = "Storage.clearCookies"
+ CommandGetUsageAndQuota = "Storage.getUsageAndQuota"
+ CommandOverrideQuotaForOrigin = "Storage.overrideQuotaForOrigin"
+ CommandTrackCacheStorageForOrigin = "Storage.trackCacheStorageForOrigin"
+ CommandTrackCacheStorageForStorageKey = "Storage.trackCacheStorageForStorageKey"
+ CommandTrackIndexedDBForOrigin = "Storage.trackIndexedDBForOrigin"
+ CommandTrackIndexedDBForStorageKey = "Storage.trackIndexedDBForStorageKey"
+ CommandUntrackCacheStorageForOrigin = "Storage.untrackCacheStorageForOrigin"
+ CommandUntrackCacheStorageForStorageKey = "Storage.untrackCacheStorageForStorageKey"
+ CommandUntrackIndexedDBForOrigin = "Storage.untrackIndexedDBForOrigin"
+ CommandUntrackIndexedDBForStorageKey = "Storage.untrackIndexedDBForStorageKey"
+ CommandGetTrustTokens = "Storage.getTrustTokens"
+ CommandClearTrustTokens = "Storage.clearTrustTokens"
+ CommandGetInterestGroupDetails = "Storage.getInterestGroupDetails"
+ CommandSetInterestGroupTracking = "Storage.setInterestGroupTracking"
+ CommandGetSharedStorageMetadata = "Storage.getSharedStorageMetadata"
+ CommandGetSharedStorageEntries = "Storage.getSharedStorageEntries"
+ CommandSetSharedStorageEntry = "Storage.setSharedStorageEntry"
+ CommandDeleteSharedStorageEntry = "Storage.deleteSharedStorageEntry"
+ CommandClearSharedStorageEntries = "Storage.clearSharedStorageEntries"
+ CommandResetSharedStorageBudget = "Storage.resetSharedStorageBudget"
+ CommandSetSharedStorageTracking = "Storage.setSharedStorageTracking"
+ CommandSetStorageBucketTracking = "Storage.setStorageBucketTracking"
+ CommandDeleteStorageBucket = "Storage.deleteStorageBucket"
+ CommandRunBounceTrackingMitigations = "Storage.runBounceTrackingMitigations"
+ CommandSetAttributionReportingLocalTestingMode = "Storage.setAttributionReportingLocalTestingMode"
+ CommandSetAttributionReportingTracking = "Storage.setAttributionReportingTracking"
)
diff --git a/storage/types.go b/storage/types.go
index b6e070a..126b63f 100644
--- a/storage/types.go
+++ b/storage/types.go
@@ -44,6 +44,7 @@ const (
TypeCacheStorage Type = "cache_storage"
TypeInterestGroups Type = "interest_groups"
TypeSharedStorage Type = "shared_storage"
+ TypeStorageBuckets Type = "storage_buckets"
TypeAll Type = "all"
TypeOther Type = "other"
)
@@ -84,6 +85,8 @@ func (t *Type) UnmarshalEasyJSON(in *jlexer.Lexer) {
*t = TypeInterestGroups
case TypeSharedStorage:
*t = TypeSharedStorage
+ case TypeStorageBuckets:
+ *t = TypeStorageBuckets
case TypeAll:
*t = TypeAll
case TypeOther:
@@ -335,3 +338,253 @@ type SharedStorageAccessParams struct {
Value string `json:"value,omitempty"` // Value for a specific entry in an origin's shared storage. Present only for SharedStorageAccessType.documentSet, SharedStorageAccessType.documentAppend, SharedStorageAccessType.workletSet, and SharedStorageAccessType.workletAppend.
IgnoreIfPresent bool `json:"ignoreIfPresent,omitempty"` // Whether or not to set an entry for a key if that key is already present. Present only for SharedStorageAccessType.documentSet and SharedStorageAccessType.workletSet.
}
+
+// BucketsDurability [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#type-StorageBucketsDurability
+type BucketsDurability string
+
+// String returns the BucketsDurability as string value.
+func (t BucketsDurability) String() string {
+ return string(t)
+}
+
+// BucketsDurability values.
