text changes
Eduard Kalinowski
11 years ago
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | bg |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Илия Линдов [ilia@infomat-bg.com]\r\n | |
| 7 | Илия Линдов [ilia@infomat-bg.com]\n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Съвпадащите препратки ще бъдат включени |
| 78 | 78 | Example: |
| 79 | 79 | Пример: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nЩе съвпаднат всички .GIF файлове | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nЩе намери всички файлове със съвпадащ 'blue' подниз като 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nЩе съвпадне с файл 'bigfile.mov', но не и с 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nЩе намери препратки към директории със съвпадащ подниз 'cgi' като /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nЩе намери препратки към директории съвпадащи с целия низ 'cgi-bin', но не и с cgi-bin-2, например | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nЩе намери препратки със съвпадащ подниз като www.someweb.com, private.someweb.com и т.н. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb.com\r\nЩе намери препратки към директории със съвпадащ подниз като www.someweb.com, www.someweb.edu, private.someweb.otherweb.com и т.н. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nЩе намери препратки съвпадащи с целия подниз 'www.someweb.com', но не и с препратки като private.someweb.com/ | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nЩе намери всякакви препратки съвпадащи с подниз като www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html и т.н. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nЩе намери само файла 'www.test.com/test/someweb.html'. Отбележете, че трябва да напишете пълния път (URL + пътя в самия сайт) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nЩе съвпаднат всички .GIF файлове | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nЩе намери всички файлове със съвпадащ 'blue' подниз като 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nЩе съвпадне с файл 'bigfile.mov', но не и с 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nЩе намери препратки към директории със съвпадащ подниз 'cgi' като /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nЩе намери препратки към директории съвпадащи с целия низ 'cgi-bin', но не и с cgi-bin-2, например | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nЩе намери препратки със съвпадащ подниз като www.someweb.com, private.someweb.com и т.н. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb.com\nЩе намери препратки към директории със съвпадащ подниз като www.someweb.com, www.someweb.edu, private.someweb.otherweb.com и т.н. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nЩе намери препратки съвпадащи с целия подниз 'www.someweb.com', но не и с препратки като private.someweb.com/ | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nЩе намери всякакви препратки съвпадащи с подниз като www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html и т.н. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nЩе намери само файла 'www.test.com/test/someweb.html'. Отбележете, че трябва да напишете пълния път (URL + пътя в самия сайт) | |
| 100 | 100 | All links will match |
| 101 | 101 | Всички препратки ще съвпаднат |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | \nВиж log-файла ако е необходимо.\n\nКликни КРАЙ за изход от HTTraQt Website Copier.\n\nБлагодарим, Ви, че използвате HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Създаването на огледалния сайт завърши!\nКликни Изход за затваряне на HTTraQt.\nВижте log-файловете да са се уверите, че всичко е наред.\n\nБлагодарим, Ви, че използвате HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * КОПИРАНЕТО ПРЕКЪСНАТО! * *\r\nТекущият временен кеш е необходим за всякакви обновления и съдържа само данни свалени по време на тази прекъсната сесия.\r\nВъзможно е предшестващият кеш да съдържа по-пълна информация; ако не желаете за загубите тази информация, трябва да я възстановите и изтриете текущия кеш.\r\n[Забележка: Това може да бъде постигнато лесно чрез изтриване на hts-cache/new.* файловете]\r\n\r\nПредполагате ли, че предшестващия кеш съдържа по пълна информация и желаете ли да я възстановите? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ГРЕШКА ПРИ КОПИРАНЕТО! * *\r\nТекущият сайт е празен.Ако действието е било обновление, то предходното огледално копие е възстановено.\r\nПричина: първата страница(и) или не бе открита, или е възникнал проблем с връзката.\r\n=>Уверете се, че този сайт все още съществува и/или проверете Вашите proxy настройки! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * КОПИРАНЕТО ПРЕКЪСНАТО! * *\nТекущият временен кеш е необходим за всякакви обновления и съдържа само данни свалени по време на тази прекъсната сесия.\nВъзможно е предшестващият кеш да съдържа по-пълна информация; ако не желаете за загубите тази информация, трябва да я възстановите и изтриете текущия кеш.\n[Забележка: Това може да бъде постигнато лесно чрез изтриване на hts-cache/new.* файловете]\n\nПредполагате ли, че предшестващия кеш съдържа по пълна информация и желаете ли да я възстановите? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ГРЕШКА ПРИ КОПИРАНЕТО! * *\nТекущият сайт е празен.Ако действието е било обновление, то предходното огледално копие е възстановено.\nПричина: първата страница(и) или не бе открита, или е възникнал проблем с връзката.\n=>Уверете се, че този сайт все още съществува и/или проверете Вашите proxy настройки! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \n\nСъвет: Кликни [Виж log-файл] за предупредителните съобщения или съобщенията за грешки |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Прекрати връзката след края на операцията |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | След края на операцията разкачи модема |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Моля уведомете ни за всяка грешка или проблем)\r\n\r\nРазработка:\r\nИнтерфейс (Windows): Xavier Roche\r\nПаяк: Xavier Roche\r\nJava Разборни Класове: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche и други сътрудници\r\nМНОГО БЛАГОДАРНОСТИ за Българският превод на:\r\nИлия Линдов (ilia@infomat-bg.com) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Моля уведомете ни за всяка грешка или проблем)\n\nРазработка:\nИнтерфейс (Windows): Xavier Roche\nПаяк: Xavier Roche\nJava Разборни Класове: Yann Philippot\n\n(C)1998-2003 Xavier Roche и други сътрудници\nМНОГО БЛАГОДАРНОСТИ за Българският превод на:\nИлия Линдов (ilia@infomat-bg.com) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | За HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Прегледай сайт... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Структура определена от потребителя |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tИме на файл без разширение (напр.: image)\r\n%N\tИме на файл с разширение (напр.: image.gif)\r\n%t\tСамо тип на файл(разширение)(напр.: gif)\r\n%p\tПът [без '/' накрая](напр.: /someimages)\r\n%h\tИме на хост (напр.: www.someweb.com)\r\n%M\tMD5 URL (128 бита, 32 ascii бита)\r\n%Q\tMD5 въпросителен низ (128 бита, 32 ascii бита)\r\n%q\tMD5 малък въпросителен низ (16 бита, 4 ascii бита)\r\n\r\n%s?\tКъсо име (напр.: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tИме на файл без разширение (напр.: image)\n%N\tИме на файл с разширение (напр.: image.gif)\n%t\tСамо тип на файл(разширение)(напр.: gif)\n%p\tПът [без '/' накрая](напр.: /someimages)\n%h\tИме на хост (напр.: www.someweb.com)\n%M\tMD5 URL (128 бита, 32 ascii бита)\n%Q\tMD5 въпросителен низ (128 бита, 32 ascii бита)\n%q\tMD5 малък въпросителен низ (16 бита, 4 ascii бита)\n\n%s?\tКъсо име (напр.: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Пример:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | Категория на проекта |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Моите Интернет Страници |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Задайте име на нов проект, \r\nили изберете съществуващ проект за обновление/продължение | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Задайте име на нов проект, \nили изберете съществуващ проект за обновление/продължение | |
| 796 | 796 | New project |
| 797 | 797 | Нов проект |
| 798 | 798 | Insert URL |
| 853 | 853 | Недостатъчно памет, фатална вътрешна грешка... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Неизвестна операция! |
| 856 | Add this URL?\r\n | |
| 857 | Добави този URL адрес?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Добави този URL адрес?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Предупреждение: Основният процес все още не отговаря. Не могат да бъдат добавяни URL адреси... |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | es |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Juan Pablo Barrio Lera (Universidad de León) \r\n | |
| 7 | Juan Pablo Barrio Lera (Universidad de León) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Los lugares que sigan esta regla serán aceptados |
| 78 | 78 | Example: |
| 79 | 79 | Ejemplo: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nDetectará todos los ficheros gif (o ficheros GIF) | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nDetectará todos los ficheros que contengan la palabra blue, como 'bluesky-small.jpeg'\r\n | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nDetectará el fichero 'bigfile.mov', pero no 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nDetectará los enlaces con nombre de ruta que incluya 'cgi', como /cgi-bin/somecgi.cgi\r\n | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nDetectará los enlaces con nombre de ruta que incluya 'cgi-bin' (pero no cgi-bin-2, por ejemplo)\r\n | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nDetectará enlaces como www.someweb.com, private.someweb.com, etc.\r\n | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nDetectará enlaces como www.someweb.com, www.someweb.edu, private.someweb.otherweb.com, etc.\r\n | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nDetectará enlaces como www.someweb.com/... (pero no private.someweb.com/ y similares)\r\n | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nDetectará enlaces como www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html, etc.\r\n | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nDetectará únicamente www.test.com/test/someweb.html. Note que deberá introducir a la vez la dirección (www.xxx.yyy) y la ruta (/test/someweb.html)\r\n | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nDetectará todos los ficheros gif (o ficheros GIF) | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nDetectará todos los ficheros que contengan la palabra blue, como 'bluesky-small.jpeg'\n | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nDetectará el fichero 'bigfile.mov', pero no 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nDetectará los enlaces con nombre de ruta que incluya 'cgi', como /cgi-bin/somecgi.cgi\n | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nDetectará los enlaces con nombre de ruta que incluya 'cgi-bin' (pero no cgi-bin-2, por ejemplo)\n | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nDetectará enlaces como www.someweb.com, private.someweb.com, etc.\n | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nDetectará enlaces como www.someweb.com, www.someweb.edu, private.someweb.otherweb.com, etc.\n | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nDetectará enlaces como www.someweb.com/... (pero no private.someweb.com/ y similares)\n | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nDetectará enlaces como www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html, etc.\n | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nDetectará únicamente www.test.com/test/someweb.html. Note que deberá introducir a la vez la dirección (www.xxx.yyy) y la ruta (/test/someweb.html)\n | |
| 100 | 100 | All links will match |
| 101 | 101 | Todos los enlaces serán autorizados/prohibidos |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | Ver el fichero de auditoría si es necesario.\n\nPulse OK para salir de HTTraQt Website Copier.\n\n¡Gracias por usar HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | El volcado ha finalizado.\nPulse OK para salir de HTTraQt\n\nConsulte los ficheros de auditoría para verificar que todo ha salido bien\n\n¡Gracias por utilizar HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * ¡COPIA INTERRUMPIDA! * *\r\nEs necesario el cache temporal actual para cualquier operación de actualización y solamente contiene datos bajados durante la presente sesión abortada.\r\nEl antiguo cache puede contener datos más completos; si vd. no desea perder dichos datos, deberá que restaurarlo y excluir el cache actual.\r\n[Nota: Esto puede hacerse fácilmente aquí excluyendo el hts-cache/nuevo.* ficheros]\r\n\r\n¿Cree que el antiguo cache puede contener datos más completos, y desea restaurarlo? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ¡ERROR DE VOLCADO! * *\r\nHTTraQt ha detectado que el volcado actual está vacío. Si se trataba de una actualización, el volcado anterior ha sido recuperado.\r\nRazón: no se ha(n) encontrado la(s) primera(s) página(s), o ha habido un problema de conexión.\r\n=> Asegúrese de que el sitio web existe aún, y/o compruebe los ajustes de su proxy! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * ¡COPIA INTERRUMPIDA! * *\nEs necesario el cache temporal actual para cualquier operación de actualización y solamente contiene datos bajados durante la presente sesión abortada.\nEl antiguo cache puede contener datos más completos; si vd. no desea perder dichos datos, deberá que restaurarlo y excluir el cache actual.\n[Nota: Esto puede hacerse fácilmente aquí excluyendo el hts-cache/nuevo.* ficheros]\n\n¿Cree que el antiguo cache puede contener datos más completos, y desea restaurarlo? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ¡ERROR DE VOLCADO! * *\nHTTraQt ha detectado que el volcado actual está vacío. Si se trataba de una actualización, el volcado anterior ha sido recuperado.\nRazón: no se ha(n) encontrado la(s) primera(s) página(s), o ha habido un problema de conexión.\n=> Asegúrese de que el sitio web existe aún, y/o compruebe los ajustes de su proxy! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \n\nConsejo: Pulse [Ver ficheros auditoría] para ver los errores y mensajes |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Desconectar al terminar la operación |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Desconectar el modem al terminar |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(notifíquenos fallos o problemas)\r\n\r\nDesarrollo:\r\nInterface (Windows): Xavier Roche\r\nMotor: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for Spanish translations to:\r\nJuan Pablo Barrio Lera (Universidad de León) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(notifíquenos fallos o problemas)\n\nDesarrollo:\nInterface (Windows): Xavier Roche\nMotor: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for Spanish translations to:\nJuan Pablo Barrio Lera (Universidad de León) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | Acerca de... |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Explorer sites... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Estructura local de ficheros |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNombre de fichero sin ext. (ej: image)\r\n%N\tNombre de fichero con extensión (ej: image.gif)\r\n%t\tExtensión (ex: gif)\r\n%p\tRuta [sin / al final] (ej: /someimages)\r\n%h\tNombre del servidor (ej: www.someweb.com)\r\n%M\tURL MD5 (128 bits, 32 ascii bytes)\r\n%Q\tquery string MD5 (128 bits, 32 ascii bytes)\r\n%q\tsmall query string MD5 (16 bits, 4 ascii bytes)\r\n\r\n%s?\tVersión corta DOS (ej: %sN)\r\n | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNombre de fichero sin ext. (ej: image)\n%N\tNombre de fichero con extensión (ej: image.gif)\n%t\tExtensión (ex: gif)\n%p\tRuta [sin / al final] (ej: /someimages)\n%h\tNombre del servidor (ej: www.someweb.com)\n%M\tURL MD5 (128 bits, 32 ascii bytes)\n%Q\tquery string MD5 (128 bits, 32 ascii bytes)\n%q\tsmall query string MD5 (16 bits, 4 ascii bytes)\n\n%s?\tVersión corta DOS (ej: %sN)\n | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | Ejemplo:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif\r\n | |
| 749 | Ejemplo:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif\n | |
| 750 | 750 | Proxy settings |
| 751 | 751 | Preferencias del proxy |
| 752 | 752 | Proxy address: |
| 791 | 791 | Categoría del proyecto: |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Mis lugares Web |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Escriba el nombre de un nuevo proyecto, \r\no seleccione un proyecto existente para ponerle al día o continuar\r\n\r\n | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Escriba el nombre de un nuevo proyecto, \no seleccione un proyecto existente para ponerle al día o continuar\n\n | |
| 796 | 796 | New project |
| 797 | 797 | Nuevo proyecto |
| 798 | 798 | Insert URL |
| 844 | 844 | Select user-defined structure? |
| 845 | 845 | ¿Seleccionar estructura definible por el usuario? |
| 846 | 846 | Please ensure that the user-defined-string is correct,\notherwise filenames will be bogus! |
| 847 | Asegúrese de que la cadena de usuario es correcta\n¡Si no lo es, los nombres de ficheros serán erróneos!\r\n\r\n | |
| 847 | Asegúrese de que la cadena de usuario es correcta\n¡Si no lo es, los nombres de ficheros serán erróneos!\n\n | |
| 848 | 848 | Do you really want to use a user-defined structure? |
| 849 | 849 | ¿Desea realmente seleccionar la estructura definible por el usuario? |
| 850 | 850 | Too manu URLs, cannot handle so many links!! |
| 853 | 853 | Memoria insuficiente; error interno crítico. |
| 854 | 854 | Unknown operation! |
| 855 | 855 | ¡Operación desconocida! |
| 856 | Add this URL?\r\n | |
| 857 | ¿Añadir esta URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | ¿Añadir esta URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Aviso: el proceso principal no responde aún; imposible añadir las URLs. |
| 860 | 860 | Type/MIME associations |
| 77 | 77 | Shodné odkazy budou zahrnuty: |
| 78 | 78 | Example: |
| 79 | 79 | Příklad: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nZahrne všechny GIF soubory | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | modrá\r\nZahrne všechny soubory obsahující slova 'modrá', např. 'modrá-obloha.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nZahrne soubor 'bigfile.mov', ale již ne 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nNajde odkazy s názvem adresáře obsahující řetězec 'cgi' jako třeba /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nNajde odkazy s názvem adresáře obsahující celý 'cgi-bin' řetězec (ale již ne cgi-bin-2) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nNajde odkazy obsahující řetězce www.someweb.com, private.someweb.com apod. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nNajde odkazy shodné s názvem adresáře obsahující řetězce www.someweb.com, www.someweb.edu, private.someweb.otherweb.com apod. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nNajde odkazy obsahující celý 'www.someweb.com' řetězec (ale ne řetězce jako private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nNajde jakékoliv odkazy obsahující řetězec jako www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html apod. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nNajde pouze soubor 'www.test.com/test/someweb.html'. Nezapomeň, že musíš zadat celou cestu (URL + cesta ke stránce) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nZahrne všechny GIF soubory | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | modrá\nZahrne všechny soubory obsahující slova 'modrá', např. 'modrá-obloha.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nZahrne soubor 'bigfile.mov', ale již ne 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nNajde odkazy s názvem adresáře obsahující řetězec 'cgi' jako třeba /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nNajde odkazy s názvem adresáře obsahující celý 'cgi-bin' řetězec (ale již ne cgi-bin-2) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nNajde odkazy obsahující řetězce www.someweb.com, private.someweb.com apod. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nNajde odkazy shodné s názvem adresáře obsahující řetězce www.someweb.com, www.someweb.edu, private.someweb.otherweb.com apod. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nNajde odkazy obsahující celý 'www.someweb.com' řetězec (ale ne řetězce jako private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nNajde jakékoliv odkazy obsahující řetězec jako www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html apod. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nNajde pouze soubor 'www.test.com/test/someweb.html'. Nezapomeň, že musíš zadat celou cestu (URL + cesta ke stránce) | |
| 100 | 100 | All links will match |
| 101 | 101 | Všechny odkazy se budou shodovat |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | \nZobraz protokol.\n\nKlikni na Ukončit pro ukončení programu HTTraQt Website Copier.\n\nDíky za použití programu HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Stahování skončeno.\nKlikni na Konec pro ukončení programu HTTraQt.\nZobraz si protokoly pro kontrolu chyb při stahování.\n\nDíky za použití programu HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * STAHOVÁNÍ ZRUŠENO! * *\r\nPro pokračování stahování je zapotřebí lokální cache, obsahující stažená data.\r\nPředchozí cache může obsahovat více informací. Pokud je nechceš ztratit, musíš ji obnovit a smazat aktuální cache.\r\n[Poznámka: To může být provedeno teď smazáním hts-cache/new.* souborů]\r\n\r\nMyslíš, že cache obsahuje více informací a přeješ si ji obnovit? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * CHYBA PŘI STAHOVÁNÍ! * *\r\nHTTraQt zjistil, že se nestáhla žádná data. Pokud se jednalo o aktualizaci, pak předešlá data byla obnovena.\r\nDůvod: Nemohla být nalezena první stránka nebo se vyskytl problém se spojením.\r\n=>Prověř zda zadaná adresa existuje anebo zkontroluj nastavení proxy! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * STAHOVÁNÍ ZRUŠENO! * *\nPro pokračování stahování je zapotřebí lokální cache, obsahující stažená data.\nPředchozí cache může obsahovat více informací. Pokud je nechceš ztratit, musíš ji obnovit a smazat aktuální cache.\n[Poznámka: To může být provedeno teď smazáním hts-cache/new.* souborů]\n\nMyslíš, že cache obsahuje více informací a přeješ si ji obnovit? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * CHYBA PŘI STAHOVÁNÍ! * *\nHTTraQt zjistil, že se nestáhla žádná data. Pokud se jednalo o aktualizaci, pak předešlá data byla obnovena.\nDůvod: Nemohla být nalezena první stránka nebo se vyskytl problém se spojením.\n=>Prověř zda zadaná adresa existuje anebo zkontroluj nastavení proxy! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \n\nTip: Klikni [Zobraz protokoly] pro zobrazení upozornění a chyb |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Odpojit po dokončení |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Odpojit modem po dokončení |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Prosíme o podání hlášení o jakýchkoliv chybách)\r\n\r\nVývoj:\r\nRozhraní (Windows): Xavier Roche\r\nPavouk: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche a ostatní, kdo přispěli\r\nČeský překlad:\r\nAntonín Matějčík (matejcik@volny.cz) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Prosíme o podání hlášení o jakýchkoliv chybách)\n\nVývoj:\nRozhraní (Windows): Xavier Roche\nPavouk: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche a ostatní, kdo přispěli\nČeský překlad:\nAntonín Matějčík (matejcik@volny.cz) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | O programu HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Prohlídnout stažené stránky.. |
| 744 | 744 | User-defined structure |
| 745 | 745 | Uživatelsky-definovaná struktura |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNázev souboru bez přípony (např. obr)\r\n%N\tNázev souboru včetně přípony (např. obr.gif)\r\n%t\tPouze přípona (např. gif)\r\n%p\tCesta [bez posledního /] (např. /obrázky)\r\n%h\tWeb adresa (např. www.kdesi.com)\r\n%M\tMD5 URL (128 bitů, 32 ascii bajtů)\r\n%Q\tMD5 ověřovací řetězec (128 bitů, 32 ascii bajtů)\r\n%q\tMD5 malý ověřovací řetězec (16 bitů, 4 ascii bajtů)\r\n\r\n%s?\tZkratka (např. %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNázev souboru bez přípony (např. obr)\n%N\tNázev souboru včetně přípony (např. obr.gif)\n%t\tPouze přípona (např. gif)\n%p\tCesta [bez posledního /] (např. /obrázky)\n%h\tWeb adresa (např. www.kdesi.com)\n%M\tMD5 URL (128 bitů, 32 ascii bajtů)\n%Q\tMD5 ověřovací řetězec (128 bitů, 32 ascii bajtů)\n%q\tMD5 malý ověřovací řetězec (16 bitů, 4 ascii bajtů)\n\n%s?\tZkratka (např. %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Příklad:\t%h%p/%n%q.%t\n->\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Temp\Projekty |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Napiš nový název projektu, \r\nnebo vyber projekt k aktualizaci | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Napiš nový název projektu, \nnebo vyber projekt k aktualizaci | |
| 796 | 796 | New project |
| 797 | 797 | Nový projekt |
| 798 | 798 | Insert URL |
| 853 | 853 | Nedostatek paměti, vážná vnitřní chyba.. |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Neznámá operace! |
| 856 | Add this URL?\r\n | |
| 857 | Přidat tuto URL adresu?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Přidat tuto URL adresu?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Upozornění: hlavní proces ještě nereaguje, nemožné přidat URL adresu(y).. |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | ct |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | David Hing Cheong Hung (DAVEHUNG@mtr.com.hk)\r\n | |
| 7 | David Hing Cheong Hung (DAVEHUNG@mtr.com.hk)\n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 72 | 72 | ?��??��?結�?被�??? |
| 73 | 73 | Example: |
| 74 | 74 | 例�?: |
| 75 | gif\r\nWill match all GIF files | |
| 76 | gif\r\n將匹?��??�GIF檔�? | |
| 77 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 78 | blue\r\n將�??�到???��???blue' ?��?��? 諸�? 'bluesky-small.jpeg' | |
| 79 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 80 | bigfile.mov\r\n將匹?��?��?'bigfile.mov', 但�??�括 'bigfile2.mov' | |
| 81 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 82 | cgi\r\n將�??�到檔�?夾�??��???cgi' ?��?��? 諸�? /cgi-bin/somecgi.cgi | |
| 83 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 84 | cgi-bin\r\n將�??�到檔�?夾�??��???cgi-bin' ?��?��?(但cgi-bin-2 ?��?) | |
| 85 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 86 | someweb.com\r\n將�??�到?�含諸�?www.someweb.com, private.someweb.com 等�??��? | |
| 87 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 88 | someweb\r\n將�??�到?�含諸�?www.someweb.com, www.someweb.edu, private.someweb.otherweb.com 等�??��? | |
| 89 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 90 | www.someweb.com\r\n將�??�到?�含'www.someweb.com' ?��?��?(但�??�括private.someweb.com/ ��? | |
| 91 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 92 | someweb\r\n將�??�到任�?諸�?以�??��?��? www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html ��?www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 93 | www.test.com/test/someweb.html\r\n將�?尋找??www.test.com/test/someweb.html' 檔�?. 注�?請輸?��??��?路�?. | |
| 75 | gif\nWill match all GIF files | |
| 76 | gif\n將匹?��??�GIF檔�? | |
| 77 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 78 | blue\n將�??�到???��???blue' ?��?��? 諸�? 'bluesky-small.jpeg' | |
| 79 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 80 | bigfile.mov\n將匹?��?��?'bigfile.mov', 但�??�括 'bigfile2.mov' | |
| 81 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 82 | cgi\n將�??�到檔�?夾�??��???cgi' ?��?��? 諸�? /cgi-bin/somecgi.cgi | |
| 83 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 84 | cgi-bin\n將�??�到檔�?夾�??��???cgi-bin' ?��?��?(但cgi-bin-2 ?��?) | |
| 85 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 86 | someweb.com\n將�??�到?�含諸�?www.someweb.com, private.someweb.com 等�??��? | |
| 87 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 88 | someweb\n將�??�到?�含諸�?www.someweb.com, www.someweb.edu, private.someweb.otherweb.com 等�??��? | |
| 89 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 90 | www.someweb.com\n將�??�到?�含'www.someweb.com' ?��?��?(但�??�括private.someweb.com/ ��? | |
| 91 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 92 | someweb\n將�??�到任�?諸�?以�??��?��? www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html ��?www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 93 | www.test.com/test/someweb.html\n將�?尋找??www.test.com/test/someweb.html' 檔�?. 注�?請輸?��??��?路�?. | |
| 94 | 94 | All links will match |
| 95 | 95 | ???��??��??��??��? |
| 96 | 96 | Add exclusion filter |
| 187 | 187 | \n如�???要�??�日誌�?��?\n\n點�?'結�?'以離?�HTTraQt Website Copier.\n\n謝�?使用HTTraQt! |
| 188 | 188 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 189 | 189 | ?��?完�?.\n點�?'確�?'以離?�HTTraQt.\n如�???要�??�日誌�?��? 以確保萬?��?��?\n\n謝�?使用HTTraQt! |
| 190 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 191 | * * ?��?被�?��? * *\r\n?��??��??��?存�??�日後更?��???, ?��??�此次被中斷?�鏡?��??�內下�??�數??\r\n?��??��?存�??�能?��??�更完整?�內��? 如�?佔U??�失?��??��??��?, 請恢復�?, 并刪?�當?��?存�?.\r\n[��? 欲刪?�當?��?存�?, ?��??�除以�?檔�?: hts-cache/new.*]\r\n\r\n你是?�肯定�??��?存�?存�??��??��??�容, 并�??�恢復�?? | |
| 192 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 193 | * * ?��??�錯!* *\r\nHTTraQt檢測?�當?�鏡?�未?��?任�??��?. ?�使?��??�新模�?, ?��?��?次鏡?�已被恢��?\r\n?��?: 首�??�能?�到, ?�發?��????�誤.\r\n=> 請確定欲?��??�網站�??? ��??�檢?�proxy設�?! <= | |
| 190 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 191 | * * ?��?被�?��? * *\n?��??��??��?存�??�日後更?��???, ?��??�此次被中斷?�鏡?��??�內下�??�數??\n?��??��?存�??�能?��??�更完整?�內��? 如�?佔U??�失?��??��??��?, 請恢復�?, 并刪?�當?��?存�?.\n[��? 欲刪?�當?��?存�?, ?��??�除以�?檔�?: hts-cache/new.*]\n\n你是?�肯定�??��?存�?存�??��??��??�容, 并�??�恢復�?? | |
| 192 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 193 | * * ?��??�錯!* *\nHTTraQt檢測?�當?�鏡?�未?��?任�??��?. ?�使?��??�新模�?, ?��?��?次鏡?�已被恢��?\n?��?: 首�??�能?�到, ?�發?��????�誤.\n=> 請確定欲?��??�網站�??? ��??�檢?�proxy設�?! <= | |
| 194 | 194 | \n\nTip: Click [View log file] to see warning or error messages |
| 195 | 195 | \n\n?�示: 點�? [?��??��?檔�?] 以查?�警?��??�誤消息 |
| 196 | 196 | Error deleting a hts-cache/new.* file, please do it manually |
| 571 | 571 | 完�??��??��??? |
| 572 | 572 | Disconnect modem on completion |
| 573 | 573 | 完�??��??�數?��? |
| 574 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 575 | \r\n(?�任何�?序錯誤�??��?請聯絡�???\r\n\r\n?�發:\r\n?�面設�? (Windows): Xavier Roche\r\n?��?引�?: Xavier Roche\r\nJava?��?引�?: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\n?��?:\r\nDavid Hing Cheong Hung (DAVEHUNG@mtr.com.hk) ?��?翻譯 | |
| 574 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 575 | \n(?�任何�?序錯誤�??��?請聯絡�???\n\n?�發:\n?�面設�? (Windows): Xavier Roche\n?��?引�?: Xavier Roche\nJava?��?引�?: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\n?��?:\nDavid Hing Cheong Hung (DAVEHUNG@mtr.com.hk) ?��?翻譯 | |
| 576 | 576 | About HTTraQt Website Copier |
| 577 | 577 | ?�於HTTraQt Website Copier |
| 578 | 578 | Please visit our Web page |
| 673 | 673 | &Browse sites... |
| 674 | 674 | &?�覽已鏡?��?��?.. |
| 675 | 675 | User-defined structure |
| 676 | 使用?�自定�?��?%n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 677 | %n\t不含?��??��?檔�???��? image)\r\n%N\t?��??��??��?檔�???��? image.gif)\r\n%t\t?�擴展�?(��? gif)\r\n%p\t路�?[?�尾??/'] (��? /someimages)\r\n%h\t主�???��? www.someweb.com)\r\n%M\tMD5 URL (128��? 32 ascii byts)\r\n%Q\tMD5 query string (128��? 32 ascii byts)\r\n%q\tMD5 small query string (16��? 4 ascii byts)\r\n\r\n%s?\t?��?案�?(��? %sN) | |
| 676 | 使用?�自定�?��?%n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 677 | %n\t不含?��??��?檔�???��? image)\n%N\t?��??��??��?檔�???��? image.gif)\n%t\t?�擴展�?(��? gif)\n%p\t路�?[?�尾??/'] (��? /someimages)\n%h\t主�???��? www.someweb.com)\n%M\tMD5 URL (128��? 32 ascii byts)\n%Q\tMD5 query string (128��? 32 ascii byts)\n%q\tMD5 small query string (16��? 4 ascii byts)\n\n%s?\t?��?案�?(��? %sN) | |
| 678 | 678 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 679 | 679 | 例�?:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 680 | 680 | Proxy settings |
| 716 | 716 | |
| 717 | 717 | C:\\My Web Sites |
| 718 | 718 | C:\\My Websites |
| 719 | Type a new project name, \r\nor select existing project to update/resume | |
| 720 | 請鍵?��??�新?��?案�?, \r\n?�選?�已?��?案以?�新?�繼��?New project | |
| 719 | Type a new project name, \nor select existing project to update/resume | |
| 720 | 請鍵?��??�新?��?案�?, \n?�選?�已?��?案以?�新?�繼��?New project | |
| 721 | 721 | ?��?專�? |
| 722 | 722 | Insert URL |
| 723 | 723 | ?�入URL |
| 775 | 775 | 記憶體�?��? ?��??�命?�內?�錯��? |
| 776 | 776 | Unknown operation! |
| 777 | 777 | ?�知?��?! |
| 778 | Add this URL?\r\n | |
| 778 | Add this URL?\n | |
| 779 | 779 | 增�?此URL? |
| 780 | 780 | Warning: main process is still not responding, cannot add URL(s).. |
| 781 | 781 | 警�?: 主�?��??��??��?, 不能增�?URL(s).. |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | cs |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Brook Qin (brookqwr at sina.com) \r\n | |
| 7 | Brook Qin (brookqwr at sina.com) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | 匹配的链接将被包含: |
| 78 | 78 | Example: |
| 79 | 79 | 示例: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\n将匹配所有GIF文件 | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\n将查找到所有包含'blue' 的文件, 诸如 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\n将匹配文件 'bigfile.mov', 但不包括 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\n将查找到文件夹名内包含'cgi' 的链接, 诸如 /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\n将查找到文件夹名内包含'cgi-bin' 的链接 (但cgi-bin-2 除外) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\n将查找到包含诸如www.someweb.com, private.someweb.com 等的链接 | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\n将查找到包含诸如www.someweb.com, www.someweb.edu, private.someweb.otherweb.com 等的链接 | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\n将查找到包含'www.someweb.com' 的链接 (但不包括private.someweb.com/ 等) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\n将查找到任何诸如以下的链接: www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html 等 | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\n将仅查找到'www.test.com/test/someweb.html' 文件. 注意请输入完整的路径. | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\n将匹配所有GIF文件 | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\n将查找到所有包含'blue' 的文件, 诸如 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\n将匹配文件 'bigfile.mov', 但不包括 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\n将查找到文件夹名内包含'cgi' 的链接, 诸如 /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\n将查找到文件夹名内包含'cgi-bin' 的链接 (但cgi-bin-2 除外) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\n将查找到包含诸如www.someweb.com, private.someweb.com 等的链接 | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\n将查找到包含诸如www.someweb.com, www.someweb.edu, private.someweb.otherweb.com 等的链接 | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\n将查找到包含'www.someweb.com' 的链接 (但不包括private.someweb.com/ 等) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\n将查找到任何诸如以下的链接: www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html 等 | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\n将仅查找到'www.test.com/test/someweb.html' 文件. 注意请输入完整的路径. | |
| 100 | 100 | All links will match |
| 101 | 101 | 所有的链接都将匹配 |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | \n如有需要请看日志文件.\n\n点击'结束'以退出HTTraQt Website Copier.\n\n谢谢使用HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | 镜像完成.\n点击'确定'以退出HTTraQt.\n如有需要请看日志文件, 以确保万无一失.\n\n谢谢使用HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * 镜像被取消! * *\r\n当前临时的预存区为日后更新所需, 仅存有此次被中断的镜像期间内下载的数据.\r\n而原有预存区可能会存有更完整的内容; 如果你不想失去原有的数据, 请恢复之, 并删除当前预存区.\r\n[注: 欲删除当前预存区, 仅需删除以下文件: hts-cache/new.*]\r\n\r\n你是否肯定原有预存区存有更完整的内容, 并希望恢复之? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * 镜像出错!* *\r\nHTTraQt检测到当前镜像未储存任何数据. 若使用的更新模式, 则前一次镜像已被恢复.\r\n=> 原因: 首页未能找到, 或发生连接错误.\r\n请确定欲镜像的网站存在, 并/或检查代理设置! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * 镜像被取消! * *\n当前临时的预存区为日后更新所需, 仅存有此次被中断的镜像期间内下载的数据.\n而原有预存区可能会存有更完整的内容; 如果你不想失去原有的数据, 请恢复之, 并删除当前预存区.\n[注: 欲删除当前预存区, 仅需删除以下文件: hts-cache/new.*]\n\n你是否肯定原有预存区存有更完整的内容, 并希望恢复之? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * 镜像出错!* *\nHTTraQt检测到当前镜像未储存任何数据. 若使用的更新模式, 则前一次镜像已被恢复.\n=> 原因: 首页未能找到, 或发生连接错误.\n请确定欲镜像的网站存在, 并/或检查代理设置! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \n\n提示: 点击 [察看日志文件] 以察看警告或错误消息 |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | 完成时断掉连接 |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | 完成时断掉调制解调器 |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(有任何程序错误或问题请联系我们)\r\n\r\n开发:\r\n界面设计 (Windows): Xavier Roche\r\n解析引擎: Xavier Roche\r\nJava解析引擎: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\n感谢:\r\nRobert Lagadec (rlagadec@yahoo.fr) 提供翻译技巧 | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(有任何程序错误或问题请联系我们)\n\n开发:\n界面设计 (Windows): Xavier Roche\n解析引擎: Xavier Roche\nJava解析引擎: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\n感谢:\nRobert Lagadec (rlagadec@yahoo.fr) 提供翻译技巧 | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | 关于HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &浏览已镜像站点... |
| 744 | 744 | User-defined structure |
| 745 | 745 | 用户自定义结构 |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\t不含扩展名的文件名(如: image)\r\n%N\t含有扩展名的文件名(如: image.gif)\r\n%t\t仅扩展名(如: gif)\r\n%p\t路径[无尾随'/'] (如: /someimages)\r\n%h\t主机名(如: www.someweb.com)\r\n%M\tMD5 URL (128位, 32 ascii 字节)\r\n%Q\tMD5 query string (128位, 32 ascii 字节)\r\n%q\tMD5 small query string (16位, 4 ascii 字节)\r\n\r\n%s?\t短文件名(如: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\t不含扩展名的文件名(如: image)\n%N\t含有扩展名的文件名(如: image.gif)\n%t\t仅扩展名(如: gif)\n%p\t路径[无尾随'/'] (如: /someimages)\n%h\t主机名(如: www.someweb.com)\n%M\tMD5 URL (128位, 32 ascii 字节)\n%Q\tMD5 query string (128位, 32 ascii 字节)\n%q\tMD5 small query string (16位, 4 ascii 字节)\n\n%s?\t短文件名(如: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | 示例:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\My Websites |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | 请键入一个新的工程名, \r\n或选择已有工程以更新或继续 | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | 请键入一个新的工程名, \n或选择已有工程以更新或继续 | |
| 796 | 796 | New project |
| 797 | 797 | 新的工程 |
| 798 | 798 | Insert URL |
| 853 | 853 | 内存不足, 发生致命内部错误! |
| 854 | 854 | Unknown operation! |
| 855 | 855 | 未知操作! |
| 856 | Add this URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | 857 | 添加此URL? |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | 警告: 主进程未有响应, 不能添加URL(s).. |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | da |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Jesper Bramm (bramm@get2net.dk) \r\n | |
| 7 | Jesper Bramm (bramm@get2net.dk) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Macthende links medtages: |
| 78 | 78 | Example: |