+const (
+ BucketsDurabilityRelaxed BucketsDurability = "relaxed"
+ BucketsDurabilityStrict BucketsDurability = "strict"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t BucketsDurability) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t BucketsDurability) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *BucketsDurability) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch BucketsDurability(v) {
+ case BucketsDurabilityRelaxed:
+ *t = BucketsDurabilityRelaxed
+ case BucketsDurabilityStrict:
+ *t = BucketsDurabilityStrict
+
+ default:
+ in.AddError(fmt.Errorf("unknown BucketsDurability value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *BucketsDurability) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
+// Bucket [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#type-StorageBucket
+type Bucket struct {
+ StorageKey SerializedStorageKey `json:"storageKey"`
+ Name string `json:"name,omitempty"` // If not specified, it is the default bucket of the storageKey.
+}
+
+// BucketInfo [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#type-StorageBucketInfo
+type BucketInfo struct {
+ Bucket *Bucket `json:"bucket"`
+ ID string `json:"id"`
+ Expiration *cdp.TimeSinceEpoch `json:"expiration"`
+ Quota float64 `json:"quota"` // Storage quota (bytes).
+ Persistent bool `json:"persistent"`
+ Durability BucketsDurability `json:"durability"`
+}
+
+// AttributionReportingSourceType [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#type-AttributionReportingSourceType
+type AttributionReportingSourceType string
+
+// String returns the AttributionReportingSourceType as string value.
+func (t AttributionReportingSourceType) String() string {
+ return string(t)
+}
+
+// AttributionReportingSourceType values.
+const (
+ AttributionReportingSourceTypeNavigation AttributionReportingSourceType = "navigation"
+ AttributionReportingSourceTypeEvent AttributionReportingSourceType = "event"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t AttributionReportingSourceType) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t AttributionReportingSourceType) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *AttributionReportingSourceType) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch AttributionReportingSourceType(v) {
+ case AttributionReportingSourceTypeNavigation:
+ *t = AttributionReportingSourceTypeNavigation
+ case AttributionReportingSourceTypeEvent:
+ *t = AttributionReportingSourceTypeEvent
+
+ default:
+ in.AddError(fmt.Errorf("unknown AttributionReportingSourceType value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *AttributionReportingSourceType) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
+
+// UnsignedInt64asBase10 [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#type-UnsignedInt64AsBase10
+type UnsignedInt64asBase10 string
+
+// String returns the UnsignedInt64asBase10 as string value.
+func (t UnsignedInt64asBase10) String() string {
+ return string(t)
+}
+
+// UnsignedInt128asBase16 [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#type-UnsignedInt128AsBase16
+type UnsignedInt128asBase16 string
+
+// String returns the UnsignedInt128asBase16 as string value.
+func (t UnsignedInt128asBase16) String() string {
+ return string(t)
+}
+
+// SignedInt64asBase10 [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#type-SignedInt64AsBase10
+type SignedInt64asBase10 string
+
+// String returns the SignedInt64asBase10 as string value.
+func (t SignedInt64asBase10) String() string {
+ return string(t)
+}
+
+// AttributionReportingFilterDataEntry [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#type-AttributionReportingFilterDataEntry
+type AttributionReportingFilterDataEntry struct {
+ Key string `json:"key"`
+ Values []string `json:"values"`
+}
+
+// AttributionReportingAggregationKeysEntry [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#type-AttributionReportingAggregationKeysEntry
+type AttributionReportingAggregationKeysEntry struct {
+ Key string `json:"key"`
+ Value UnsignedInt128asBase16 `json:"value"`
+}
+
+// AttributionReportingSourceRegistration [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#type-AttributionReportingSourceRegistration
+type AttributionReportingSourceRegistration struct {
+ Time *cdp.TimeSinceEpoch `json:"time"`
+ Expiry int64 `json:"expiry,omitempty"` // duration in seconds
+ EventReportWindow int64 `json:"eventReportWindow,omitempty"` // duration in seconds
+ AggregatableReportWindow int64 `json:"aggregatableReportWindow,omitempty"` // duration in seconds
+ Type AttributionReportingSourceType `json:"type"`
+ SourceOrigin string `json:"sourceOrigin"`
+ ReportingOrigin string `json:"reportingOrigin"`
+ DestinationSites []string `json:"destinationSites"`
+ EventID UnsignedInt64asBase10 `json:"eventId"`
+ Priority SignedInt64asBase10 `json:"priority"`
+ FilterData []*AttributionReportingFilterDataEntry `json:"filterData"`
+ AggregationKeys []*AttributionReportingAggregationKeysEntry `json:"aggregationKeys"`
+ DebugKey UnsignedInt64asBase10 `json:"debugKey,omitempty"`
+}
+
+// AttributionReportingSourceRegistrationResult [no description].