| 79 | 79 | Eksempel: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nVil matche alle .GIF filer | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nMedtager alle filer med en matchende tekststreng. Skriver du f.eks. 'blue' medtages eksempelvis 'bluesky-small.jpeg'\r\n | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nVil medtage filen 'bigfile.mov', men ikke filen 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nvil finde links med mappenavne der matcher tekststrengen 'cgi' , eksempelvis /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nvil finde links med mappenavne der matcher hele tekststrengen 'cgi-bin' , men ikke 'cgi-bin-2' | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nFinder links med matchende sub-string som f.eks.www.someweb.com, private.someweb.com etc. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nFinder links med matchende mappe sub-string som f.eks.www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc.\r\n | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nFinder links der matcher hele strengen 'www.someweb.com' , (men IKKE links som: private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nFinder ethvert link med matchende tekst-streng som f.eks. www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc.\r\n | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nFinder kun 'www.test.com/test/someweb.html' file. Bemærk at du skal skrive den fulde stil[URL+stinavn] | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nVil matche alle .GIF filer | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nMedtager alle filer med en matchende tekststreng. Skriver du f.eks. 'blue' medtages eksempelvis 'bluesky-small.jpeg'\n | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nVil medtage filen 'bigfile.mov', men ikke filen 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nvil finde links med mappenavne der matcher tekststrengen 'cgi' , eksempelvis /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nvil finde links med mappenavne der matcher hele tekststrengen 'cgi-bin' , men ikke 'cgi-bin-2' | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nFinder links med matchende sub-string som f.eks.www.someweb.com, private.someweb.com etc. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nFinder links med matchende mappe sub-string som f.eks.www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc.\n | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nFinder links der matcher hele strengen 'www.someweb.com' , (men IKKE links som: private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nFinder ethvert link med matchende tekst-streng som f.eks. www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc.\n | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nFinder kun 'www.test.com/test/someweb.html' file. Bemærk at du skal skrive den fulde stil[URL+stinavn] | |
| 100 | 100 | All links will match |
| 101 | 101 | Alle links vil matche |
| 102 | 102 | Add exclusion filter |
| 152 | 152 | Unable to initialize the OLE system |
| 153 | 153 | Kan ikke starte OLE-systemet |
| 154 | 154 | HTTraQt could not find any interrupted download file cache in the specified folder! |
| 155 | HTTraQt kunne ikke finde nogen afbrudte download fil-cache i den angivne mappe !\r\n | |
| 155 | HTTraQt kunne ikke finde nogen afbrudte download fil-cache i den angivne mappe !\n | |
| 156 | 156 | Could not connect to provider |
| 157 | 157 | Kan ikke tilslutte til udbyder |
| 158 | 158 | receive |
| 200 | 200 | \nSee the log file if necessary.\n\nClick FINISH to quit HTTraQt Website Copier.\n\nThanks for using HTTraQt! |
| 201 | 201 | Se eventuelt log filen.\n\nKlik AFSLUT for at lukke HTTraQt Website Copier.\n\nTak for at du brugte HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | Website kopieringen er fuldført. \nKlik OK for at afslutte HTTraQt.\nSe log fil(erne) for at kontrollere at alt forløb OK.\n\nTak for at du brugte HTTraQt!\r\n | |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | ** KOPIERINGEN ER OPGIVET**\r\nDen nuværende cache er påkrævet for alle opdaterings operationer og indeholder kun data der er downloadet med den aktuelle afbrudte overførsel.\r\nDen tidligere cache kan indeholde mere fyldestgørende information; hvis du ønsker at bevare den information, skal du gendanne den og slette den aktuelle cache.\r\n[Note: Dette kan nemt gøres ved at slette 'hts-cache/new.* files]\r\n\r\nTror du den tidligere cache-fil muligvis indeholder mere fyldestgørende information, og vil du gendanne denne? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * KOPIERINGS FEJL * *\r\nHTTraQt har opdaget at den igangværende kopiering er tom. Hvis du var i gang med at opdatere en kopi, vil det tidligere indhold blive gendannet \r\nMulig årsag: Den første side kunne enten ikke findes eller der opstod et problem med forbindelsen.\r\n=> Kontroller at webstedet findes og/eller kontroller Proxy-indstillingerne! <= | |
| 203 | Website kopieringen er fuldført. \nKlik OK for at afslutte HTTraQt.\nSe log fil(erne) for at kontrollere at alt forløb OK.\n\nTak for at du brugte HTTraQt!\n | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | ** KOPIERINGEN ER OPGIVET**\nDen nuværende cache er påkrævet for alle opdaterings operationer og indeholder kun data der er downloadet med den aktuelle afbrudte overførsel.\nDen tidligere cache kan indeholde mere fyldestgørende information; hvis du ønsker at bevare den information, skal du gendanne den og slette den aktuelle cache.\n[Note: Dette kan nemt gøres ved at slette 'hts-cache/new.* files]\n\nTror du den tidligere cache-fil muligvis indeholder mere fyldestgørende information, og vil du gendanne denne? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * KOPIERINGS FEJL * *\nHTTraQt har opdaget at den igangværende kopiering er tom. Hvis du var i gang med at opdatere en kopi, vil det tidligere indhold blive gendannet \nMulig årsag: Den første side kunne enten ikke findes eller der opstod et problem med forbindelsen.\n=> Kontroller at webstedet findes og/eller kontroller Proxy-indstillingerne! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \n\nTip: Klik [Se log fil] for at se advarsels- og fejlmeddelelser |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 616 | 616 | Start |
| 617 | 617 | Start |
| 618 | 618 | Please adjust connection parameters if necessary,\nthen press FINISH to launch the mirroring operation. |
| 619 | Tilpas opkaldsparametre om nødvendigt.\nKlik på Udfør for at starte kopieringen.\r\n | |
| 619 | Tilpas opkaldsparametre om nødvendigt.\nKlik på Udfør for at starte kopieringen.\n | |
| 620 | 620 | Save settings only, do not launch download now. |
| 621 | 621 | Gem indstillingerne, men start ikke overførslen endnu. |
| 622 | 622 | On hold |
| 633 | 633 | Afbryd forbindelsen når overførslen er færdig |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Afbryd forbindelsen når overførslen er færdig |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Finder du fejl eller opstår der problemer så kontakt os venligst)\r\n\r\nUdvikling:\r\nGrænseflade (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche og andre bidragsydere\r\nMange tak for dansk oversættelses til:\r\nJesper Bramm (bramm@get2net.dk) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Finder du fejl eller opstår der problemer så kontakt os venligst)\n\nUdvikling:\nGrænseflade (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche og andre bidragsydere\nMange tak for dansk oversættelses til:\nJesper Bramm (bramm@get2net.dk) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | Om HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Gennemse websteder |
| 744 | 744 | User-defined structure |
| 745 | 745 | Brugerdefineret struktur |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tFilnavn uden type(eks: image)\r\n%N\tHele filnavnet inklusive filtype (eks: image.gif)\r\n%t\tKun filtype (eks: gif)\r\n%p\tSti [uden endelsen /] (eks: /someimages)\r\n%h\tVærts navn (eks: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 forespørgsel streng (128 bits, 32 ascii bytes)\r\n%q\tMD5 kort forespørgselsstreng (16 bits, 4 ascii bytes)\r\n\r\n%s?\tKort navn (eks: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tFilnavn uden type(eks: image)\n%N\tHele filnavnet inklusive filtype (eks: image.gif)\n%t\tKun filtype (eks: gif)\n%p\tSti [uden endelsen /] (eks: /someimages)\n%h\tVærts navn (eks: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 forespørgsel streng (128 bits, 32 ascii bytes)\n%q\tMD5 kort forespørgselsstreng (16 bits, 4 ascii bytes)\n\n%s?\tKort navn (eks: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Eksempel:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Mine web-steder |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | 795 | Skriv navnet på et nyt projekt\neller\nvælg at opdatere et eksisterende projekt |
| 796 | 796 | New project |
| 797 | 797 | Nyt projekt |
| 822 | 822 | Catch URL! |
| 823 | 823 | 'Fang' URL! |
| 824 | 824 | Please set temporary browser proxy settings to the following values (Copy/Paste Proxy Address and Port).\nThen click on the Form SUBMIT button in your browser page, or click on the specific link you want to capture. |
| 825 | Sæt venligst browserens proxy indstillinger til følgende værdier:(Kopiér/Sæt ind Proxy Addresse og Port).\nKlik på Form SUBMIT knappen på din browser-side, eller klik på specifikke link du ønsker at hente.\r\n\r\n | |
| 825 | Sæt venligst browserens proxy indstillinger til følgende værdier:(Kopiér/Sæt ind Proxy Addresse og Port).\nKlik på Form SUBMIT knappen på din browser-side, eller klik på specifikke link du ønsker at hente.\n\n | |
| 826 | 826 | This will send the desired link from your browser to HTTraQt. |
| 827 | 827 | Dette vil sende det ønskede link fra din browser til HTTraQt. |
| 828 | 828 | ABORT |
| 853 | 853 | Ikke mere hukommelse, alvorlig intern fejl er opstået... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Ukendt handling ! |
| 856 | Add this URL?\r\n | |
| 857 | Tilføj denne URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Tilføj denne URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Advarsel: Processen svarer stadigvæk ikke ,URL'en kan ikke tilføjes.... |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | de |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Rainer Klueting (rk-htt at centermail.net) \r\nBastian Gorke (bastiang at yahoo.com) \r\nRudi Ferrari (Wyando at netcologne.de) \r\nMarcus Gaza (MarcusGaza at t-online.de) \r\n | |
| 7 | Rainer Klueting (rk-htt at centermail.net) \nBastian Gorke (bastiang at yahoo.com) \nRudi Ferrari (Wyando at netcologne.de) \nMarcus Gaza (MarcusGaza at t-online.de) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Einzuschließende Links: |
| 78 | 78 | Example: |
| 79 | 79 | Beispiel: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nFindet alle GIF-Dateien | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nFindet alle Dateien, die 'blue' enthalten, wie 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nFindet 'bigfile.mov', aber nicht 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nFindet alle Links zu Ordnern, deren Name 'cgi' enthält, wie /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nFindet Links zu Ordnern namens 'cgi-bin' (aber z.B. nicht zu 'cgi-bin-2') | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nFindet Links wie www.someweb.com, private.someweb.com etc. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nFindet Links wie www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nFindet Links wie www.someweb.com/... (aber nicht wie private.someweb.com/...) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nFindet Links wie www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nFindet nur die Datei 'www.test.com/test/someweb.html'. Bitte beachten: Der Pfad muss vollständig angegeben werden (URL und Pfadangabe). | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nFindet alle GIF-Dateien | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nFindet alle Dateien, die 'blue' enthalten, wie 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nFindet 'bigfile.mov', aber nicht 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nFindet alle Links zu Ordnern, deren Name 'cgi' enthält, wie /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nFindet Links zu Ordnern namens 'cgi-bin' (aber z.B. nicht zu 'cgi-bin-2') | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nFindet Links wie www.someweb.com, private.someweb.com etc. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nFindet Links wie www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nFindet Links wie www.someweb.com/... (aber nicht wie private.someweb.com/...) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nFindet Links wie www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nFindet nur die Datei 'www.test.com/test/someweb.html'. Bitte beachten: Der Pfad muss vollständig angegeben werden (URL und Pfadangabe). | |
| 100 | 100 | All links will match |
| 101 | 101 | Alle Verknüpfungen sind eingeschlossen |
| 102 | 102 | Add exclusion filter |
| 196 | 196 | A problem occured during the mirroring operation\n |
| 197 | 197 | Beim Kopieren der Webseiten ist ein Problem aufgetreten\n |
| 198 | 198 | \nDuring:\n |
| 199 | \r\n\nWährend:\n | |
| 199 | \n\nWährend:\n | |
| 200 | 200 | \nSee the log file if necessary.\n\nClick FINISH to quit HTTraQt Website Copier.\n\nThanks for using HTTraQt! |
| 201 | \r\n\nNäheres bei Bedarf im Protokoll.\n\n'Beenden' beendet HTTraQt Website Copier.\n\nDanke, dass Sie HTTraQt benutzt haben! | |
| 201 | \n\nNäheres bei Bedarf im Protokoll.\n\n'Beenden' beendet HTTraQt Website Copier.\n\nDanke, dass Sie HTTraQt benutzt haben! | |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Kopiervorgang abgeschlossen.\n'Beenden' beendet HTTraQt.\nIn den Protokolldateien können Sie prüfen, ob Probleme auftraten.\n\nDanke, dass Sie HTTraQt benutzt haben! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * KOPIERVORGANG ABGEBROCHEN! * *\r\nDer aktuelle temporäre Cache wird für eine künftige Aktualisierung gebraucht. Er enthält nur Daten, die während der soeben abgebrochenen Sitzung heruntergeladen wurden.\r\nEin früher angelegter Cache enthält unter Umständen vollständigere Informationen; wenn Sie diese nicht verlieren wollen, müssen Sie sie wiederherstellen und den aktuellen Cache löschen.\r\n[Hinweis: Dazu werden einfach die Dateien hts-cache/new.* gelöscht]\r\n\r\nWollen Sie den vor dieser Sitzung erzeugten Cache wiederherstellen? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * FEHLER BEIM KOPIEREN! * *\r\nDie aktuelle Webseitenkopie ist leer. Wenn es sich um eine Aktualisierung gehandelt hat, ist die letzte Kopie wiederhergestellt worden.\r\nMögliche Ursachen: Entweder wurde(n) die erste(n) Seite(n) nicht gefunden, oder es gab ein Problem mit der Verbindung.\r\n=> Vergewissern Sie sich, dass die Website noch existiert, und/oder überprüfen Sie die Einstellungen für den Proxy! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * KOPIERVORGANG ABGEBROCHEN! * *\nDer aktuelle temporäre Cache wird für eine künftige Aktualisierung gebraucht. Er enthält nur Daten, die während der soeben abgebrochenen Sitzung heruntergeladen wurden.\nEin früher angelegter Cache enthält unter Umständen vollständigere Informationen; wenn Sie diese nicht verlieren wollen, müssen Sie sie wiederherstellen und den aktuellen Cache löschen.\n[Hinweis: Dazu werden einfach die Dateien hts-cache/new.* gelöscht]\n\nWollen Sie den vor dieser Sitzung erzeugten Cache wiederherstellen? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * FEHLER BEIM KOPIEREN! * *\nDie aktuelle Webseitenkopie ist leer. Wenn es sich um eine Aktualisierung gehandelt hat, ist die letzte Kopie wiederhergestellt worden.\nMögliche Ursachen: Entweder wurde(n) die erste(n) Seite(n) nicht gefunden, oder es gab ein Problem mit der Verbindung.\n=> Vergewissern Sie sich, dass die Website noch existiert, und/oder überprüfen Sie die Einstellungen für den Proxy! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | \r\n\n\nTipp: Ein Klick auf [Protokoll zeigen] zeigt Warnungen und Fehlermeldungen an | |
| 209 | \n\n\nTipp: Ein Klick auf [Protokoll zeigen] zeigt Warnungen und Fehlermeldungen an | |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 211 | 211 | Fehler beim Löschen einer Datei hts-cache/new.*. Bitte löschen Sie von Hand. |
| 212 | 212 | Do you really want to quit HTTraQt Website Copier? |
| 633 | 633 | Nach der Aktion Verbindung trennen |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Modemverbindung trennen, wenn fertig |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Bitte benachrichtigen Sie uns über Fehler und Probleme)\r\n\r\nEntwicklung:\r\nOberfläche (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for German translations to:\r\nRainer Klueting (rainer@klueting.de) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Bitte benachrichtigen Sie uns über Fehler und Probleme)\n\nEntwicklung:\nOberfläche (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for German translations to:\nRainer Klueting (rainer@klueting.de) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | Über HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Webseiten anzeigen... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Benutzerdefinierte Struktur |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tName der Datei ohne Dateityp (Bsp: Bild)\r\n%N\tName der Datei, mit Dateityp (Bsp: Bild.gif)\r\n%t\tDateityp (Bsp: gif)\r\n%p\tPfad [ohne letzten /] (Bsp: /Bilder)\r\n%h\tDomainname (Bsp: www.someweb.com)\r\n%M\tURL MD5 (128 Bits, 32 ASCII-Bytes)\r\n%Q\tAbfragetext MD5 (128 Bits, 32 ASCII-Bytes)\r\n%q\tKurzer Abfragetext MD5 (16 Bits, 4 ASCII-Bytes)\r\n\r\n%s?\tKurzname DOS(ex: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tName der Datei ohne Dateityp (Bsp: Bild)\n%N\tName der Datei, mit Dateityp (Bsp: Bild.gif)\n%t\tDateityp (Bsp: gif)\n%p\tPfad [ohne letzten /] (Bsp: /Bilder)\n%h\tDomainname (Bsp: www.someweb.com)\n%M\tURL MD5 (128 Bits, 32 ASCII-Bytes)\n%Q\tAbfragetext MD5 (128 Bits, 32 ASCII-Bytes)\n%q\tKurzer Abfragetext MD5 (16 Bits, 4 ASCII-Bytes)\n\n%s?\tKurzname DOS(ex: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Beispiel:\t%h%p/%n%q.%t\n->\t\tc:\\Spiegelung\\www.someweb.com\\Bilder\\Bild.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | Prkojektkategorie |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Meine Webseiten |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Neuen Projektnamen eintragen, \r\noder existierendes Projekt zum Aktualisieren oder zur Wiederaufnahme auswählen | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Neuen Projektnamen eintragen, \noder existierendes Projekt zum Aktualisieren oder zur Wiederaufnahme auswählen | |
| 796 | 796 | New project |
| 797 | 797 | Neues Projekt |
| 798 | 798 | Insert URL |
| 853 | 853 | Nicht genug Speicher. Kritischer interner Fehler... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Unbekannte Operation! |
| 856 | Add this URL?\r\n | |
| 857 | Diese URL hinzufügen?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Diese URL hinzufügen?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Warnung: Hauptprozess antwortet nicht; kann keine URLs hinzufügen. |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | et |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Tõnu Virma\r\n | |
| 7 | Tõnu Virma\n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Vastavad lingid tuleb kaasa arvata: |
| 78 | 78 | Example: |
| 79 | 79 | Näidis: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nleiab kõik GIF-failid | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nleiab kõik failid, mis sisaldavad alamstringi 'blue', nagu 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nleiab faili 'bigfile.mov', aga mitte 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nleiab lingid, mille kaustanimes sisaldub 'cgi' nagu /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nleiab lingid, mille kaustanimeks on terve 'cgi-bin' string (aga mitte cgi-bin-2, näiteks) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nleiab seda alamstringi sisaldavad lingid, nagu www.someweb.com, private.someweb.com jne. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nleiab seda alamstringi sisaldavad lingid, nagu www.someweb.com, www.someweb.edu, private.someweb.otherweb.com jne. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nleiab lingid, mis vastavad alamstringile 'www.someweb.com' (aga mitte linke, nagu private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nleiab kõik seda alamstringi sisaldavad lingid, nagu www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html jne. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nleiab ainult faili 'www.test.com/test/someweb.html'. Sisestada tuleb täielik asukoht (URL + faili asukoht) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nleiab kõik GIF-failid | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nleiab kõik failid, mis sisaldavad alamstringi 'blue', nagu 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nleiab faili 'bigfile.mov', aga mitte 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nleiab lingid, mille kaustanimes sisaldub 'cgi' nagu /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nleiab lingid, mille kaustanimeks on terve 'cgi-bin' string (aga mitte cgi-bin-2, näiteks) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nleiab seda alamstringi sisaldavad lingid, nagu www.someweb.com, private.someweb.com jne. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nleiab seda alamstringi sisaldavad lingid, nagu www.someweb.com, www.someweb.edu, private.someweb.otherweb.com jne. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nleiab lingid, mis vastavad alamstringile 'www.someweb.com' (aga mitte linke, nagu private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nleiab kõik seda alamstringi sisaldavad lingid, nagu www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html jne. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nleiab ainult faili 'www.test.com/test/someweb.html'. Sisestada tuleb täielik asukoht (URL + faili asukoht) | |
| 100 | 100 | All links will match |
| 101 | 101 | Kõik lingid leitakse |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | \nVaata logifaili kui tarvis.\n\nKliki FINISH, et sulgeda HTTraQt Website Copier.\n\nTänan HTTraQt'i kasutamise eest! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Kopeerimisoperatsioon on lõpetatud.\nKliki Välju, et sulgeda HTTraQt.\nVaata logifaili veendumaks, et kõik on korras.\n\nTänan HTTraQt'i kasutamise eest! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * KOPEERIMINE KATKESTATUD! * *\r\nPraegune ajutine cache on vajalik igasuguse uuendamise jaoks ja sisaldab ainult käesoleva katkestatud seansi jooksul tiritud andmeid.\r\nEelmine cache võib sisaldada põhjalikumat informatsiooni; kui sa ei taha seda informatsiooni kaotada, tuleb see taastada ja kustutada praegune cache.\r\n[Märkus: Seda on siin lihtne teha, kustutades hts-cache/new.* failid]\r\n\r\nKas arvad, et eelmine cache võib sisaldada põhjalikumat informatsiooni, ja kas tahad seda taastada? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * KOPEERIMISE VIGA! * *\r\nHTTraQt leidis, et praegune veebikoopia on tühi. Kui see on uuendus, taastatakse eelmine koopia.\r\nPõhjus: esimest lehekülge ei leitud, või on ühenduse probleemid.\r\n=> Veendu, et veebisait ikka alles on, ja/või kontrolli proxy seadistust! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * KOPEERIMINE KATKESTATUD! * *\nPraegune ajutine cache on vajalik igasuguse uuendamise jaoks ja sisaldab ainult käesoleva katkestatud seansi jooksul tiritud andmeid.\nEelmine cache võib sisaldada põhjalikumat informatsiooni; kui sa ei taha seda informatsiooni kaotada, tuleb see taastada ja kustutada praegune cache.\n[Märkus: Seda on siin lihtne teha, kustutades hts-cache/new.* failid]\n\nKas arvad, et eelmine cache võib sisaldada põhjalikumat informatsiooni, ja kas tahad seda taastada? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * KOPEERIMISE VIGA! * *\nHTTraQt leidis, et praegune veebikoopia on tühi. Kui see on uuendus, taastatakse eelmine koopia.\nPõhjus: esimest lehekülge ei leitud, või on ühenduse probleemid.\n=> Veendu, et veebisait ikka alles on, ja/või kontrolli proxy seadistust! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \n\nVihje: Hoiatuste ja veateadete nägemiseks kliki [Vaata logifaili] |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Lahuta ühendus, kui on lõpetatud |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Lahuta modem lõpetamisel |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Palun teata meile igast veast või probleemist)\r\n\r\nArendajad:\r\nKasutajaliides (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nEestikeelne tõlge: Tõnu Virma | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Palun teata meile igast veast või probleemist)\n\nArendajad:\nKasutajaliides (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nEestikeelne tõlge: Tõnu Virma | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | Info HTTraQt Website Copier'i kohta |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | Si&rvi saite... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Kasutaja-defineeritud struktuur |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tFaili nimi ilma laiendita (nt: image)\r\n%N\tFaili nimi koos laiendiga (nt: image.gif)\r\n%t\tFaili laiend ainult (nt: gif)\r\n%p\tAsukoht [ilma /-ta lõpus] (nt: /someimages)\r\n%h\tHosti nimi (nt: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tDOS-i lühinimi (nt: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tFaili nimi ilma laiendita (nt: image)\n%N\tFaili nimi koos laiendiga (nt: image.gif)\n%t\tFaili laiend ainult (nt: gif)\n%p\tAsukoht [ilma /-ta lõpus] (nt: /someimages)\n%h\tHosti nimi (nt: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tDOS-i lühinimi (nt: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Näidis:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Minu veebisaidid |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Sisesta uue projekti nimi, \r\nvõi vali olemasolev projekt uuendamiseks/jätkamiseks | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Sisesta uue projekti nimi, \nvõi vali olemasolev projekt uuendamiseks/jätkamiseks | |
| 796 | 796 | New project |
| 797 | 797 | Uus projekt |
| 798 | 798 | Insert URL |
| 853 | 853 | Mälu ei ole piisavalt, fataalne sisemine viga... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Tundmatu operatsioon! |
| 856 | Add this URL?\r\n | |
| 857 | Kas lisada see URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Kas lisada see URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Hoiatus: põhiprotsess ei reageeri ikka veel, ei saa lisada URL-e... |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | en |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Xavier Roche (roche at httrack.com)\r\nRobert Lagadec (rlagadec at yahoo.fr) \r\n | |
| 7 | Xavier Roche (roche at httrack.com)\nRobert Lagadec (rlagadec at yahoo.fr) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Matching links will be included: |
| 78 | 78 | Example: |
| 79 | 79 | Example: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nWill match all GIF files | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nWill match all GIF files | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 100 | 100 | All links will match |
| 101 | 101 | All links will match |
| 102 | 102 | Add exclusion filter |
| 203 | 203 | \nSee the log file if necessary.\n\nClick FINISH to quit HTTraQt Website Copier.\n\nThanks for using HTTraQt! |
| 204 | 204 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 205 | 205 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 206 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 207 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 208 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 209 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 206 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 207 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 208 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 209 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 210 | 210 | \n\nTip: Click [View log file] to see warning or error messages |
| 211 | 211 | \n\nTip: Click [View log file] to see warning or error messages |
| 212 | 212 | Error deleting a hts-cache/new.* file, please do it manually |
| 635 | 635 | Disconnect when finished |
| 636 | 636 | Disconnect modem on completion |
| 637 | 637 | Disconnect modem on completion |
| 638 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 639 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 638 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 639 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 640 | 640 | About HTTraQt Website Copier |
| 641 | 641 | About HTTraQt Website Copier |
| 642 | 642 | Please visit our Web page |
| 745 | 745 | &Browse sites... |
| 746 | 746 | User-defined structure |
| 747 | 747 | User-defined structure |
| 748 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 749 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 748 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 749 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 750 | 750 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 751 | 751 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 752 | 752 | Proxy settings |
| 793 | 793 | Project category: |
| 794 | 794 | C:\\My Web Sites |
| 795 | 795 | C:\\My Web Sites |
| 796 | Type a new project name, \r\nor select existing project to update/resume | |
| 797 | Type a new project name, \r\nor select existing project to update/resume | |
| 796 | Type a new project name, \nor select existing project to update/resume | |
| 797 | Type a new project name, \nor select existing project to update/resume | |
| 798 | 798 | New project |
| 799 | 799 | New project |
| 800 | 800 | Insert URL |
| 855 | 855 | Not enough memory, fatal internal error.. |
| 856 | 856 | Unknown operation! |
| 857 | 857 | Unknown operation! |
| 858 | Add this URL?\r\n | |
| 859 | Add this URL?\r\n | |
| 858 | Add this URL?\n | |
| 859 | Add this URL?\n | |
| 860 | 860 | Warning: main process is still not responding, cannot add URL(s).. |
| 861 | 861 | Warning: main process is still not responding, cannot add URL(s).. |
| 862 | 862 | Type/MIME associations |
| 77 | 77 | Sopivat linkit sisällytetään: |
| 78 | 78 | Example: |
| 79 | 79 | Esimerkki: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nSopii kaikiin gif-tiedostoihin | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | sini\r\nLöytää kaikki tiedostot, joissa on 'sini', myös sanan keskeltä kuten 'sinitaivas_pieni.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | iso.mov\r\nSopii tiedostoon 'iso.mov', muttei tiedostoon 'iso2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nLöytää linkit, joiden kansion nimi sisältää tekstin 'cgi' kuten /cgi-bin/jokincgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nLöytää linkit, joiden kansion nimessä on vain teksti 'cgi-bin' (mutta ei cgi-bin-2, esimerkiksi) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | jokinnetti.fi\r\nLöytää linkit, jotka sisältävät tekstin 'jokinnetti.fi', esimerkiksi www.jokinnetti.fi, yksityinen.jokinnetti.fi jne. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | jokinnetti\r\nLöytää linkit, joka sisältää tämän tekstin, kuten www.jokinnetti.fi, www.jokinnetti.eu, yksityinen.jokinnetti.toinennetti.fi jne. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.jokinnetti.fi\r\nLöytää linkit, joissa on 'www.jokinnetti.fi' (mutta ei linkkejä yksityinen.jokinnetti.fi/...) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | jokinnetti\r\nLöytää kaikki linkit, jotka sisältävät tämän tekstin, kuten www.jokinnetti.fi/..., www.testi.abc/fromjokinnetti/index.html, www.testi.abc/test/jokinnetti.html jne. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.testi.com/test/jokinnetti.html\r\nLöytää vain tiedoston 'www.testi.com/test/jokinnetti.html'. Huomaa, että sinun pitää kirjoittaa koko polku (URL + paikan polku) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nSopii kaikiin gif-tiedostoihin | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | sini\nLöytää kaikki tiedostot, joissa on 'sini', myös sanan keskeltä kuten 'sinitaivas_pieni.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | iso.mov\nSopii tiedostoon 'iso.mov', muttei tiedostoon 'iso2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nLöytää linkit, joiden kansion nimi sisältää tekstin 'cgi' kuten /cgi-bin/jokincgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nLöytää linkit, joiden kansion nimessä on vain teksti 'cgi-bin' (mutta ei cgi-bin-2, esimerkiksi) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | jokinnetti.fi\nLöytää linkit, jotka sisältävät tekstin 'jokinnetti.fi', esimerkiksi www.jokinnetti.fi, yksityinen.jokinnetti.fi jne. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | jokinnetti\nLöytää linkit, joka sisältää tämän tekstin, kuten www.jokinnetti.fi, www.jokinnetti.eu, yksityinen.jokinnetti.toinennetti.fi jne. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.jokinnetti.fi\nLöytää linkit, joissa on 'www.jokinnetti.fi' (mutta ei linkkejä yksityinen.jokinnetti.fi/...) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | jokinnetti\nLöytää kaikki linkit, jotka sisältävät tämän tekstin, kuten www.jokinnetti.fi/..., www.testi.abc/fromjokinnetti/index.html, www.testi.abc/test/jokinnetti.html jne. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.testi.com/test/jokinnetti.html\nLöytää vain tiedoston 'www.testi.com/test/jokinnetti.html'. Huomaa, että sinun pitää kirjoittaa koko polku (URL + paikan polku) | |
| 100 | 100 | All links will match |
| 101 | 101 | Kaikki linkit sopii |
| 102 | 102 | Add exclusion filter |
| 203 | 203 | \nKatso lokitiedostoa tarvittaessa.\n\nPaina VALMIS poistuaksesi HTTraQt Website Copierista.\n\nKiitoksia HTTraQtin käytöstä! |
| 204 | 204 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 205 | 205 | Peilausoperaatio valmis.\nPaina poistu sulkeaksesi HTTraQtin.\nKatso lokitiedosto(j)a varmistaaksesi, että kaikki on kunnossa.\n\nKiitoksia HTTraQtin käytöstä! |
| 206 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 207 | * * PEILI KESKEYTETTY! * *\r\nNykyistä välimuistia tarvitaan päivitysoperaatioihin ja se sisältää tietoa vain äsken keskeytetystä imuroinnista.\r\nAiempi välimuisti saattaa sisältää täydellisempää tietoa; jos et halua menettää tätä tietoa, sinun pitää palauttaa se ja poistaa nykyinen välimuisti.\r\n[Huomaa: Tämän voi helposti tehdä nyt poistamalla hts-cache/new.*-tiedostot]\r\n\r\nLuuletko, että edellinen välimuisti sisältäisi täydellisempää tietoa, ja että haluat palauttaa sen? | |
| 208 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 209 | * * PEILIVIRHE! * *\r\nHTTraQt huomasi, että nykyinen peili on tyhjä. Jos se oli päivitys, edellinen peli on palautettu.\r\nSyy: ensimmäiset sivut eivät löytyneet tai tapahtui yhteysvirhe.\r\n=> Varmista että nettisivu on yhä olemassa ja tarkista välityspalvelinasetuksesi! <= | |
| 206 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 207 | * * PEILI KESKEYTETTY! * *\nNykyistä välimuistia tarvitaan päivitysoperaatioihin ja se sisältää tietoa vain äsken keskeytetystä imuroinnista.\nAiempi välimuisti saattaa sisältää täydellisempää tietoa; jos et halua menettää tätä tietoa, sinun pitää palauttaa se ja poistaa nykyinen välimuisti.\n[Huomaa: Tämän voi helposti tehdä nyt poistamalla hts-cache/new.*-tiedostot]\n\nLuuletko, että edellinen välimuisti sisältäisi täydellisempää tietoa, ja että haluat palauttaa sen? | |
| 208 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 209 | * * PEILIVIRHE! * *\nHTTraQt huomasi, että nykyinen peili on tyhjä. Jos se oli päivitys, edellinen peli on palautettu.\nSyy: ensimmäiset sivut eivät löytyneet tai tapahtui yhteysvirhe.\n=> Varmista että nettisivu on yhä olemassa ja tarkista välityspalvelinasetuksesi! <= | |
| 210 | 210 | \n\nTip: Click [View log file] to see warning or error messages |
| 211 | 211 | \n\nVinkki: Paina [Näytä lokitiedosto] nähdäksesi varoitus- ja virheviestit |
| 212 | 212 | Error deleting a hts-cache/new.* file, please do it manually |
| 635 | 635 | Katkaise yhteys, kun on valmista |
| 636 | 636 | Disconnect modem on completion |
| 637 | 637 | Katkaise modeemiyhteys, kun on valmista |
| 638 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 639 | \r\n(Kerro meille bugeista ja ongelmista)\r\n\r\nKehitys:\r\nKäyttöliittymä (Windows): Xavier Roche\r\nNettirobotti: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C) 1998-2003 Xavier Roche ja muut avustajat\r\nSuomentanut Mika Kähkönen 22.-24.7.2005\r\nmika.kahkonen@mbnet.fi\r\nhttp://koti.mbnet.fi/kahoset | |
| 638 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 639 | \n(Kerro meille bugeista ja ongelmista)\n\nKehitys:\nKäyttöliittymä (Windows): Xavier Roche\nNettirobotti: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C) 1998-2003 Xavier Roche ja muut avustajat\nSuomentanut Mika Kähkönen 22.-24.7.2005\nmika.kahkonen@mbnet.fi\nhttp://koti.mbnet.fi/kahoset | |
| 640 | 640 | About HTTraQt Website Copier |
| 641 | 641 | Tietoja HTTraQt Website Copier |
| 642 | 642 | Please visit our Web page |
| 745 | 745 | S&elaa sivuja... |
| 746 | 746 | User-defined structure |
| 747 | 747 | Käyttäjän määrittelemä rakenne |
| 748 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 749 | %n\tTiedostonimi ilman tyyppiä (esim: kuva)\r\n%N\tTiedostonimi ja tyyppi (esim: kuva.png)\r\n%t\tVain tiedostotyyppi (esim: png)\r\n%p\tPolku [loppuun ei /] (esim: /kuvia)\r\n%h\tIsäntänimi (esim: www.jokinnetti.fi)\r\n%M\tMD5-URL (128 bittiä, 32 ascii-tavua)\r\n%Q\tMD5-kyselyjono (128 bittiä, 32 ascii-tavua)\r\n%q\tPieni MD5-kyselyjono (16 bittiä, 4 ascii-tavua)\r\n\r\n%s?\tLyhyt nimi(esim: %sN) | |
| 748 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 749 | %n\tTiedostonimi ilman tyyppiä (esim: kuva)\n%N\tTiedostonimi ja tyyppi (esim: kuva.png)\n%t\tVain tiedostotyyppi (esim: png)\n%p\tPolku [loppuun ei /] (esim: /kuvia)\n%h\tIsäntänimi (esim: www.jokinnetti.fi)\n%M\tMD5-URL (128 bittiä, 32 ascii-tavua)\n%Q\tMD5-kyselyjono (128 bittiä, 32 ascii-tavua)\n%q\tPieni MD5-kyselyjono (16 bittiä, 4 ascii-tavua)\n\n%s?\tLyhyt nimi(esim: %sN) | |
| 750 | 750 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 751 | 751 | Esimerkki:\t%h%p/%n%q.%t\n->\t\tc:\\peili\\www.jokinnetti.com\\jotainkuvia\\kuva.gif |
| 752 | 752 | Proxy settings |
| 793 | 793 | Projektin luokka: |
| 794 | 794 | C:\\My Web Sites |
| 795 | 795 | C:\\Nettisivuni |
| 796 | Type a new project name, \r\nor select existing project to update/resume | |
| 796 | Type a new project name, \nor select existing project to update/resume | |
| 797 | 797 | Kirjoita uuden projektin nimi, \r\tai valitse päivitettävä tai jatkettava projekti |
| 798 | 798 | New project |
| 799 | 799 | Uusi projekti |
| 855 | 855 | Ei tarpeeksi muistia, vakava sisäinen virhe... |
| 856 | 856 | Unknown operation! |
| 857 | 857 | Tuntematon operaatio! |
| 858 | Add this URL?\r\n | |
| 859 | Lisää URL?\r\n | |
| 858 | Add this URL?\n | |
| 859 | Lisää URL?\n | |
| 860 | 860 | Warning: main process is still not responding, cannot add URL(s).. |
| 861 | 861 | Varoitus: pääprosessi ei vieläkään vastaa, ei voi lisätä URL:iä... |
| 862 | 862 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | fr |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Xavier Roche (roche at httrack.com)\r\nRobert Lagadec (rlagadec at yahoo.fr) \r\n | |
| 7 | Xavier Roche (roche at httrack.com)\nRobert Lagadec (rlagadec at yahoo.fr) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Les liens répondant à cette règle seront inclus |
| 78 | 78 | Example: |