+//
+// See: https://chromedevtools.github.io/devtools-protocol/tot/Storage#type-AttributionReportingSourceRegistrationResult
+type AttributionReportingSourceRegistrationResult string
+
+// String returns the AttributionReportingSourceRegistrationResult as string value.
+func (t AttributionReportingSourceRegistrationResult) String() string {
+ return string(t)
+}
+
+// AttributionReportingSourceRegistrationResult values.
+const (
+ AttributionReportingSourceRegistrationResultSuccess AttributionReportingSourceRegistrationResult = "success"
+ AttributionReportingSourceRegistrationResultInternalError AttributionReportingSourceRegistrationResult = "internalError"
+ AttributionReportingSourceRegistrationResultInsufficientSourceCapacity AttributionReportingSourceRegistrationResult = "insufficientSourceCapacity"
+ AttributionReportingSourceRegistrationResultInsufficientUniqueDestinationCapacity AttributionReportingSourceRegistrationResult = "insufficientUniqueDestinationCapacity"
+ AttributionReportingSourceRegistrationResultExcessiveReportingOrigins AttributionReportingSourceRegistrationResult = "excessiveReportingOrigins"
+ AttributionReportingSourceRegistrationResultProhibitedByBrowserPolicy AttributionReportingSourceRegistrationResult = "prohibitedByBrowserPolicy"
+ AttributionReportingSourceRegistrationResultSuccessNoised AttributionReportingSourceRegistrationResult = "successNoised"
+ AttributionReportingSourceRegistrationResultDestinationReportingLimitReached AttributionReportingSourceRegistrationResult = "destinationReportingLimitReached"
+ AttributionReportingSourceRegistrationResultDestinationGlobalLimitReached AttributionReportingSourceRegistrationResult = "destinationGlobalLimitReached"
+ AttributionReportingSourceRegistrationResultDestinationBothLimitsReached AttributionReportingSourceRegistrationResult = "destinationBothLimitsReached"
+ AttributionReportingSourceRegistrationResultReportingOriginsPerSiteLimitReached AttributionReportingSourceRegistrationResult = "reportingOriginsPerSiteLimitReached"
+ AttributionReportingSourceRegistrationResultExceedsMaxChannelCapacity AttributionReportingSourceRegistrationResult = "exceedsMaxChannelCapacity"
+)
+
+// MarshalEasyJSON satisfies easyjson.Marshaler.
+func (t AttributionReportingSourceRegistrationResult) MarshalEasyJSON(out *jwriter.Writer) {
+ out.String(string(t))
+}
+
+// MarshalJSON satisfies json.Marshaler.
+func (t AttributionReportingSourceRegistrationResult) MarshalJSON() ([]byte, error) {
+ return easyjson.Marshal(t)
+}
+
+// UnmarshalEasyJSON satisfies easyjson.Unmarshaler.
+func (t *AttributionReportingSourceRegistrationResult) UnmarshalEasyJSON(in *jlexer.Lexer) {
+ v := in.String()
+ switch AttributionReportingSourceRegistrationResult(v) {
+ case AttributionReportingSourceRegistrationResultSuccess:
+ *t = AttributionReportingSourceRegistrationResultSuccess
+ case AttributionReportingSourceRegistrationResultInternalError:
+ *t = AttributionReportingSourceRegistrationResultInternalError
+ case AttributionReportingSourceRegistrationResultInsufficientSourceCapacity:
+ *t = AttributionReportingSourceRegistrationResultInsufficientSourceCapacity
+ case AttributionReportingSourceRegistrationResultInsufficientUniqueDestinationCapacity:
+ *t = AttributionReportingSourceRegistrationResultInsufficientUniqueDestinationCapacity
+ case AttributionReportingSourceRegistrationResultExcessiveReportingOrigins:
+ *t = AttributionReportingSourceRegistrationResultExcessiveReportingOrigins
+ case AttributionReportingSourceRegistrationResultProhibitedByBrowserPolicy:
+ *t = AttributionReportingSourceRegistrationResultProhibitedByBrowserPolicy
+ case AttributionReportingSourceRegistrationResultSuccessNoised:
+ *t = AttributionReportingSourceRegistrationResultSuccessNoised
+ case AttributionReportingSourceRegistrationResultDestinationReportingLimitReached:
+ *t = AttributionReportingSourceRegistrationResultDestinationReportingLimitReached
+ case AttributionReportingSourceRegistrationResultDestinationGlobalLimitReached:
+ *t = AttributionReportingSourceRegistrationResultDestinationGlobalLimitReached
+ case AttributionReportingSourceRegistrationResultDestinationBothLimitsReached:
+ *t = AttributionReportingSourceRegistrationResultDestinationBothLimitsReached
+ case AttributionReportingSourceRegistrationResultReportingOriginsPerSiteLimitReached:
+ *t = AttributionReportingSourceRegistrationResultReportingOriginsPerSiteLimitReached
+ case AttributionReportingSourceRegistrationResultExceedsMaxChannelCapacity:
+ *t = AttributionReportingSourceRegistrationResultExceedsMaxChannelCapacity
+
+ default:
+ in.AddError(fmt.Errorf("unknown AttributionReportingSourceRegistrationResult value: %v", v))
+ }
+}
+
+// UnmarshalJSON satisfies json.Unmarshaler.