| 79 | 79 | Exemple: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\ndétectera tous les fichiers GIF | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\ndétectera tous les fichiers contenant le mot blue, comme 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\ndétectera le fichier 'bigfile.mov', mais pas 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\ndétectera des liens contenant 'cgi', comme /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\ndétectera par exemple des liens contenant 'cgi-bin', mais pas 'cgi-bin-2' | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\ndétectera des liens comme www.someweb.com, private.someweb.com, etc. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\ndétectera des liens comme www.someweb.com, www.someweb.edu, private.someweb.otherweb.com, etc. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\ndétectera des liens comme www.someweb.com/... (mais pas ceux comme private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\ndétectera des liens comme www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\ndétectera uniquement www.test.com/test/someweb.html.\nNotez que vous avez à taper l'adresse complète (URL + Chemin du fichier) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\ndétectera tous les fichiers GIF | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\ndétectera tous les fichiers contenant le mot blue, comme 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\ndétectera le fichier 'bigfile.mov', mais pas 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\ndétectera des liens contenant 'cgi', comme /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\ndétectera par exemple des liens contenant 'cgi-bin', mais pas 'cgi-bin-2' | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\ndétectera des liens comme www.someweb.com, private.someweb.com, etc. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\ndétectera des liens comme www.someweb.com, www.someweb.edu, private.someweb.otherweb.com, etc. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\ndétectera des liens comme www.someweb.com/... (mais pas ceux comme private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\ndétectera des liens comme www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\ndétectera uniquement www.test.com/test/someweb.html.\nNotez que vous avez à taper l'adresse complète (URL + Chemin du fichier) | |
| 100 | 100 | All links will match |
| 101 | 101 | Tous les liens seront détectés |
| 102 | 102 | Add exclusion filter |
| 203 | 203 | Voyez le fichier journal au besoin\n\nCliquez sur TERMINER pour quitter HTTraQt\n\nMerci d'utiliser HTTraQt! |
| 204 | 204 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 205 | 205 | la copie du site est terminée\nCliquez sur OK pour quitter HTTraQt\nConsultez au besoin les fichiers journaux pour vérifier que tout s'est bien passé\n\nMerci d'utiliser HTTraQt! |
| 206 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 207 | * * COPIE INTERROMPUE! * *\r\nLe cache temporaire actuel est nécessaire pour toute mise à jour et ne contient que les données téléchargées durant la présente session interrompue.\r\nIl est possible que le cache précédent contienne des données plus complètes; si vous ne voulez pas perdre ces données, vous devez le restaurer et effacer le cache actuel.\r\n[Note: Cette opération peut être facilement effectuée ici en effacant les fichiers hts-cache/new.*]\r\n\r\nPensez-vous que le cache précédent pourrait contenir des informations plus complètes, et voulez-vous le restaurer? | |
| 208 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 209 | * * ERREUR DE COPIE! * *\r\nHTTraQt a détecté que la copie courante était vide. Si il s'agissait d'une mise à jour, l'ancienne copie a été restaurée.\r\nRaison: soit la (les) première(s) page(s) n'ont pu être téléchargées, soit un problème de connexion est survenu.\r\n=> Vérifiez que le site existe toujours, et/ou vérifiez les réglages du proxy! <= | |
| 206 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 207 | * * COPIE INTERROMPUE! * *\nLe cache temporaire actuel est nécessaire pour toute mise à jour et ne contient que les données téléchargées durant la présente session interrompue.\nIl est possible que le cache précédent contienne des données plus complètes; si vous ne voulez pas perdre ces données, vous devez le restaurer et effacer le cache actuel.\n[Note: Cette opération peut être facilement effectuée ici en effacant les fichiers hts-cache/new.*]\n\nPensez-vous que le cache précédent pourrait contenir des informations plus complètes, et voulez-vous le restaurer? | |
| 208 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 209 | * * ERREUR DE COPIE! * *\nHTTraQt a détecté que la copie courante était vide. Si il s'agissait d'une mise à jour, l'ancienne copie a été restaurée.\nRaison: soit la (les) première(s) page(s) n'ont pu être téléchargées, soit un problème de connexion est survenu.\n=> Vérifiez que le site existe toujours, et/ou vérifiez les réglages du proxy! <= | |
| 210 | 210 | \n\nTip: Click [View log file] to see warning or error messages |
| 211 | 211 | \nConseil: sélectionnez la commande 'Voir le fichier journal' pour visionner les messages d'erreur et d'avertissement |
| 212 | 212 | Error deleting a hts-cache/new.* file, please do it manually |
| 635 | 635 | Déconnecter à la fin de l'opération |
| 636 | 636 | Disconnect modem on completion |
| 637 | 637 | Déconnecter le modem lorsque l'opération sera finie |
| 638 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 639 | \r\n(signalez-nous tout bug ou problème)\r\n\r\nDéveloppement:\r\nInterface (Windows): Xavier Roche\r\nMoteur: Xavier Roche\r\nParseurClassesJava: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMERCI pour la relecture à:\r\nRobert Lagadec | |
| 638 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 639 | \n(signalez-nous tout bug ou problème)\n\nDéveloppement:\nInterface (Windows): Xavier Roche\nMoteur: Xavier Roche\nParseurClassesJava: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMERCI pour la relecture à:\nRobert Lagadec | |
| 640 | 640 | About HTTraQt Website Copier |
| 641 | 641 | A propos de HTTraQt Website Copier |
| 642 | 642 | Please visit our Web page |
| 745 | 745 | &Browse sites... |
| 746 | 746 | User-defined structure |
| 747 | 747 | Définir une structure personnalisée |
| 748 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 749 | %n\tNom du fichier sans ext. (ex: image)\r\n%N\tNom du fichier avec extension (ex: image.gif)\r\n%t\tExtension (ex: gif)\r\n%p\tChemin [sans dernier /] (ex: /someimages)\r\n%h\tNom du serveur (ex: www.someweb.com)\r\n%M\tURL MD5 (128 bits, 32 ascii bytes)\r\n%Q\tquery string MD5 (128 bits, 32 ascii bytes)\r\n%q\tsmall query string MD5 (16 bits, 4 ascii bytes)\r\n\r\n%s?\tVersion courte DOS (ex: %sN) | |
| 748 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 749 | %n\tNom du fichier sans ext. (ex: image)\n%N\tNom du fichier avec extension (ex: image.gif)\n%t\tExtension (ex: gif)\n%p\tChemin [sans dernier /] (ex: /someimages)\n%h\tNom du serveur (ex: www.someweb.com)\n%M\tURL MD5 (128 bits, 32 ascii bytes)\n%Q\tquery string MD5 (128 bits, 32 ascii bytes)\n%q\tsmall query string MD5 (16 bits, 4 ascii bytes)\n\n%s?\tVersion courte DOS (ex: %sN) | |
| 750 | 750 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 751 | 751 | Exemple:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 752 | 752 | Proxy settings |
| 793 | 793 | Catégorie du projet: |
| 794 | 794 | C:\\My Web Sites |
| 795 | 795 | C:\\Mes Sites Web |
| 796 | Type a new project name, \r\nor select existing project to update/resume | |
| 797 | Entrez le nom d'un nouveau projet, \r\nou sélectionnez un projet existant pour le mettre à jour/le reprendre | |
| 796 | Type a new project name, \nor select existing project to update/resume | |
| 797 | Entrez le nom d'un nouveau projet, \nou sélectionnez un projet existant pour le mettre à jour/le reprendre | |
| 798 | 798 | New project |
| 799 | 799 | Nouveau projet |
| 800 | 800 | Insert URL |
| 855 | 855 | Pas assez de mémoire, erreur interne fatale... |
| 856 | 856 | Unknown operation! |
| 857 | 857 | Opération inconnue! |
| 858 | Add this URL?\r\n | |
| 859 | Ajouter cette adresse URL?\r\n | |
| 858 | Add this URL?\n | |
| 859 | Ajouter cette adresse URL?\n | |
| 860 | 860 | Warning: main process is still not responding, cannot add URL(s).. |
| 861 | 861 | Attention: le processus principal ne répond toujours pas, impossible d'ajouter ces URLs... |
| 862 | 862 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | el |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Michael Papadakis (mikepap at freemail dot gr)\r\n | |
| 7 | Michael Papadakis (mikepap at freemail dot gr)\n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Τα links που ταιριάζουν θα συμπεριληφθούν |
| 78 | 78 | Example: |
| 79 | 79 | Παράδειγμα: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nΘα ταιριάξει όλα τα αρχεία GIF | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nΘα βρει όλα τα αρχεία με τη φράση 'blue' όπως το 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nΘα ταιριάξει το αρχείο 'bigfile.mov', αλλά όχι το 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nΘα βρεί links με όνομα φακέλου που περιέχει το 'cgi', όπως /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nΘα βρεί links με όνομα φακέλου που ταιριάζει με όλο το 'cgi-bin', αλλά όχι το 'cgi-bin-2' | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nΘα βρεί links που περιέχουν τη φράση, σαν τα www.someweb.com, private.someweb.com κλπ. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nΘα βρεί links σε φακέλους που περιέχουν τη φράση, σαν τα www.someweb.com, www.someweb.edu, private.someweb.otherweb.com κλπ. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nΘα βρεί links που ταιριάζουν με όλο το 'www.someweb.com', αλλά όχι το 'private.someweb.com'. | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nΘα βρεί links που περιέχουν τη φράση οπουδήποτε στο URL, όπως τα www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html κλπ. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nΘα βρεί μόνο το αρχείο 'www.test.com/test/someweb.html'. Προσέξτε ότι θα πρέπει να γράψετε όλη τη διαδρομή. | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nΘα ταιριάξει όλα τα αρχεία GIF | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nΘα βρει όλα τα αρχεία με τη φράση 'blue' όπως το 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nΘα ταιριάξει το αρχείο 'bigfile.mov', αλλά όχι το 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nΘα βρεί links με όνομα φακέλου που περιέχει το 'cgi', όπως /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nΘα βρεί links με όνομα φακέλου που ταιριάζει με όλο το 'cgi-bin', αλλά όχι το 'cgi-bin-2' | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nΘα βρεί links που περιέχουν τη φράση, σαν τα www.someweb.com, private.someweb.com κλπ. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nΘα βρεί links σε φακέλους που περιέχουν τη φράση, σαν τα www.someweb.com, www.someweb.edu, private.someweb.otherweb.com κλπ. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nΘα βρεί links που ταιριάζουν με όλο το 'www.someweb.com', αλλά όχι το 'private.someweb.com'. | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nΘα βρεί links που περιέχουν τη φράση οπουδήποτε στο URL, όπως τα www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html κλπ. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nΘα βρεί μόνο το αρχείο 'www.test.com/test/someweb.html'. Προσέξτε ότι θα πρέπει να γράψετε όλη τη διαδρομή. | |
| 100 | 100 | All links will match |
| 101 | 101 | Όλα τα links θα ταιριάξουν |
| 102 | 102 | Add exclusion filter |
| 203 | 203 | \nΔείτε το αρχείο γεγονότων αν είναι απαραίτητο.\n\nΚλικ στο ΤΕΛΟΣ για να εγκαταλείψετε το HTTraQt Website Copier.\n\nΣας ευχαριστώ για την χρήση του HTTraQt! |
| 204 | 204 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 205 | 205 | Η διαδικασία αντιγραφής τέλειωσε.\nΚλικ στο Έξοδος για να εγκαταλείψετε το HTTraQt.\nΔείτε το αρχείο γεγονότων αν είναι απαραίτητο, έτσι ώστε να επιβεβαιώσετε ότι όλα είναι εντάξει.\n\nΣας ευχαριστώ για την χρήση του HTTraQt! |
| 206 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 207 | * * Η ΑΝΤΙΓΡΑΦΗ ΕΓΚΑΤΑΛΕΙΦΘΗΚΕ! * *\r\nΗ παρούσα προσωρινή cache είναι απαραίτητη για κάθε λειτουργία ανανέωσης και περιλαμβάνει μόνο δεδομένα που κατέβηκαν κατά τη διάρκεια της τωρινής εγκαταλελειμένης περιόδου.\r\nΗ προηγούμενη cache ίσως περιέχει πιο ολοκληρωμένες πληροφορίες. Αν δεν θέλετε να χάσετε αυτές τις πληροφορίες, πρέπει να να τις ανακτήσετε και να διαγράψετε την παρούσα cache.\r\n[Σημείωση: Αυτό μπορεί να γίνει εύκολα σβήνοντας τα αρχεία hts-cache/new.*]\r\n\r\nΝομίζετε πως η προηγούμενη cache ίσως περιέχει πιο ολοκληρωμένες πληροφορίες και θέλετε να την ανακτήσετε; | |
| 208 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 209 | * * ΣΦΑΛΜΑ ΑΝΤΙΓΡΑΦΗΣ * *\r\nΤο HTTraQt ανακάλυψε πως το παρόν αντίγραφο είναι άδειο. Αν ήταν μια ανανέωση, το προηγούμενο αντίγραφο ανακτήθηκε.\r\nΛόγος: Οι πρώτη(ες) σελίδα(ες) είτε δεν βρέθηκαν ή υπήρξε πρόβλημα κατά την σύνδεση.\r\n=> Επιβεβαιώστε ότι η τοποθεσία υπάρχει ακόμα και/ή ελέγξτε τις ρυθμίσεις του proxy σας! <= | |
| 206 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 207 | * * Η ΑΝΤΙΓΡΑΦΗ ΕΓΚΑΤΑΛΕΙΦΘΗΚΕ! * *\nΗ παρούσα προσωρινή cache είναι απαραίτητη για κάθε λειτουργία ανανέωσης και περιλαμβάνει μόνο δεδομένα που κατέβηκαν κατά τη διάρκεια της τωρινής εγκαταλελειμένης περιόδου.\nΗ προηγούμενη cache ίσως περιέχει πιο ολοκληρωμένες πληροφορίες. Αν δεν θέλετε να χάσετε αυτές τις πληροφορίες, πρέπει να να τις ανακτήσετε και να διαγράψετε την παρούσα cache.\n[Σημείωση: Αυτό μπορεί να γίνει εύκολα σβήνοντας τα αρχεία hts-cache/new.*]\n\nΝομίζετε πως η προηγούμενη cache ίσως περιέχει πιο ολοκληρωμένες πληροφορίες και θέλετε να την ανακτήσετε; | |
| 208 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 209 | * * ΣΦΑΛΜΑ ΑΝΤΙΓΡΑΦΗΣ * *\nΤο HTTraQt ανακάλυψε πως το παρόν αντίγραφο είναι άδειο. Αν ήταν μια ανανέωση, το προηγούμενο αντίγραφο ανακτήθηκε.\nΛόγος: Οι πρώτη(ες) σελίδα(ες) είτε δεν βρέθηκαν ή υπήρξε πρόβλημα κατά την σύνδεση.\n=> Επιβεβαιώστε ότι η τοποθεσία υπάρχει ακόμα και/ή ελέγξτε τις ρυθμίσεις του proxy σας! <= | |
| 210 | 210 | \n\nTip: Click [View log file] to see warning or error messages |
| 211 | 211 | \n\nΣυμβουλή: Κλικ στο [Προβολή αρχείο γεγονότων] για να δείτε μηνύματα προειδοποιήσεων ή λαθών |
| 212 | 212 | Error deleting a hts-cache/new.* file, please do it manually |
| 635 | 635 | Αποσύνδεση στο τέλος |
| 636 | 636 | Disconnect modem on completion |
| 637 | 637 | Αποσύνδεση του modem στο τέλος |
| 638 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 639 | \r\n(Παρακαλώ να μας ενημερώσετε για κάθε πρόβλημα ή bug)\r\n\r\nΑνάπτυξη:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for Greek translations to:\r\nMichael Papadakis (mikepap at freemail dot gr) | |
| 638 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 639 | \n(Παρακαλώ να μας ενημερώσετε για κάθε πρόβλημα ή bug)\n\nΑνάπτυξη:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for Greek translations to:\nMichael Papadakis (mikepap at freemail dot gr) | |
| 640 | 640 | About HTTraQt Website Copier |
| 641 | 641 | Σχετικά με το HTTraQt Website Copier |
| 642 | 642 | Please visit our Web page |
| 745 | 745 | &Πλοήγηση τοποθεσιών... |
| 746 | 746 | User-defined structure |
| 747 | 747 | Δομή ορισμένη από τον χρήστη |
| 748 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 749 | %n\tΌνομα αρχείου χωρίς τον τύπο του (πχ: image)\r\n%N\tΌνομα αρχείου με τον τύπο του (πχ: image.gif)\r\n%t\tΤύπος αρχείου μόνο (πχ: gif)\r\n%p\tΔιαδρομή [χωρίς / στο τέλος] (πχ: /someimages)\r\n%h\tΌνομα τοποθεσίας (πχ: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 φράση αναζήτησης (128 bits, 32 ascii bytes)\r\n%q\tMD5 μικρή φράση αναζήτησης (16 bits, 4 ascii bytes)\r\n\r\n%s?\tΜικρό όνομα όπως στο DOS (πχ: %sN) | |
| 748 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 749 | %n\tΌνομα αρχείου χωρίς τον τύπο του (πχ: image)\n%N\tΌνομα αρχείου με τον τύπο του (πχ: image.gif)\n%t\tΤύπος αρχείου μόνο (πχ: gif)\n%p\tΔιαδρομή [χωρίς / στο τέλος] (πχ: /someimages)\n%h\tΌνομα τοποθεσίας (πχ: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 φράση αναζήτησης (128 bits, 32 ascii bytes)\n%q\tMD5 μικρή φράση αναζήτησης (16 bits, 4 ascii bytes)\n\n%s?\tΜικρό όνομα όπως στο DOS (πχ: %sN) | |
| 750 | 750 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 751 | 751 | Παράδειγμα:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 752 | 752 | Proxy settings |
| 793 | 793 | Κατηγορία εργασίας: |
| 794 | 794 | C:\\My Web Sites |
| 795 | 795 | C:\\Οι Τοποθεσίες μου |
| 796 | Type a new project name, \r\nor select existing project to update/resume | |
| 797 | Τοποθετείστε ένα νέο όνομα εργασίας, \r\nή επιλέξτε μία υπάρχουσα εργασία για ανανέωση/συνέχιση | |
| 796 | Type a new project name, \nor select existing project to update/resume | |
| 797 | Τοποθετείστε ένα νέο όνομα εργασίας, \nή επιλέξτε μία υπάρχουσα εργασία για ανανέωση/συνέχιση | |
| 798 | 798 | New project |
| 799 | 799 | Νέα εργασία |
| 800 | 800 | Insert URL |
| 855 | 855 | Δεν υπάρχει αρκετή μνήμη, εσωτερικό καταστροφικό σφάλμα... |
| 856 | 856 | Unknown operation! |
| 857 | 857 | ’γνωστη λειτουργία! |
| 858 | Add this URL?\r\n | |
| 859 | Πρόσθεση αυτού του URL;\r\n | |
| 858 | Add this URL?\n | |
| 859 | Πρόσθεση αυτού του URL;\n | |
| 860 | 860 | Warning: main process is still not responding, cannot add URL(s).. |
| 861 | 861 | Προειδοποίηση: Το κυρίως process ακόμα δεν ανταποκρίνεται, δεν γίνεται να προστεθούν URL(s)... |
| 862 | 862 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | it |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Witold Krakowski (wkrakowski at libero.it)\r\n | |
| 7 | Witold Krakowski (wkrakowski at libero.it)\n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | I collegamenti soggetti a questa regola verranno accettati |
| 78 | 78 | Example: |
| 79 | 79 | Esempio: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nTroverà tutti i file gif | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nTroverà tutti i file contenenti blue, es. 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nTroverà il file 'bigfile.mov', ma non 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nTroverà i collegamenti con la cartella contenente 'cgi', es. /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nTroverà i collegamenti con la cartella contenente 'cgi-bin' (ma non cgi-bin-2, per esempio) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nTroverà tutti i collegamenti come www.someweb.com, private.someweb.com etc. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nTroverà tutti i collegamenti come www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nTroverà tutti i collegamenti come www.someweb.com/... (ma non collegamenti come private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nTroverà tutti i collegamenti come www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nTroverà soltanto il collegamenti www.test.com/test/someweb.html. Notate che bisogna inserire sia l'indirizo (www.xxx.yyy), che il percorso (/test/someweb.html) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nTroverà tutti i file gif | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nTroverà tutti i file contenenti blue, es. 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nTroverà il file 'bigfile.mov', ma non 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nTroverà i collegamenti con la cartella contenente 'cgi', es. /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nTroverà i collegamenti con la cartella contenente 'cgi-bin' (ma non cgi-bin-2, per esempio) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nTroverà tutti i collegamenti come www.someweb.com, private.someweb.com etc. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nTroverà tutti i collegamenti come www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nTroverà tutti i collegamenti come www.someweb.com/... (ma non collegamenti come private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nTroverà tutti i collegamenti come www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nTroverà soltanto il collegamenti www.test.com/test/someweb.html. Notate che bisogna inserire sia l'indirizo (www.xxx.yyy), che il percorso (/test/someweb.html) | |
| 100 | 100 | All links will match |
| 101 | 101 | Tutti i collegamenti verranno rifiutati/accettati |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | Verifica il log se necessario.\n\nClicca OK per uscire da HTTraQt.\n\nGrazie per aver usato HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Il mirror è finito.\nClicca OK per uscire da HTTraQt.\nGuarda i file log per assicurarti che tutto è andato a buon fine.\n\nGrazie per aver usato HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * MIRROR INTERROTTO! * *\r\nLa cache corrente è necessaria per le operazioni di aggiornamento e contiene solo i dati scaricati durante questa sessione interrotta.\r\nLa cache precedente potrebbe contenere informazioni più complete; se non vuoi perdere quelle informazioni, devi ripristinarla e cancellare la cache corrente.\r\n[Nota: per fare questo, cancella il contenuto della cartella hts-cache del mirror]\r\n\r\nPensi che la cache precedente possa contenere informazioni più complete e vuoi ripristinarla? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ERRORE NEL MIRROR! * *\r\nHTTraQt ha stabilito che il mirror attuale è vuoto. Se questo è un'aggiornamento, il mirror precedente è stato ripristinato.\r\nMotivo: la prima pagina(e) non è stata trovata oppure c'è stato un problema durante la connessione\r\n=> Assicuratevi che il sito esista ancora, e/o verificate le vostre impostazioni del proxy! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * MIRROR INTERROTTO! * *\nLa cache corrente è necessaria per le operazioni di aggiornamento e contiene solo i dati scaricati durante questa sessione interrotta.\nLa cache precedente potrebbe contenere informazioni più complete; se non vuoi perdere quelle informazioni, devi ripristinarla e cancellare la cache corrente.\n[Nota: per fare questo, cancella il contenuto della cartella hts-cache del mirror]\n\nPensi che la cache precedente possa contenere informazioni più complete e vuoi ripristinarla? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ERRORE NEL MIRROR! * *\nHTTraQt ha stabilito che il mirror attuale è vuoto. Se questo è un'aggiornamento, il mirror precedente è stato ripristinato.\nMotivo: la prima pagina(e) non è stata trovata oppure c'è stato un problema durante la connessione\n=> Assicuratevi che il sito esista ancora, e/o verificate le vostre impostazioni del proxy! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \nSuggerimento: Clicca [Visualizza filr di log] per vedere i messaggi di avvertimento o di errore |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Disconnetti alla fine |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Disconnetti il modem quando il mirror é finito |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(informateci degli errori o problemi)\r\n\rSviluppo:\r\nInterfacccia: Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for Italian translations to:\r\nWitold Krakowski (wkrakowski@libero.it) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(informateci degli errori o problemi)\n\rSviluppo:\nInterfacccia: Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for Italian translations to:\nWitold Krakowski (wkrakowski@libero.it) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | Informazioni su HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Visita i siti... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Struttura definita dall'utente |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | 747 | %n\tNome del file senza il tipo (es.: immagine)\n%N\tNome del file, incluso il tipo (es.: immagine)\n%t\tTipo del file (es.: gif)\n%p\tPercorso [senza fine /] (es.: /immagini)\n%h\tIl nome del host (es.: www.someweb.com)\n\n%s?\tVersione corta per il DOS (es.: %sN) |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Esempio:\t%h%p/%n.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Mie pagine Web |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Inserisci il nome del nuovo progetto, \r\no seleziona un progetto esistente per aggiornare/continuare | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Inserisci il nome del nuovo progetto, \no seleziona un progetto esistente per aggiornare/continuare | |
| 796 | 796 | New project |
| 797 | 797 | Nuovo progetto |
| 798 | 798 | Insert URL |
| 853 | 853 | Troppa poca memoria, grave errore interno... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Operazione sconosciuta! |
| 856 | Add this URL?\r\n | |
| 857 | Aggiungere questo URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Aggiungere questo URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Attenzione: il processo principale non risponde, non è possibile aggiungere URL. |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | hu |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Jozsef Tamas Herczeg (hdodi at freemail.hu) \r\n | |
| 7 | Jozsef Tamas Herczeg (hdodi at freemail.hu) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | A megegyező hivatkozásokat tartalmazni fogja: |
| 78 | 78 | Example: |
| 79 | 79 | Például: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nKiszűr minden GIF fájlt | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nMegkeres minden olyan fájlt, ami tartalmazza a 'blue' szöveget, azaz 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nKiszűri a 'bigfile.mov' fájlt, viszont a 'bigfile2.mov' fájlt nem | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nMegkeres minden olyan mappanév hivatkozást, ami tartalmazza a 'cgi' szöveget, azaz /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nMegkeres minden olyan mappanév hivatkozást, ami tartalmazza a teljes 'cgi-bin' szöveget (de a cgi-bin-2 már nem) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nMegkeres minden olyan hivatkozást, ami tartalmazza a www.someweb.com, private.someweb.com stb. szöveget | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nMegkeres minden olyan hivatkozást, ami tartalmazza a www.someweb.com, www.someweb.edu, private.someweb.otherweb.com stb. mappanév szöveget. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nMegkeres minden olyan hivatkozást, ami tartalmazza a teljes 'www.someweb.com' szöveget (de nem olyan hivatkozásokat, mint a private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nMegkeres minden olyan hivatkozást, ami tartalmazza a www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html stb. szövegeket. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nCsak a www.test.com/test/someweb.html fájlt keresi meg. Jegyezze meg, hogy be kell írnia a teljes útvonalat (URL + elérési út) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nKiszűr minden GIF fájlt | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nMegkeres minden olyan fájlt, ami tartalmazza a 'blue' szöveget, azaz 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nKiszűri a 'bigfile.mov' fájlt, viszont a 'bigfile2.mov' fájlt nem | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nMegkeres minden olyan mappanév hivatkozást, ami tartalmazza a 'cgi' szöveget, azaz /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nMegkeres minden olyan mappanév hivatkozást, ami tartalmazza a teljes 'cgi-bin' szöveget (de a cgi-bin-2 már nem) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nMegkeres minden olyan hivatkozást, ami tartalmazza a www.someweb.com, private.someweb.com stb. szöveget | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nMegkeres minden olyan hivatkozást, ami tartalmazza a www.someweb.com, www.someweb.edu, private.someweb.otherweb.com stb. mappanév szöveget. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nMegkeres minden olyan hivatkozást, ami tartalmazza a teljes 'www.someweb.com' szöveget (de nem olyan hivatkozásokat, mint a private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nMegkeres minden olyan hivatkozást, ami tartalmazza a www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html stb. szövegeket. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nCsak a www.test.com/test/someweb.html fájlt keresi meg. Jegyezze meg, hogy be kell írnia a teljes útvonalat (URL + elérési út) | |
| 100 | 100 | All links will match |
| 101 | 101 | Minden hivatkozást egyeztet |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | \nNézze meg a naplófájlt, ha szükséges.\n\nKattintson a BEFEJEZÉS gombra a HTTraQt webhely másolóból való kilépéshez.\n\nKöszönet a HTTraQt használatáért! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | A tükrözés befejeződött.\nKattintson az OK gombra a HTTraQt bezárásához.\nNézze meg a naplófájl(oka)t, ha szükséges, hogy meggyőződjön róla, minden rendben van-e.\n\nKöszönet a HTTraQt használatáért! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * TÜKRÖZÉS MEGSZAKÍTVA! * *\r\nA frissítéshez az aktuális ideiglenes gyorsítótárra van szükség, és csak az imént megszakított művelettel letöltött adatokat tartalmazza.\r\nA régi gyorsítótár bizonyára több információt tartalmaz; ha nem akarja elveszíteni azt az információt, vissza kell állítania és törölnie a jelenlegi gyorsítótárat.\r\n[Megjegyzés: Ez könnyen elvégezhető itt a hts-cache/new fájlok* törlésével.]\r\n\r\nÚgy gondolja, hogy a régi gyorsítótár teljesebb információt tartalmazhat, és vissza kívánja állítani? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * TÜKRÖZÉSI HIBA! * *\r\nA HTTraQt felismerte, hogy az aktuális tükrözés üres. Ha frissítés volt, vissza lett állítva az előző tükrözés.\r\nOk: az első oldal(ak) vagy nem találhatók, vagy csatlakozási probléma lépett föl.\r\n=> Nézze meg, hogy a webhely létezik-e még, és/vagy ellenőrizze a proxy beállításokat! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * TÜKRÖZÉS MEGSZAKÍTVA! * *\nA frissítéshez az aktuális ideiglenes gyorsítótárra van szükség, és csak az imént megszakított művelettel letöltött adatokat tartalmazza.\nA régi gyorsítótár bizonyára több információt tartalmaz; ha nem akarja elveszíteni azt az információt, vissza kell állítania és törölnie a jelenlegi gyorsítótárat.\n[Megjegyzés: Ez könnyen elvégezhető itt a hts-cache/new fájlok* törlésével.]\n\nÚgy gondolja, hogy a régi gyorsítótár teljesebb információt tartalmazhat, és vissza kívánja állítani? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * TÜKRÖZÉSI HIBA! * *\nA HTTraQt felismerte, hogy az aktuális tükrözés üres. Ha frissítés volt, vissza lett állítva az előző tükrözés.\nOk: az első oldal(ak) vagy nem találhatók, vagy csatlakozási probléma lépett föl.\n=> Nézze meg, hogy a webhely létezik-e még, és/vagy ellenőrizze a proxy beállításokat! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \nTipp: Kattintson a [Naplófájl megjelenítése] menüpontra a figyelmeztetések vagy hibaüzenetek megtekintéséhez |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Vonalbontás, ha kész |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Modem leválasztása, ha kész |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Kérjük, jelezzen nekünk bármilyen hibát vagy problémát)\r\n\r\nFejlesztés:\r\nKezelőfelület (Windows): Xavier Roche\r\nIndexelés: Xavier Roche\r\nJavaElemzőOsztályok: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nEZER KÖSZÖNET a magyar fordításért:\r\nHerczeg József Tamásnak (hdodi@freemail.hu) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Kérjük, jelezzen nekünk bármilyen hibát vagy problémát)\n\nFejlesztés:\nKezelőfelület (Windows): Xavier Roche\nIndexelés: Xavier Roche\nJavaElemzőOsztályok: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nEZER KÖSZÖNET a magyar fordításért:\nHerczeg József Tamásnak (hdodi@freemail.hu) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | HTTraQt webhely másoló névjegye |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | Webhelyek &böngészése... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Felhasználói meghatározású szerkezet |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tFájlnév fájltípus nélkül (kiv: kép)\r\n%N\tFájlnév fájltípussal (kiv: kep.gif)\r\n%t\tCsak fájltípus (kiv: gif)\r\n%p\tÚtvonal [vég nélkül /] (kiv: /nehanykep)\r\n%h\tKiszolgáló neve (kiv: www.someweb.com)\r\n%M\tMD5 URL (128 bit, 32 ascii bájt)\r\n%Q\tMD5 keresendő szöveg (128 bit, 32 ascii bájt)\r\n%q\tMD5 kis keresési szöveg (16 bit, 4 ascii bájt)\r\n\r\n%s?\tRövid név (kiv: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tFájlnév fájltípus nélkül (kiv: kép)\n%N\tFájlnév fájltípussal (kiv: kep.gif)\n%t\tCsak fájltípus (kiv: gif)\n%p\tÚtvonal [vég nélkül /] (kiv: /nehanykep)\n%h\tKiszolgáló neve (kiv: www.someweb.com)\n%M\tMD5 URL (128 bit, 32 ascii bájt)\n%Q\tMD5 keresendő szöveg (128 bit, 32 ascii bájt)\n%q\tMD5 kis keresési szöveg (16 bit, 4 ascii bájt)\n\n%s?\tRövid név (kiv: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Példa:\t%h%p/%n%q.%t\n->\t\tc:\\tukor\\www.someweb.com\\nehanykep\\kep.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Letoltott weblapok |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Írja be az új projekt nevét, \r\nvagy jelöljön ki létező projektet a frissítéshez/folytatáshoz | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Írja be az új projekt nevét, \nvagy jelöljön ki létező projektet a frissítéshez/folytatáshoz | |
| 796 | 796 | New project |
| 797 | 797 | Új projekt |
| 798 | 798 | Insert URL |
| 853 | 853 | Nincs elég memória, végzetes belső hiba. |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Ismeretlen művelet! |
| 856 | Add this URL?\r\n | |
| 857 | Hozzáadja az URL-t?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Hozzáadja az URL-t?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Figyelem! A fő folyamat még nem válaszol, nem lehet URL-(eke)t hozzáadni.. |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | nl |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Rudi Ferrari (Wyando at netcologne.de) \r\n | |
| 7 | Rudi Ferrari (Wyando at netcologne.de) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Links volgens deze regel worden aanvaard: |
| 78 | 78 | Example: |
| 79 | 79 | Voorbeeld: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nZal alle gif (of GIF) bestanden vinden | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nZal alle bestanden met blue vinden, zoals 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nZal het bestand 'bigfile.mov' vinden, maar niet 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nZal links vinden met directories die 'cgi' bevatten, zoals /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nZal links vinden met directory naam 'cgi-bin' (maar niet bevoorbeeld: cgi-bin-2) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nZal alle links vinden zoals www.someweb.com, private.someweb.com etc. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nZal alle links vinden zoals www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nZal alle links vinden zoals www.someweb.com/... (maar geen links zoals private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nZal alle links vinden zoals www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nZal enkel de link www.test.com/test/someweb.html vinden. Merk op dat je zowel het adres (www.xxx.yyy) alsook de pad (/test/someweb.html) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nZal alle gif (of GIF) bestanden vinden | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nZal alle bestanden met blue vinden, zoals 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nZal het bestand 'bigfile.mov' vinden, maar niet 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nZal links vinden met directories die 'cgi' bevatten, zoals /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nZal links vinden met directory naam 'cgi-bin' (maar niet bevoorbeeld: cgi-bin-2) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nZal alle links vinden zoals www.someweb.com, private.someweb.com etc. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nZal alle links vinden zoals www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nZal alle links vinden zoals www.someweb.com/... (maar geen links zoals private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nZal alle links vinden zoals www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nZal enkel de link www.test.com/test/someweb.html vinden. Merk op dat je zowel het adres (www.xxx.yyy) alsook de pad (/test/someweb.html) | |
| 100 | 100 | All links will match |
| 101 | 101 | Alle links zullen uitgesloten/aanvaard worden |
| 102 | 102 | Add exclusion filter |
| 196 | 196 | A problem occured during the mirroring operation\n |
| 197 | 197 | Een probleem is opgetreden tijdens de spiegeling\n |
| 198 | 198 | \nDuring:\n |
| 199 | \r\n\nTijdens:\n\r\n | |
| 199 | \n\nTijdens:\n\n | |
| 200 | 200 | \nSee the log file if necessary.\n\nClick FINISH to quit HTTraQt Website Copier.\n\nThanks for using HTTraQt! |
| 201 | 201 | Indien noodzakelijk, zie in het protocolbestand.\n\nKlik OK om HTTraQt Website Copier te beëindigen.\n\nAlvast bedankt voor het gebruik van HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | De spiegeling is uitgevoerd.\nKlik OK om HTTraQt te beëindigen.\nIndien nodig, zie protocolbestand(en) om zeker te gaan dat alles OK is\n\nAlvast bedankt voor het gebruik van HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * SPIEGELING AFGEBROKEN! * *\r\nDe aktuele tijdelijke cache is noodzakelijk voor gelijkwelke update operatie en bevat enkel data gedownload gedurende de zoeven afgebroken sessie.\r\nDe eerste cache kan juistere informaties bevatten; indien je deze informatie niet wenst te verliezen, dan moet je deze restoren and de aktuele cache wissen.\r\n[Opmerking: Dit is het eenvoudigst door het wissen van de hts-cache/new.* bestanden]\r\n\r\nDenk je dat de eerste cache juistere informaties bevat, en wil je deze restoren? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * FOUT MET DE SPIEGELING * *\r\nHTTraQt heeft vastgesteld dat de aktuele spiegeling leeg is. Indien het een update was, is de vorige copie terug actueel.\r\nReden: de eerste pagina(s) konden ofwel niet gevonden worden, of er was een probleem met de connectie.\r\n=> Verzeker je ervan, dat de website nog steeds bestaat en/of je proxy settings correct zijn! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * SPIEGELING AFGEBROKEN! * *\nDe aktuele tijdelijke cache is noodzakelijk voor gelijkwelke update operatie en bevat enkel data gedownload gedurende de zoeven afgebroken sessie.\nDe eerste cache kan juistere informaties bevatten; indien je deze informatie niet wenst te verliezen, dan moet je deze restoren and de aktuele cache wissen.\n[Opmerking: Dit is het eenvoudigst door het wissen van de hts-cache/new.* bestanden]\n\nDenk je dat de eerste cache juistere informaties bevat, en wil je deze restoren? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * FOUT MET DE SPIEGELING * *\nHTTraQt heeft vastgesteld dat de aktuele spiegeling leeg is. Indien het een update was, is de vorige copie terug actueel.\nReden: de eerste pagina(s) konden ofwel niet gevonden worden, of er was een probleem met de connectie.\n=> Verzeker je ervan, dat de website nog steeds bestaat en/of je proxy settings correct zijn! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | :\r\n\n\nTip: Klik [Toon protocolbestand] voor de fouten en mededelingen\r\n | |
| 209 | :\n\n\nTip: Klik [Toon protocolbestand] voor de fouten en mededelingen\n | |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 211 | 211 | Het wissen van hts-cache/new.* bestanden is niet gelukt, gelieve dit manueel te doen |
| 212 | 212 | Do you really want to quit HTTraQt Website Copier? |
| 633 | 633 | Indien gedaan verbinding verbreken |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Indien gedaan modemverbinding verbreken |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Ons fouten en problemen mede te delen)\r\n\r\nOntwikkeling:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for Dutch translations to:\r\nRudi Ferrari (Wyando@netcologne.de) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Ons fouten en problemen mede te delen)\n\nOntwikkeling:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for Dutch translations to:\nRudi Ferrari (Wyando@netcologne.de) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | Over HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | We&bpaginas aantonen... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Struktuur door de gebruiker gedefiniëerd |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNaam van het bestand zonder extensie (bv: image)\r\n%N\tNaam van het bestand met extensie (bv: image.gif)\r\n%t\tBestandstype (bv: gif)\r\n%p\tPath [zonder / op het einde] (bv: /someimages)\r\n%h\tHost naam (ex: www.someweb.com)\r\n%M\tURL MD5 (128 bits, 32 ascii bytes)\r\n%Q\tquery string MD5 (128 bits, 32 ascii bytes)\r\n%q\tsmall query string MD5 (16 bits, 4 ascii bytes)\r\n\r\n%s?\tkorte naam versie (ex: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNaam van het bestand zonder extensie (bv: image)\n%N\tNaam van het bestand met extensie (bv: image.gif)\n%t\tBestandstype (bv: gif)\n%p\tPath [zonder / op het einde] (bv: /someimages)\n%h\tHost naam (ex: www.someweb.com)\n%M\tURL MD5 (128 bits, 32 ascii bytes)\n%Q\tquery string MD5 (128 bits, 32 ascii bytes)\n%q\tsmall query string MD5 (16 bits, 4 ascii bytes)\n\n%s?\tkorte naam versie (ex: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Voorbeeld:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Mijn Web paginas |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Geef een nieuw projectnaam, \r\nof kies een bestaand project voor update/voortzetting\r\n | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Geef een nieuw projectnaam, \nof kies een bestaand project voor update/voortzetting\n | |
| 796 | 796 | New project |
| 797 | 797 | Nieuw project |
| 798 | 798 | Insert URL |
| 844 | 844 | Select user-defined structure? |
| 845 | 845 | Gebruikersdefiniëeerde struktuur kiezen? |
| 846 | 846 | Please ensure that the user-defined-string is correct,\notherwise filenames will be bogus! |
| 847 | Verzeker je ervan, dat de gebruikersdefiniëeerde struktuur correct is.\nIndien niet, zullen de bestandsnamen verkeerd zijn.\r\n | |
| 847 | Verzeker je ervan, dat de gebruikersdefiniëeerde struktuur correct is.\nIndien niet, zullen de bestandsnamen verkeerd zijn.\n | |
| 848 | 848 | Do you really want to use a user-defined structure? |
| 849 | 849 | Wil je werkelijk de gebruikersdefiniëerde struktuur kiezen? |
| 850 | 850 | Too manu URLs, cannot handle so many links!! |
| 853 | 853 | Niet genoeg geheugen, fatale interne fout... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Onbekende operatie! |
| 856 | Add this URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | 857 | Deze URL toevoegen?\r |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Waarschuwing: hoofd proces antwoord niet, kann geen URLs toevoegen |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | no |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Tobias "Spug" Langhoff (Dark Spug at hazardlabs.com )\r\n[ spug_enigma@hotmail.com ] \r\n | |
| 7 | Tobias "Spug" Langhoff (Dark Spug at hazardlabs.com )\n[ spug_enigma@hotmail.com ] \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Følgende matchende linker vil bli inkludert: |
| 78 | 78 | Example: |
| 79 | 79 | Eksempel: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nMatcher alle GIF-filer | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nFinner alle filer med matchende tekst. Skriver du f.eks. 'blue' lastes 'bluesky-small.jpeg' ned. | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nFinner filen 'bigfile.mov', men ikke 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nFinner linker med mappenavn som matcher tekststrengen 'cgi', f.eks. /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nFinner linker med mappenavn som matcher hele 'cgi-bin'-strengen (men ikke cgi-bin-2, for eksempel) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nFinner linker med matchende tekststreng, som f.eks www.someweb.com, private.someweb.com osv. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nFinner linker med mappenavn som matcher tekststrengen 'someweb', for eksempel www.someweb.com, www.someweb.no, private.someweb.otherweb.com osv. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nFinner linker som matcher hele 'www.someweb.com'-strengen (men ikke linker som f.eks private.someweb.com/.. osv.) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nFinner alle linker med matchende tekststreng, som for eksempel www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html osv. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nFinner bare filen 'www.test.com/test/someweb.html'. Legg merke til at du må skrive hele adressen (URL + mappenavn) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nMatcher alle GIF-filer | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nFinner alle filer med matchende tekst. Skriver du f.eks. 'blue' lastes 'bluesky-small.jpeg' ned. | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nFinner filen 'bigfile.mov', men ikke 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nFinner linker med mappenavn som matcher tekststrengen 'cgi', f.eks. /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nFinner linker med mappenavn som matcher hele 'cgi-bin'-strengen (men ikke cgi-bin-2, for eksempel) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nFinner linker med matchende tekststreng, som f.eks www.someweb.com, private.someweb.com osv. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nFinner linker med mappenavn som matcher tekststrengen 'someweb', for eksempel www.someweb.com, www.someweb.no, private.someweb.otherweb.com osv. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nFinner linker som matcher hele 'www.someweb.com'-strengen (men ikke linker som f.eks private.someweb.com/.. osv.) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nFinner alle linker med matchende tekststreng, som for eksempel www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html osv. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nFinner bare filen 'www.test.com/test/someweb.html'. Legg merke til at du må skrive hele adressen (URL + mappenavn) | |
| 100 | 100 | All links will match |
| 101 | 101 | Alle linker matcher |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | \nVis loggen hvis nødvendig.\n\nKlikk på AVSLUTT for å avslutte HTTraQt Website Copier.\n\nTakk for at du brukte HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Kopieringen er fullført.\nKlikk AVSLUTT for å avslutte HTTraQt.\nVis loggfil(er) vis det er nødvendig, for å sjekke at alt er OK.\n\nTakk for at du brukte HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * KOPIERINGEN ER AVBRUTT! * *\r\nDen nåværende midlertidige cachen er obligatorisk for alle oppdateringsoperasjoner, og inneholder bare data fra den siste avbrutte kopieringsprosessen.\r\nDen tidligere cachen kan inneholde fyldigere informasjon; hvis du ønsker å beholde den informasjonen må du gjenopprette den og slette den aktuelle cachen.\r\n[OBS: Dette kan lettest gjøres ved å slette alle 'hts-cache/new.*'-filer]\r\n\r\nTror du den tidligere cache-filen kanskje inneholder fyldigere informasjon, og vil du gjenopprette den? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * KOPIERINGSFEIL! * *\r\nHttrack har oppdaget at den gjeldende websiden er tom. Hvis du var i gang med å oppdatere enn kopi, vil det gamle innholdet bli gjenopprettet.\r\nMulig årsak: Den første siden kunne enten ikke finnes, eller det oppstod et problem med forbindelsen.\r\n=> Kontroller at websiden fremdeles finnes, og/eller sjekk proxy-innstillingene dine! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * KOPIERINGEN ER AVBRUTT! * *\nDen nåværende midlertidige cachen er obligatorisk for alle oppdateringsoperasjoner, og inneholder bare data fra den siste avbrutte kopieringsprosessen.\nDen tidligere cachen kan inneholde fyldigere informasjon; hvis du ønsker å beholde den informasjonen må du gjenopprette den og slette den aktuelle cachen.\n[OBS: Dette kan lettest gjøres ved å slette alle 'hts-cache/new.*'-filer]\n\nTror du den tidligere cache-filen kanskje inneholder fyldigere informasjon, og vil du gjenopprette den? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * KOPIERINGSFEIL! * *\nHttrack har oppdaget at den gjeldende websiden er tom. Hvis du var i gang med å oppdatere enn kopi, vil det gamle innholdet bli gjenopprettet.\nMulig årsak: Den første siden kunne enten ikke finnes, eller det oppstod et problem med forbindelsen.\n=> Kontroller at websiden fremdeles finnes, og/eller sjekk proxy-innstillingene dine! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \n\nTips: Klikk på [Vis loggfil] for å se advarsler og feilmeldinger |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Koble fra når fullført |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Koble fra modem når fullført |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Vennligst fortell oss om feil eller problemer med programmet)\r\n\r\nUtvikling (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche og andre bidragsytere\r\n\r\nNorwegian translation:\r\nTobias "Spug" Langhoff ( spug_enigma@hotmail.com ) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Vennligst fortell oss om feil eller problemer med programmet)\n\nUtvikling (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche og andre bidragsytere\n\nNorwegian translation:\nTobias "Spug" Langhoff ( spug_enigma@hotmail.com ) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | Om HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | Forhåndsvis webside... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Brukerdefinert struktur |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tFilnavn uten filtype (f.eks bilde)\r\n%N\tFilnavn MED filtype (f.eks bilde.gif)\r\n%t\tBare filtype (f.eks gif)\r\n%p\tBane [uten slutt-/] (f.eks /bilder)\r\n%h\tVertsnavn (f.eks www.someweb.com)\r\n%M\tMD5-URL (128-biters, 32 ASCII-bytes)\r\n%Q\tMD5-forespørsels-streng (128-biters, 32 ASCII-bytes(\r\n%q\tKort MD5-forespørsels-streng (16-biters, 4 ASCII-bytes)\r\n\r\n%s?\tKort navn (f.eks %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tFilnavn uten filtype (f.eks bilde)\n%N\tFilnavn MED filtype (f.eks bilde.gif)\n%t\tBare filtype (f.eks gif)\n%p\tBane [uten slutt-/] (f.eks /bilder)\n%h\tVertsnavn (f.eks www.someweb.com)\n%M\tMD5-URL (128-biters, 32 ASCII-bytes)\n%Q\tMD5-forespørsels-streng (128-biters, 32 ASCII-bytes(\n%q\tKort MD5-forespørsels-streng (16-biters, 4 ASCII-bytes)\n\n%s?\tKort navn (f.eks %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Eksempel:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\bilder\\bilde.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Mine websider |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Skriv inn et nytt prosjektnavn, \r\neller velg et eksisterende prosjekt du vil oppdatere/fortsette på | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Skriv inn et nytt prosjektnavn, \neller velg et eksisterende prosjekt du vil oppdatere/fortsette på | |
| 796 | 796 | New project |
| 797 | 797 | Nytt prosjekt |
| 798 | 798 | Insert URL |
| 853 | 853 | Ikke nok minne, fatal intern feil... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Ukjent kommando! |
| 856 | Add this URL?\r\n | |
| 857 | Legg til denne URLen?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Legg til denne URLen?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Advarsel: hovedprosessen svarer fremdeles ikke, URLen(e) kan ikke legges til... |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | pl |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Lukasz Jokiel (Opole University of Technology, Lukasz.Jokiel at po.opole.pl) \r\n | |
| 7 | Lukasz Jokiel (Opole University of Technology, Lukasz.Jokiel at po.opole.pl) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Łšcza objęte tš regułš zostanš zaakceptowane: |
| 78 | 78 | Example: |
| 79 | 79 | Przykład: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nZnajdzie wszystkie gify | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | niebieskie\r\nZnajdzie wszystkie pliki zawierajšce człon 'niebieskie', takie jak 'niebieskieniebo-maly.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | duzyplik.mov\r\nZnajdzie plik 'duzyplik.mov', ale nie 'duzyplik.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nZnajdzie łšcza z katalogiem zawierajšcym 'cgi' takie jak '/cgi-bin/pewnecgi.cgi' | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nZnajdzie łšcza z katalogiem zawierajšcym 'cgi-bin', ale na przykład nie 'cgi-bin-2' | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | pewnastrona.com\r\nZnajdzie wszystkie łšcza takie jak www.pewnastrona.com, members.pewnastrona.com itd. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | pewnastrona\r\nZnajdzie wszystkie łšcza takie jak www.pewnastrona.com, www.pewnastrona.pl, www.pewnastrona.innastrona.edu itd. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.pewnastrona.com\r\nZnajdzie wszystkie łšcza takie jak www.pewnastrona.com/ ... (lecz nie takie jak members.pewnastrona.com/...) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | pewnastrona\r\nZnajdzie wszystkie łacza takie jak www.pewnastrona.com/.., www.test.abc/mojapewnastrona/index.html, www.test.abc/test/pewnastrona.html itd. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/pewnastrona.html\r\nZnajdzie tylko łšcza typu www.test.com/test/pewnastrona.html. Zauważ, że należy wpisać zarówno adres (www.xxx.yyy), jak i cieżkę (/test/pewnastrona.html) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nZnajdzie wszystkie gify | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | niebieskie\nZnajdzie wszystkie pliki zawierajšce człon 'niebieskie', takie jak 'niebieskieniebo-maly.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | duzyplik.mov\nZnajdzie plik 'duzyplik.mov', ale nie 'duzyplik.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nZnajdzie łšcza z katalogiem zawierajšcym 'cgi' takie jak '/cgi-bin/pewnecgi.cgi' | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nZnajdzie łšcza z katalogiem zawierajšcym 'cgi-bin', ale na przykład nie 'cgi-bin-2' | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | pewnastrona.com\nZnajdzie wszystkie łšcza takie jak www.pewnastrona.com, members.pewnastrona.com itd. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | pewnastrona\nZnajdzie wszystkie łšcza takie jak www.pewnastrona.com, www.pewnastrona.pl, www.pewnastrona.innastrona.edu itd. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.pewnastrona.com\nZnajdzie wszystkie łšcza takie jak www.pewnastrona.com/ ... (lecz nie takie jak members.pewnastrona.com/...) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | pewnastrona\nZnajdzie wszystkie łacza takie jak www.pewnastrona.com/.., www.test.abc/mojapewnastrona/index.html, www.test.abc/test/pewnastrona.html itd. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/pewnastrona.html\nZnajdzie tylko łšcza typu www.test.com/test/pewnastrona.html. Zauważ, że należy wpisać zarówno adres (www.xxx.yyy), jak i cieżkę (/test/pewnastrona.html) | |
| 100 | 100 | All links will match |
| 101 | 101 | Wszystkie łacza będš akceptowane/ignorowane (odrzucone) |
| 102 | 102 | Add exclusion filter |
| 152 | 152 | Unable to initialize the OLE system |
| 153 | 153 | Nie moge zainicjalizowac OLE |
| 154 | 154 | HTTraQt could not find any interrupted download file cache in the specified folder! |
| 155 | W tym katalogu nie ma cache\r\nHTTraQt nie może znaleć żadnego przerwanego lustra (mirroru) | |
| 155 | W tym katalogu nie ma cache\nHTTraQt nie może znaleć żadnego przerwanego lustra (mirroru) | |
| 156 | 156 | Could not connect to provider |
| 157 | 157 | Połšczenie z usługodawcš było niemożliwe |
| 158 | 158 | receive |
| 194 | 194 | Site mirroring finished! |
| 195 | 195 | Zakończono tworzenie lustra (mirroru) |
| 196 | 196 | A problem occured during the mirroring operation\n |
| 197 | Poajwił się problem podczas tworzenia lustra\r\n | |
| 197 | Poajwił się problem podczas tworzenia lustra\n | |
| 198 | 198 | \nDuring:\n |
| 199 | Podczas:\r\n | |
| 199 | Podczas:\n | |
| 200 | 200 | \nSee the log file if necessary.\n\nClick FINISH to quit HTTraQt Website Copier.\n\nThanks for using HTTraQt! |
| 201 | Jeżeli jest to wymagane sprawd logi.\r\nKliknij OK aby wyjć z HTTraQt Website Copier.\r\nDziękujemy za używanie HTTraQt ! | |
| 201 | Jeżeli jest to wymagane sprawd logi.\nKliknij OK aby wyjć z HTTraQt Website Copier.\nDziękujemy za używanie HTTraQt ! | |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | Zakończono tworzenie lustra.\r\nKliknij OK aby wyjć z HTTraQt.\r\nSprawd logi, upewnij się, czy wszystko przebiegło dobrze.\r\nDziękujemy za używanie HTTraQt ! | |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * TWORZENIE LUSTRA PRZERWANE! * *\r\nObecnie wykorzystywany cache, wymagany dla jakichkolwiek operacji uaktualniajšcych zawiera jedynie dane z obecnej przerwanej sesji.\r\nPoprzedni cache może zawierać bardziej kompletne dane; jeli nie chcesz ich stracić, przywróć je i usuń obecny cache.\r\n[Uwaga: Możesz to łatwo zrobić tutaj poprzez skasowanie htscache/new.* pliki]\r\nCzy uważasz, że poprzedni cache może zawierać bardziej kompletne informacje i czy przywrócić go ? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * BŁĄD LUSTRA! * *\r\nHTtrack stwierdza ze obecne lustro jest puste. Jeśli było to uaktualnienie, to przywrócono poprzednią wersję lustra. Powód: Nie można było odczytać pierwszych stron lub wystąpił błąd połączenia.\r\n=> Upewnij się czy strona ciągle istnieje, lub też sprawdź ustawienia proxy! <= | |
| 203 | Zakończono tworzenie lustra.\nKliknij OK aby wyjć z HTTraQt.\nSprawd logi, upewnij się, czy wszystko przebiegło dobrze.\nDziękujemy za używanie HTTraQt ! | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * TWORZENIE LUSTRA PRZERWANE! * *\nObecnie wykorzystywany cache, wymagany dla jakichkolwiek operacji uaktualniajšcych zawiera jedynie dane z obecnej przerwanej sesji.\nPoprzedni cache może zawierać bardziej kompletne dane; jeli nie chcesz ich stracić, przywróć je i usuń obecny cache.\n[Uwaga: Możesz to łatwo zrobić tutaj poprzez skasowanie htscache/new.* pliki]\nCzy uważasz, że poprzedni cache może zawierać bardziej kompletne informacje i czy przywrócić go ? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * BŁĄD LUSTRA! * *\nHTtrack stwierdza ze obecne lustro jest puste. Jeśli było to uaktualnienie, to przywrócono poprzednią wersję lustra. Powód: Nie można było odczytać pierwszych stron lub wystąpił błąd połączenia.\n=> Upewnij się czy strona ciągle istnieje, lub też sprawdź ustawienia proxy! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | Tip: Kliknij (Pokaż logi) aby zobaczyć informacje o błędach i ostrzeżeniach |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 270 | 270 | Load URL(s) from text file |
| 271 | 271 | Wczytaj URLe z pliku tekstowego |
| 272 | 272 | HTTraQt preferences (*.opt)|*.opt|| |
| 273 | Opcje HTTraQt (*.opt)|*.opt|\r\n | |
| 273 | Opcje HTTraQt (*.opt)|*.opt|\n | |
| 274 | 274 | Address List text file (*.txt)|*.txt|| |
| 275 | 275 | Tekstowy plik z adresami (*.txt)|*.txt|| |
| 276 | 276 | File not found! |
| 633 | 633 | Zakończ połšczenie z usługodawcš po pobraniu |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Po pobraniu rozłšcz modem |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(proszę poinformować nas o jakichkolwiek błędach w działaniu programu)\r\n\r\nTwórcy:\r\nInterfejs(Windows): Xavier Roche\r\nMotor: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nPolska wersja językowa: Łukasz Jokiel (Opole University of Technology, Lukasz.Jokiel@po.opole.pl) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(proszę poinformować nas o jakichkolwiek błędach w działaniu programu)\n\nTwórcy:\nInterfejs(Windows): Xavier Roche\nMotor: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nPolska wersja językowa: Łukasz Jokiel (Opole University of Technology, Lukasz.Jokiel@po.opole.pl) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | O... HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Przeglądaj strony sieciowe... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Struktura zdefiniowana przez użytkownika |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\r\nNazwa pliku bez typu pliku (np: image)\r\n%N\r\nNazwa wraz z typem pliku (np: image.gif)\r\n%t\r\nTyp pliku (np: .gif)\r\n%p\r\nScieżka [bez końcowego /] (np: /pewneobrazki)\r\n%h\r\nNazwa hosta (np: www.pewnyhost.com)\r\n%s?\r\n%M\tURL MD5 (128 bits, 32 ascii bytes)\r\n%Q\tquery string MD5 (128 bits, 32 ascii bytes)\r\n%q\tsmall query string MD5 (16 bits, 4 ascii bytes)\r\n\r\nKrótka wersja dla DOS (np: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\nNazwa pliku bez typu pliku (np: image)\n%N\nNazwa wraz z typem pliku (np: image.gif)\n%t\nTyp pliku (np: .gif)\n%p\nScieżka [bez końcowego /] (np: /pewneobrazki)\n%h\nNazwa hosta (np: www.pewnyhost.com)\n%s?\n%M\tURL MD5 (128 bits, 32 ascii bytes)\n%Q\tquery string MD5 (128 bits, 32 ascii bytes)\n%q\tsmall query string MD5 (16 bits, 4 ascii bytes)\n\nKrótka wersja dla DOS (np: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | Przykład:\r\n%h%p/%n%q.%t\r\n-> \t\tc:\\mirror\\www.pewienhost.com\\pewneobrazki\\obrazek.gif | |
| 749 | Przykład:\n%h%p/%n%q.%t\n-> \t\tc:\\mirror\\www.pewienhost.com\\pewneobrazki\\obrazek.gif | |
| 750 | 750 | Proxy settings |
| 751 | 751 | Ustawienia proxy |
| 752 | 752 | Proxy address: |
| 791 | 791 | Projekt - kategoria: |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Moje Strony Web |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Wpisz nazwę nowego projektu,\r\nalbo wybierz istniejšcy projekt, który chesz kontunuować/uaktualnić | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Wpisz nazwę nowego projektu,\nalbo wybierz istniejšcy projekt, który chesz kontunuować/uaktualnić | |
| 796 | 796 | New project |
| 797 | 797 | Nowy projekt |
| 798 | 798 | Insert URL |
| 822 | 822 | Catch URL! |
| 823 | 823 | Pobierz URL! |
| 824 | 824 | Please set temporary browser proxy settings to the following values (Copy/Paste Proxy Address and Port).\nThen click on the Form SUBMIT button in your browser page, or click on the specific link you want to capture. |
| 825 | Proszę tymczasowo ustawić proxy w Twojej przeglšdarce (lub Ustawieniach Internetowych) na następujšce: (wytnij/wstaw adres proxy oraz port).\r\nNastępnie w przeglšdarce, kliknij na formularzu lub kliknij łšcze, które chcesz pobrać. | |
| 825 | Proszę tymczasowo ustawić proxy w Twojej przeglšdarce (lub Ustawieniach Internetowych) na następujšce: (wytnij/wstaw adres proxy oraz port).\nNastępnie w przeglšdarce, kliknij na formularzu lub kliknij łšcze, które chcesz pobrać. | |
| 826 | 826 | This will send the desired link from your browser to HTTraQt. |
| 827 | 827 | Ta operacja przechwyci łšcze z Twojej przeglšdarki do HTTraQt'a |
| 828 | 828 | ABORT |
| 844 | 844 | Select user-defined structure? |
| 845 | 845 | Wybrać zdefiniowanš przez użytkownika strukturę ? |
| 846 | 846 | Please ensure that the user-defined-string is correct,\notherwise filenames will be bogus! |
| 847 | Upewnij się czy zdefiniowane przez użytkownika cišgi (strings) sš poprawne\r\nJeli tego nie zrobisz to nazwy plików będš wyglšdały bardzo dziwnie! | |
| 847 | Upewnij się czy zdefiniowane przez użytkownika cišgi (strings) sš poprawne\nJeli tego nie zrobisz to nazwy plików będš wyglšdały bardzo dziwnie! | |
| 848 | 848 | Do you really want to use a user-defined structure? |
| 849 | 849 | Czy naprawdę chcesz wybrać zdefiniowanš przez użytkownika strukturę? |
| 850 | 850 | Too manu URLs, cannot handle so many links!! |
| 853 | 853 | Za mało pamięci, fatalny błšd wewnętrzny... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Nieznana operacja! |
| 856 | Add this URL?\r\n | |
| 857 | Dodać ten URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Dodać ten URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Ostrzeżenie: główny proces cišgle nie odpowiada, nie można dodać URLi.. |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | pt |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Paulo Neto (company at layout.com.br) \r\n | |
| 7 | Paulo Neto (company at layout.com.br) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Estas regras serão incluidas |
| 78 | 78 | Example: |
| 79 | 79 | Exemplo: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nDetectará todos os arquivos gif (ou arquivos GIF) | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | verde\r\nDetectará todos os arquivos contendo verde, tais como 'verdepiscina.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | grande.mov\r\nDetectará o arquivo 'grande.mov', porém não 'grande2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nDetectará links em diretórios contendo 'cgi' tais como /cgi-bin/algumacoisa.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nDetectará links (diretórios) com nomes 'cgi-bin (porém não cgi-bin-2, por exemplo) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | algumacoisa.com\r\nDetectará todos os links como www.algumacosia.com, privado.algumacoisa.com etc. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | algumsite\r\nDetectará links como www.algumsite.com, www.algumsite.edu, private.algumsite.outrosite.com, etc. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | ww.algumsite.com\r\nDetectará todos os links como ww.algumsite.com/... (porém não links como private.algumsite.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | algumsite\r\nDetectará todos os links como www.algumsite.com/.., www.teste.abc/dealgumsite/index.html, www.teste.abc/teste/algumsite.html etc. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.teste.com/teste/algumsite.html\r\nApenas detectará links como www.teste.com/teste/algumsite.html. Note que você terá que digitar ambos os endereços (www.xxx.yyy) e caminhos (/teste/algumsite.html) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nDetectará todos os arquivos gif (ou arquivos GIF) | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | verde\nDetectará todos os arquivos contendo verde, tais como 'verdepiscina.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | grande.mov\nDetectará o arquivo 'grande.mov', porém não 'grande2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nDetectará links em diretórios contendo 'cgi' tais como /cgi-bin/algumacoisa.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nDetectará links (diretórios) com nomes 'cgi-bin (porém não cgi-bin-2, por exemplo) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | algumacoisa.com\nDetectará todos os links como www.algumacosia.com, privado.algumacoisa.com etc. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | algumsite\nDetectará links como www.algumsite.com, www.algumsite.edu, private.algumsite.outrosite.com, etc. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | ww.algumsite.com\nDetectará todos os links como ww.algumsite.com/... (porém não links como private.algumsite.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | algumsite\nDetectará todos os links como www.algumsite.com/.., www.teste.abc/dealgumsite/index.html, www.teste.abc/teste/algumsite.html etc. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.teste.com/teste/algumsite.html\nApenas detectará links como www.teste.com/teste/algumsite.html. Note que você terá que digitar ambos os endereços (www.xxx.yyy) e caminhos (/teste/algumsite.html) | |
| 100 | 100 | All links will match |
| 101 | 101 | Todos os links serão detectados |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | Veja o relatório se necessário.\n\nClique OK para sair do HTTraQt.\n\nObrigado por usar o HTTraQt Website Copier! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Cópia finalizada.\nClique OK para sair.\nVeja o relatório para verificar se está tudo OK.\n\nObrigado por utilizar o HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * CÓPIA INTERROMPIDA! * *\r\nO cache temporário atual é necessário para qualquer operação de atualização e somente contém dados carregados durante a presente sessão.\r\nÉ possível que o cache anterior contenha dados mais completas; se você não quiser perder esses dados, você deve restaurá-lo e excluir o cache atual.\r\n[Nota: Esta operação pode ser facilmente executada aqui excluindo os arquivos hts-cache/novo.*]\r\n\r\nVocê acredita que o cache anterior pode conter informações mais completas, e você deseja restaurá-lo? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ERRO DE CÓPIA! * *\r\nO HTTraQt detectou que a cópia atual está vazia. Se ela fosse uma atualização, a cópia anterior teria sido restaurada.\r\nCausa: a primeira página não foi encontrada, ou um problema de conexão ocorreu.\r\n=> Assegure-se de que o website existe, e/ou verifique suas configurações proxy! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * CÓPIA INTERROMPIDA! * *\nO cache temporário atual é necessário para qualquer operação de atualização e somente contém dados carregados durante a presente sessão.\nÉ possível que o cache anterior contenha dados mais completas; se você não quiser perder esses dados, você deve restaurá-lo e excluir o cache atual.\n[Nota: Esta operação pode ser facilmente executada aqui excluindo os arquivos hts-cache/novo.*]\n\nVocê acredita que o cache anterior pode conter informações mais completas, e você deseja restaurá-lo? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ERRO DE CÓPIA! * *\nO HTTraQt detectou que a cópia atual está vazia. Se ela fosse uma atualização, a cópia anterior teria sido restaurada.\nCausa: a primeira página não foi encontrada, ou um problema de conexão ocorreu.\n=> Assegure-se de que o website existe, e/ou verifique suas configurações proxy! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | Dica: Clique [Ver relatório] para visualizar avisos e as mensagens de erro |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Desconectar ao finalizar |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Desconectar o modem ao finalizar |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(por favor nos comunique sobre erros ou problemas)\r\n\r\nDesenvolvimento:\r\nInterface (Windows): Xavier Roche\r\nMotor: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche e outros colaboradores\r\nTraduzido para o Português-Brasil por :\r\nPaulo Neto (Layout do Brasil, company@layout.com.br) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(por favor nos comunique sobre erros ou problemas)\n\nDesenvolvimento:\nInterface (Windows): Xavier Roche\nMotor: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche e outros colaboradores\nTraduzido para o Português-Brasil por :\nPaulo Neto (Layout do Brasil, company@layout.com.br) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | Sobre o HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Procurar sites... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Estrutura definida pelo usuário |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNome do arquivo sem extensão (ex.: imagem)\r\n%N\tNome do arquivo com extensão (ex.: imagem.gif)\r\n%t\tExtensão (ex.: gif)\r\n%p\tCaminho (sem o / final) (ex.: /imagens)\r\n%h\tNome do servidor (ex.: www.algumsite.com)\r\n%M\tURL MD5 (128 bits, 32 ascii bytes)\r\n%Q\tsequência de pesquisa MD5 (128 bits, 32 ascii bytes)\r\n%q\tpequena sequência de pesquisa MD5 (16 bits, 4 ascii bytes)\r\n\r\n%s?\tNome curto (ex.: %sN ) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNome do arquivo sem extensão (ex.: imagem)\n%N\tNome do arquivo com extensão (ex.: imagem.gif)\n%t\tExtensão (ex.: gif)\n%p\tCaminho (sem o / final) (ex.: /imagens)\n%h\tNome do servidor (ex.: www.algumsite.com)\n%M\tURL MD5 (128 bits, 32 ascii bytes)\n%Q\tsequência de pesquisa MD5 (128 bits, 32 ascii bytes)\n%q\tpequena sequência de pesquisa MD5 (16 bits, 4 ascii bytes)\n\n%s?\tNome curto (ex.: %sN ) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Exemplo:\t%h%p/%n%q.%t\n->\t\tc:\\alternativo\\www.algumsite.com\\algumasimagens\\imagem.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Meus Sites |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Digite um nome para o novo projeto, \r\nou escolha um projeto existente para continuar/atualizar. | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Digite um nome para o novo projeto, \nou escolha um projeto existente para continuar/atualizar. | |
| 796 | 796 | New project |
| 797 | 797 | Novo projeto |
| 798 | 798 | Insert URL |
| 853 | 853 | Memória insuficiente, erro fatal interno... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Operação desconhecida! |
| 856 | Add this URL?\r\n | |
| 857 | Adicionar esta URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Adicionar esta URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Atenção: o processo principal não está respondendo, não foi possivel adicionar URL(s). |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | pt |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Rui Fernandes (CANTIC, ruiefe at mail.malhatlantica.pt) \r\nPedro T. Pinheiro (Universidade Nova de Lisboa-FCT, ptiago at mail.iupi.pt) \r\n | |
| 7 | Rui Fernandes (CANTIC, ruiefe at mail.malhatlantica.pt) \nPedro T. Pinheiro (Universidade Nova de Lisboa-FCT, ptiago at mail.iupi.pt) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | As hiperligações correspondentes a esta regra serão incluídas |
| 78 | 78 | Example: |
| 79 | 79 | Exemplo: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\ndetectará todos os ficheiros GIF | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\ndetectará todos os ficheiros contendo blue, tais como 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\ndetectará o ficheiro 'bigfile.mov' mas não 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\ndetectará hiperligações contendo 'cgi' tais como /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\ndetectará por exemplo hiperligações com nomes contendo 'cgi-bin' mas não 'cgi-bin-2' | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\ndetectará hiperligações como www.someweb.com, private.someweb.com, etc. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\ndetectará hiperligações como www.someweb.com, www.someweb.edu, private.someweb.otherweb.com, etc. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\ndetectará hiperligações como www.someweb.com/... (mas não hiperligações como private.someweb.com/...) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\ndetectará hiperligações como www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html, etc. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\napenas detectará hiperligações como www.test.com/test/someweb.html. Note que terá que digitar o endereço completo (URL + caminho do ficheiro) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\ndetectará todos os ficheiros GIF | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\ndetectará todos os ficheiros contendo blue, tais como 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\ndetectará o ficheiro 'bigfile.mov' mas não 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\ndetectará hiperligações contendo 'cgi' tais como /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\ndetectará por exemplo hiperligações com nomes contendo 'cgi-bin' mas não 'cgi-bin-2' | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\ndetectará hiperligações como www.someweb.com, private.someweb.com, etc. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\ndetectará hiperligações como www.someweb.com, www.someweb.edu, private.someweb.otherweb.com, etc. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\ndetectará hiperligações como www.someweb.com/... (mas não hiperligações como private.someweb.com/...) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\ndetectará hiperligações como www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html, etc. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\napenas detectará hiperligações como www.test.com/test/someweb.html. Note que terá que digitar o endereço completo (URL + caminho do ficheiro) | |
| 100 | 100 | All links will match |
| 101 | 101 | Todas as hiperligações serão detectadas |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | Veja o relatório, se necessário.\n\nClique TERMINAR para sair do HTTraQt.\n\nObrigado por usar o HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Cópia terminada.\nClique OK para sair.\nVeja o relatório para verificar se não há erros.\n\nObrigado por usar o HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * CÓPIA INTERROMPIDA! * *\r\nA cache temporária actual é necessária para actualização e só contém os dados carregados durante a sessão em curso.\r\nÉ possível que a cache anterior contenha dados mais completos; para não perder esses dados, deve restaurá-la e apagar a cache actual.\r\n[Nota: Esta operação pode ser facilmente executada aqui apagando os ficheiros hts-cache/new.*]\r\n\r\nPensa que a cache anterior pode conter informações mais completas e quer restaurá-la? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ERRO DE CÓPIA! * *\r\nHTTraQt detectou que a cópia actual está vazia. Se fez uma actualização, a cópia anterior foi restaurada.\r\nRazão: a primeira página não foi encontrada ou ocorreu um problema na conexão.\r\n=> Certifique-se de que o site existe e confirme as configurações do proxy! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * CÓPIA INTERROMPIDA! * *\nA cache temporária actual é necessária para actualização e só contém os dados carregados durante a sessão em curso.\nÉ possível que a cache anterior contenha dados mais completos; para não perder esses dados, deve restaurá-la e apagar a cache actual.\n[Nota: Esta operação pode ser facilmente executada aqui apagando os ficheiros hts-cache/new.*]\n\nPensa que a cache anterior pode conter informações mais completas e quer restaurá-la? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ERRO DE CÓPIA! * *\nHTTraQt detectou que a cópia actual está vazia. Se fez uma actualização, a cópia anterior foi restaurada.\nRazão: a primeira página não foi encontrada ou ocorreu um problema na conexão.\n=> Certifique-se de que o site existe e confirme as configurações do proxy! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \nSugestão:Clique [Ver relatório] para ver os avisos e as mensagens de erro |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Desligar no fim da operação |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Desconectar o modem no final |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Por favor avise-nos acerca de erros ou problemas)\r\n\r\nDesenvolvimento:\r\nInterface (Windows): Xavier Roche\r\nMotor: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nAgradecimentos pela tradução para o Português para:\r\nRui Fernandes (CANTIC, ruiefe@mail.malhatlantica.pt) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Por favor avise-nos acerca de erros ou problemas)\n\nDesenvolvimento:\nInterface (Windows): Xavier Roche\nMotor: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nAgradecimentos pela tradução para o Português para:\nRui Fernandes (CANTIC, ruiefe@mail.malhatlantica.pt) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | Acerca do HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Ver sites... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Estrutura local de ficheiros |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNome do ficheiro sem extensão (ex: image)\r\n%N\tNome do ficheiro incluindo extensão (ex: image.gif)\r\n%t\tExtensão (ex: gif)\r\n%p\tCaminho (sem / final) (ex: /someimages)\r\n%h\tNome do servidor (ex: www.someweb.com)\r\n%M\tURL MD5 (128 bits, 32 ascii bytes)\r\n%Q\tquery string MD5 (128 bits, 32 ascii bytes)\r\n%q\tsmall query string MD5 (16 bits, 4 ascii bytes)\r\n\r\n%s?\tVersão curta DOS (ex: %sN ) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNome do ficheiro sem extensão (ex: image)\n%N\tNome do ficheiro incluindo extensão (ex: image.gif)\n%t\tExtensão (ex: gif)\n%p\tCaminho (sem / final) (ex: /someimages)\n%h\tNome do servidor (ex: www.someweb.com)\n%M\tURL MD5 (128 bits, 32 ascii bytes)\n%Q\tquery string MD5 (128 bits, 32 ascii bytes)\n%q\tsmall query string MD5 (16 bits, 4 ascii bytes)\n\n%s?\tVersão curta DOS (ex: %sN ) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Exemplo:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Os meus Sites |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | 795 | Introduza o nome para um novo projecto,\nou escolha um projecto para continuar ou actualizar |