+func (t *AttributionReportingSourceRegistrationResult) UnmarshalJSON(buf []byte) error {
+ return easyjson.Unmarshal(buf, t)
+}
diff --git a/webauthn/easyjson.go b/webauthn/easyjson.go
index ff95cfc..1526e27 100644
--- a/webauthn/easyjson.go
+++ b/webauthn/easyjson.go
@@ -52,6 +52,8 @@ func easyjsonC5a4559bDecodeGithubComChromedpCdprotoWebauthn(in *jlexer.Lexer, ou
out.HasCredBlob = bool(in.Bool())
case "hasMinPinLength":
out.HasMinPinLength = bool(in.Bool())
+ case "hasPrf":
+ out.HasPrf = bool(in.Bool())
case "automaticPresenceSimulation":
out.AutomaticPresenceSimulation = bool(in.Bool())
case "isUserVerified":
@@ -110,6 +112,11 @@ func easyjsonC5a4559bEncodeGithubComChromedpCdprotoWebauthn(out *jwriter.Writer,
out.RawString(prefix)
out.Bool(bool(in.HasMinPinLength))
}
+ if in.HasPrf {
+ const prefix string = ",\"hasPrf\":"
+ out.RawString(prefix)
+ out.Bool(bool(in.HasPrf))
+ }
if in.AutomaticPresenceSimulation {
const prefix string = ",\"automaticPresenceSimulation\":"
out.RawString(prefix)
diff --git a/webauthn/types.go b/webauthn/types.go
index 4744da2..0a882d6 100644
--- a/webauthn/types.go
+++ b/webauthn/types.go
@@ -176,6 +176,7 @@ type VirtualAuthenticatorOptions struct {
HasLargeBlob bool `json:"hasLargeBlob,omitempty"` // If set to true, the authenticator will support the largeBlob extension. https://w3c.github.io/webauthn#largeBlob Defaults to false.
HasCredBlob bool `json:"hasCredBlob,omitempty"` // If set to true, the authenticator will support the credBlob extension. https://fidoalliance.org/specs/fido-v2.1-rd-20201208/fido-client-to-authenticator-protocol-v2.1-rd-20201208.html#sctn-credBlob-extension Defaults to false.
HasMinPinLength bool `json:"hasMinPinLength,omitempty"` // If set to true, the authenticator will support the minPinLength extension. https://fidoalliance.org/specs/fido-v2.1-ps-20210615/fido-client-to-authenticator-protocol-v2.1-ps-20210615.html#sctn-minpinlength-extension Defaults to false.
+ HasPrf bool `json:"hasPrf,omitempty"` // If set to true, the authenticator will support the prf extension. https://w3c.github.io/webauthn/#prf-extension Defaults to false.
AutomaticPresenceSimulation bool `json:"automaticPresenceSimulation,omitempty"` // If set to true, tests of user presence will succeed immediately. Otherwise, they will not be resolved. Defaults to true.
IsUserVerified bool `json:"isUserVerified,omitempty"` // Sets whether User Verification succeeds or fails for an authenticator. Defaults to false.
}
Debdiff
[The following lists of changes regard files as different if they have different names, permissions or owners.]
Files in second set of .debs but not in first
-rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/autofill/autofill.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/autofill/easyjson.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/autofill/types.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/deviceaccess/deviceaccess.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/deviceaccess/easyjson.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/deviceaccess/events.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/deviceaccess/types.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/fedcm/easyjson.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/fedcm/events.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/fedcm/fedcm.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/fedcm/types.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/preload/easyjson.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/preload/events.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/preload/preload.go -rw-r--r-- root/root /usr/share/gocode/src/github.com/chromedp/cdproto/preload/types.go
No differences were encountered in the control files