| 796 | 796 | New project |
| 797 | 797 | Novo projecto |
| 853 | 853 | Memória insuficiente, erro fatal interno... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Operação desconhecida!! |
| 856 | Add this URL?\r\n | |
| 857 | Adicionar este endereço URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Adicionar este endereço URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Aviso: o processo principal ainda não responde, impossível adicionar URL. |
| 860 | 860 | Type/MIME associations |
| 880 | 880 | Welcome to HTTraQt Website Copier!\n\nPlease click on the NEXT button to\n\n- start a new project\n- or resume a partial download |
| 881 | 881 | Benvindo ao HTTraQt Website Copier!\n\nClique no botão Seguinte para\n\n- iniciar um novo projecto ou\n- retomar um projecto existente. |
| 882 | 882 | File names with extension:\nFile names containing:\nThis file name:\nFolder names containing:\nThis folder name:\nLinks on this domain:\nLinks on domains containing:\nLinks from this host:\nLinks containing:\nThis link:\nALL LINKS |
| 883 | Ficheiros de tipo:\nFicheiros contendo:\nEste ficheiro:\nNomes de pastas contendo:\nEsta pasta:\nHiperligações neste domínio:\nHiperligações num domínio contendo:\nHiperligações deste servidor:\nHiperligações contendo:\nEsta hiperligação:\nTODAS AS HIPERLIGAÇÕES\r\n | |
| 883 | Ficheiros de tipo:\nFicheiros contendo:\nEste ficheiro:\nNomes de pastas contendo:\nEsta pasta:\nHiperligações neste domínio:\nHiperligações num domínio contendo:\nHiperligações deste servidor:\nHiperligações contendo:\nEsta hiperligação:\nTODAS AS HIPERLIGAÇÕES\n | |
| 884 | 884 | Show all\nHide debug\nHide infos\nHide debug and infos |
| 885 | 885 | Mostrar tudo\nOcultar erros\nOcultar informações\nOcultar erros e informações |
| 886 | 886 | Site-structure (default)\nHtml in web/, images/other files in web/images/\nHtml in web/html, images/other in web/images\nHtml in web/, images/other in web/\nHtml in web/, images/other in web/xxx, where xxx is the file extension\nHtml in web/html, images/other in web/xxx\nSite-structure, without www.domain.xxx/\nHtml in site_name/, images/other files in site_name/images/\nHtml in site_name/html, images/other in site_name/images\nHtml in site_name/, images/other in site_name/\nHtml in site_name/, images/other in site_name/xxx\nHtml in site_name/html, images/other in site_name/xxx\nAll files in web/, with random names (gadget !)\nAll files in site_name/, with random names (gadget !)\nUser-defined structure.. |
| 62 | 62 | Scan Rules |
| 63 | 63 | Reguli de scanare |
| 64 | 64 | Use wildcards to exclude or include URLs or links.\nYou can put several scan strings on the same line.\nUse spaces as separators.\n\nExample: +*.zip -www.*.com -www.*.edu/cgi-bin/*.cgi |
| 65 | Folosiþi ? sau *pentru a exclude sau include URL-uri sau linkuri.\r\nPuteþi pune mai multe adrese pe aceeaºi linie.\r\nFolosiþi spaþiile ca separatori. \r\nExemplu +*.zip -www.*.com -www.*.edu/cgi-bin/*.cgi | |
| 65 | Folosiþi ? sau *pentru a exclude sau include URL-uri sau linkuri.\nPuteþi pune mai multe adrese pe aceeaºi linie.\nFolosiþi spaþiile ca separatori. \nExemplu +*.zip -www.*.com -www.*.edu/cgi-bin/*.cgi | |
| 66 | 66 | Exclude links |
| 67 | 67 | Exclude link(uri) |
| 68 | 68 | Include link(s) |
| 69 | 69 | Include link(uri) |
| 70 | 70 | Tip: To have ALL GIF files included, use something like +www.someweb.com/*.gif. \n(+*.gif / -*.gif will include/exclude ALL GIFs from ALL sites) |
| 71 | Pentru a include toate fiºierele GIF dintr-un singur site, folosiþi ceva de genul +www.nume_site.com/*.gif.\r\n(+*.gif / -*.gif va include/exclude toate fiºierele GIF din toate siturile) | |
| 71 | Pentru a include toate fiºierele GIF dintr-un singur site, folosiþi ceva de genul +www.nume_site.com/*.gif.\n(+*.gif / -*.gif va include/exclude toate fiºierele GIF din toate siturile) | |
| 72 | 72 | Save prefs |
| 73 | 73 | Salveazã preferinþele |
| 74 | 74 | Matching links will be excluded: |
| 77 | 77 | Link-urile care se potrivesc acestei reguli vor fi incluse: |
| 78 | 78 | Example: |
| 79 | 79 | Exemplu: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nVa potrivi toate fiºierele GIF | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nVa gãsi toate fiºierele care conþin un subºir 'blue' cum ar fi 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nVa detecta numai fiºierul 'bigfile.mov', dar nu ºi 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nVa gãsi linkuri spre folderele în numele cãrora se gãseºte subºirul "cgi" cum ar fi /cgi/bin/oricecgi,cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nVa gãsi linkuri spre folderele în numele cãrora se gãseºte numai subºirul 'cgi-bin' (dar nu ºi cgi-bin-2, de exemplu) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nVa gãsi linkuri ce conþin acest subºir cum ar fi www.someweb.com, private.someweb.com etc.\r\n | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nVa gãsi linkuri ce conþin acest subºir cum ar fi www.someweb.com,www.someweb.edu,private.someweb.otherweb.com etc. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nVa gãsi linkurile care conþin tot subºirul 'www.someweb.com' ( dar nu ºi linkuri de genul private.someweb.com/..)\r\n | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nVa gãsi orice link ce conþine subºirul dat, de exemplu: www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc.\r\n | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nVa gãsi numai fiºierul 'www.test.com/test/someweb.html' .Observaþi cã trebuie sã introduceþi calea completã (URL + site path) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nVa potrivi toate fiºierele GIF | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nVa gãsi toate fiºierele care conþin un subºir 'blue' cum ar fi 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nVa detecta numai fiºierul 'bigfile.mov', dar nu ºi 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nVa gãsi linkuri spre folderele în numele cãrora se gãseºte subºirul "cgi" cum ar fi /cgi/bin/oricecgi,cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nVa gãsi linkuri spre folderele în numele cãrora se gãseºte numai subºirul 'cgi-bin' (dar nu ºi cgi-bin-2, de exemplu) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nVa gãsi linkuri ce conþin acest subºir cum ar fi www.someweb.com, private.someweb.com etc.\n | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nVa gãsi linkuri ce conþin acest subºir cum ar fi www.someweb.com,www.someweb.edu,private.someweb.otherweb.com etc. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nVa gãsi linkurile care conþin tot subºirul 'www.someweb.com' ( dar nu ºi linkuri de genul private.someweb.com/..)\n | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nVa gãsi orice link ce conþine subºirul dat, de exemplu: www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc.\n | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nVa gãsi numai fiºierul 'www.test.com/test/someweb.html' .Observaþi cã trebuie sã introduceþi calea completã (URL + site path) | |
| 100 | 100 | All links will match |
| 101 | 101 | Toate linkurile vor fi cãutate |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | \nVezi jurnalul (log-ul) dacã este necesar. \n\nClick TERMINARE pentru a ieºi din HTTraQt Website Copier.\n\nVã mulþumim cã folosiþi HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Operaþia de clonare terminatã. \nClick Ieºire pentru a pãrãsi HTTraQt. \nVezi fiºierele jurnal dacã este necesar, pentru a vã asigura cã totul e OK. \n\nVã mulþumim cã folosiþi HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * *CLONARE ÎNTRERUPTÃ! * * \r\nCache-ul teporar este necesar pentru orice operaþie de actualizare ºi nu conþine decât datele descãrcate în timpul sesiunii curente întrerupte.\r\nCache-ul precedent poate conþine informaþia mai completã; dacã nu doriþi sã pierdeþi aceste date, trebuie sã restauraþi ºi sã ºtergeþi cache-ul curent\r\n(Notã: Aceastã operaþie poate fi fãcutã cu uºurinþã prin ºtergerea fiºierelor hts-cache/new.*)\r\n\r\n Credeºi cã vechiul cache poate conþine mai multe informaþii ºi doriþi sã le restauraþi? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * EROARE CLONARE! * *\r\nHTTraQt a detectat cã, clona curentã este goalã. Dacã a fost o actualizare, clona precedentã a fost restauratã.\r\nMotivul: Fie prima(ele) paginã(i) nu pot(ate) fi gãsitã(e), fie a intervenit o problemã de conectare.\r\n=>Asiguraþi-vã cã situl existã ºi/sau verificaþi setãrile legate de proxy!<= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * *CLONARE ÎNTRERUPTÃ! * * \nCache-ul teporar este necesar pentru orice operaþie de actualizare ºi nu conþine decât datele descãrcate în timpul sesiunii curente întrerupte.\nCache-ul precedent poate conþine informaþia mai completã; dacã nu doriþi sã pierdeþi aceste date, trebuie sã restauraþi ºi sã ºtergeþi cache-ul curent\n(Notã: Aceastã operaþie poate fi fãcutã cu uºurinþã prin ºtergerea fiºierelor hts-cache/new.*)\n\n Credeºi cã vechiul cache poate conþine mai multe informaþii ºi doriþi sã le restauraþi? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * EROARE CLONARE! * *\nHTTraQt a detectat cã, clona curentã este goalã. Dacã a fost o actualizare, clona precedentã a fost restauratã.\nMotivul: Fie prima(ele) paginã(i) nu pot(ate) fi gãsitã(e), fie a intervenit o problemã de conectare.\n=>Asiguraþi-vã cã situl existã ºi/sau verificaþi setãrile legate de proxy!<= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \n\nSfat:Click [Vizualizeazã fiºierul jurnal] pentru a vedea mesajele de avertizare sau eroare. |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Deconecteazã ºa terminare |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Deconecteazã modemul la terminare |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | 637 | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | Despre HTTraQt Website Copier |
| 743 | 743 | &Rãsfoire situri... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Structurã definitã de utilizator |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNumele fiºierului fãrã extensie (ex: image)\r\n%N\tNumele fiºierului cu extensie (ex: image.gif)\r\n%t\tNumai tipul fiºierului (extensia) (ex: gif)\r\n%p\tCalea [fãrã / la sfârºit] (ex: /someimages)\r\n%h\tNumele Gazdei (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tDenumire scurtã DOS (ex: %sN)\r\n | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNumele fiºierului fãrã extensie (ex: image)\n%N\tNumele fiºierului cu extensie (ex: image.gif)\n%t\tNumai tipul fiºierului (extensia) (ex: gif)\n%p\tCalea [fãrã / la sfârºit] (ex: /someimages)\n%h\tNumele Gazdei (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tDenumire scurtã DOS (ex: %sN)\n | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Exemplu:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Siturile Mele |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Introduceþi numele unui proiect nou,\r\nsau selectaþi un proiect existent pentru actiualizare/continuare | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Introduceþi numele unui proiect nou,\nsau selectaþi un proiect existent pentru actiualizare/continuare | |
| 796 | 796 | New project |
| 797 | 797 | Proiect nou |
| 798 | 798 | Insert URL |
| 853 | 853 | Memorie insuficientã, eroare internã fatalã... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Operaþie necunoscutã! |
| 856 | Add this URL?\r\n | |
| 857 | Adaug aceastã adresã URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Adaug aceastã adresã URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | ATENÞIE: Procesul principal tot nu rãspunde, nu pot adãuga adresa (adresele) URL.. |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | ru |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Andrei Iliev (iliev at vitaplus.ru) \r\n | |
| 7 | Andrei Iliev (iliev at vitaplus.ru) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Линки, удовлетворяющие этому условию будут включены: |
| 78 | 78 | Example: |
| 79 | 79 | Пример: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nОбнаружит все gif (или GIF) файлы | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nОтловит все файлы, содержащие в имени подстроку 'blue', например 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nОтловит файл 'bigfile.mov', но, в тоже время, пропустит файл 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nОтловит адреса, содержащие каталоги с подстрокой 'cgi', такие как /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nОтловит адреса, содержащие каталог 'cgi-bin' (но не cgi-bin-2, например) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nОтловит такие линки, как www.someweb.com, private.someweb.com и т.п.. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nОтловит адреса типа www.someweb.com, www.someweb.edu, private.someweb.otherweb.com и т.д.\r\n | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nОтловит адреса, такие как www.someweb.com/... (но не такие, как private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nОтловит все линки такие, как www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html и т.п. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nОтловит только www.test.com/test/someweb.html. Заметим, что необходимо указать полный адрес ресурса - хост (www.xxx.yyy) и путь (/test/someweb.html) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nОбнаружит все gif (или GIF) файлы | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nОтловит все файлы, содержащие в имени подстроку 'blue', например 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nОтловит файл 'bigfile.mov', но, в тоже время, пропустит файл 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nОтловит адреса, содержащие каталоги с подстрокой 'cgi', такие как /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nОтловит адреса, содержащие каталог 'cgi-bin' (но не cgi-bin-2, например) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nОтловит такие линки, как www.someweb.com, private.someweb.com и т.п.. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nОтловит адреса типа www.someweb.com, www.someweb.edu, private.someweb.otherweb.com и т.д.\n | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nОтловит адреса, такие как www.someweb.com/... (но не такие, как private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nОтловит все линки такие, как www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html и т.п. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nОтловит только www.test.com/test/someweb.html. Заметим, что необходимо указать полный адрес ресурса - хост (www.xxx.yyy) и путь (/test/someweb.html) | |
| 100 | 100 | All links will match |
| 101 | 101 | Все линки допустимы |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | В случае необходимости, смотри лог файл.\n\nДля выхода из HTTraQt нажмите кнопку OK.\n\nСпасибо за использование HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Создание зеркала завершено.\nДля выхода из программы нажмите кнопку OK.\nДля проверки успешности закачки посмотрите лог файл(ы).\n\nСпасибо за использование HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * ЗАКАЧКА ПРЕРВАНА! * *\r\nВременный кэш, созданный во время текущей сессий, содержит данные, загруженные только во время данной сессии и потребуется только в случае возобновления закачки.\r\nОднако, предыдущий кэш может содержать более полную информацию. Если вы не хотите потерять эти данные, вам нужно удалить текущий кэш и возобновить предыдущий.\r\n(Это можно легко сделать прямо здесь, удалив файлы hts-cache/new.]\r\n\r\nСчитает-ли вы, что предыдущий кэш может содержать более полную информацию, и хотите ли вы восстановить его? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ОШИБКА! * *\r\nТекущее зеркало - пусто. Если это было обновление, предыдущая версия зеркала восстановлена.\r\nПричина: первая страница(ы) или не найдена, или были проблемы с соединением.\r\n=> Убедитесь, что вебсайт все-еще существует, и/или проверьте установки прокси-сервера! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * ЗАКАЧКА ПРЕРВАНА! * *\nВременный кэш, созданный во время текущей сессий, содержит данные, загруженные только во время данной сессии и потребуется только в случае возобновления закачки.\nОднако, предыдущий кэш может содержать более полную информацию. Если вы не хотите потерять эти данные, вам нужно удалить текущий кэш и возобновить предыдущий.\n(Это можно легко сделать прямо здесь, удалив файлы hts-cache/new.]\n\nСчитает-ли вы, что предыдущий кэш может содержать более полную информацию, и хотите ли вы восстановить его? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ОШИБКА! * *\nТекущее зеркало - пусто. Если это было обновление, предыдущая версия зеркала восстановлена.\nПричина: первая страница(ы) или не найдена, или были проблемы с соединением.\n=> Убедитесь, что вебсайт все-еще существует, и/или проверьте установки прокси-сервера! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \nПодсказка:Для просмотра сообщений об ошибках и предупреждений нажмите [Просмотр лог файла] |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 211 | Ошибка удаления файла hts-cache/new.* , пожалуйста, удалите его ручками.\r\n | |
| 211 | Ошибка удаления файла hts-cache/new.* , пожалуйста, удалите его ручками.\n | |
| 212 | 212 | Do you really want to quit HTTraQt Website Copier? |
| 213 | 213 | Вы действительно хотите выйти из HTTraQt? |
| 214 | 214 | - Mirroring Mode -\n\nEnter address(es) in URL box |
| 633 | 633 | Отсоединиться при завершении |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Отсоеденить при завершении |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Сообщите нам пожалуйста о замеченных проблемах и ошибках)\r\n\r\nРазработка:\r\nИнтерфейс (Windows): Xavier Roche\r\nКачалка (spider): Xavier Roche\r\nПарсер ява-классов: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for Russian translations to:\r\nAndrei Iliev (andreiiliev@mail.ru) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Сообщите нам пожалуйста о замеченных проблемах и ошибках)\n\nРазработка:\nИнтерфейс (Windows): Xavier Roche\nКачалка (spider): Xavier Roche\nПарсер ява-классов: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for Russian translations to:\nAndrei Iliev (andreiiliev@mail.ru) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | О программе HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Просмотр сайтов... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Задание структуры |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tИмя файла без расширения (напр.: image)\r\n%N\tИмя файла с расширением (напр.: image.gif)\r\n%t\tРасширение файла (напр.: gif)\r\n%p\tПуть к файлу [без оканчивающего /] (напр.: /someimages)\r\n%h\tИмя хоста (напр.: www.someweb.com)\r\n%M\tURL MD5 (128 bits, 32 ascii bytes)\r\n%Q\tquery string MD5 (128 bits, 32 ascii bytes)\r\n%q\tsmall query string MD5 (16 bits, 4 ascii bytes)\r\n\r\n%s?\tDOS'кое имя (напр: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tИмя файла без расширения (напр.: image)\n%N\tИмя файла с расширением (напр.: image.gif)\n%t\tРасширение файла (напр.: gif)\n%p\tПуть к файлу [без оканчивающего /] (напр.: /someimages)\n%h\tИмя хоста (напр.: www.someweb.com)\n%M\tURL MD5 (128 bits, 32 ascii bytes)\n%Q\tquery string MD5 (128 bits, 32 ascii bytes)\n%q\tsmall query string MD5 (16 bits, 4 ascii bytes)\n\n%s?\tDOS'кое имя (напр: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Пример:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | Категория проекта: |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Мои Web Сайты |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Задайте название нового проекта, \r\nили выберете существующий проект для его актуализации/продолжения | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Задайте название нового проекта, \nили выберете существующий проект для его актуализации/продолжения | |
| 796 | 796 | New project |
| 797 | 797 | Новый проект |
| 798 | 798 | Insert URL |
| 853 | 853 | Не достаточно памяти, фатальная внутренняя ошибка... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Неизвестная операция |
| 856 | Add this URL?\r\n | |
| 857 | Добавить этот URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Добавить этот URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Внимание: программа не отвечает на запросы, не возможно добавить URL'ы... |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | sk |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Dr. Martin Sereday (sereday at stonline.sk)\r\n | |
| 7 | Dr. Martin Sereday (sereday at stonline.sk)\n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Zodpovedajúce linky budú zaradené |
| 78 | 78 | Example: |
| 79 | 79 | Napr.: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nZodpovedá vetkým GIF súborom | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nNájde vetky súbory obsahujúce skupinu znakov 'blue' - napr. 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nZodpovedá súborom 'bigfile.mov', ale nie 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nVyhžadá vetky linky s názvom adresára obsahujúcim skupinu znakov 'cgi' - napr. /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nVyhžadá vetky linky s názvom adresára obsahujúcim skupinu znakov 'cgi-bin' (ale u nie napr. cgi-bin-2) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nVyhžadá vetky zhodné reazce napr.: www.someweb.com, private.someweb.com atď. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nVyhžadá vetky adresáre obsahujúce reazec napr.: www.someweb.com, www.someweb.edu, private.someweb.otherweb.com atď. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nVyhžadá vetky linky obsahujúce úplný reazec napr.: 'www.someweb.com' (ale nie linky napr.: private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nVyhžadá vetky linky obsahujúce reazec napr.: www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html atď. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nVyhžadá iba súbor 'www.test.com/test/someweb.html'. POZOR!, musí sa napísa úplná cesta (URL + cesta v rámci truktúry) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nZodpovedá vetkým GIF súborom | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nNájde vetky súbory obsahujúce skupinu znakov 'blue' - napr. 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nZodpovedá súborom 'bigfile.mov', ale nie 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nVyhžadá vetky linky s názvom adresára obsahujúcim skupinu znakov 'cgi' - napr. /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nVyhžadá vetky linky s názvom adresára obsahujúcim skupinu znakov 'cgi-bin' (ale u nie napr. cgi-bin-2) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nVyhžadá vetky zhodné reazce napr.: www.someweb.com, private.someweb.com atď. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nVyhžadá vetky adresáre obsahujúce reazec napr.: www.someweb.com, www.someweb.edu, private.someweb.otherweb.com atď. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nVyhžadá vetky linky obsahujúce úplný reazec napr.: 'www.someweb.com' (ale nie linky napr.: private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nVyhžadá vetky linky obsahujúce reazec napr.: www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html atď. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nVyhžadá iba súbor 'www.test.com/test/someweb.html'. POZOR!, musí sa napísa úplná cesta (URL + cesta v rámci truktúry) | |
| 100 | 100 | All links will match |
| 101 | 101 | Vetky linky sa budú zhodova |
| 102 | 102 | Add exclusion filter |
| 152 | 152 | Unable to initialize the OLE system |
| 153 | 153 | Nedá sa incializova OLE systém |
| 154 | 154 | HTTraQt could not find any interrupted download file cache in the specified folder! |
| 155 | HTTraQt nenaiel iaden cache prerueného súboru v pecifikovanom adresári\r\n | |
| 155 | HTTraQt nenaiel iaden cache prerueného súboru v pecifikovanom adresári\n | |
| 156 | 156 | Could not connect to provider |
| 157 | 157 | Nedá sa spoji s providerom |
| 158 | 158 | receive |
| 198 | 198 | \nDuring:\n |
| 199 | 199 | \nPočas:\n |
| 200 | 200 | \nSee the log file if necessary.\n\nClick FINISH to quit HTTraQt Website Copier.\n\nThanks for using HTTraQt! |
| 201 | \nAk treba, pozrie protokol.\n\n\r\nKliknutím na KONIEC opusti HTTraQt Website Copier.\n\nVďaka za pouitie HTTraQt!\r\n | |
| 201 | \nAk treba, pozrie protokol.\n\n\nKliknutím na KONIEC opusti HTTraQt Website Copier.\n\nVďaka za pouitie HTTraQt!\n | |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | Operácia kopírovania ukončená.\nKliknutím na Exit opusti HTTraQt.\nPozrie protokoly súbor(y), ak sa treba uisti, e vetkoje v poriadku.\n\nVďaka za pouitie HTTraQt!\r\n | |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * KOPÍROVANIE PRERUENÉ! * *\r\nAktuálna dočasná cache je potrebná prevetky aktualizačné operácie a obsahuje iba dáta stiahnuté počas tejto preruenej operácie\r\nPredchádzajúca chache môe obsahova kompletnejie informácie. Ak sa tieto informácie nemajú strati, treba ju obnovi a vymaza terajiu aktuálnu cache.\r\n[Poznámka: Dá sa to urobi teraz vymazaním súborov hts-cache/new.* ]\r\n\r\nObsahuje predchádzajúca cache obsahuje kompletnejiu informáciu a má sa obnovi?\r\n | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * CHYBA KOPÍROVANIA! * *\r\nHTTraQt zistil, e táto kópia je prázdna. Ak mala by aktualizovaná, predchádzajúca kópia bola obnovená.\r\nDôvod: Úvodná stránka buď nebola nájdená, alebo nastal problém so spojením.\r\n=> Presvedči sa, či webstránka ete existuje a/alebo skontrolova vlastné nastavenie proxy! <= | |
| 203 | Operácia kopírovania ukončená.\nKliknutím na Exit opusti HTTraQt.\nPozrie protokoly súbor(y), ak sa treba uisti, e vetkoje v poriadku.\n\nVďaka za pouitie HTTraQt!\n | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * KOPÍROVANIE PRERUENÉ! * *\nAktuálna dočasná cache je potrebná prevetky aktualizačné operácie a obsahuje iba dáta stiahnuté počas tejto preruenej operácie\nPredchádzajúca chache môe obsahova kompletnejie informácie. Ak sa tieto informácie nemajú strati, treba ju obnovi a vymaza terajiu aktuálnu cache.\n[Poznámka: Dá sa to urobi teraz vymazaním súborov hts-cache/new.* ]\n\nObsahuje predchádzajúca cache obsahuje kompletnejiu informáciu a má sa obnovi?\n | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * CHYBA KOPÍROVANIA! * *\nHTTraQt zistil, e táto kópia je prázdna. Ak mala by aktualizovaná, predchádzajúca kópia bola obnovená.\nDôvod: Úvodná stránka buď nebola nájdená, alebo nastal problém so spojením.\n=> Presvedči sa, či webstránka ete existuje a/alebo skontrolova vlastné nastavenie proxy! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \n\nTip: Kliknú na [Zobrazi protokol] a pozrie na upozornania alebo chybové hlásenia |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 211 | 211 | Chyba pri mazaní súborov hts-cache/new.* . Vymaza ručne |
| 212 | 212 | Do you really want to quit HTTraQt Website Copier? |
| 213 | Naozaj opusti HTTraQt Website Copier?\r\n | |
| 213 | Naozaj opusti HTTraQt Website Copier?\n | |
| 214 | 214 | - Mirroring Mode -\n\nEnter address(es) in URL box |
| 215 | 215 | - Mód kopírovania -\n\nUda adresu(y) do políčka URL |
| 216 | 216 | - Interactive Wizard Mode (questions) -\n\nEnter address(es) in URL box |
| 228 | 228 | Path |
| 229 | 229 | Cesta |
| 230 | 230 | - Links List Mode -\n\nUse URL box to enter address(es) of page(s) containing links to mirror |
| 231 | - Mód zoznamu linkov -\n\nPoui políčko URL na zadanie adresy (adries) súboru(ov) obsahujúcich linky ku kópii\r\n | |
| 231 | - Mód zoznamu linkov -\n\nPoui políčko URL na zadanie adresy (adries) súboru(ov) obsahujúcich linky ku kópii\n | |
| 232 | 232 | New project / Import? |
| 233 | 233 | Nový projekt / Import? |
| 234 | 234 | Choose criterion |
| 633 | 633 | Odpoji, ak je kopírovanie ukončené |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Odpoji modem po dokončení |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Oznám nám akúkožvek chybu alebo problém)\r\n\r\nVývoj:\r\nProstredie (Windows): Xavier Roche\r\nPavúk: Xavier Roche\r\nKontrolór Javy: Yann Philippot\r\n\r\n(C)1998-2001 Xavier Roche a ostatní pomocníci\r\nVEźKÉ POĎAKOVANIE za preklady:\r\nDr. Martin Sereday (sereday@slovanet.sk) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Oznám nám akúkožvek chybu alebo problém)\n\nVývoj:\nProstredie (Windows): Xavier Roche\nPavúk: Xavier Roche\nKontrolór Javy: Yann Philippot\n\n(C)1998-2001 Xavier Roche a ostatní pomocníci\nVEźKÉ POĎAKOVANIE za preklady:\nDr. Martin Sereday (sereday@slovanet.sk) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | O HTTraQt Website Copier... |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Prezera stránky... |
| 744 | 744 | User-defined structure |
| 745 | 745 | truktúra definovaná uívatežom |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNázov súboru bez udania typu (napr.: obrázok)\r\n%N\tNázov súboru vrátane typu (napr.: obrázok.gif)\r\n%t\tIba typ súboru (napr.: gif)\r\n%p\tCesta bez ukončenia /] (napr.: /obrázky)\r\n%h\tNázov zdroja (napr.: www.someweb.com)\r\n%M\tMD5 URL (128 bitov, 32 ascii bytov)\r\n%Q\tMD5 vyhžadávací reazec (128 bitov, 32 ascii bytov)\r\n%q\tMD5 malý vyhžadávací reazec (16 bitov, 4 ascii bytov)\r\n\r\n%s?\tKrátky názov (napr.: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tNázov súboru bez udania typu (napr.: obrázok)\n%N\tNázov súboru vrátane typu (napr.: obrázok.gif)\n%t\tIba typ súboru (napr.: gif)\n%p\tCesta bez ukončenia /] (napr.: /obrázky)\n%h\tNázov zdroja (napr.: www.someweb.com)\n%M\tMD5 URL (128 bitov, 32 ascii bytov)\n%Q\tMD5 vyhžadávací reazec (128 bitov, 32 ascii bytov)\n%q\tMD5 malý vyhžadávací reazec (16 bitov, 4 ascii bytov)\n\n%s?\tKrátky názov (napr.: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Príklad:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\My Web Sites |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Napísa názov nového projektu, alebo zvoli existujúci projekt, \r\nv ktorom sa má pokračova alebo aktualizova\r\n | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Napísa názov nového projektu, alebo zvoli existujúci projekt, \nv ktorom sa má pokračova alebo aktualizova\n | |
| 796 | 796 | New project |
| 797 | 797 | Nový projekt |
| 798 | 798 | Insert URL |
| 822 | 822 | Catch URL! |
| 823 | 823 | Prebra URL! |
| 824 | 824 | Please set temporary browser proxy settings to the following values (Copy/Paste Proxy Address and Port).\nThen click on the Form SUBMIT button in your browser page, or click on the specific link you want to capture. |
| 825 | Nastavi dočasne nastavenia proxy prehliadača na tieto hodnoty (Kopírova/Vloi adresa a port proxy).\n\rPotom kliknú na tlačidlo POLI na stránke prehliadača, alebo kliknú na konkrétny link, ktorý sa má prevzia.\r\n | |
| 825 | Nastavi dočasne nastavenia proxy prehliadača na tieto hodnoty (Kopírova/Vloi adresa a port proxy).\n\rPotom kliknú na tlačidlo POLI na stránke prehliadača, alebo kliknú na konkrétny link, ktorý sa má prevzia.\n | |
| 826 | 826 | This will send the desired link from your browser to HTTraQt. |
| 827 | 827 | Toto odole poadovaný link z tvojho prehliadača do HTTraQt. |
| 828 | 828 | ABORT |
| 853 | 853 | Nedostatok pamäti, závaná interná chyba... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Neznáma operácia! |
| 856 | Add this URL?\r\n | |
| 857 | Prida toto URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Prida toto URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Upozornenie: hlavný proces ete stále neodpovedá, nemôem prida URL.. |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | si |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Jadran Rudec,iur.\r\njrudec@email.si \r\n | |
| 7 | Jadran Rudec,iur.\njrudec@email.si \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Zadete povezave bodo vkljuèene: |
| 78 | 78 | Example: |
| 79 | 79 | Primer: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nBo vseboval vse GIF datoteke | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nNael bo vse datoteke z zadetki 'modro' pod string kot 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nBo zadel datoteko 'bigfile.mov' toda ne 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nNael bo povezave z mapo kot zadetek z imenom pod string 'cgi' kot /cgi-bin/poljubwencgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nNael bopovezave z zadetim imenom mapeing v celoti 'cgi-bin' string (toda ne cgi-bin-2, kot primer) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nNael bo povezave z zadetim pod stringom kot www.spletnastran.com, private.spletnastran.com itn. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nNael bo povezave z zadeto mapo podstringa kot www.spletnastran.com, www.semeweb.edu, private.someweb.otherweb.com etc. | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nNael bo povezave zadete kot 'www.someweb.com' pod string (toda ne povezave kot so private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nNael bo povezave zadetih pod stringom kot www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nNael bo le povezave kot 'www.test.com/test/someweb.html' datoteko. Pazite, da boste vpisali popolno pot (URL + pot spletne strani) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nBo vseboval vse GIF datoteke | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nNael bo vse datoteke z zadetki 'modro' pod string kot 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nBo zadel datoteko 'bigfile.mov' toda ne 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nNael bo povezave z mapo kot zadetek z imenom pod string 'cgi' kot /cgi-bin/poljubwencgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nNael bopovezave z zadetim imenom mapeing v celoti 'cgi-bin' string (toda ne cgi-bin-2, kot primer) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nNael bo povezave z zadetim pod stringom kot www.spletnastran.com, private.spletnastran.com itn. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nNael bo povezave z zadeto mapo podstringa kot www.spletnastran.com, www.semeweb.edu, private.someweb.otherweb.com etc. | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nNael bo povezave zadete kot 'www.someweb.com' pod string (toda ne povezave kot so private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nNael bo povezave zadetih pod stringom kot www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nNael bo le povezave kot 'www.test.com/test/someweb.html' datoteko. Pazite, da boste vpisali popolno pot (URL + pot spletne strani) | |
| 100 | 100 | All links will match |
| 101 | 101 | Vse povezave bodo zadete |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | \nPreberite log datoteko, èe je potrebno.\n\nKliknite na gumb KONÈANO za konec dele z HTTraQt Website Copier.\n\nZahvaljujemo se za to, da ste uporabljali HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Zrcaljenje je popolnoma dokonèano.\nKliknite na gumb Izhod za konec dela s programom HTTraQt.\nPreberite log datoteko(e), èe se elite preprièati, da je bilo vse vredu.\n\nZahvaljujemo se za to, da ste uporabljali HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * ZRCALJENJE JE PREKINJENO! * *\r\nTekoèi zaèasni predpomnilnik je bil zahtevan za kaktere koli postopke nadgradnje in vsebuje le preneene podatke znotraj prekinjene seje.\r\nOblikovani predpomnilnik vsebuje veè popolnih informacij; èe ne elite izgubiti teh podatkov jih lahko obnovite in zbriete tekoèi predpomnilnik.\r\n[Opomba: To lahko enostavneje storite, èe boste roèno zbrisali hts-cache/ nemudoma * datoteke]\r\n\r\nMislite, da oblikovani predpomnilnik vsebuje veè popolnih informacij in jih elite obnoviti? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * NAPAKA MED ZRCALJENJEM! * *\r\nHTTraQt je ugotovil, da je aktivno zrcaljenje prazno. Èe je bilo nadgrajeno bo obnovljeno prejnje zrcaljenje.\r\nVzrok: prva stran ni bila najdena ali pa vsebuje napake.\r\n=> Preprièajte se ali spletna stran sploh obstaja in/ ali ste preverili vae nastavitve proxy strenika! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * ZRCALJENJE JE PREKINJENO! * *\nTekoèi zaèasni predpomnilnik je bil zahtevan za kaktere koli postopke nadgradnje in vsebuje le preneene podatke znotraj prekinjene seje.\nOblikovani predpomnilnik vsebuje veè popolnih informacij; èe ne elite izgubiti teh podatkov jih lahko obnovite in zbriete tekoèi predpomnilnik.\n[Opomba: To lahko enostavneje storite, èe boste roèno zbrisali hts-cache/ nemudoma * datoteke]\n\nMislite, da oblikovani predpomnilnik vsebuje veè popolnih informacij in jih elite obnoviti? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * NAPAKA MED ZRCALJENJEM! * *\nHTTraQt je ugotovil, da je aktivno zrcaljenje prazno. Èe je bilo nadgrajeno bo obnovljeno prejnje zrcaljenje.\nVzrok: prva stran ni bila najdena ali pa vsebuje napake.\n=> Preprièajte se ali spletna stran sploh obstaja in/ ali ste preverili vae nastavitve proxy strenika! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \n\nNamig: Kliknite na [Preglej log datoteko] kjer boste lahko prebrali vsa opozorila in sporoèila o napakah |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Prekini povezavo, ko bo konèano |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Izkljuèi modem ob dokonèanju |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Prosimo Vas, da nas obvestite o kakrnih koli teavah ali napakah)\r\n\r\nRazvoj:\r\nVmesnik (Okna): Xavier Roche\r\nHitrost: Xavier Roche\r\nJavaParserRazredi: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche in drugi sodelujoèi\r\nVELIKA ZAHVALA za namige prevodov gre:\r\nRobertu Lagadecu (rlagadec@yahoo.fr) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Prosimo Vas, da nas obvestite o kakrnih koli teavah ali napakah)\n\nRazvoj:\nVmesnik (Okna): Xavier Roche\nHitrost: Xavier Roche\nJavaParserRazredi: Yann Philippot\n\n(C)1998-2003 Xavier Roche in drugi sodelujoèi\nVELIKA ZAHVALA za namige prevodov gre:\nRobertu Lagadecu (rlagadec@yahoo.fr) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | O programu HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Prebrskaj spletne strani... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Uporabniko doloèena struktura |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tIme datoteke brez konènice (npr.: slika)\r\n%N\tIme datoteko s konènico (npr: slika.gif)\r\n%t\tLe konènica datoteke (npr: gif)\r\n%p\tPot [brez zakljuèka /] (primer: /poljubnaslika)\r\n%h\tIme gostitelja (npr: www.poljubnastran.com)\r\n%M\tMD5 URL (128 bitov, 32 ascii bytov)\r\n%Q\tMD5 poizvedovalni string (128 bitov, 32 ascii bytov)\r\n%q\tMD5 majhen poizvedovalni string (16 bitov, 4 ascii bytov)\r\n\r\n%s?\tKratko ime (Npr.: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tIme datoteke brez konènice (npr.: slika)\n%N\tIme datoteko s konènico (npr: slika.gif)\n%t\tLe konènica datoteke (npr: gif)\n%p\tPot [brez zakljuèka /] (primer: /poljubnaslika)\n%h\tIme gostitelja (npr: www.poljubnastran.com)\n%M\tMD5 URL (128 bitov, 32 ascii bytov)\n%Q\tMD5 poizvedovalni string (128 bitov, 32 ascii bytov)\n%q\tMD5 majhen poizvedovalni string (16 bitov, 4 ascii bytov)\n\n%s?\tKratko ime (Npr.: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Moje spletne strani |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Vpiite novo ime projekta, \r\nali izberite obstojeèe za nadgradnjo/prevzem | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Vpiite novo ime projekta, \nali izberite obstojeèe za nadgradnjo/prevzem | |
| 796 | 796 | New project |
| 797 | 797 | Novi projekt |
| 798 | 798 | Insert URL |
| 853 | 853 | Ni dovolj pomnilnika, usodna notranja napaka... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Neznano opravilo! |
| 856 | Add this URL?\r\n | |
| 857 | Dodaj ta URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Dodaj ta URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Opozorilo: glavni proces je nepremièen in ne morem dodati URL(je).. |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | sv |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Staffan Ström (staffan at fam-strom.org) \r\n | |
| 7 | Staffan Ström (staffan at fam-strom.org) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Matchande länkar kommer att inkluderas: |
| 78 | 78 | Example: |
| 79 | 79 | Exempel: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\n Kommer att matcha alla GIF-filer | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nKommer att hitta alla filer med en matchande textsträng. Skriver du ex. vis 'blue' medtages 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nKommer att ta med filen 'bigfile.mov', men inte filen 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nKommer att hitta länkar med mappnamn som matchar textsträngen 'cgi', t.ex. /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nFinner länkar med mappnamn som matchar hela 'cgi-bin' textsträngen (men inte cgi-bin-2, som ett exempel) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nHittar länkar med matchande sub-string t.ex. www.someweb.com, private.someweb.com etc. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nHittar länkar med matchande mappnamn sub-string som t.ex. www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc.\r\n\r\n | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nHittar länkar som matchar hela strängen 'www.someweb.com' , (men INTE länkar som: private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nHittar möjliga länkar med matchande text-sträng som t.ex. www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc.\r\n | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nHittar bara 'www.test.com/test/someweb.html' filen. Notera att du skall skriva den fullständiga sökvägen[URL + sökväg] | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\n Kommer att matcha alla GIF-filer | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nKommer att hitta alla filer med en matchande textsträng. Skriver du ex. vis 'blue' medtages 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nKommer att ta med filen 'bigfile.mov', men inte filen 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nKommer att hitta länkar med mappnamn som matchar textsträngen 'cgi', t.ex. /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nFinner länkar med mappnamn som matchar hela 'cgi-bin' textsträngen (men inte cgi-bin-2, som ett exempel) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nHittar länkar med matchande sub-string t.ex. www.someweb.com, private.someweb.com etc. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nHittar länkar med matchande mappnamn sub-string som t.ex. www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc.\n\n | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nHittar länkar som matchar hela strängen 'www.someweb.com' , (men INTE länkar som: private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nHittar möjliga länkar med matchande text-sträng som t.ex. www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc.\n | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nHittar bara 'www.test.com/test/someweb.html' filen. Notera att du skall skriva den fullständiga sökvägen[URL + sökväg] | |
| 100 | 100 | All links will match |
| 101 | 101 | Alla länkar kommer att matcha |
| 102 | 102 | Add exclusion filter |
| 152 | 152 | Unable to initialize the OLE system |
| 153 | 153 | Kan inte starta OLE-systemet |
| 154 | 154 | HTTraQt could not find any interrupted download file cache in the specified folder! |
| 155 | HTTraQt kan inte hitta nĺgon avbruten download fil-cache i den angivna mappen!\r\n | |
| 155 | HTTraQt kan inte hitta nĺgon avbruten download fil-cache i den angivna mappen!\n | |
| 156 | 156 | Could not connect to provider |
| 157 | 157 | Kan inte ansluta till Internet |
| 158 | 158 | receive |
| 200 | 200 | \nSee the log file if necessary.\n\nClick FINISH to quit HTTraQt Website Copier.\n\nThanks for using HTTraQt! |
| 201 | 201 | \nGranska eventuellt log filen.\n\nKlicka pĺ AVSLUTA för att stänga HTTraQt Website Copier.\n\nTack för att du använder HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | Webb kopieringen är utförd. \nKlicka OK för att avsluta HTTraQt.\nGranska log-fil(erna) för att kontrollera att allt har fungerat.\n\nTack för att du avänder HTTraQt!\r\n | |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * KOPIERINGEN ÄR AVBRUTEN! * *\r\nDen nuvarnde cachen är obligatorisk för alla uppdaterings operationer och innehĺller data frĺn senaste nerladdning med den aktuella avbrutna överföringen.\r\nDen tidigare cachen kan innehĺlla mera komplett information; on du önskar att spara den informationen, ska du ĺterskapa den och radera den aktuella cachen.\r\n[Note: Detta kan lättast göras genom att radera samtliga 'hts-cache/new.* filer]\r\n\r\nTror du att den tidigare cache-fil eventuellt innehĺler mera komplett information, och vill du ĺterställa den? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * KOPIERINGSFEL! * *\r\nHTTraQt har upptäckt att den nuvarande webb-kopieringen är tom. Om det var en uppdatering du utförde, har den gamla kopian ĺterskapats.\r\nMöjlig fel: Den första sidan kunde antingen inte hittas eller uppstod det ett problem med förbindelsen.\r\n=> Kontrollera att webbservern finns och/eller kontrollera Proxy-inställningen! <= | |
| 203 | Webb kopieringen är utförd. \nKlicka OK för att avsluta HTTraQt.\nGranska log-fil(erna) för att kontrollera att allt har fungerat.\n\nTack för att du avänder HTTraQt!\n | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * KOPIERINGEN ÄR AVBRUTEN! * *\nDen nuvarnde cachen är obligatorisk för alla uppdaterings operationer och innehĺller data frĺn senaste nerladdning med den aktuella avbrutna överföringen.\nDen tidigare cachen kan innehĺlla mera komplett information; on du önskar att spara den informationen, ska du ĺterskapa den och radera den aktuella cachen.\n[Note: Detta kan lättast göras genom att radera samtliga 'hts-cache/new.* filer]\n\nTror du att den tidigare cache-fil eventuellt innehĺler mera komplett information, och vill du ĺterställa den? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * KOPIERINGSFEL! * *\nHTTraQt har upptäckt att den nuvarande webb-kopieringen är tom. Om det var en uppdatering du utförde, har den gamla kopian ĺterskapats.\nMöjlig fel: Den första sidan kunde antingen inte hittas eller uppstod det ett problem med förbindelsen.\n=> Kontrollera att webbservern finns och/eller kontrollera Proxy-inställningen! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \n\nTips: Klicka [Granska log fil] för att granska varning/fel-meddelande |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Koppla ner förbindelsen när överföringen är klar |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Koppla ned modemet efter avslutning |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Hittar du fel eller uppstĺr det problem, kontakta oss)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for Swedish translations to:\r\nStaffan Ström (staffan@fam-strom.org) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Hittar du fel eller uppstĺr det problem, kontakta oss)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for Swedish translations to:\nStaffan Ström (staffan@fam-strom.org) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | Om HTTraQt Website Copier... |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Gĺ igenom webbsidor |
| 744 | 744 | User-defined structure |
| 745 | 745 | Användardefinerad struktur |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tFilnamn utan filtyp (ex: image)\r\n%N\tHela filnamnet inkl. filtyp (ex: image.gif)\r\n%t\tEnbart filtyp (ex: gif)\r\n%p\tSökväg [utan ändelsen /] (ex: /someimages)\r\n%h\tVärddator-namn (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 frĺgesträng (128 bits, 32 ascii bytes)\r\n%q\tMD5 kort frĺgesträng (16 bits, 4 ascii bytes)\r\n\r\n%s?\tKort namn (ex: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tFilnamn utan filtyp (ex: image)\n%N\tHela filnamnet inkl. filtyp (ex: image.gif)\n%t\tEnbart filtyp (ex: gif)\n%p\tSökväg [utan ändelsen /] (ex: /someimages)\n%h\tVärddator-namn (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 frĺgesträng (128 bits, 32 ascii bytes)\n%q\tMD5 kort frĺgesträng (16 bits, 4 ascii bytes)\n\n%s?\tKort namn (ex: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Exempel:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Mina webbsidor |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | 795 | Skriv namnet pĺ ett nytt projekt\neller\nvälj att uppdatera ett existerande projekt |
| 796 | 796 | New project |
| 797 | 797 | Nytt projekt |
| 853 | 853 | Det finns inte tillräckligt med minne, allvarligt internt fel har uppstĺtt.. |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Okänd handling! |
| 856 | Add this URL?\r\n | |
| 857 | Addera denna URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Addera denna URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Varning: Processen svarar inte, URLen kan inte adderas.... |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | tr |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Arman (Armish) Aksoy <armish@linux-sevenler.de>\r\n | |
| 7 | Arman (Armish) Aksoy <armish@linux-sevenler.de>\n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Eşleşen bu bağlantılar alınacaktır: |
| 78 | 78 | Example: |
| 79 | 79 | Örnek: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nTüm GIF dosyalarını eşleştirecektir | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | mavi\r\nTüm kelimeleri ve içerdiklerini 'mavi' adlı kelimeyle karşılaştıracaktır, mesela 'mavigokyuzu.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | buyukdosya.mov\r\nBu aramada 'buyukdosya.mov' eşleşecektir fakat 'buyukdosya2.mov' eşleşmeyecektir | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\n'cgi' kelimesiyle eşleşen tüm bağlantıları bulacaktır, mesela '/cgi-bin/somecgi.cgi' | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\n'cgi-bin' ile eşleşen tüm dizin bağlantılarını bulacaktır, fakat 'cgi-bin-2' gibi bir kelime bu aramada eşleşmez | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | siteniz.com\r\n'siteniz.com' içeren tüm bağlantıları bulacaktır, mesela 'www.siteniz.com', 'ozel.siteniz.com' | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | siteniz\r\n'siteniz' kelimesini içeren tüm bağlantıları bulacaktır, mesela 'www.siteniz.com', 'ozel.siteniz.com', 'www.siteniz.edu' | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.siteniz.com\r\n'www.siteniz.com' içeren tüm adresleri bulacaktır, ama mesela 'ozel.siteniz.com' bu aramada eşleşmeyecektir | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | siteniz\r\n'siteniz' ile eşleşen tüm alt ve ana bağlantıları bulacaktır, mesela www.siteniz.com/blabla, www.deneme.abc/sitenizden/, wwww.deneme.com/siteniz.html | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.deneme.com/deneme/adres.html\r\nSadece 'www.deneme.com/deneme/adres.html' dosyasınız bulur. Bunun için tam adresi (Site adresi + site konumu) girmeniz gerektiğini unutmayınız | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nTüm GIF dosyalarını eşleştirecektir | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | mavi\nTüm kelimeleri ve içerdiklerini 'mavi' adlı kelimeyle karşılaştıracaktır, mesela 'mavigokyuzu.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | buyukdosya.mov\nBu aramada 'buyukdosya.mov' eşleşecektir fakat 'buyukdosya2.mov' eşleşmeyecektir | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\n'cgi' kelimesiyle eşleşen tüm bağlantıları bulacaktır, mesela '/cgi-bin/somecgi.cgi' | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\n'cgi-bin' ile eşleşen tüm dizin bağlantılarını bulacaktır, fakat 'cgi-bin-2' gibi bir kelime bu aramada eşleşmez | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | siteniz.com\n'siteniz.com' içeren tüm bağlantıları bulacaktır, mesela 'www.siteniz.com', 'ozel.siteniz.com' | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | siteniz\n'siteniz' kelimesini içeren tüm bağlantıları bulacaktır, mesela 'www.siteniz.com', 'ozel.siteniz.com', 'www.siteniz.edu' | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.siteniz.com\n'www.siteniz.com' içeren tüm adresleri bulacaktır, ama mesela 'ozel.siteniz.com' bu aramada eşleşmeyecektir | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | siteniz\n'siteniz' ile eşleşen tüm alt ve ana bağlantıları bulacaktır, mesela www.siteniz.com/blabla, www.deneme.abc/sitenizden/, wwww.deneme.com/siteniz.html | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.deneme.com/deneme/adres.html\nSadece 'www.deneme.com/deneme/adres.html' dosyasınız bulur. Bunun için tam adresi (Site adresi + site konumu) girmeniz gerektiğini unutmayınız | |
| 100 | 100 | All links will match |
| 101 | 101 | Bütün bağlantılar eşleştirilecek |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | \nEğer gerekliyse kayıt dosyasına bakabilirsiniz.\n\nHTTraQt Website Copier'den çıkmak için BİTİR'e tıklayın.\n\nHTTraQt kullandığınız için teşekkürler! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Yansı işlemi tamamlandı.\nWinHTTrac'dan çıkmak için Çık'a tıklayın.\nHerşeyin düzgün yapıldığından emin olmak için kayıt dosyasına bakabilirsiniz.\n\nHTTraQt kullandığınız için teşekkürler! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * YANSI İŞLEMİ İPTAL EDİLDİ! * *\r\nHerhangi bir güncelleme işlemi için şuanki geçici kayıtlar gereklidir ve bu kayıtlar indirilen dosyaları tutarlar.\r\nBiçimlendirilmiş kayıt daha fazla bilgi içerebilir; eğer bu bilgiyi kaybetmek istemiyorsanız, bu kaydı yedekleyebilir ve geçici olanını silebilirsiniz.\r\n[Not: Bu işlemi hts-cache/new.* dosyalarını silerek kolaylıkla yapabilirsiniz]\r\n\rBiçimlendirilmiş kaydı geri almak istiyor musunuz? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * YANSI İŞLEMİ HATASI! * *\r\nHTTraQt kullanılan yanısnın boş olduğunu tespit etti. Eğer bu bir güncelleme ise, önceki yansı geri alınabilir.\r\nNeden: başlangıç sayfa(lar)ı bulunamadı veya bir bağlantı problemi oluştu.\r\n=> Web sitesinin olup olmadığını ve vekil sunucu ayarlarınızı kontrol edin! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * YANSI İŞLEMİ İPTAL EDİLDİ! * *\nHerhangi bir güncelleme işlemi için şuanki geçici kayıtlar gereklidir ve bu kayıtlar indirilen dosyaları tutarlar.\nBiçimlendirilmiş kayıt daha fazla bilgi içerebilir; eğer bu bilgiyi kaybetmek istemiyorsanız, bu kaydı yedekleyebilir ve geçici olanını silebilirsiniz.\n[Not: Bu işlemi hts-cache/new.* dosyalarını silerek kolaylıkla yapabilirsiniz]\n\rBiçimlendirilmiş kaydı geri almak istiyor musunuz? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * YANSI İŞLEMİ HATASI! * *\nHTTraQt kullanılan yanısnın boş olduğunu tespit etti. Eğer bu bir güncelleme ise, önceki yansı geri alınabilir.\nNeden: başlangıç sayfa(lar)ı bulunamadı veya bir bağlantı problemi oluştu.\n=> Web sitesinin olup olmadığını ve vekil sunucu ayarlarınızı kontrol edin! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \n\İpucu: Hata ve uyarı mesajlarını görmek için [Kayıt dosyasını göster]'e tıklayınn |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 633 | 633 | Bittiğinde bağlantıyı kes |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | İşlem tamamlandığında modemden bağlantıyı kopar |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Lütfen bize her türlü hatayı ve problemi aktarınız)\r\n\r\nGeliştirme:\r\nArayüz (Windows): Xavier Roche\r\nAğ: Xavier Roche\r\nJava Ayıklama Sınıfları: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche ve diğerleri\r\nÇeviri ipuçları için teşekkürler: \r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Lütfen bize her türlü hatayı ve problemi aktarınız)\n\nGeliştirme:\nArayüz (Windows): Xavier Roche\nAğ: Xavier Roche\nJava Ayıklama Sınıfları: Yann Philippot\n\n(C)1998-2003 Xavier Roche ve diğerleri\nÇeviri ipuçları için teşekkürler: \nRobert Lagadec (rlagadec@yahoo.fr) | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | HTTraQt Website Copier Hakkında |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Siteleri tara... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Kullanıcı tanımlı yapı |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tDosyanın soneksiz adı (örn: resim)\r\n%N\tDosyanın sonekli adı (örn: resim.gif)\r\n%t\tYalnız dosyanın türü (örn: gif)\r\n%p\tKonum [/ ile bitmeyen] (örn: /resimler)\r\n%h\tSunucu adı (örn: www.siteniz.com)\r\n%M\tMD5 URL (128 bit, 32 ascii bayt)\r\n%Q\tMD5 sorgu kelimesi (128 bit, 32 ascii bayt)\r\n%q\tMD5 kısa arama kelimesi (16 bit, 4 ascii bayt)\r\n\r\n%s?\tKısa ad (örnek: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tDosyanın soneksiz adı (örn: resim)\n%N\tDosyanın sonekli adı (örn: resim.gif)\n%t\tYalnız dosyanın türü (örn: gif)\n%p\tKonum [/ ile bitmeyen] (örn: /resimler)\n%h\tSunucu adı (örn: www.siteniz.com)\n%M\tMD5 URL (128 bit, 32 ascii bayt)\n%Q\tMD5 sorgu kelimesi (128 bit, 32 ascii bayt)\n%q\tMD5 kısa arama kelimesi (16 bit, 4 ascii bayt)\n\n%s?\tKısa ad (örnek: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Örnek:\t%h%p/%n%q.%t\n->\t\tc:\\yansı\\www.siteniz.com\\resimler\\resim.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Benim Web Sitem |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Yeni bir proje adı yazın, \r\nveya devam edilecek/güncellenecek projeyi seçin | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Yeni bir proje adı yazın, \nveya devam edilecek/güncellenecek projeyi seçin | |
| 796 | 796 | New project |
| 797 | 797 | Yeni proje |
| 798 | 798 | Insert URL |
| 853 | 853 | Yeterli hafıza yok, ölümcül iç hata.. |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Bilinmeyen işlem! |
| 856 | Add this URL?\r\n | |
| 857 | Bu URL eklensin mi?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Bu URL eklensin mi?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Uyarı: Ana süreç hala cevap vermedi, URL eklenemedi.. |
| 860 | 860 | Type/MIME associations |
| 4 | 4 | LANGUAGE_ISO |
| 5 | 5 | ua |
| 6 | 6 | LANGUAGE_AUTHOR |
| 7 | Andrij Shevchuk (http://programy.com.ua, http://vic-info.com.ua) \r\n | |
| 7 | Andrij Shevchuk (http://programy.com.ua, http://vic-info.com.ua) \n | |
| 8 | 8 | LANGUAGE_CHARSET |
| 9 | 9 | UTF-8 |
| 10 | 10 | LANGUAGE_WINDOWSID |
| 77 | 77 | Лінки, що задовольняють цій умові будуть включені: |
| 78 | 78 | Example: |
| 79 | 79 | Приклад: |
| 80 | gif\r\nWill match all GIF files | |
| 81 | gif\r\nзнайде усі gif (чи GIF) файли | |
| 82 | blue\r\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\r\nзнайдеайли, що містять в імені подстроку 'blue', наприклад 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\r\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\r\nзнайде'bigfile.mov', але, у теж час, пропустить файл 'bigfile2.mov' | |
| 86 | cgi\r\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\r\nзнайде адреси, що містять каталоги з подстрокой 'cgi', такі як /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\r\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\r\nзнайде адреси, що містять каталог 'cgi-bin' (але не cgi-bin-2, наприклад) | |
| 90 | someweb.com\r\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\r\nзнайде такі лінки, як www.someweb.com, private.someweb.com і т.п.. | |
| 92 | someweb\r\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\r\nзнайде адреси типу www.someweb.com, www.someweb.edu, private.someweb.otherweb.com і т.д.\r\n | |
| 94 | www.someweb.com\r\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\r\nзнайде адреси, такі як www.someweb.com/... (але не такі, як private.someweb.com/..) | |
| 96 | someweb\r\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\r\nзнайде усі лінки такі, як www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html і т.п. | |
| 98 | www.test.com/test/someweb.html\r\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\r\nзнайде тільки www.test.com/test/someweb.html. Зважте, необхідно вказати повну адресу ресурсу - хост (www.xxx.yyy) і шлях (/test/someweb.html) | |
| 80 | gif\nWill match all GIF files | |
| 81 | gif\nзнайде усі gif (чи GIF) файли | |
| 82 | blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg' | |
| 83 | blue\nзнайдеайли, що містять в імені подстроку 'blue', наприклад 'bluesky-small.jpeg' | |
| 84 | bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov' | |
| 85 | bigfile.mov\nзнайде'bigfile.mov', але, у теж час, пропустить файл 'bigfile2.mov' | |
| 86 | cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi | |
| 87 | cgi\nзнайде адреси, що містять каталоги з подстрокой 'cgi', такі як /cgi-bin/somecgi.cgi | |
| 88 | cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example) | |
| 89 | cgi-bin\nзнайде адреси, що містять каталог 'cgi-bin' (але не cgi-bin-2, наприклад) | |
| 90 | someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc. | |
| 91 | someweb.com\nзнайде такі лінки, як www.someweb.com, private.someweb.com і т.п.. | |
| 92 | someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc. | |
| 93 | someweb\nзнайде адреси типу www.someweb.com, www.someweb.edu, private.someweb.otherweb.com і т.д.\n | |
| 94 | www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..) | |
| 95 | www.someweb.com\nзнайде адреси, такі як www.someweb.com/... (але не такі, як private.someweb.com/..) | |
| 96 | someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc. | |
| 97 | someweb\nзнайде усі лінки такі, як www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html і т.п. | |
| 98 | www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path) | |
| 99 | www.test.com/test/someweb.html\nзнайде тільки www.test.com/test/someweb.html. Зважте, необхідно вказати повну адресу ресурсу - хост (www.xxx.yyy) і шлях (/test/someweb.html) | |
| 100 | 100 | All links will match |
| 101 | 101 | Усі лінки припустимі |
| 102 | 102 | Add exclusion filter |
| 201 | 201 | У разі потреби, дивіться лог файл.\n\nдля виходу з HTTraQt натисніть кнопку OK.\n\nдякуємо за використання HTTraQt! |
| 202 | 202 | Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt! |
| 203 | 203 | Створення дзеркала завершене.\nдля виходу з програми натисніть кнопку OK.\nдля перевірки успішності завантаження подивитеся лог файл(и).\n\nдякуємо за використання HTTraQt! |
| 204 | * * MIRROR ABORTED! * *\r\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\r\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\r\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\r\n\r\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * ЗАВАНТАЖЕННЯ ПЕРЕРВАНЕ! * *\r\nтимчасовий кеш, створений під час поточної сесії, містить дані, завантажені тільки під час даної сесії і буде потрібний тільки у випадку поновлення завантаження.\r\nале, може містити більш повну інформацію. Якщо ви не хочете втратити ці дані, вам потрібно видалити поточний кеш і відновити попередній.\r\n(Це можна легко зробити прямо тут, видаливши файли hts-cache/new.]\r\n\r\nВи вважаєте, що попередній кеш може містити більш повну інформацію, і чи хочете ви відновити його? | |
| 206 | * * MIRROR ERROR! * *\r\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\r\nReason: the first page(s) either could not be found, or a connection problem occured.\r\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ПОМИЛКА! * *\r\nце дзеркало - порожнє. Якщо це було відновлення, версія дзеркала відновлена.\r\nпричина: перша сторінка(и) чи не знайдена, чи були проблеми з з'єднанням.\r\n=> Переконайтеся, що вебсайт ще існує, і/чи перевірте установки проксі-сервера! <= | |
| 204 | * * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it? | |
| 205 | * * ЗАВАНТАЖЕННЯ ПЕРЕРВАНЕ! * *\nтимчасовий кеш, створений під час поточної сесії, містить дані, завантажені тільки під час даної сесії і буде потрібний тільки у випадку поновлення завантаження.\nале, може містити більш повну інформацію. Якщо ви не хочете втратити ці дані, вам потрібно видалити поточний кеш і відновити попередній.\n(Це можна легко зробити прямо тут, видаливши файли hts-cache/new.]\n\nВи вважаєте, що попередній кеш може містити більш повну інформацію, і чи хочете ви відновити його? | |
| 206 | * * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <= | |
| 207 | * * ПОМИЛКА! * *\nце дзеркало - порожнє. Якщо це було відновлення, версія дзеркала відновлена.\nпричина: перша сторінка(и) чи не знайдена, чи були проблеми з з'єднанням.\n=> Переконайтеся, що вебсайт ще існує, і/чи перевірте установки проксі-сервера! <= | |
| 208 | 208 | \n\nTip: Click [View log file] to see warning or error messages |
| 209 | 209 | \nподсказка:Для перегляду повідомлень про помилки і попереджень натисніть [Перегляд лог файлу] |
| 210 | 210 | Error deleting a hts-cache/new.* file, please do it manually |
| 211 | Помилка видалення файлу hts-cache/new.* , будь ласка, видалите його ручками.\r\n | |
| 211 | Помилка видалення файлу hts-cache/new.* , будь ласка, видалите його ручками.\n | |
| 212 | 212 | Do you really want to quit HTTraQt Website Copier? |
| 213 | 213 | Ви дійсно хочете вийти з HTTraQt? |
| 214 | 214 | - Mirroring Mode -\n\nEnter address(es) in URL box |
| 633 | 633 | Від'єднатись при завершенні |
| 634 | 634 | Disconnect modem on completion |
| 635 | 635 | Від'єднати при завершенні |
| 636 | \r\n(Please notify us of any bug or problem)\r\n\r\nDevelopment:\r\nInterface (Windows): Xavier Roche\r\nSpider: Xavier Roche\r\nJavaParserClasses: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for translation tips to:\r\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \r\n(Повідомите нам будь ласка про помічені проблеми і помилки)\r\n\r\nразработка:\r\nинтерфейс (Windows): Xavier Roche\r\nкачалка (spider): Xavier Roche\r\nпарсер java-класів: Yann Philippot\r\n\r\n(C)1998-2003 Xavier Roche and other contributors\r\nMANY THANKS for Ukrainian translations to:\r\nAndrij Shevchuk (andrijsh@mail.lviv.ua) http://programy.com.ua, http://vic-info.com.ua | |
| 636 | \n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr) | |
| 637 | \n(Повідомите нам будь ласка про помічені проблеми і помилки)\n\nразработка:\nинтерфейс (Windows): Xavier Roche\nкачалка (spider): Xavier Roche\nпарсер java-класів: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for Ukrainian translations to:\nAndrij Shevchuk (andrijsh@mail.lviv.ua) http://programy.com.ua, http://vic-info.com.ua | |
| 638 | 638 | About HTTraQt Website Copier |
| 639 | 639 | Про програму HTTraQt Website Copier |
| 640 | 640 | Please visit our Web page |
| 743 | 743 | &Перегляд сайтів... |
| 744 | 744 | User-defined structure |
| 745 | 745 | Задання структури |
| 746 | %n\tName of file without file type (ex: image)\r\n%N\tName of file including file type (ex: image.gif)\r\n%t\tFile type only (ex: gif)\r\n%p\tPath [without ending /] (ex: /someimages)\r\n%h\tHost name (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tІмена файлів без типу (наприклад: image)\r\n%N\tІмена файлів з типом (напр.: image.gif)\r\n%t\tТільки тип файлу (напр.: gif)\r\n%p\tШлях [без закінчення /] (пр.: /someimages)\r\n%h\tНазва Хоста (ex: www.someweb.com)\r\n%M\tMD5 URL (128 bits, 32 ascii bytes)\r\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\r\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\r\n\r\n%s?\tКороткі імена (пр: %sN) | |
| 746 | %n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN) | |
| 747 | %n\tІмена файлів без типу (наприклад: image)\n%N\tІмена файлів з типом (напр.: image.gif)\n%t\tТільки тип файлу (напр.: gif)\n%p\tШлях [без закінчення /] (пр.: /someimages)\n%h\tНазва Хоста (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tКороткі імена (пр: %sN) | |
| 748 | 748 | Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 749 | 749 | Наприклад:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif |
| 750 | 750 | Proxy settings |
| 791 | 791 | |
| 792 | 792 | C:\\My Web Sites |
| 793 | 793 | C:\\Мої Web Сайти |
| 794 | Type a new project name, \r\nor select existing project to update/resume | |
| 795 | Задайте назву нового проекту, \r\nабо Виберіть існуючий проект для його актуалізації/продовження | |
| 794 | Type a new project name, \nor select existing project to update/resume | |
| 795 | Задайте назву нового проекту, \nабо Виберіть існуючий проект для його актуалізації/продовження | |
| 796 | 796 | New project |
| 797 | 797 | Новий проект |
| 798 | 798 | Insert URL |
| 853 | 853 | Замало пам'яті, фатальна внутрішня помилка... |
| 854 | 854 | Unknown operation! |
| 855 | 855 | Невідома операція |
| 856 | Add this URL?\r\n | |
| 857 | Додати цей URL?\r\n | |
| 856 | Add this URL?\n | |
| 857 | Додати цей URL?\n | |
| 858 | 858 | Warning: main process is still not responding, cannot add URL(s).. |
| 859 | 859 | Увага: програма не відповідає на запити, не можливо додати URL'и... |
| 860 | 860 | Type/MIME associations |
| 0 | /*************************************************************************** | |
| 1 | * C++ Implementation: * | |
| 2 | * Copyright (C) 2012 by Eduard Kalinowski * | |
| 3 | * Germany, Lower Saxony, Hanover * | |
| 4 | * eduard_kalinowski@yahoo.de * | |
| 5 | * * | |
| 6 | * HTTraQt is free software; you can redistribute it and/or * | |
| 7 | * modify it under the terms of the GNU Lesser General Public * | |
| 8 | * License as published by the Free Software Foundation; either * | |
| 9 | * version 3 of the License, or (at your option) any later version. * | |
| 10 | * * | |
| 11 | * HTTraQt is distributed in the hope that it will be useful, but * | |
| 12 | * WITHOUT ANY WARRANTY; without even the implied warranty of * | |
| 13 | * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. * | |
| 14 | * * | |
| 15 | * See the GNU Lesser General Public License for more details. * | |
| 16 | * * | |
| 17 | * You should have received a copy of the GNU Lesser General Public * | |
| 18 | * License along with HTTraQt. If not, see http://www.gnu.org/licenses * | |
| 19 | ***************************************************************************/ | |
| 20 | ||
| 21 | #include <QtGui> | |
| 22 | ||
| 23 | #include "./includes/httraq.h" | |
| 24 | #include "./includes/BuildStringDialog.h" | |
| 25 | ||
| 26 | // #include <iostream.h> | |
| 27 | ||
| 28 | extern HTTraQt* mainWidget; | |
| 29 | ||
| 30 | ||
| 31 | BuildStringDialog::BuildStringDialog(QWidget *parent) | |
| 32 | : QDialog(parent) | |
| 33 | { | |
| 34 | setupUi(this); | |
| 35 | ||
| 36 | connect(okButton, SIGNAL(clicked()), this, SLOT(onOk())); | |
| 37 | connect(pushButton, SIGNAL(clicked()), this, SLOT(reject())); | |
| 38 | } | |
| 39 | ||
| 40 | void BuildStringDialog::onOk() | |
| 41 | { | |
| 42 | QString st; | |
| 43 | st = lineEdit->text(); | |
| 44 | mainWidget->SetProfile("BuildString", st); | |
| 45 | ||
| 46 | accept(); | |
| 47 | } | |
| 48 | ||
| 49 | ||
| 50 | void BuildStringDialog::translate() | |
| 51 | { | |
| 52 | QString st; | |
| 53 | label->setText(translateString(LANG_Q2)); | |
| 54 | label_2->setText(translateString(LANG_Q3)); | |
| 55 | ||
| 56 | mainWidget->GetProfile("BuildString", st); | |
| 57 | lineEdit->setText(st); | |
| 58 | } | |
| 59 | ||
| 60 | ||
| 61 | ||
| 62 | ||
| 63 | ||
| 64 |
| 0 | 0 | #CMakeLists.txt |
| 1 | 1 | |
| 2 | 2 | set(MAIN_SOURCES ${CMAKE_CURRENT_SOURCE_DIR}/AboutDialog.cpp |
| 3 | ${CMAKE_CURRENT_SOURCE_DIR}/BuildStringDialog.cpp | |
| 4 | 3 | ${CMAKE_CURRENT_SOURCE_DIR}/buttonPanel.cpp |
| 5 | 4 | ${CMAKE_CURRENT_SOURCE_DIR}/ConfirmTab.cpp |
| 6 | 5 | ${CMAKE_CURRENT_SOURCE_DIR}/FinalTab.cpp |
| 22 | 21 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/InsertUrlDialog.h |
| 23 | 22 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/NewProjTab.h |
| 24 | 23 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/ProgressTab.h |
| 25 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/BuildStringDialog.h | |
| 26 | 24 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/ConfirmTab.h |
| 27 | 25 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/htinterface.h |
| 28 | 26 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/httraq.h |
| 32 | 30 | |
| 33 | 31 | |
| 34 | 32 | set(MAIN_FORMS ${CMAKE_CURRENT_SOURCE_DIR}/forms/AboutDialog.ui |
| 35 | ${CMAKE_CURRENT_SOURCE_DIR}/forms/BuildStringDialog.ui | |
| 36 | 33 | ${CMAKE_CURRENT_SOURCE_DIR}/forms/buttonPanel.ui |
| 37 | 34 | ${CMAKE_CURRENT_SOURCE_DIR}/forms/ConfirmTab.ui |
| 38 | 35 | ${CMAKE_CURRENT_SOURCE_DIR}/forms/FinalTab.ui |
| 31 | 31 | |
| 32 | 32 | void ConfirmTab::translate() |
| 33 | 33 | { |
| 34 | label01->setText(translateString("Please adjust connection parameters if necessary,\n" | |
| 35 | "then press FINISH to launch the mirroring operation.")); | |
| 36 | label04->setText(translateString("Shutdown PC when finished")); | |
| 37 | label05->setText(translateString("Transfer scheduled for: (hh/mm/ss)")); | |
| 38 | label06->setText(translateString("Save settings only, do not launch download now.")); | |
| 39 | group02->setTitle(translateString("On hold")); | |
| 34 | label01->setText(translateString(_ADJ)); | |
| 35 | label04->setText(translateString(_SHUTD)); | |
| 36 | label05->setText(translateString(_TR_SHED)); | |
| 37 | label06->setText(translateString(_SAV_SETTINGS)); | |
| 38 | group02->setTitle(translateString(_ON_HOLD)); | |
| 40 | 39 | } |
| 41 | 40 | |
| 42 | 41 |
| 90 | 90 | |
| 91 | 91 | QDir dr(newPrDir); |
| 92 | 92 | if (dr.exists() == false) { |
| 93 | mainWidget->readSettings(true); | |
| 94 | 93 | if (dr.mkpath(newPrDir) == false) { |
| 95 | 94 | QMessageBox::critical(this, "Creating error", "Can not create directory!"); |
| 96 | 95 | return false; |
| 97 | 96 | } |
| 98 | } else { | |
| 99 | mainWidget->readSettings(false); | |
| 100 | } | |
| 97 | } | |
| 98 | ||
| 99 | mainWidget->getOptions(); | |
| 101 | 100 | |
| 102 | 101 | mainWidget->writeSettings(false); |
| 103 | 102 | |
| 224 | 223 | } |
| 225 | 224 | |
| 226 | 225 | if (exists == false) { |
| 227 | mainWidget->readSettings(true); | |
| 226 | // mainWidget->readSettings(true); | |
| 228 | 227 | label03->setText(translateString("New project")); |
| 229 | 228 | |
| 230 | 229 | } else { |
| 231 | 230 | label03->setText(translateString("Type a new project name, \nor select existing project to update/resume")); |
| 232 | 231 | } |
| 232 | mainWidget->getOptions(); | |
| 233 | 233 | |
| 234 | 234 | changeProjname(fileName); |
| 235 | 235 | |
| 268 | 268 | && (settings.size()) > 0) { // taille log contr�le>0 |
| 269 | 269 | // QString strSection = "OptionsValues"; |
| 270 | 270 | // mainWidget->currentOptions = newOptions; |
| 271 | mainWidget->readSettings(false);//, newOptions); | |
| 271 | // mainWidget->readSettings(false);//, newOptions); | |
| 272 | 272 | mainWidget->GetProfile("CurrentUrl", st); |
| 273 | 273 | mainWidget->GetProfile("Category", stl); |
| 274 | 274 | // |
| 276 | 276 | label01->setText(translateString("Project name:")); |
| 277 | 277 | |
| 278 | 278 | } else { |
| 279 | mainWidget->readSettings(true); | |
| 279 | // mainWidget->readSettings(true); | |
| 280 | 280 | label03->setText(translateString("New project")); |
| 281 | 281 | label01->setText(translateString("New project name:")); |
| 282 | 282 | } |
| 43 | 43 | label07->insertItems(0, lCombo); |
| 44 | 44 | |
| 45 | 45 | //help text for the label10 |
| 46 | hl01 << _MOD00 | |
| 47 | << _MOD01 | |
| 48 | << _MOD02 | |
| 49 | << _MOD03 | |
| 50 | << _MOD04 | |
| 51 | << _MOD05 | |
| 46 | hl01 << _MOD00 | |
| 47 | << _MOD01 | |
| 48 | << _MOD02 | |
| 49 | << _MOD03 | |
| 50 | << _MOD04 | |
| 51 | << _MOD05 | |
| 52 | 52 | << _MOD06; |
| 53 | 53 | |
| 54 | 54 | label07->setCurrentIndex(0); |
| 0 | <?xml version="1.0" encoding="UTF-8"?> | |
| 1 | <ui version="4.0"> | |
| 2 | <class>BuildStringDialog</class> | |
| 3 | <widget class="QDialog" name="BuildStringDialog"> | |
| 4 | <property name="geometry"> | |
| 5 | <rect> | |
| 6 | <x>0</x> | |
| 7 | <y>0</y> | |
| 8 | <width>422</width> | |
| 9 | <height>352</height> | |
| 10 | </rect> | |
| 11 | </property> | |
| 12 | <property name="sizePolicy"> | |
| 13 | <sizepolicy hsizetype="Fixed" vsizetype="Fixed"> | |
| 14 | <horstretch>0</horstretch> | |
| 15 | <verstretch>0</verstretch> | |
| 16 | </sizepolicy> | |
| 17 | </property> | |
| 18 | <property name="font"> | |
| 19 | <font> | |
| 20 | <pointsize>8</pointsize> | |
| 21 | </font> | |
| 22 | </property> | |
| 23 | <property name="windowTitle"> | |
| 24 | <string>About HTTraQt Website Copier</string> | |
| 25 | </property> | |
| 26 | <widget class="QLabel" name="label"> | |
| 27 | <property name="geometry"> | |
| 28 | <rect> | |
| 29 | <x>10</x> | |
| 30 | <y>50</y> | |
| 31 | <width>401</width> | |
| 32 | <height>201</height> | |
| 33 | </rect> | |
| 34 | </property> | |
| 35 | <property name="autoFillBackground"> | |
| 36 | <bool>true</bool> | |
| 37 | </property> | |
| 38 | <property name="frameShape"> | |
| 39 | <enum>QFrame::NoFrame</enum> | |
| 40 | </property> | |
| 41 | <property name="frameShadow"> | |
| 42 | <enum>QFrame::Raised</enum> | |
| 43 | </property> | |
| 44 | <property name="text"> | |
| 45 | <string/> | |
| 46 | </property> | |
| 47 | <property name="alignment"> | |
| 48 | <set>Qt::AlignLeading|Qt::AlignLeft|Qt::AlignTop</set> | |
| 49 | </property> | |
| 50 | <property name="wordWrap"> | |
| 51 | <bool>true</bool> | |
| 52 | </property> | |
| 53 | <property name="openExternalLinks"> | |
| 54 | <bool>true</bool> | |
| 55 | </property> | |
| 56 | </widget> | |
| 57 | <widget class="QLineEdit" name="lineEdit"> | |
| 58 | <property name="geometry"> | |
| 59 | <rect> | |
| 60 | <x>10</x> | |
| 61 | <y>10</y> | |
| 62 | <width>401</width> | |
| 63 | <height>26</height> | |
| 64 | </rect> | |
| 65 | </property> | |
| 66 | </widget> | |
| 67 | <widget class="QLabel" name="label_2"> | |
| 68 | <property name="geometry"> | |
| 69 | <rect> | |
| 70 | <x>10</x> | |
| 71 | <y>270</y> | |
| 72 | <width>401</width> | |
| 73 | <height>41</height> | |
| 74 | </rect> | |
| 75 | </property> | |
| 76 | <property name="text"> | |
| 77 | <string>TextLabel</string> | |
| 78 | </property> | |
| 79 | </widget> | |
| 80 | <widget class="QPushButton" name="okButton"> | |
| 81 | <property name="geometry"> | |
| 82 | <rect> | |
| 83 | <x>330</x> | |
| 84 | <y>320</y> | |
| 85 | <width>75</width> | |
| 86 | <height>25</height> | |
| 87 | </rect> | |
| 88 | </property> | |
| 89 | <property name="minimumSize"> | |
| 90 | <size> | |
| 91 | <width>75</width> | |
| 92 | <height>25</height> | |
| 93 | </size> | |
| 94 | </property> | |
| 95 | <property name="maximumSize"> | |
| 96 | <size> | |
| 97 | <width>75</width> | |
| 98 | <height>25</height> | |
| 99 | </size> | |
| 100 | </property> | |
| 101 | <property name="text"> | |
| 102 | <string>O&K</string> | |
| 103 | </property> | |
| 104 | <property name="shortcut"> | |
| 105 | <string>Alt+K</string> | |
| 106 | </property> | |
| 107 | <property name="default"> | |
| 108 | <bool>true</bool> | |
| 109 | </property> | |
| 110 | </widget> | |
| 111 | <widget class="QPushButton" name="pushButton"> | |
| 112 | <property name="geometry"> | |
| 113 | <rect> | |
| 114 | <x>240</x> | |
| 115 | <y>320</y> | |
| 116 | <width>75</width> | |
| 117 | <height>25</height> | |
| 118 | </rect> | |
| 119 | </property> | |
| 120 | <property name="minimumSize"> | |
| 121 | <size> | |
| 122 | <width>75</width> | |
| 123 | <height>25</height> | |
| 124 | </size> | |
| 125 | </property> | |
| 126 | <property name="maximumSize"> | |
| 127 | <size> | |
| 128 | <width>75</width> | |
| 129 | <height>25</height> | |
| 130 | </size> | |
| 131 | </property> | |
| 132 | <property name="text"> | |
| 133 | <string>Cancel</string> | |
| 134 | </property> | |
| 135 | </widget> | |
| 136 | </widget> | |
| 137 | <layoutdefault spacing="6" margin="11"/> | |
| 138 | <resources> | |
| 139 | <include location="../../icons/application.qrc"/> | |
| 140 | </resources> | |
| 141 | <connections/> | |
| 142 | </ui> |
| 194 | 194 | |
| 195 | 195 | st1 = translateString("Error"); |
| 196 | 196 | |
| 197 | st2 = translateString("* * MIRROR ERROR! * *\nHTTraQt has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <="); | |
| 197 | st2 = translateString(_MIRROR_ERR); | |
| 198 | 198 | |
| 199 | 199 | QMessageBox::warning(this, st1, st2); |
| 200 | 200 | |
| 237 | 237 | // if ( msg.length() > 1 ) { |
| 238 | 238 | result = msg.data(); |
| 239 | 239 | // actualP = process; |
| 240 | qDebug() << "displayProgressMsg:" << result ; | |
| 240 | // qDebug() << "displayProgressMsg:" << result ; | |
| 241 | 241 | // } |
| 242 | 242 | |
| 243 | 243 | // if ( result.length() < 1 ) |
| 254 | 254 | line = process->readLine().trimmed(); |
| 255 | 255 | } |
| 256 | 256 | |
| 257 | qDebug() << "displayOutputMsg:" << line ; | |
| 257 | // qDebug() << "displayOutputMsg:" << line ; | |
| 258 | 258 | } |
| 259 | 259 | |
| 260 | 260 | |
| 480 | 480 | { |
| 481 | 481 | QString fname; |
| 482 | 482 | if (currentProject.length() > 0) { |
| 483 | fname = currentWorkDir + "/" + currentProject +"linprofile.ini"; | |
| 483 | fname = currentWorkDir + "/" + currentProject +"/linprofile.ini"; | |
| 484 | 484 | |
| 485 | 485 | if (QFile::exists(fname) == true) { |
| 486 | 486 | currentOptionsFile = fname; |
| 572 | 572 | {"KeepAlive", INTEGER, 1}, |
| 573 | 573 | {"RemoveTimeout", INTEGER, 0}, |
| 574 | 574 | {"RemoveRateout", INTEGER, 0}, |
| 575 | {"RateOut", INTEGER, 1}, | |
| 575 | {"RateOut", INTEGER, 0}, | |
| 576 | 576 | {"StoreAllInCache", INTEGER, 0}, |
| 577 | 577 | {"MIMEDefsMime1", TEXT, ""}, |
| 578 | 578 | {"MIMEDefsMime2", TEXT, ""}, |
| 633 | 633 | QString fname; |
| 634 | 634 | if (global == true) { |
| 635 | 635 | s = new QSettings("KarboSoft", "HTTraQt"); |
| 636 | // qDebug() << "writesettings global"; | |
| 636 | 637 | } else { |
| 637 | 638 | if (currentProject.length() == 0) |
| 638 | 639 | return; |
| 648 | 649 | } |
| 649 | 650 | |
| 650 | 651 | fname += "/linprofile.ini"; |
| 651 | // qDebug() << fname; | |
| 652 | // qDebug() << "writesettings local" << fname; | |
| 652 | 653 | s = new QSettings(fname, QSettings::IniFormat); |
| 653 | 654 | } |
| 654 | 655 | |
| 704 | 705 | if (global == true) { |
| 705 | 706 | s = new QSettings("KarboSoft", "HTTraQt"); |
| 706 | 707 | currentWorkDir = s->value("WorkDir", QDir::homePath() + "/My Web Sites").toString(); |
| 708 | // qDebug() << "readSettings global"; | |
| 707 | 709 | } else { |
| 708 | 710 | fname = currentWorkDir + "/" + currentProject + "/linprofile.ini"; |
| 709 | 711 | if (QFile::exists(fname) == false) { // not exists |
| 711 | 713 | } else { |
| 712 | 714 | s = new QSettings(fname, QSettings::IniFormat); |
| 713 | 715 | } |
| 716 | // qDebug() << "readSettings local" << fname; | |
| 714 | 717 | } |
| 715 | 718 | |
| 716 | 719 | // now reading of settings |
| 1375 | 1378 | |
| 1376 | 1379 | // str = firstWidget->label1027->currentText(); |
| 1377 | 1380 | // SetProfileString(mainOptions, "Category", str); |
| 1378 | str = (*(OptionsTab*)widgets[2]).textEdit->toPlainText() /*.text()*/; | |
| 1381 | str = (*(OptionsTab*)widgets[2]).textEdit->toPlainText(); | |
| 1379 | 1382 | SetProfile("CurrentUrl", str); |
| 1380 | 1383 | |
| 1381 | 1384 | str.replace("\n", " "); |
| 1487 | 1490 | } |
| 1488 | 1491 | |
| 1489 | 1492 | GetProfile("Cookies", n); |
| 1490 | if (n != 0) { | |
| 1493 | if (n == 0) { | |
| 1491 | 1494 | cmdOpt += "b0"; |
| 1492 | 1495 | } |
| 1493 | 1496 | |
| 0 | /*************************************************************************** | |
| 1 | * C++ Implementation: * | |
| 2 | * Copyright (C) 2012 by Eduard Kalinowski * | |
| 3 | * Germany, Lower Saxony, Hanover * | |
| 4 | * eduard_kalinowski@yahoo.de * | |
| 5 | * * | |
| 6 | * HTTraQt is free software; you can redistribute it and/or * | |
| 7 | * modify it under the terms of the GNU Lesser General Public * | |
| 8 | * License as published by the Free Software Foundation; either * | |
| 9 | * version 3 of the License, or (at your option) any later version. * | |
| 10 | * * | |
| 11 | * HTTraQt is distributed in the hope that it will be useful, but * | |
| 12 | * WITHOUT ANY WARRANTY; without even the implied warranty of * | |
| 13 | * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. * | |
| 14 | * * | |
| 15 | * See the GNU Lesser General Public License for more details. * | |
| 16 | * * | |
| 17 | * You should have received a copy of the GNU Lesser General Public * | |
| 18 | * License along with HTTraQt. If not, see http://www.gnu.org/licenses * | |
| 19 | ***************************************************************************/ | |
| 20 | ||
| 21 | #ifndef BUILDSTRING_H | |
| 22 | #define BUILDSTRING_H | |
| 23 | ||
| 24 | #include "httraq.h" | |
| 25 | #include "ui_BuildStringDialog.h" | |
| 26 | ||
| 27 | class HTTraQt; | |
| 28 | ||
| 29 | ||
| 30 | class BuildStringDialog: public QDialog, public Ui_BuildStringDialog | |
| 31 | { | |
| 32 | Q_OBJECT | |
| 33 | public: | |
| 34 | BuildStringDialog(QWidget *parent = 0); | |
| 35 | void translate(); | |
| 36 | private slots: | |
| 37 | void onOk(); | |
| 38 | ||
| 39 | }; | |
| 40 | ||
| 41 | #endif |
| 0 | #ifndef LANG_H | |
| 1 | #define LANG_H | |
| 2 | ||
| 3 | ||
| 4 | #define _NR_CONN "N# connections" | |
| 5 | #define _TIMEOUTS "TimeOut(s)" | |
| 6 | #define _RETRIES "Retries" | |
| 7 | #define _MAX_RATE "Maximum transfer rate" | |
| 8 | #define _MIN_RATE "Minimum transfer rate" | |
| 9 | #define _KEEP_ALIVE "Persistent connections (Keep-Alive)" | |
| 10 | #define _CANCEL_TIMEOUT "Cancel all links from host if timeout occurs" | |
| 11 | #define _CANCEL_SLOW "Cancel all links from host if too slow" | |
| 12 | #define _CHECK_DOC_TYPE "Check document type" | |
| 13 | #define _SPIDER "Spider" | |
| 14 | #define _ACCEPT_COOK "Accept cookies" | |
| 15 | #define _PARSE_JAVA "Parse java files" | |
| 16 | #define _UPDATE_HACK "Update hack (limit re-transfers)" | |
| 17 | #define _URL_HACK "URL hacks (join similar URLs)" | |
| 18 | #define _TOL_REQ "Tolerant requests (for servers)" | |
| 19 | #define _FORCE_OLD "Force old HTTP/1.0 requests (no 1.1)" | |
| 20 | #define _BROWS_ID "Browser identity" | |
| 21 | #define _OS_ID "Operation system Identity" | |
| 22 | #define _HTML_FOOT "HTML footer" | |
| 23 | #define _STRUCT_TYPE "Structure type (how links are saved)" | |
| 24 | #define _DOS_NAMES "DOS names (8+3)" | |
| 25 | #define _NO_ERR_PAG "No error pages" | |
| 26 | #define _NO_EXTERAL "No external pages" | |
| 27 | #define _HIDE_PASS "Hide passwords" | |
| 28 | #define _HIDE_QUERY "Hide query strings" | |
| 29 | #define _NOT_PURGE "Do not purge old files" | |
| 30 | #define _ISO9660_NAMES "ISO9660 names (CDROM)" | |
| 31 | #define _BUILD "Build" | |
| 32 | #define _ONLY_EXPERTS "These options should be modified only exceptionally" | |
| 33 | #define _PRIM_SCAN "Primary Scan Rule" | |
| 34 | #define _TRAVEL_MODE "Travel mode" | |
| 35 | #define _GLOBAL_TRAVEL "Global travel mode" | |
| 36 | #define _REWRITE_LINKS "Rewrite links: internal / external" | |
| 37 | #define _USE_CACHE "Use a cache for updates and retries" | |
| 38 | #define _DEBUG_MODE "Activate Debugging Mode (httraq.log)" | |
| 39 | #define _MAX_FROM_ROOT "Maximum mirroring depth from root address" | |
| 40 | #define _MAX_EXTERNAL "Maximum mirroring depth for external/forbidden addresses (0, that is, none, is the default)" | |
| 41 | #define _MAX_SIZE_HTML "Max size of any HTML file (B)" | |
| 42 | #define _MAX_SIZE_NHTML "Max size of any non-HTML file" | |
| 43 | #define _SIZE_LIMIT "Size limit" | |
| 44 | #define _PAUSE_DOWN "Pause after downloading.." | |
| 45 | #define _MAX_TIME "Max time" | |
| 46 | #define _MAX_CONN_SEC "Max connections / seconds" | |
| 47 | #define _MAX_LINKS "Maximum number of links" | |
| 48 | #define _ALL_LINKS_MATCH "All links will match" | |
| 49 | #define _GET_NHTML "Get non-HTML files related to a link, eg external .ZIP or pictures" | |
| 50 | #define _TEST_LINKS "Test all links (even forbidden ones)" | |
| 51 | #define _GET_HTML_FIRST "Get HTML files first!" | |
| 52 | #define _MIME_ASSOC "Type/MIME associations" | |
| 53 | #define _FILE_TYPES "File types:" | |
| 54 | #define _MIME_ID "MIME identity:" | |
| 55 | #define _PROX_ADDR "Proxy address:" | |
| 56 | #define _PROX_PORT "Proxy port:" | |
| 57 | #define _LOGIN "Login" | |
| 58 | #define _PASS "Password" | |
| 59 | #define _USE_PROXY "Use proxy for ftp transfers" | |
| 60 | #define _USE_WILDCARDS "Use wildcards to exclude or include URLs or links.\nYou can put several scan strings on the same line.\nUse spaces as separators.\n\nExample: +*.zip -www.*.com -www.*.edu/cgi-bin/*.cgi" | |
| 61 | #define _CRITERION "Criterion" | |
| 62 | #define _STRING "String" | |
| 63 | #define _TIP_GIF "Tip: To have ALL GIF files included, use something like +www.someweb.com/*.gif. \n(+*.gif / -*.gif will include/exclude ALL GIFs from ALL sites)" | |
| 64 | #define _CARD_FILTER "WildCardFilters" | |
| 65 | #define _ADD_SCAN_RULE "Add Scan Rule" | |
| 66 | #define _EXCL_LINKS "Exclude links" | |
| 67 | #define _INCL_LINKS "Include link(s)" | |
| 68 | #define _STORE_CACHE "Store ALL files in cache" | |
| 69 | #define _NO_REDOWNLOAD "Do not re-download locally erased files" | |
| 70 | #define _CREATE_LOG "Create Log files" | |
| 71 | #define _MAKE_INDEX "Make an index" | |
| 72 | #define _MAKE_WORD_INDEX "Make a word database" | |
| 73 | ||
| 74 | #define LISTDEF_1 "File names with extension:\nFile names containing:\nThis file name:\nFolder names containing:\nThis folder name:\nLinks on this domain:\nLinks on domains containing:\nLinks from this host:\nLinks containing:\nThis link:\nALL LINKS" | |
| 75 | #define LISTDEF_2 "Show all\nHide debug\nHide infos\nHide debug and infos" | |
| 76 | #define LISTDEF_3 "Site-structure (default)\nHtml in web/, images/other files in web/images/\nHtml in web/html, images/other in web/images\nHtml in web/, images/other in web/\nHtml in web/, images/other in web/xxx, where xxx is the file extension\nHtml in web/html, images/other in web/xxx\nSite-structure, without www.domain.xxx/\nHtml in site_name/, images/other files in site_name/images/\nHtml in site_name/html, images/other in site_name/images\nHtml in site_name/, images/other in site_name/\nHtml in site_name/, images/other in site_name/xxx\nHtml in site_name/html, images/other in site_name/xxx\nAll files in web/, with random names (gadget !)\nAll files in site_name/, with random names (gadget !)\nUser-defined structure.." | |
| 77 | #define LISTDEF_4 "Just scan\nStore html files\nStore non html files\nStore all files (default)\nStore html files first" | |
| 78 | #define LISTDEF_5 "Stay in the same directory\nCan go down (default)\nCan go up\nCan both go up & down" | |
| 79 | #define LISTDEF_6 "Stay on the same address (default)\nStay on the same domain\nStay on the same top level domain\nGo everywhere on the web" | |
| 80 | #define LISTDEF_7 "Never\nIf unknown (except /)\nIf unknown" | |
| 81 | #define LISTDEF_8 "no robots.txt rules\nrobots.txt except wizard\nfollow robots.txt rules" | |
| 82 | #define LISTDEF_9 "normal\nextended\ndebug" | |
| 83 | #define LISTDEF_10 "Download web site(s)\nDownload web site(s) + questions\nGet individual files\nDownload all sites in pages (multiple mirror)\nTest links in pages (bookmark test)\n* Continue interrupted download\n* Update existing download" | |
| 84 | #define LISTDEF_11 "Relative URI / Absolute URL (default)\nAbsolute URL / Absolute URL\nAbsolute URI / Absolute URL\nOriginal URL / Original URL" | |
| 85 | ||
| 86 | #define _MOD00 "- Mirroring Mode -\n\nEnter address(es) in URL box" | |
| 87 | #define _MOD01 "- Interactive Wizard Mode (questions) -\n\nEnter address(es) in URL box" | |
| 88 | #define _MOD02 "- File Download Mode -\n\nEnter file address(es) in URL box" | |
| 89 | #define _MOD03 "- Links List Mode -\n\nUse URL box to enter address(es) of page(s) containing links to mirror" | |
| 90 | #define _MOD04 "- Link Testing Mode -\n\nEnter Web address(es) with links to test in URL box" | |
| 91 | #define _MOD05 "- Update Mode -\n\nVerify address(es) in URL box, check parameters if necessary then click on 'NEXT' button" | |
| 92 | #define _MOD06 "- Resume Mode (Interrupted Operation) -\n\nVerify address(es) in URL box, check parameters if necessary then click on 'NEXT' button" | |
| 93 | ||
| 94 | ||
| 95 | #define LANG_OK "OK" | |
| 96 | #define LANG_CANCEL "Cancel" | |
| 97 | #define LANG_QUIT "Exit" | |
| 98 | #define LANG_CLOSE "Close" | |
| 99 | #define LANG_TIPCANCEL "Cancel changes" | |
| 100 | #define LANG_TIPOK "Click to confirm" | |
| 101 | #define LANG_TIPHELP "Click to get help!" | |
| 102 | #define LANG_TIPPREV "Click to return to previous screen" | |
| 103 | #define LANG_TIPNEXT "Click to go to next screen" | |
| 104 | #define LANG_HIDEPWD "Hide password" | |
| 105 | #define LANG_SAVEPROJECT "Save project" | |
| 106 | #define LANG_CLOSEPRJ "Close current project?" | |
| 107 | #define LANG_DELETECONF "Delete this project?" | |
| 108 | #define LANG_DELETEEMPTYCONF "Delete empty project %s?" | |
| 109 | #define LANG_ACTIONNYP "Action not yet implemented" | |
| 110 | #define LANG_ERRORDEL "Error deleting this project" | |
| 111 | #define LANG_B1 "Select a rule for the filter" | |
| 112 | #define LANG_B2 "Enter keywords for the filter" | |
| 113 | #define LANG_B3 "Cancel" | |
| 114 | #define LANG_B4 "Add this rule" | |
| 115 | #define LANG_A2 "Please enter one or several keyword(s) for the rule" | |
| 116 | #define LANG_B8 "Add" | |
| 117 | #define LANG_B9 "Scan Rules" | |
| 118 | #define LANG_B14 "Save prefs" | |
| 119 | #define LANG_B20 "Matching links will be excluded:" | |
| 120 | #define LANG_B21 "Matching links will be included:" | |
| 121 | #define LANG_B22 "Example:" | |
| 122 | #define LANG_B23 "gif\nWill match all GIF files" | |
| 123 | #define LANG_B24 "blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg'" | |
| 124 | #define LANG_B25 "bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov'" | |
| 125 | #define LANG_B26 "cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi" | |
| 126 | #define LANG_B27 "cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example)" | |
| 127 | #define LANG_B28 "someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc." | |
| 128 | #define LANG_B29 "someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc." | |
| 129 | #define LANG_B30 "www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..)" | |
| 130 | #define LANG_B31 "someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc." | |
| 131 | #define LANG_B32 "www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path)" | |
| 132 | #define LANG_C1 "Add exclusion filter" | |
| 133 | #define LANG_C2 "Add inclusion filter" | |
| 134 | #define LANG_C3 "Existing filters" | |
| 135 | #define LANG_C4 "Cancel changes" | |
| 136 | #define LANG_C5 "Save current preferences as default values" | |
| 137 | #define LANG_C6 "Click to confirm" | |
| 138 | #define LANG_D1 "No log files in %s!" | |
| 139 | #define LANG_D2 "No 'index.html' file in %s!" | |
| 140 | #define LANG_D3 "Click to quit HTTraQt Website Copier" | |
| 141 | #define LANG_D4 "View log files" | |
| 142 | #define LANG_D5 "Browse HTML start page" | |
| 143 | #define LANG_D6 "End of mirror" | |
| 144 | #define LANG_D7 "View log files" | |
| 145 | #define LANG_D8 "Browse Mirrored Website" | |
| 146 | #define LANG_D9 "New project..." | |
| 147 | #define LANG_E1 "View error and warning reports" | |
| 148 | #define LANG_E2 "View report" | |
| 149 | #define LANG_E3 "Close the log file window" | |
| 150 | #define LANG_E4 "Info type:" | |
| 151 | #define LANG_E5 "Errors" | |
| 152 | #define LANG_E6 "Infos" | |
| 153 | #define LANG_E7 "Find" | |
| 154 | #define LANG_E8 "Find a word" | |
| 155 | #define LANG_E10 "Info log file" | |
| 156 | #define LANG_E11 "Warning/Errors log file" | |
| 157 | #define LANG_F1 "Unable to initialize the OLE system" | |
| 158 | #define LANG_F2 "HTTraQt could not find any interrupted download file cache in the specified folder!" | |
| 159 | #define LANG_F3 "Could not connect to provider" | |
| 160 | #define LANG_F4 "receive" | |
| 161 | #define LANG_F5 "request" | |
| 162 | #define LANG_F6 "connect" | |
| 163 | #define LANG_F7 "search" | |
| 164 | #define LANG_F8 "ready" | |
| 165 | #define LANG_F9 "error" | |
| 166 | #define LANG_F10 "Receiving files.." | |
| 167 | #define LANG_F11 "Parsing HTML file.." | |
| 168 | #define LANG_F11b "Purging files.." | |
| 169 | #define LANG_F11c "Loading cache in progress.." | |
| 170 | #define LANG_F12 "Parsing HTML file (testing links).." | |
| 171 | #define LANG_F13 "Pause - Toggle [Mirror]/[Pause download] to resume operation" | |
| 172 | #define LANG_F13b "Finishing pending transfers - Select [Cancel] to stop now!" | |
| 173 | #define LANG_F14 "scanning" | |
| 174 | #define LANG_F15 "Waiting for scheduled time.." | |
| 175 | #define LANG_F15b "Transferring data.." | |
| 176 | #define LANG_F16 "Connecting to provider" | |
| 177 | #define LANG_F17 "[%d seconds] to go before start of operation" | |
| 178 | #define LANG_F18 "Site mirroring in progress [%s, %s bytes]" | |
| 179 | #define LANG_F18b "Site mirroring finished!" | |
| 180 | #define LANG_F19 "A problem occured during the mirroring operation\n" | |
| 181 | #define LANG_F20 "\nDuring:\n" | |
| 182 | #define LANG_F21 "\nSee the log file if necessary.\n\nClick FINISH to quit HTTraQt Website Copier.\n\nThanks for using HTTraQt!" | |
| 183 | #define LANG_F22 "Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt!" | |
| 184 | #define LANG_F22b "* * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it?" | |
| 185 | #define LANG_F22c "* * MIRROR ERROR! * *\nHTTrack has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <=" | |
| 186 | #define LANG_F23 "\n\nTip: Click [View log file] to see warning or error messages" | |
| 187 | #define LANG_F24 "Error deleting a hts-cache/new.* file, please do it manually" | |
| 188 | #define LANG_G1 "Do you really want to quit HTTraQt Website Copier?" | |
| 189 | #define LANG_G7 "Log files Path" | |
| 190 | #define LANG_G8 "Path" | |
| 191 | #define LANG_G1C "New project / Import?" | |
| 192 | #define LANG_G9 "Choose criterion" | |
| 193 | #define LANG_G10 "Maximum link scanning depth" | |
| 194 | #define LANG_G11 "Enter address(es) here" | |
| 195 | #define LANG_G13 "Define additional filtering rules" | |
| 196 | #define LANG_G14 "Proxy Name (if needed)" | |
| 197 | #define LANG_G15 "Proxy Port" | |
| 198 | #define LANG_G15b "Define proxy settings" | |
| 199 | #define LANG_G15c "Use standard HTTP proxy as FTP proxy" | |
| 200 | #define LANG_G16 "Path" | |
| 201 | #define LANG_G17 "Select Path" | |
| 202 | #define LANG_G18 "Path" | |
| 203 | #define LANG_G19 "Select Path" | |
| 204 | #define LANG_G20 "Quit HTTraQt Website Copier" | |
| 205 | #define LANG_G21 "About HTTraQt" | |
| 206 | #define LANG_G22 "Save current preferences as default values" | |
| 207 | #define LANG_G23 "Click to continue" | |
| 208 | #define LANG_G24 "Click to define options" | |
| 209 | #define LANG_G24b "Click to add a URL" | |
| 210 | #define LANG_G24c "Load URL(s) from text file" | |
| 211 | #define LANG_G25 "HTTraQt preferences (*.opt)|*.opt||" | |
| 212 | #define LANG_G25b "Address List text file (*.txt)|*.txt||" | |
| 213 | #define LANG_G26 "File not found!" | |
| 214 | #define LANG_G26b "Do you really want to change the project name/path?" | |
| 215 | #define LANG_G27 "Load user-default options?" | |
| 216 | #define LANG_G28 "Save user-default options?" | |
| 217 | #define LANG_G29 "Reset all default options?" | |
| 218 | #define LANG_G30 "Welcome to HTTraQt!" | |
| 219 | #define _ACTION "Action:" | |
| 220 | #define LANG_G32 "Max Depth" | |
| 221 | #define LANG_G32b "Maximum external depth:" | |
| 222 | #define LANG_G33 "Filters (refuse/accept links) :" | |
| 223 | #define LANG_G34 "Paths" | |
| 224 | #define LANG_G37 "Save prefs" | |
| 225 | #define LANG_G39 "Define.." | |
| 226 | #define _SET_OPT "Set options.." | |
| 227 | #define _PREFS_OPT "Preferences and mirror options:" | |
| 228 | #define LANG_G42 "Project name" | |
| 229 | #define _ADD_URL "Add a URL..." | |
| 230 | #define _WEB_ADDR "Web Addresses: (URL)" | |
| 231 | #define LANG_H1 "Stop HTTraQt?" | |
| 232 | #define LANG_H2 "No log files in %s!" | |
| 233 | #define LANG_H3 "Pause Download?" | |
| 234 | #define LANG_H4 "Stop the mirroring operation" | |
| 235 | #define LANG_H5 "Minimize to System Tray" | |
| 236 | #define LANG_H6 "Click to skip a link or stop parsing" | |
| 237 | #define LANG_H7 "Click to skip a link" | |
| 238 | #define LANG_H8 "Bytes saved" | |
| 239 | #define LANG_H9 "Links scanned" | |
| 240 | #define LANG_H10 "Time:" | |
| 241 | #define LANG_H11 "Connections:" | |
| 242 | #define LANG_H12 "Running:" | |
| 243 | #define LANG_H13 "Hide" | |
| 244 | #define LANG_H14 "Transfer rate" | |
| 245 | #define LANG_H15 "SKIP" | |
| 246 | #define LANG_H16 "Information" | |
| 247 | #define LANG_H17 "Files written:" | |
| 248 | #define LANG_H18 "Files updated:" | |
| 249 | #define LANG_H19 "Errors:" | |
| 250 | #define LANG_H20 "In progress:" | |
| 251 | #define LANG_I1 "Follow external links" | |
| 252 | #define LANG_I2 "Test all links in pages" | |
| 253 | #define LANG_I2b "Try to ferret out all links" | |
| 254 | #define LANG_I2c "Download HTML files first (faster)" | |
| 255 | #define LANG_I3 "Choose local site structure" | |
| 256 | #define LANG_I4 "Set user-defined structure on disk" | |
| 257 | #define LANG_I5b "Do not update zero size or user-erased files" | |
| 258 | #define LANG_I6 "Create a Start Page" | |
| 259 | #define LANG_I6b "Create a word database of all html pages" | |
| 260 | #define LANG_I7 "Create error logging and report files" | |
| 261 | #define LANG_I8 "Generate DOS 8-3 filenames ONLY" | |
| 262 | #define LANG_I8b "Generate ISO9660 filenames ONLY for CDROM medias" | |
| 263 | #define LANG_I9 "Do not create HTML error pages" | |
| 264 | #define LANG_I10 "Select file types to be saved to disk" | |
| 265 | #define LANG_I11 "Select parsing direction" | |
| 266 | #define LANG_I11b "Select global parsing direction" | |
| 267 | #define LANG_I11c "Setup URL rewriting rules for internal links (downloaded ones) and external links (not downloaded ones)" | |
| 268 | #define LANG_I12 "Max simultaneous connections" | |
| 269 | #define LANG_I13 "File timeout" | |
| 270 | #define LANG_I15 "Minimum admissible transfer rate" | |
| 271 | #define LANG_I17 "Maximum number of retries on non-fatal errors" | |
| 272 | #define LANG_I18 "Maximum size for any single HTML file" | |
| 273 | #define LANG_I19 "Maximum size for any single non-HTML file" | |
| 274 | #define LANG_I20 "Maximum amount of bytes to retrieve from the Web" | |
| 275 | #define LANG_I20b "Make a pause after downloading this amount of bytes" | |
| 276 | #define LANG_I21 "Maximum duration time for the mirroring operation" | |
| 277 | #define LANG_I22b "Maximum connections/seconds (avoid server overload)" | |
| 278 | #define LANG_I22c "Maximum number of links that can be tested (not saved!)" | |
| 279 | #define LANG_I23b "Comment to be placed in each HTML file" | |
| 280 | #define LANG_I24 "Back to starting page" | |
| 281 | #define LANG_I25 "Save current preferences as default values" | |
| 282 | #define LANG_I26 "Click to continue" | |
| 283 | #define LANG_I27 "Click to cancel changes" | |
| 284 | #define LANG_I28 "Follow local robots rules on sites" | |
| 285 | #define LANG_I29 "Links to non-localised external pages will produce error pages" | |
| 286 | #define LANG_I1a "Do not erase obsolete files after update" | |
| 287 | #define LANG_I1b "Accept cookies?" | |
| 288 | #define LANG_I1c "Check document type when unknown?" | |
| 289 | #define LANG_I1d "Parse java applets to retrieve included files that must be downloaded?" | |
| 290 | #define LANG_I1e "Store all files in cache instead of HTML only" | |
| 291 | #define LANG_I1f "Log file type (if generated)" | |
| 292 | #define LANG_I1h "Create a debugging file" | |
| 293 | #define LANG_I1i "Use non-standard requests to get round some server bugs" | |
| 294 | #define LANG_I1j "Use old HTTP/1.0 requests (limits engine power!)" | |
| 295 | #define LANG_I1k "Attempt to limit retransfers through several tricks (file size test..)" | |
| 296 | #define LANG_I1k2 "Attempt to limit the number of links by skipping similar URLs (www.foo.com==foo.com, http=https ..)" | |
| 297 | #define LANG_I30 "Write external links without login/password" | |
| 298 | #define LANG_I30b "Write internal links without query string" | |
| 299 | #define LANG_I32b "Try to catch all URLs (even in unknown tags/code)" | |
| 300 | #define LANG_I34 "Use a cache for updates" | |
| 301 | #define LANG_I36 "Log files" | |
| 302 | #define LANG_I39 "Primary Scan Rule" | |
| 303 | #define LANG_I41 "Flow control" | |
| 304 | #define LANG_I42 "Limits" | |
| 305 | #define LANG_I43 "Identity" | |
| 306 | #define LANG_I45 "Abandon host if error" | |
| 307 | #define LANG_I47 "Abandon host if too slow" | |
| 308 | #define LANG_I47b "Configure" | |
| 309 | #define LANG_I47f "Reduce connection time and type lookup time using persistent connections" | |
| 310 | #define LANG_I51 "Max site size" | |
| 311 | #define _SAVE_PREFS "Save prefs" | |
| 312 | #define LANG_I54 "Max transfer rate" | |
| 313 | #define LANG_I55 "Follow robots.txt" | |
| 314 | ||
| 315 | #define LANG_IOPT1 "Links" | |
| 316 | #define LANG_IOPT3 "Experts Only" | |
| 317 | #define LANG_IOPT4 "Flow Control" | |
| 318 | #define LANG_IOPT5 "Limits" | |
| 319 | #define LANG_IOPT6 "Browser ID" | |
| 320 | #define LANG_IOPT7 "Scan Rules" | |
| 321 | #define LANG_IOPT9 "Log, Index, Cache" | |
| 322 | #define LANG_IOPT10 "Proxy" | |
| 323 | #define LANG_IOPT11 "MIME Types" | |
| 324 | #define LANG_J1 "Do you really want to quit HTTraQt Website Copier?" | |
| 325 | #define LANG_J2 "Do not connect to a provider (already connected)" | |
| 326 | #define LANG_J2b "Do not use remote access connection" | |
| 327 | #define LANG_J3 "Schedule the mirroring operation" | |
| 328 | #define LANG_J4 "Quit HTTraQt Website Copier" | |
| 329 | #define LANG_J5 "Back to starting page" | |
| 330 | #define LANG_J6 "Click to start!" | |
| 331 | #define LANG_J7 "No saved password for this connection!" | |
| 332 | #define LANG_J8 "Can not get remote connection settings" | |
| 333 | #define LANG_J8b "Select a connection provider" | |
| 334 | #define LANG_J9 "Start" | |
| 335 | #define LANG_J10 "Please adjust connection parameters if necessary,\nthen press FINISH to launch the mirroring operation." | |
| 336 | #define LANG_J10b "Save settings only, do not launch download now." | |
| 337 | #define LANG_J11 "On hold" | |
| 338 | #define LANG_J12 "Transfer scheduled for: (hh/mm/ss)" | |
| 339 | #define LANG_J13 "Start" | |
| 340 | #define LANG_J14 "Connect to provider (RAS)" | |
| 341 | #define LANG_J15 "Connect to this provider" | |
| 342 | #define LANG_J16 "Disconnect when finished" | |
| 343 | #define LANG_J17 "Disconnect modem on completion" | |
| 344 | #define LANG_K1 "\n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr)" | |
| 345 | #define LANG_K2 "About HTTraQt Website Copier" | |
| 346 | #define LANG_K3 "Please visit our Web page" | |
| 347 | #define LANG_L1 "Wizard query" | |
| 348 | #define LANG_L2 "Your answer:" | |
| 349 | #define LANG_M1 "Link detected.." | |
| 350 | #define LANG_M2 "Choose a rule" | |
| 351 | #define LANG_M3 "Ignore this link" | |
| 352 | #define LANG_M4 "Ignore directory" | |
| 353 | #define LANG_M5 "Ignore domain" | |
| 354 | #define LANG_M6 "Catch this page only" | |
| 355 | #define LANG_M7 "Mirror site" | |
| 356 | #define LANG_M8 "Mirror domain" | |
| 357 | #define LANG_M9 "Ignore all" | |
| 358 | #define LANG_N1 "Wizard query" | |
| 359 | #define LANG_N2 "NO" | |
| 360 | #define LANG_O1 "File" | |
| 361 | #define LANG_O2 "Options" | |
| 362 | #define LANG_O3 "Log" | |
| 363 | #define LANG_O4 "Window" | |
| 364 | #define LANG_O5 "Help" | |
| 365 | #define LANG_O10 "Pause transfer" | |
| 366 | #define LANG_O11 "Exit" | |
| 367 | #define LANG_O12 "Modify options" | |
| 368 | #define LANG_O13 "View log" | |
| 369 | #define LANG_O14 "View error log" | |
| 370 | #define LANG_O14b "View file transfers" | |
| 371 | #define LANG_O15 "Hide" | |
| 372 | #define LANG_O16 "About HTTraQt Website Copier" | |
| 373 | #define LANG_O17 "Check program updates..." | |
| 374 | #define LANG_O18 "&Toolbar" | |
| 375 | #define LANG_O19 "&Status Bar" | |
| 376 | #define LANG_O20 "S&plit" | |
| 377 | #define LANG_P1 "File" | |
| 378 | #define LANG_P2 "Preferences" | |
| 379 | #define LANG_P3 "Mirror" | |
| 380 | #define LANG_P4 "Log" | |
| 381 | #define LANG_P5 "Window" | |
| 382 | #define LANG_P6 "Help" | |
| 383 | #define LANG_P10 "Exit" | |
| 384 | #define LANG_P11 "Load default options" | |
| 385 | #define LANG_P12 "Save default options" | |
| 386 | #define LANG_P12b "Reset to default options" | |
| 387 | #define LANG_P13 "Load options..." | |
| 388 | #define LANG_P14 "Save options as..." | |
| 389 | #define LANG_P15 "Language preference..." | |
| 390 | #define LANG_P16 "Contents..." | |
| 391 | #define LANG_P17 "About HTTraQt..." | |
| 392 | #define LANG_P18 "New project\tCtrl+N" | |
| 393 | #define LANG_P19 "&Open...\tCtrl+O" | |
| 394 | #define LANG_P20 "&Save\tCtrl+S" | |
| 395 | #define LANG_P21 "Save &As..." | |
| 396 | #define LANG_P22 "&Delete..." | |
| 397 | #define LANG_P23 "&Browse sites..." | |
| 398 | #define LANG_Q1 "User-defined structure" | |
| 399 | #define LANG_Q2 "%n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN)" | |
| 400 | #define LANG_Q3 "Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif" | |
| 401 | #define LANG_R1 "Proxy settings" | |
| 402 | #define LANG_R4 "Authentication (only if needed)" | |
| 403 | #define LANG_R10 "Enter proxy address here" | |
| 404 | #define LANG_R11 "Enter proxy port here" | |
| 405 | #define LANG_R12 "Enter proxy login" | |
| 406 | #define LANG_R13 "Enter proxy password" | |
| 407 | #define LANG_S1 "Enter project name here" | |
| 408 | #define LANG_S2 "Enter saving path here" | |
| 409 | #define LANG_S3 "Select existing project to update" | |
| 410 | #define LANG_S4 "Click here to select path" | |
| 411 | #define LANG_S5 "Select or create a new category name, to sort your mirrors in categories" | |
| 412 | #define LANG_S10 "HTTrack Project Wizard..." | |
| 413 | #define LANG_S11 "New project name:" | |
| 414 | #define LANG_S11b "Existing project name:" | |
| 415 | #define LANG_S11c "Project name:" | |
| 416 | #define LANG_S12 "Base path:" | |
| 417 | #define LANG_S13 "Project category:" | |
| 418 | #define LANG_S20 "C:\\My Web Sites" | |
| 419 | #define LANG_S30 "Type a new project name, \nor select existing project to update/resume" | |
| 420 | #define LANG_S31 "New project" | |
| 421 | #define LANG_T1 "Insert URL" | |
| 422 | #define LANG_T2 "URL:" | |
| 423 | #define LANG_T4 "Authentication (only if needed)" | |
| 424 | #define LANG_T7 "Forms or complex links:" | |
| 425 | #define LANG_T8 "Capture URL..." | |
| 426 | #define LANG_T10 "Enter URL address(es) here" | |
| 427 | #define LANG_T12 "Enter site login" | |
| 428 | #define LANG_T13 "Enter site password" | |
| 429 | #define LANG_T14 "Use this capture tool for links that can only be accessed through forms or javascript code" | |
| 430 | #define LANG_U1 "Choose language according to preference" | |
| 431 | #define LANG_V1 "Catch URL!" | |
| 432 | #define LANG_V2 "Please set temporary browser proxy settings to the following values (Copy/Paste Proxy Address and Port).\nThen click on the Form SUBMIT button in your browser page, or click on the specific link you want to capture." | |
| 433 | #define LANG_V3 "This will send the desired link from your browser to HTTraQt." | |
| 434 | #define LANG_V4 "ABORT" | |
| 435 | #define LANG_V10 "Copy/Paste the temporary proxy parameters here" | |
| 436 | #define LANG_V11 "Cancel" | |
| 437 | #define LANG_DIAL1 "Unable to find Help files!" | |
| 438 | #define LANG_DIAL2 "Unable to save parameters!" | |
| 439 | #define LANG_DIAL3 "Please drag only one folder at a time" | |
| 440 | #define LANG_DIAL4 "Please drag only folders, not files" | |
| 441 | #define LANG_DIAL5 "Please drag folders only" | |
| 442 | #define LANG_DIAL6 "Select user-defined structure?" | |
| 443 | #define LANG_DIAL7 "Please ensure that the user-defined-string is correct,\notherwise filenames will be bogus!" | |
| 444 | #define LANG_DIAL8 "Do you really want to use a user-defined structure?" | |
| 445 | #define LANG_DIAL9 "Too manu URLs, cannot handle so many links!!" | |
| 446 | #define LANG_DIAL10 "Not enough memory, fatal internal error.." | |
| 447 | #define LANG_DIAL11 "Unknown operation!" | |
| 448 | #define LANG_DIAL12 "Add this URL?\n" | |
| 449 | #define LANG_DIAL13 "Warning: main process is still not responding, cannot add URL(s).." | |
| 450 | #define LANG_W4 "Select or modify your file type(s) here" | |
| 451 | #define LANG_W5 "Select or modify your MIME type(s) here" | |
| 452 | #define LANG_W6 "Go up" | |
| 453 | #define LANG_W7 "Go down" | |
| 454 | #define LANG_X1 "File download information" | |
| 455 | #define LANG_X2 "Freeze Window" | |
| 456 | #define LANG_X3 "More information:" | |
| 457 | #define LANG_Y1 "Welcome to HTTraQt Website Copier!\n\nPlease click on the NEXT button to\n\n- start a new project\n- or resume a partial download" | |
| 458 | ||
| 459 | #define LANG_OSFWB "Open Source offline browser" | |
| 460 | #define LANG_METADESC "Website Copier/Offline Browser. Copy remote websites to your computer. Free." | |
| 461 | #define LANG_METAKEYW "httrack, winhttrack, webhttrack, offline browser" | |
| 462 | #define _URLLIST "URL list (.txt)" | |
| 463 | #define LANG_PREVIOUS "Previous" | |
| 464 | #define LANG_NEXT "Next" | |
| 465 | #define LANG_URLS "URLs" | |
| 466 | #define LANG_WARNING "Warning" | |
| 467 | #define LANG_NOJS "Your browser does not currently support javascript. For better results, please use a javascript-aware browser." | |
| 468 | #define LANG_THANKYOU "Thank you" | |
| 469 | #define LANG_CANCLSWND "You can now close this window" | |
| 470 | #define LANG_SERVEND "Server terminated" | |
| 471 | #define LANG_FATALERR "A fatal error has occured during this mirror" | |
| 472 | ||
| 473 | ||
| 474 | #endif ⏎ | |
| 0 | #ifndef LANGUAGE_HEADER | |
| 1 | #define LANGUAGE_HEADER | |
| 2 | ||
| 3 | ||
| 4 | #define _NR_CONN "N# connections" | |
| 5 | #define _TIMEOUTS "TimeOut(s)" | |
| 6 | #define _RETRIES "Retries" | |
| 7 | #define _MAX_RATE "Maximum transfer rate" | |
| 8 | #define _MIN_RATE "Minimum transfer rate" | |
| 9 | #define _KEEP_ALIVE "Persistent connections (Keep-Alive)" | |
| 10 | #define _CANCEL_TIMEOUT "Cancel all links from host if timeout occurs" | |
| 11 | #define _CANCEL_SLOW "Cancel all links from host if too slow" | |
| 12 | #define _CHECK_DOC_TYPE "Check document type" | |
| 13 | #define _SPIDER "Spider" | |
| 14 | #define _ACCEPT_COOK "Accept cookies" | |
| 15 | #define _PARSE_JAVA "Parse java files" | |
| 16 | #define _UPDATE_HACK "Update hack (limit re-transfers)" | |
| 17 | #define _URL_HACK "URL hacks (join similar URLs)" | |
| 18 | #define _TOL_REQ "Tolerant requests (for servers)" | |
| 19 | #define _FORCE_OLD "Force old HTTP/1.0 requests (no 1.1)" | |
| 20 | #define _BROWS_ID "Browser identity" | |
| 21 | #define _OS_ID "Operation system Identity" | |
| 22 | #define _HTML_FOOT "HTML footer" | |
| 23 | #define _STRUCT_TYPE "Structure type (how links are saved)" | |
| 24 | #define _DOS_NAMES "DOS names (8+3)" | |
| 25 | #define _NO_ERR_PAG "No error pages" | |
| 26 | #define _NO_EXTERAL "No external pages" | |
| 27 | #define _HIDE_PASS "Hide passwords" | |
| 28 | #define _HIDE_QUERY "Hide query strings" | |
| 29 | #define _NOT_PURGE "Do not purge old files" | |
| 30 | #define _ISO9660_NAMES "ISO9660 names (CDROM)" | |
| 31 | #define _BUILD "Build" | |
| 32 | #define _ONLY_EXPERTS "These options should be modified only exceptionally" | |
| 33 | #define _PRIM_SCAN "Primary Scan Rule" | |
| 34 | #define _TRAVEL_MODE "Travel mode" | |
| 35 | #define _GLOBAL_TRAVEL "Global travel mode" | |
| 36 | #define _REWRITE_LINKS "Rewrite links: internal / external" | |
| 37 | #define _USE_CACHE "Use a cache for updates and retries" | |
| 38 | #define _DEBUG_MODE "Activate Debugging Mode (httraq.log)" | |
| 39 | #define _MAX_FROM_ROOT "Maximum mirroring depth from root address" | |
| 40 | #define _MAX_EXTERNAL "Maximum mirroring depth for external/forbidden addresses (0, that is, none, is the default)" | |
| 41 | #define _MAX_SIZE_HTML "Max size of any HTML file (B)" | |
| 42 | #define _MAX_SIZE_NHTML "Max size of any non-HTML file" | |
| 43 | #define _SIZE_LIMIT "Size limit" | |
| 44 | #define _PAUSE_DOWN "Pause after downloading.." | |
| 45 | #define _MAX_TIME "Max time" | |
| 46 | #define _MAX_CONN_SEC "Max connections / seconds" | |
| 47 | #define _MAX_LINKS "Maximum number of links" | |
| 48 | #define _ALL_LINKS_MATCH "All links will match" | |
| 49 | #define _GET_NHTML "Get non-HTML files related to a link, eg external .ZIP or pictures" | |
| 50 | #define _TEST_LINKS "Test all links (even forbidden ones)" | |
| 51 | #define _GET_HTML_FIRST "Get HTML files first!" | |
| 52 | #define _MIME_ASSOC "Type/MIME associations" | |
| 53 | #define _FILE_TYPES "File types:" | |
| 54 | #define _MIME_ID "MIME identity:" | |
| 55 | #define _PROX_ADDR "Proxy address:" | |
| 56 | #define _PROX_PORT "Proxy port:" | |
| 57 | #define _LOGIN "Login" | |
| 58 | #define _PASS "Password" | |
| 59 | #define _USE_PROXY "Use proxy for ftp transfers" | |
| 60 | #define _USE_WILDCARDS "Use wildcards to exclude or include URLs or links.\nYou can put several scan strings on the same line.\nUse spaces as separators.\n\nExample: +*.zip -www.*.com -www.*.edu/cgi-bin/*.cgi" | |
| 61 | #define _CRITERION "Criterion" | |
| 62 | #define _STRING "String" | |
| 63 | #define _TIP_GIF "Tip: To have ALL GIF files included, use something like +www.someweb.com/*.gif. \n(+*.gif / -*.gif will include/exclude ALL GIFs from ALL sites)" | |
| 64 | #define _CARD_FILTER "WildCardFilters" | |
| 65 | #define _ADD_SCAN_RULE "Add Scan Rule" | |
| 66 | #define _EXCL_LINKS "Exclude links" | |
| 67 | #define _INCL_LINKS "Include link(s)" | |
| 68 | #define _STORE_CACHE "Store ALL files in cache" | |
| 69 | #define _NO_REDOWNLOAD "Do not re-download locally erased files" | |
| 70 | #define _CREATE_LOG "Create Log files" | |
| 71 | #define _MAKE_INDEX "Make an index" | |
| 72 | #define _MAKE_WORD_INDEX "Make a word database" | |
| 73 | ||
| 74 | #define LISTDEF_1 "File names with extension:\nFile names containing:\nThis file name:\nFolder names containing:\nThis folder name:\nLinks on this domain:\nLinks on domains containing:\nLinks from this host:\nLinks containing:\nThis link:\nALL LINKS" | |
| 75 | #define LISTDEF_2 "Show all\nHide debug\nHide infos\nHide debug and infos" | |
| 76 | #define LISTDEF_3 "Site-structure (default)\nHtml in web/, images/other files in web/images/\nHtml in web/html, images/other in web/images\nHtml in web/, images/other in web/\nHtml in web/, images/other in web/xxx, where xxx is the file extension\nHtml in web/html, images/other in web/xxx\nSite-structure, without www.domain.xxx/\nHtml in site_name/, images/other files in site_name/images/\nHtml in site_name/html, images/other in site_name/images\nHtml in site_name/, images/other in site_name/\nHtml in site_name/, images/other in site_name/xxx\nHtml in site_name/html, images/other in site_name/xxx\nAll files in web/, with random names (gadget !)\nAll files in site_name/, with random names (gadget !)\nUser-defined structure.." | |
| 77 | #define LISTDEF_4 "Just scan\nStore html files\nStore non html files\nStore all files (default)\nStore html files first" | |
| 78 | #define LISTDEF_5 "Stay in the same directory\nCan go down (default)\nCan go up\nCan both go up & down" | |
| 79 | #define LISTDEF_6 "Stay on the same address (default)\nStay on the same domain\nStay on the same top level domain\nGo everywhere on the web" | |
| 80 | #define LISTDEF_7 "Never\nIf unknown (except /)\nIf unknown" | |
| 81 | #define LISTDEF_8 "no robots.txt rules\nrobots.txt except wizard\nfollow robots.txt rules" | |
| 82 | #define LISTDEF_9 "normal\nextended\ndebug" | |
| 83 | #define LISTDEF_10 "Download web site(s)\nDownload web site(s) + questions\nGet individual files\nDownload all sites in pages (multiple mirror)\nTest links in pages (bookmark test)\n* Continue interrupted download\n* Update existing download" | |
| 84 | #define LISTDEF_11 "Relative URI / Absolute URL (default)\nAbsolute URL / Absolute URL\nAbsolute URI / Absolute URL\nOriginal URL / Original URL" | |
| 85 | ||
| 86 | #define _MOD00 "- Mirroring Mode -\n\nEnter address(es) in URL box" | |
| 87 | #define _MOD01 "- Interactive Wizard Mode (questions) -\n\nEnter address(es) in URL box" | |
| 88 | #define _MOD02 "- File Download Mode -\n\nEnter file address(es) in URL box" | |
| 89 | #define _MOD03 "- Links List Mode -\n\nUse URL box to enter address(es) of page(s) containing links to mirror" | |
| 90 | #define _MOD04 "- Link Testing Mode -\n\nEnter Web address(es) with links to test in URL box" | |
| 91 | #define _MOD05 "- Update Mode -\n\nVerify address(es) in URL box, check parameters if necessary then click on 'NEXT' button" | |
| 92 | #define _MOD06 "- Resume Mode (Interrupted Operation) -\n\nVerify address(es) in URL box, check parameters if necessary then click on 'NEXT' button" | |
| 93 | ||
| 94 | ||
| 95 | #define L_OK "OK" | |
| 96 | #define L_CANCEL "Cancel" | |
| 97 | #define L_QUIT "Exit" | |
| 98 | #define L_CLOSE "Close" | |
| 99 | #define L_TIPCANCEL "Cancel changes" | |
| 100 | #define L_TIPOK "Click to confirm" | |
| 101 | #define L_TIPHELP "Click to get help!" | |
| 102 | #define L_TIPPREV "Click to return to previous screen" | |
| 103 | #define L_TIPNEXT "Click to go to next screen" | |
| 104 | #define L_HIDEPWD "Hide password" | |
| 105 | #define L_SAVEPROJECT "Save project" | |
| 106 | #define L_CLOSEPRJ "Close current project?" | |
| 107 | #define L_DELETECONF "Delete this project?" | |
| 108 | #define L_DELETEEMPTYCONF "Delete empty project %s?" | |
| 109 | #define L_ACTIONNYP "Action not yet implemented" | |
| 110 | #define L_ERRORDEL "Error deleting this project" | |
| 111 | #define L_B1 "Select a rule for the filter" | |
| 112 | #define L_B2 "Enter keywords for the filter" | |
| 113 | #define L_B3 "Cancel" | |
| 114 | #define L_B4 "Add this rule" | |
| 115 | #define L_A2 "Please enter one or several keyword(s) for the rule" | |
| 116 | #define L_B8 "Add" | |
| 117 | #define L_B9 "Scan Rules" | |
| 118 | #define L_B14 "Save prefs" | |
| 119 | #define L_B20 "Matching links will be excluded:" | |
| 120 | #define L_B21 "Matching links will be included:" | |
| 121 | #define L_B22 "Example:" | |
| 122 | #define L_B23 "gif\nWill match all GIF files" | |
| 123 | #define L_B24 "blue\nWill find all files with a matching 'blue' sub-string such as 'bluesky-small.jpeg'" | |
| 124 | #define L_B25 "bigfile.mov\nWill match the file 'bigfile.mov', but not 'bigfile2.mov'" | |
| 125 | #define L_B26 "cgi\nWill find links with folder name matching sub-string 'cgi' such as /cgi-bin/somecgi.cgi" | |
| 126 | #define L_B27 "cgi-bin\nWill find links with folder name matching whole 'cgi-bin' string (but not cgi-bin-2, for example)" | |
| 127 | #define L_B28 "someweb.com\nWill find links with matching sub-string such as www.someweb.com, private.someweb.com etc." | |
| 128 | #define L_B29 "someweb\nWill find links with matching folder sub-string such as www.someweb.com, www.someweb.edu, private.someweb.otherweb.com etc." | |
| 129 | #define L_B30 "www.someweb.com\nWill find links matching whole 'www.someweb.com' sub-string (but not links such as private.someweb.com/..)" | |
| 130 | #define L_B31 "someweb\nWill find any links with matching sub-string such as www.someweb.com/.., www.test.abc/fromsomeweb/index.html, www.test.abc/test/someweb.html etc." | |
| 131 | #define L_B32 "www.test.com/test/someweb.html\nWill only find the 'www.test.com/test/someweb.html' file. Note that you have to type the complete path (URL + site path)" | |
| 132 | #define L_C1 "Add exclusion filter" | |
| 133 | #define L_C2 "Add inclusion filter" | |
| 134 | #define L_C3 "Existing filters" | |
| 135 | #define L_C4 "Cancel changes" | |
| 136 | #define L_C5 "Save current preferences as default values" | |
| 137 | #define L_C6 "Click to confirm" | |
| 138 | #define L_D1 "No log files in %s!" | |
| 139 | #define L_D2 "No 'index.html' file in %s!" | |
| 140 | #define L_D3 "Click to quit HTTraQt Website Copier" | |
| 141 | #define L_D4 "View log files" | |
| 142 | #define L_D5 "Browse HTML start page" | |
| 143 | #define L_D6 "End of mirror" | |
| 144 | #define L_D7 "View log files" | |
| 145 | #define L_D8 "Browse Mirrored Website" | |
| 146 | #define L_D9 "New project..." | |
| 147 | #define L_E1 "View error and warning reports" | |
| 148 | #define L_E2 "View report" | |
| 149 | #define L_E3 "Close the log file window" | |
| 150 | #define L_E4 "Info type:" | |
| 151 | #define L_E5 "Errors" | |
| 152 | #define L_E6 "Infos" | |
| 153 | #define L_E7 "Find" | |
| 154 | #define L_E8 "Find a word" | |
| 155 | #define L_E10 "Info log file" | |
| 156 | #define L_E11 "Warning/Errors log file" | |
| 157 | #define L_F1 "Unable to initialize the OLE system" | |
| 158 | #define L_F2 "HTTraQt could not find any interrupted download file cache in the specified folder!" | |
| 159 | #define L_F3 "Could not connect to provider" | |
| 160 | #define L_F4 "receive" | |
| 161 | #define L_F5 "request" | |
| 162 | #define L_F6 "connect" | |
| 163 | #define L_F7 "search" | |
| 164 | #define L_F8 "ready" | |
| 165 | #define L_F9 "error" | |
| 166 | #define L_F10 "Receiving files.." | |
| 167 | #define L_F11 "Parsing HTML file.." | |
| 168 | #define L_F11b "Purging files.." | |
| 169 | #define L_F11c "Loading cache in progress.." | |
| 170 | #define L_F12 "Parsing HTML file (testing links).." | |
| 171 | #define L_F13 "Pause - Toggle [Mirror]/[Pause download] to resume operation" | |
| 172 | #define L_F13b "Finishing pending transfers - Select [Cancel] to stop now!" | |
| 173 | #define L_F14 "scanning" | |
| 174 | #define L_F15 "Waiting for scheduled time.." | |
| 175 | #define L_F15b "Transferring data.." | |
| 176 | #define L_F16 "Connecting to provider" | |
| 177 | #define L_F17 "[%d seconds] to go before start of operation" | |
| 178 | #define L_F18 "Site mirroring in progress [%s, %s bytes]" | |
| 179 | #define L_F18b "Site mirroring finished!" | |
| 180 | #define L_F19 "A problem occured during the mirroring operation\n" | |
| 181 | #define L_F20 "\nDuring:\n" | |
| 182 | #define L_F21 "\nSee the log file if necessary.\n\nClick FINISH to quit HTTraQt Website Copier.\n\nThanks for using HTTraQt!" | |
| 183 | #define L_F22 "Mirroring operation complete.\nClick Exit to quit HTTraQt.\nSee log file(s) if necessary to ensure that everything is OK.\n\nThanks for using HTTraQt!" | |
| 184 | #define _MIRROR_ABORTED "* * MIRROR ABORTED! * *\nThe current temporary cache is required for any update operation and only contains data downloaded during the present aborted session.\nThe former cache might contain more complete information; if you do not want to lose that information, you have to restore it and delete the current cache.\n[Note: This can easily be done here by erasing the hts-cache/new.* files]\n\nDo you think the former cache might contain more complete information, and do you want to restore it?" | |
| 185 | #define _MIRROR_ERR "* * MIRROR ERROR! * *\nHTTrack has detected that the current mirror is empty. If it was an update, the previous mirror has been restored.\nReason: the first page(s) either could not be found, or a connection problem occured.\n=> Ensure that the website still exists, and/or check your proxy settings! <=" | |
| 186 | #define L_F23 "\n\nTip: Click [View log file] to see warning or error messages" | |
| 187 | #define L_F24 "Error deleting a hts-cache/new.* file, please do it manually" | |
| 188 | #define L_G1 "Do you really want to quit HTTraQt Website Copier?" | |
| 189 | #define L_G7 "Log files Path" | |
| 190 | #define L_G8 "Path" | |
| 191 | #define L_G1C "New project / Import?" | |
| 192 | #define L_G9 "Choose criterion" | |
| 193 | #define L_G10 "Maximum link scanning depth" | |
| 194 | #define L_G11 "Enter address(es) here" | |
| 195 | #define L_G13 "Define additional filtering rules" | |
| 196 | #define L_G14 "Proxy Name (if needed)" | |
| 197 | #define L_G15 "Proxy Port" | |
| 198 | #define L_G15b "Define proxy settings" | |
| 199 | #define L_G15c "Use standard HTTP proxy as FTP proxy" | |
| 200 | #define L_G16 "Path" | |
| 201 | #define L_G17 "Select Path" | |
| 202 | #define L_G18 "Path" | |
| 203 | #define L_G19 "Select Path" | |
| 204 | #define L_G20 "Quit HTTraQt Website Copier" | |
| 205 | #define L_G21 "About HTTraQt" | |
| 206 | #define L_G22 "Save current preferences as default values" | |
| 207 | #define L_G23 "Click to continue" | |
| 208 | #define L_G24 "Click to define options" | |
| 209 | #define L_G24b "Click to add a URL" | |
| 210 | #define L_G24c "Load URL(s) from text file" | |
| 211 | #define L_G25 "HTTraQt preferences (*.opt)|*.opt||" | |
| 212 | #define L_G25b "Address List text file (*.txt)|*.txt||" | |
| 213 | #define L_G26 "File not found!" | |
| 214 | #define L_G26b "Do you really want to change the project name/path?" | |
| 215 | #define L_G27 "Load user-default options?" | |
| 216 | #define L_G28 "Save user-default options?" | |
| 217 | #define L_G29 "Reset all default options?" | |
| 218 | #define L_G30 "Welcome to HTTraQt!" | |
| 219 | #define _ACTION "Action:" | |
| 220 | #define L_G32 "Max Depth" | |
| 221 | #define L_G32b "Maximum external depth:" | |
| 222 | #define L_G33 "Filters (refuse/accept links) :" | |
| 223 | #define L_G34 "Paths" | |
| 224 | #define L_G37 "Save prefs" | |
| 225 | #define L_G39 "Define.." | |
| 226 | #define _SET_OPT "Set options.." | |
| 227 | #define _PREFS_OPT "Preferences and mirror options:" | |
| 228 | #define L_G42 "Project name" | |
| 229 | #define _ADD_URL "Add a URL..." | |
| 230 | #define _WEB_ADDR "Web Addresses: (URL)" | |
| 231 | #define L_H1 "Stop HTTraQt?" | |
| 232 | #define L_H2 "No log files in %s!" | |
| 233 | #define L_H3 "Pause Download?" | |
| 234 | #define L_H4 "Stop the mirroring operation" | |
| 235 | #define L_H5 "Minimize to System Tray" | |
| 236 | #define L_H6 "Click to skip a link or stop parsing" | |
| 237 | #define L_H7 "Click to skip a link" | |
| 238 | #define L_H8 "Bytes saved" | |
| 239 | #define L_H9 "Links scanned" | |
| 240 | #define L_H10 "Time:" | |
| 241 | #define L_H11 "Connections:" | |
| 242 | #define L_H12 "Running:" | |
| 243 | #define L_H13 "Hide" | |
| 244 | #define L_H14 "Transfer rate" | |
| 245 | #define L_H15 "SKIP" | |
| 246 | #define L_H16 "Information" | |
| 247 | #define L_H17 "Files written:" | |
| 248 | #define L_H18 "Files updated:" | |
| 249 | #define L_H19 "Errors:" | |
| 250 | #define L_H20 "In progress:" | |
| 251 | #define L_I1 "Follow external links" | |
| 252 | #define L_I2 "Test all links in pages" | |
| 253 | #define L_I2b "Try to ferret out all links" | |
| 254 | #define L_I2c "Download HTML files first (faster)" | |
| 255 | #define L_I3 "Choose local site structure" | |
| 256 | #define L_I4 "Set user-defined structure on disk" | |
| 257 | #define L_I5b "Do not update zero size or user-erased files" | |
| 258 | #define L_I6 "Create a Start Page" | |
| 259 | #define L_I6b "Create a word database of all html pages" | |
| 260 | #define L_I7 "Create error logging and report files" | |
| 261 | #define L_I8 "Generate DOS 8-3 filenames ONLY" | |
| 262 | #define L_I8b "Generate ISO9660 filenames ONLY for CDROM medias" | |
| 263 | #define L_I9 "Do not create HTML error pages" | |
| 264 | #define L_I10 "Select file types to be saved to disk" | |
| 265 | #define L_I11 "Select parsing direction" | |
| 266 | #define L_I11b "Select global parsing direction" | |
| 267 | #define L_I11c "Setup URL rewriting rules for internal links (downloaded ones) and external links (not downloaded ones)" | |
| 268 | #define L_I12 "Max simultaneous connections" | |
| 269 | #define L_I13 "File timeout" | |
| 270 | #define L_I15 "Minimum admissible transfer rate" | |
| 271 | #define L_I17 "Maximum number of retries on non-fatal errors" | |
| 272 | #define L_I18 "Maximum size for any single HTML file" | |
| 273 | #define L_I19 "Maximum size for any single non-HTML file" | |
| 274 | #define L_I20 "Maximum amount of bytes to retrieve from the Web" | |
| 275 | #define L_I20b "Make a pause after downloading this amount of bytes" | |
| 276 | #define L_I21 "Maximum duration time for the mirroring operation" | |
| 277 | #define L_I22b "Maximum connections/seconds (avoid server overload)" | |
| 278 | #define L_I22c "Maximum number of links that can be tested (not saved!)" | |
| 279 | #define L_I23b "Comment to be placed in each HTML file" | |
| 280 | #define L_I24 "Back to starting page" | |
| 281 | #define L_I25 "Save current preferences as default values" | |
| 282 | #define L_I26 "Click to continue" | |
| 283 | #define L_I27 "Click to cancel changes" | |
| 284 | #define L_I28 "Follow local robots rules on sites" | |
| 285 | #define L_I29 "Links to non-localised external pages will produce error pages" | |
| 286 | #define L_I1a "Do not erase obsolete files after update" | |
| 287 | #define L_I1b "Accept cookies?" | |
| 288 | #define L_I1c "Check document type when unknown?" | |
| 289 | #define L_I1d "Parse java applets to retrieve included files that must be downloaded?" | |
| 290 | #define L_I1e "Store all files in cache instead of HTML only" | |
| 291 | #define L_I1f "Log file type (if generated)" | |
| 292 | #define L_I1h "Create a debugging file" | |
| 293 | #define L_I1i "Use non-standard requests to get round some server bugs" | |
| 294 | #define L_I1j "Use old HTTP/1.0 requests (limits engine power!)" | |
| 295 | #define L_I1k "Attempt to limit retransfers through several tricks (file size test..)" | |
| 296 | #define L_I1k2 "Attempt to limit the number of links by skipping similar URLs (www.foo.com==foo.com, http=https ..)" | |
| 297 | #define L_I30 "Write external links without login/password" | |
| 298 | #define L_I30b "Write internal links without query string" | |
| 299 | #define L_I32b "Try to catch all URLs (even in unknown tags/code)" | |
| 300 | #define L_I34 "Use a cache for updates" | |
| 301 | #define L_I36 "Log files" | |
| 302 | #define L_I39 "Primary Scan Rule" | |
| 303 | #define L_I41 "Flow control" | |
| 304 | #define L_I42 "Limits" | |
| 305 | #define L_I43 "Identity" | |
| 306 | #define L_I45 "Abandon host if error" | |
| 307 | #define L_I47 "Abandon host if too slow" | |
| 308 | #define L_I47b "Configure" | |
| 309 | #define L_I47f "Reduce connection time and type lookup time using persistent connections" | |
| 310 | #define L_I51 "Max site size" | |
| 311 | #define _SAVE_PREFS "Save prefs" | |
| 312 | #define L_I54 "Max transfer rate" | |
| 313 | #define L_I55 "Follow robots.txt" | |
| 314 | ||
| 315 | #define L_IOPT1 "Links" | |
| 316 | #define L_IOPT3 "Experts Only" | |
| 317 | #define L_IOPT4 "Flow Control" | |
| 318 | #define L_IOPT5 "Limits" | |
| 319 | #define L_IOPT6 "Browser ID" | |
| 320 | #define L_IOPT7 "Scan Rules" | |
| 321 | #define L_IOPT9 "Log, Index, Cache" | |
| 322 | #define L_IOPT10 "Proxy" | |
| 323 | #define L_IOPT11 "MIME Types" | |
| 324 | #define L_J1 "Do you really want to quit HTTraQt Website Copier?" | |
| 325 | #define L_J2 "Do not connect to a provider (already connected)" | |
| 326 | #define L_J2b "Do not use remote access connection" | |
| 327 | #define L_J3 "Schedule the mirroring operation" | |
| 328 | #define L_J4 "Quit HTTraQt Website Copier" | |
| 329 | #define L_J5 "Back to starting page" | |
| 330 | #define L_J6 "Click to start!" | |
| 331 | #define L_J7 "No saved password for this connection!" | |
| 332 | #define L_J8 "Can not get remote connection settings" | |
| 333 | #define L_J8b "Select a connection provider" | |
| 334 | #define L_J9 "Start" | |
| 335 | #define _ADJ "Please adjust connection parameters if necessary,\nthen press FINISH to launch the mirroring operation." | |
| 336 | #define _SAV_SETTINGS "Save settings only, do not launch download now." | |
| 337 | #define _ON_HOLD "On hold" | |
| 338 | #define _SHUTD "Shutdown PC when finished" | |
| 339 | #define _TR_SHED "Transfer scheduled for: (hh/mm/ss)" | |
| 340 | #define L_J13 "Start" | |
| 341 | #define L_J14 "Connect to provider (RAS)" | |
| 342 | #define L_J15 "Connect to this provider" | |
| 343 | #define L_J16 "Disconnect when finished" | |
| 344 | #define L_J17 "Disconnect modem on completion" | |
| 345 | #define L_K1 "\n(Please notify us of any bug or problem)\n\nDevelopment:\nInterface (Windows): Xavier Roche\nSpider: Xavier Roche\nJavaParserClasses: Yann Philippot\n\n(C)1998-2003 Xavier Roche and other contributors\nMANY THANKS for translation tips to:\nRobert Lagadec (rlagadec@yahoo.fr)" | |
| 346 | #define L_K2 "About HTTraQt Website Copier" | |
| 347 | #define L_K3 "Please visit our Web page" | |
| 348 | #define L_L1 "Wizard query" | |
| 349 | #define L_L2 "Your answer:" | |
| 350 | #define L_M1 "Link detected.." | |
| 351 | #define L_M2 "Choose a rule" | |
| 352 | #define L_M3 "Ignore this link" | |
| 353 | #define L_M4 "Ignore directory" | |
| 354 | #define L_M5 "Ignore domain" | |
| 355 | #define L_M6 "Catch this page only" | |
| 356 | #define L_M7 "Mirror site" | |
| 357 | #define L_M8 "Mirror domain" | |
| 358 | #define L_M9 "Ignore all" | |
| 359 | #define L_N1 "Wizard query" | |
| 360 | #define L_N2 "NO" | |
| 361 | #define L_O1 "File" | |
| 362 | #define L_O2 "Options" | |
| 363 | #define L_O3 "Log" | |
| 364 | #define L_O4 "Window" | |
| 365 | #define L_O5 "Help" | |
| 366 | #define L_O10 "Pause transfer" | |
| 367 | #define L_O11 "Exit" | |
| 368 | #define L_O12 "Modify options" | |
| 369 | #define L_O13 "View log" | |
| 370 | #define L_O14 "View error log" | |
| 371 | #define L_O14b "View file transfers" | |
| 372 | #define L_O15 "Hide" | |
| 373 | #define L_O16 "About HTTraQt Website Copier" | |
| 374 | #define L_O17 "Check program updates..." | |
| 375 | #define L_O18 "&Toolbar" | |
| 376 | #define L_O19 "&Status Bar" | |
| 377 | #define L_O20 "S&plit" | |
| 378 | #define L_P1 "File" | |
| 379 | #define L_P2 "Preferences" | |
| 380 | #define L_P3 "Mirror" | |
| 381 | #define L_P4 "Log" | |
| 382 | #define L_P5 "Window" | |
| 383 | #define L_P6 "Help" | |
| 384 | #define L_P10 "Exit" | |
| 385 | #define L_P11 "Load default options" | |
| 386 | #define L_P12 "Save default options" | |
| 387 | #define L_P12b "Reset to default options" | |
| 388 | #define L_P13 "Load options..." | |
| 389 | #define L_P14 "Save options as..." | |
| 390 | #define L_P15 "Language preference..." | |
| 391 | #define L_P16 "Contents..." | |
| 392 | #define L_P17 "About HTTraQt..." | |
| 393 | #define L_P18 "New project\tCtrl+N" | |
| 394 | #define L_P19 "&Open...\tCtrl+O" | |
| 395 | #define L_P20 "&Save\tCtrl+S" | |
| 396 | #define L_P21 "Save &As..." | |
| 397 | #define L_P22 "&Delete..." | |
| 398 | #define L_P23 "&Browse sites..." | |
| 399 | #define L_Q1 "User-defined structure" | |
| 400 | #define L_Q2 "%n\tName of file without file type (ex: image)\n%N\tName of file including file type (ex: image.gif)\n%t\tFile type only (ex: gif)\n%p\tPath [without ending /] (ex: /someimages)\n%h\tHost name (ex: www.someweb.com)\n%M\tMD5 URL (128 bits, 32 ascii bytes)\n%Q\tMD5 query string (128 bits, 32 ascii bytes)\n%q\tMD5 small query string (16 bits, 4 ascii bytes)\n\n%s?\tShort name (ex: %sN)" | |
| 401 | #define L_Q3 "Example:\t%h%p/%n%q.%t\n->\t\tc:\\mirror\\www.someweb.com\\someimages\\image.gif" | |
| 402 | #define L_R1 "Proxy settings" | |
| 403 | #define L_R4 "Authentication (only if needed)" | |
| 404 | #define L_R10 "Enter proxy address here" | |
| 405 | #define L_R11 "Enter proxy port here" | |
| 406 | #define L_R12 "Enter proxy login" | |
| 407 | #define L_R13 "Enter proxy password" | |
| 408 | #define L_S1 "Enter project name here" | |
| 409 | #define L_S2 "Enter saving path here" | |
| 410 | #define L_S3 "Select existing project to update" | |
| 411 | #define L_S4 "Click here to select path" | |
| 412 | #define L_S5 "Select or create a new category name, to sort your mirrors in categories" | |
| 413 | #define L_S10 "HTTrack Project Wizard..." | |
| 414 | #define L_S11 "New project name:" | |
| 415 | #define L_S11b "Existing project name:" | |
| 416 | #define L_S11c "Project name:" | |
| 417 | #define L_S12 "Base path:" | |
| 418 | #define L_S13 "Project category:" | |
| 419 | #define L_S20 "C:\\My Web Sites" | |
| 420 | #define L_S30 "Type a new project name, \nor select existing project to update/resume" | |
| 421 | #define L_S31 "New project" | |
| 422 | #define L_T1 "Insert URL" | |
| 423 | #define L_T2 "URL:" | |
| 424 | #define L_T4 "Authentication (only if needed)" | |
| 425 | #define L_T7 "Forms or complex links:" | |
| 426 | #define L_T8 "Capture URL..." | |
| 427 | #define L_T10 "Enter URL address(es) here" | |
| 428 | #define L_T12 "Enter site login" | |
| 429 | #define L_T13 "Enter site password" | |
| 430 | #define L_T14 "Use this capture tool for links that can only be accessed through forms or javascript code" | |
| 431 | #define L_U1 "Choose language according to preference" | |
| 432 | #define L_V1 "Catch URL!" | |
| 433 | #define L_V2 "Please set temporary browser proxy settings to the following values (Copy/Paste Proxy Address and Port).\nThen click on the Form SUBMIT button in your browser page, or click on the specific link you want to capture." | |
| 434 | #define L_V3 "This will send the desired link from your browser to HTTraQt." | |
| 435 | #define L_V4 "ABORT" | |
| 436 | #define L_V10 "Copy/Paste the temporary proxy parameters here" | |
| 437 | #define L_V11 "Cancel" | |
| 438 | #define L_DIAL1 "Unable to find Help files!" | |
| 439 | #define L_DIAL2 "Unable to save parameters!" | |
| 440 | #define L_DIAL3 "Please drag only one folder at a time" | |
| 441 | #define L_DIAL4 "Please drag only folders, not files" | |
| 442 | #define L_DIAL5 "Please drag folders only" | |
| 443 | #define L_DIAL6 "Select user-defined structure?" | |
| 444 | #define L_DIAL7 "Please ensure that the user-defined-string is correct,\notherwise filenames will be bogus!" | |
| 445 | #define L_DIAL8 "Do you really want to use a user-defined structure?" | |
| 446 | #define L_DIAL9 "Too manu URLs, cannot handle so many links!!" | |
| 447 | #define L_DIAL10 "Not enough memory, fatal internal error.." | |
| 448 | #define L_DIAL11 "Unknown operation!" | |
| 449 | #define L_DIAL12 "Add this URL?\n" | |
| 450 | #define L_DIAL13 "Warning: main process is still not responding, cannot add URL(s).." | |
| 451 | #define L_W4 "Select or modify your file type(s) here" | |
| 452 | #define L_W5 "Select or modify your MIME type(s) here" | |
| 453 | #define L_W6 "Go up" | |
| 454 | #define L_W7 "Go down" | |
| 455 | #define L_X1 "File download information" | |
| 456 | #define L_X2 "Freeze Window" | |
| 457 | #define L_X3 "More information:" | |
| 458 | #define L_Y1 "Welcome to HTTraQt Website Copier!\n\nPlease click on the NEXT button to\n\n- start a new project\n- or resume a partial download" | |
| 459 | ||
| 460 | #define L_OSFWB "Open Source offline browser" | |
| 461 | #define L_METADESC "Website Copier/Offline Browser. Copy remote websites to your computer. Free." | |
| 462 | #define L_METAKEYW "httrack, winhttrack, webhttrack, offline browser" | |
| 463 | #define _URLLIST "URL list (.txt)" | |
| 464 | #define L_PREVIOUS "Previous" | |
| 465 | #define L_NEXT "Next" | |
| 466 | #define L_URLS "URLs" | |
| 467 | #define L_WARNING "Warning" | |
| 468 | #define L_NOJS "Your browser does not currently support javascript. For better results, please use a javascript-aware browser." | |
| 469 | #define L_THANKYOU "Thank you" | |
| 470 | #define L_CANCLSWND "You can now close this window" | |
| 471 | #define L_SERVEND "Server terminated" | |
| 472 | #define L_FATALERR "A fatal error has occured during this mirror" | |
| 473 | ||
| 474 | ||
| 475 | #endif⏎ |
| 0 | /*************************************************************************** | |
| 1 | * C++ Implementation: * | |
| 2 | * Copyright (C) 2012 by Eduard Kalinowski * | |
| 3 | * Germany, Lower Saxony, Hanover * | |
| 4 | * eduard_kalinowski@yahoo.de * | |
| 5 | * * | |
| 6 | * HTTraQt is free software; you can redistribute it and/or * | |
| 7 | * modify it under the terms of the GNU Lesser General Public * | |
| 8 | * License as published by the Free Software Foundation; either * | |
| 9 | * version 3 of the License, or (at your option) any later version. * | |
| 10 | * * | |
| 11 | * HTTraQt is distributed in the hope that it will be useful, but * | |
| 12 | * WITHOUT ANY WARRANTY; without even the implied warranty of * | |
| 13 | * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. * | |
| 14 | * * | |
| 15 | * See the GNU Lesser General Public License for more details. * | |
| 16 | * * | |
| 17 | * You should have received a copy of the GNU Lesser General Public * | |
| 18 | * License along with HTTraQt. If not, see http://www.gnu.org/licenses * | |
| 19 | ***************************************************************************/ | |
| 20 | ||
| 21 | #include <QtGui> | |
| 22 | ||
| 23 | #include "../main/includes/httraq.h" | |
| 24 | #include "./includes/BuildStringDialog.h" | |
| 25 | ||
| 26 | // #include <iostream.h> | |
| 27 | ||
| 28 | extern HTTraQt* mainWidget; | |
| 29 | ||
| 30 | ||
| 31 | BuildStringDialog::BuildStringDialog(QWidget *parent) | |
| 32 | : QDialog(parent) | |
| 33 | { | |
| 34 | setupUi(this); | |
| 35 | ||
| 36 | initTextPoints(); | |
| 37 | ||
| 38 | connect(okButton, SIGNAL(clicked()), this, SLOT(onOk())); | |
| 39 | connect(pushButton, SIGNAL(clicked()), this, SLOT(reject())); | |
| 40 | } | |
| 41 | ||
| 42 | void BuildStringDialog::onOk() | |
| 43 | { | |
| 44 | QString st; | |
| 45 | st = lineEdit->text(); | |
| 46 | mainWidget->SetProfile("BuildString", st); | |
| 47 | ||
| 48 | accept(); | |
| 49 | } | |
| 50 | ||
| 51 | ||
| 52 | void BuildStringDialog::initTextPoints() | |
| 53 | { | |
| 54 | QString st; | |
| 55 | label->setText(translateString(L_Q2)); | |
| 56 | label_2->setText(translateString(L_Q3)); | |
| 57 | ||
| 58 | mainWidget->GetProfile("BuildString", st); | |
| 59 | lineEdit->setText(st); | |
| 60 | } | |
| 61 | ||
| 62 | ||
| 63 | ||
| 64 | ||
| 65 | ||
| 66 |
| 2 | 2 | set(OPT_SOURCES ${CMAKE_CURRENT_SOURCE_DIR}/optionsbrowser.cpp |
| 3 | 3 | ${CMAKE_CURRENT_SOURCE_DIR}/optionsbuild.cpp |
| 4 | 4 | ${CMAKE_CURRENT_SOURCE_DIR}/OptionsDialog.cpp |
| 5 | ${CMAKE_CURRENT_SOURCE_DIR}/BuildStringDialog.cpp | |
| 5 | 6 | ${CMAKE_CURRENT_SOURCE_DIR}/optionsexperts.cpp |
| 6 | 7 | ${CMAKE_CURRENT_SOURCE_DIR}/optionsflow.cpp |
| 7 | 8 | ${CMAKE_CURRENT_SOURCE_DIR}/optionslimits.cpp |
| 16 | 17 | set(OPT_HEADERS ${CMAKE_CURRENT_SOURCE_DIR}/includes/optionsbrowser.h |
| 17 | 18 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/optionsbuild.h |
| 18 | 19 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/OptionsDialog.h |
| 20 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/BuildStringDialog.h | |
| 19 | 21 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/optionsexperts.h |
| 20 | 22 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/optionsflow.h |
| 21 | 23 | ${CMAKE_CURRENT_SOURCE_DIR}/includes/optionslimits.h |
| 30 | 32 | |
| 31 | 33 | set(OPT_FORMS ${CMAKE_CURRENT_SOURCE_DIR}/forms/OptionsBrowser.ui |
| 32 | 34 | ${CMAKE_CURRENT_SOURCE_DIR}/forms/OptionsBuild.ui |
| 35 | ${CMAKE_CURRENT_SOURCE_DIR}/forms/BuildStringDialog.ui | |
| 33 | 36 | ${CMAKE_CURRENT_SOURCE_DIR}/forms/OptionsDialog.ui |
| 34 | 37 | ${CMAKE_CURRENT_SOURCE_DIR}/forms/OptionsExperts.ui |
| 35 | 38 | ${CMAKE_CURRENT_SOURCE_DIR}/forms/OptionsFlow.ui |
| 124 | 124 | if ((*ivec).opttype == TEXT) { |
| 125 | 125 | (*ivec).value = ((QLineEdit*)(*ivec).wg)->text(); |
| 126 | 126 | } |
| 127 | ||
| 128 | 127 | break; |
| 129 | 128 | } |
| 130 | 129 | case LABEL: { |
| 0 | <?xml version="1.0" encoding="UTF-8"?> | |
| 1 | <ui version="4.0"> | |
| 2 | <class>BuildStringDialog</class> | |
| 3 | <widget class="QDialog" name="BuildStringDialog"> | |
| 4 | <property name="geometry"> | |
| 5 | <rect> | |
| 6 | <x>0</x> | |
| 7 | <y>0</y> | |
| 8 | <width>422</width> | |
| 9 | <height>352</height> | |
| 10 | </rect> | |
| 11 | </property> | |
| 12 | <property name="sizePolicy"> | |
| 13 | <sizepolicy hsizetype="Fixed" vsizetype="Fixed"> | |
| 14 | <horstretch>0</horstretch> | |
| 15 | <verstretch>0</verstretch> | |
| 16 | </sizepolicy> | |
| 17 | </property> | |
| 18 | <property name="font"> | |
| 19 | <font> | |
| 20 | <pointsize>8</pointsize> | |
| 21 | </font> | |
| 22 | </property> | |
| 23 | <property name="windowTitle"> | |
| 24 | <string>About HTTraQt Website Copier</string> | |
| 25 | </property> | |
| 26 | <widget class="QLabel" name="label"> | |
| 27 | <property name="geometry"> | |
| 28 | <rect> | |
| 29 | <x>10</x> | |
| 30 | <y>50</y> | |
| 31 | <width>401</width> | |
| 32 | <height>201</height> | |
| 33 | </rect> | |
| 34 | </property> | |
| 35 | <property name="autoFillBackground"> | |
| 36 | <bool>true</bool> | |
| 37 | </property> | |
| 38 | <property name="frameShape"> | |
| 39 | <enum>QFrame::NoFrame</enum> | |
| 40 | </property> | |
| 41 | <property name="frameShadow"> | |
| 42 | <enum>QFrame::Raised</enum> | |
| 43 | </property> | |
| 44 | <property name="text"> | |
| 45 | <string/> | |
| 46 | </property> | |
| 47 | <property name="alignment"> | |
| 48 | <set>Qt::AlignLeading|Qt::AlignLeft|Qt::AlignTop</set> | |
| 49 | </property> | |
| 50 | <property name="wordWrap"> | |
| 51 | <bool>true</bool> | |
| 52 | </property> | |
| 53 | <property name="openExternalLinks"> | |
| 54 | <bool>true</bool> | |
| 55 | </property> | |
| 56 | </widget> | |
| 57 | <widget class="QLineEdit" name="lineEdit"> | |
| 58 | <property name="geometry"> | |
| 59 | <rect> | |
| 60 | <x>10</x> | |
| 61 | <y>10</y> | |
| 62 | <width>401</width> | |
| 63 | <height>26</height> | |
| 64 | </rect> | |
| 65 | </property> | |
| 66 | </widget> | |
| 67 | <widget class="QLabel" name="label_2"> | |
| 68 | <property name="geometry"> | |
| 69 | <rect> | |
| 70 | <x>10</x> | |
| 71 | <y>270</y> | |
| 72 | <width>401</width> | |
| 73 | <height>41</height> | |
| 74 | </rect> | |
| 75 | </property> | |
| 76 | <property name="text"> | |
| 77 | <string>TextLabel</string> | |
| 78 | </property> | |
| 79 | </widget> | |
| 80 | <widget class="QPushButton" name="okButton"> | |
| 81 | <property name="geometry"> | |
| 82 | <rect> | |
| 83 | <x>330</x> | |
| 84 | <y>320</y> | |
| 85 | <width>75</width> | |
| 86 | <height>25</height> | |
| 87 | </rect> | |
| 88 | </property> | |
| 89 | <property name="minimumSize"> | |
| 90 | <size> | |
| 91 | <width>75</width> | |
| 92 | <height>25</height> | |
| 93 | </size> | |
| 94 | </property> | |
| 95 | <property name="maximumSize"> | |
| 96 | <size> | |
| 97 | <width>75</width> | |
| 98 | <height>25</height> | |
| 99 | </size> | |
| 100 | </property> | |
| 101 | <property name="text"> | |
| 102 | <string>O&K</string> | |
| 103 | </property> | |
| 104 | <property name="shortcut"> | |
| 105 | <string>Alt+K</string> | |
| 106 | </property> | |
| 107 | <property name="default"> | |
| 108 | <bool>true</bool> | |
| 109 | </property> | |
| 110 | </widget> | |
| 111 | <widget class="QPushButton" name="pushButton"> | |
| 112 | <property name="geometry"> | |
| 113 | <rect> | |
| 114 | <x>240</x> | |
| 115 | <y>320</y> | |
| 116 | <width>75</width> | |
| 117 | <height>25</height> | |
| 118 | </rect> | |
| 119 | </property> | |
| 120 | <property name="minimumSize"> | |
| 121 | <size> | |
| 122 | <width>75</width> | |
| 123 | <height>25</height> | |
| 124 | </size> | |
| 125 | </property> | |
| 126 | <property name="maximumSize"> | |
| 127 | <size> | |
| 128 | <width>75</width> | |
| 129 | <height>25</height> | |
| 130 | </size> | |
| 131 | </property> | |
| 132 | <property name="text"> | |
| 133 | <string>Cancel</string> | |
| 134 | </property> | |
| 135 | </widget> | |
| 136 | </widget> | |
| 137 | <layoutdefault spacing="6" margin="11"/> | |
| 138 | <resources> | |
| 139 | <include location="../../icons/application.qrc"/> | |
| 140 | </resources> | |
| 141 | <connections/> | |
| 142 | </ui> |
| 0 | /*************************************************************************** | |
| 1 | * C++ Implementation: * | |
| 2 | * Copyright (C) 2012 by Eduard Kalinowski * | |
| 3 | * Germany, Lower Saxony, Hanover * | |
| 4 | * eduard_kalinowski@yahoo.de * | |
| 5 | * * | |
| 6 | * HTTraQt is free software; you can redistribute it and/or * | |
| 7 | * modify it under the terms of the GNU Lesser General Public * | |
| 8 | * License as published by the Free Software Foundation; either * | |
| 9 | * version 3 of the License, or (at your option) any later version. * | |
| 10 | * * | |
| 11 | * HTTraQt is distributed in the hope that it will be useful, but * | |
| 12 | * WITHOUT ANY WARRANTY; without even the implied warranty of * | |
| 13 | * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. * | |
| 14 | * * | |
| 15 | * See the GNU Lesser General Public License for more details. * | |
| 16 | * * | |
| 17 | * You should have received a copy of the GNU Lesser General Public * | |
| 18 | * License along with HTTraQt. If not, see http://www.gnu.org/licenses * | |
| 19 | ***************************************************************************/ | |
| 20 | ||
| 21 | #ifndef BUILDSTRING_H | |
| 22 | #define BUILDSTRING_H | |
| 23 | ||
| 24 | #include "httraq.h" | |
| 25 | #include "ui_BuildStringDialog.h" | |
| 26 | ||
| 27 | class HTTraQt; | |
| 28 | ||
| 29 | ||
| 30 | class BuildStringDialog: public QDialog, public Ui_BuildStringDialog | |
| 31 | { | |
| 32 | Q_OBJECT | |
| 33 | public: | |
| 34 | BuildStringDialog(QWidget *parent = 0); | |
| 35 | void initTextPoints(); | |
| 36 | private slots: | |
| 37 | void onOk(); | |
| 38 | ||
| 39 | }; | |
| 40 | ||
| 41 | #endif |
| 18 | 18 | * License along with HTTraQt. If not, see http://www.gnu.org/licenses * |
| 19 | 19 | ***************************************************************************/ |
| 20 | 20 | |
| 21 | #include "./includes/BuildStringDialog.h" | |
| 21 | 22 | #include "./includes/OptionsDialog.h" |
| 22 | 23 | #include "./includes/optionsbuild.h" |
| 23 | 24 | #include "../main/includes/httraq.h" |
| 31 | 32 | |
| 32 | 33 | QString str = translateString(LISTDEF_3); |
| 33 | 34 | QStringList strl = str.split("\n"); |
| 34 | // strl << "Site-structure (default)" | |
| 35 | // << "Html in web/, images/other files in web/images" | |
| 36 | // << "Html in web/html, images/other in web/images" | |
| 37 | // << "Html in web/, images/other in web/" | |
| 38 | // << "Html in web/, images/other in web/xxx, where xxx is the file extension" | |
| 39 | // << "Html in web/html, images/other in web/xxx" | |
| 40 | // << "Site-structure, without www.domain.xxx/" | |
| 41 | // << "Html in site_name/, images/other files in site_name/images/" | |
| 42 | // << "Html in site_name/html, images/other in site_name/images" | |
| 43 | // << "Html in site_name/, images/other in site_name/" | |
| 44 | // << "Html in site_name/, images/other in site_name/xxx" | |
| 45 | // << "Html in site_name/html, images/other in site_name/xxx" | |
| 46 | // << "All files in web/, with random names (gadget !)" | |
| 47 | // << "All files in site_name/, with random names (gadget !)" | |
| 48 | // << "User-defined structure.."; | |
| 49 | 35 | |
| 50 | 36 | label1045->insertItems(0, strl); |
| 51 | 37 | |
| 78 | 64 | void optionsBuild::callBuildStringDialog() |
| 79 | 65 | { |
| 80 | 66 | // einbauen aufruf vom dialog |
| 67 | BuildStringDialog* bdial = new BuildStringDialog(); | |
| 68 | bdial->exec(); | |
| 81 | 69 | } |
| 82 | 70 | |
| 83 | 71 | /*$SPECIALIZATION$*/ |
| 34 | 34 | |
| 35 | 35 | ident = {ident01, ident02, ident03, ident04, ident05, ident06, ident07, ident08}; |
| 36 | 36 | mime = {mime01, mime02, mime03, mime04, mime05, mime06, mime07, mime08}; |
| 37 | ||
| 38 | for (int i=0; i < ident.size(); i++){ | |
| 37 | ||
| 38 | for (int i=0; i < ident.size(); i++) { | |
| 39 | 39 | ident[i]->insertItems(0, htmlMime); |
| 40 | connect(ident[i], SIGNAL(activated(int)), this, SLOT(onMIME())); | |
| 40 | // connect(ident[i], SIGNAL(activated(int)), this, SLOT(onMIME())); | |
| 41 | 41 | } |
| 42 | 42 | |
| 43 | 43 | QString st; |
| 44 | 44 | QStringList listeMime; |
| 45 | 45 | listeMime << "" << "php" << "cgi" << "asp" << "php2" << "php3" << "php4" << "php5" << "jsp" << "pl" << "cfm" << "php,php3,asp" << "asp,exe" << "pl,cgi" << "php,php2,php3,php4,php5"; |
| 46 | 46 | |
| 47 | for (int i=0; i < mime.size(); i++){ | |
| 47 | for (int i=0; i < mime.size(); i++) { | |
| 48 | 48 | mime[i]->insertItems(0, listeMime); |
| 49 | connect(mime[i], SIGNAL(activated(int)), this, SLOT(onMIME())); | |
| 49 | // connect(mime[i], SIGNAL(activated(int)), this, SLOT(onMIME())); | |
| 50 | 50 | } |
| 51 | 51 | |
| 52 | 52 | initTextPoints(); |
| 53 | ||
| 53 | ||
| 54 | 54 | // emit onMIME(); |
| 55 | 55 | } |
| 56 | 56 | |
| 66 | 66 | { label1294, _FILE_TYPES, "", LABEL, NOTYPE, 0}, |
| 67 | 67 | { label1295, _MIME_ID, "", LABEL, NOTYPE, 0} |
| 68 | 68 | }; |
| 69 | ||
| 70 | for (int i=0; i<8; i++){ | |
| 71 | ((OptionsDialog*)(parentDialog))->_tabTextInfos += { ident[i], "", QString().sprintf("MIMEDefsExt%d", (i+1)), COMBOBOX, TEXT, ""}; | |
| 72 | ((OptionsDialog*)(parentDialog))->_tabTextInfos += { mime[i], "", QString().sprintf("MIMEDefsMime%d", (i+1)), COMBOBOX, TEXT, ""}; | |
| 69 | ||
| 70 | for (int i=0; i<8; i++) { | |
| 71 | ((OptionsDialog*)(parentDialog))->_tabTextInfos += { ident[i], "", QString().sprintf("MIMEDefsExt%d", (i+1)), COMBOBOX, TEXT, ""}; | |
| 72 | ((OptionsDialog*)(parentDialog))->_tabTextInfos += { mime[i], "", QString().sprintf("MIMEDefsMime%d", (i+1)), COMBOBOX, TEXT, ""}; | |
| 73 | 73 | } |
| 74 | 74 | } |
| 75 | 75 | |
| 76 | 76 | void optionsMime::onMIME() |
| 77 | 77 | { |
| 78 | for (int i=0; i < 8; i++){ | |
| 79 | if (mime[i]->currentText().length() > 0 && ident[i]->currentText().length() > 0){ | |
| 78 | for (int i=0; i < 8; i++) { | |
| 79 | if (mime[i]->currentText().length() > 0 && ident[i]->currentText().length() > 0) { | |
| 80 | 80 | ident[i]->setEnabled(true); |
| 81 | 81 | mime[i]->setEnabled(true); |
| 82 | ||
| 83 | if ( i<7 ){ | |
| 82 | ||
| 83 | if (i<7) { | |
| 84 | 84 | ident[i+1]->setEnabled(true); |
| 85 | 85 | mime[i+1]->setEnabled(true); |
| 86 | 86 | } |
| 87 | 87 | continue; |
| 88 | 88 | } |
| 89 | ||
| 90 | if (mime[i]->currentText().length() == 0 && ident[i]->currentText().length() == 0){ | |
| 89 | ||
| 90 | if (mime[i]->currentText().length() == 0 && ident[i]->currentText().length() == 0) { | |
| 91 | 91 | ident[i]->setEnabled(false); |
| 92 | 92 | mime[i]->setEnabled(false); |
| 93 | 93 | } |
| 94 | 94 | } |
| 95 | 95 | } |
| 96 | 96 | |
| 97 | ||
| 97 | ||
| 98 | 98 | |
| 99 | 99 | // void optionsMime::update() |
| 100 | 100 | // { |
| 59 | 59 | { textLabel1, _CRITERION, "", LABEL, NOTYPE, 0}, |
| 60 | 60 | { textLabel2, _STRING, "", LABEL, NOTYPE, 0}, |
| 61 | 61 | { label1198, _TIP_GIF, "", LABEL, NOTYPE, 0}, |
| 62 | { scanList, "", _CARD_FILTER, LABEL, TEXT, ""}, | |
| 62 | { scanList, "", _CARD_FILTER, LABEL, TEXT, ""}, | |
| 63 | 63 | { groupAddScan, _ADD_SCAN_RULE, "", GROUPBOX, NOTYPE, 0}, |
| 64 | 64 | { label1094, _INCL_LINKS, "", BUTTON, NOTYPE, 0}, |
| 65 | 65 | { label1093, _EXCL_LINKS, "", BUTTON, NOTYPE, 0}, |